| 34487-61-1 |
Phenol red sodium salt Water soluble |
1g |
----Eur |
chemotra |
|
| P-06753 |
PHENOL RED SODIUM SALT (Water Soluble) CAS: 34487-61-1 |
25 gm |
111-Eur |
Oxford Lab |
|
| M79800205 |
Phenol Red, sodium salt water soluble CAS: [34487-61-1] |
25 g |
124-Eur |
Molekula |
|
| P-06753 |
PHENOL RED SODIUM SALT (Water Soluble) CAS: 34487-61-1 |
100 gm |
133-Eur |
Oxford Lab |
|
| M79800205 |
Phenol Red, sodium salt water soluble CAS Number [34487_61_1] |
25 G |
128-Eur |
Molekula |
|
| 103-PA19S |
VEGFR-2_Flk-1 (Peptide), soluble Anti-Mouse Host: Rabbit soluble vascular endothelial growth factor receptor-2 ; soluble Kdr; soluble Ly73; soluble Flk-1; sVEGFR2; sVEGF receptor 2; soluble kinase in |
100 |
180-Eur |
Reliatech |
|
| 102-PA21 |
VEGFR-1_Flt-1 (Peptide), soluble Anti-Human Host: Rabbit soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble FLT; soluble VEGF receptor 1 |
200 |
270-Eur |
Reliatech |
|
| 102-PA21S |
VEGFR-1_Flt-1 (Peptide), soluble Anti-Human Host: Rabbit soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble FLT; soluble VEGF receptor 1 |
100 |
180-Eur |
Reliatech |
|
| EIAAB40114 |
Aryl sulfotransferase 1,HAST1_HAST2,Homo sapiens,Human,OK_SW-cl.88,Phenol sulfotransferase 1,Phenol-sulfating phenol sulfotransferase 1,P-PST 1,ST1A1,ST1A3,STP,STP1,Sulfotransferase 1A1,SULT1A1,Thermo |
|
1109-Eur |
EIAab |
|
| 102-PA19 |
VEGFR-2_KDR (Peptide), soluble Anti-Human Host: Rabbit soluble vascular endothelial growth factor receptor-2 ; soluble KDR; soluble FLK1; soluble CD309; VEGF receptor 2; sKDR |
200 |
270-Eur |
Reliatech |
|
| 102-PA19S |
VEGFR-2_KDR (Peptide), soluble Anti-Human Host: Rabbit soluble vascular endothelial growth factor receptor-2 ; soluble KDR; soluble FLK1; soluble CD309; VEGF receptor 2; sKDR |
100 |
180-Eur |
Reliatech |
|
| EIAAB40116 |
Aryl sulfotransferase 2,Homo sapiens,Human,Phenol sulfotransferase 2,Phenol-sulfating phenol sulfotransferase 2,P-PST 2,ST1A2,STP2,Sulfotransferase 1A2,SULT1A2 |
|
1109-Eur |
EIAab |
|
| EIAAB40111 |
Aryl sulfotransferase,Bos taurus,Bovine,Phenol sulfotransferase,Phenol-sulfating phenol sulfotransferase,P-PST,ST1A1,STP,Sulfotransferase 1A1,SULT1A1 |
|
1333-Eur |
EIAab |
|
| S01-012 |
VEGFR-1_Flt-1 (D5), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
20 |
180-Eur |
Reliatech |
|
| S01-011 |
VEGFR-1_Flt-1 (D5), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
5 |
108-Eur |
Reliatech |
|
| S01-016 |
VEGFR-1_Flt-1 (D3), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
20 |
199-Eur |
Reliatech |
|
| S01-014 |
VEGFR-1_Flt-1 (D4), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
20 |
199-Eur |
Reliatech |
|
| S01-013 |
VEGFR-1_Flt-1 (D4), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
5 |
121-Eur |
Reliatech |
|
| S01-015 |
VEGFR-1_Flt-1 (D3), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
5 |
121-Eur |
Reliatech |
|
| SFC-M06 |
VEGFR-1_Flt-1(D7)-Fc Chimera, soluble Mouse Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
50 |
199-Eur |
Reliatech |
|
| SFC-006 |
VEGFR-1_Flt-1(D7)-Fc Chimera, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
50 |
199-Eur |
Reliatech |
|
| SFC-005 |
VEGFR-1_Flt-1(D7)-Fc Chimera, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
10 |
88-Eur |
Reliatech |
|
| S01-010 |
VEGFR-1_Flt-1 (native), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
20 |
180-Eur |
Reliatech |
|
| S01-009 |
VEGFR-1_Flt-1 (native), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
5 |
108-Eur |
Reliatech |
|
| SFC-M05 |
VEGFR-1_Flt-1(D7)-Fc Chimera, soluble Mouse Host: Insect cells soluble vascular endothelial growth factor receptor-1; soluble FLT1; soluble VEGFR-1 |
10 |
88-Eur |
Reliatech |
|
| S01-002 |
VEGFR-2_KDR (D7), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-2 ; soluble CD309; soluble VEGF receptor-2; sKDR |
50 |
244-Eur |
Reliatech |
|
| S01-001 |
VEGFR-2_KDR (D7), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-2 ; soluble CD309; soluble VEGF receptor-2; sKDR |
5 |
69-Eur |
Reliatech |
|
| S01-003 |
VEGFR-2_KDR (native), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-2 ; soluble CD309; soluble VEGF receptor-2; sKDR |
5 |
154-Eur |
Reliatech |
|
| SFC-007 |
VEGFR-2_KDR-Fc Chimera, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-2 ; soluble CD309; soluble VEGF receptor-2; sKDR |
10 |
36-Eur |
Reliatech |
|
| SFC-008 |
VEGFR-2_KDR-Fc Chimera, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-2 ; soluble CD309; soluble VEGF receptor-2; sKDR |
50 |
199-Eur |
Reliatech |
|
| S01-004 |
VEGFR-2_KDR (native), soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-2 ; soluble CD309; soluble VEGF receptor-2; sKDR |
20 |
348-Eur |
Reliatech |
|
| F-04199 |
PHENOL REAGENT (Folin & Ciocateu's Phenol Regent) CAS: |
500 ml |
126-Eur |
Oxford Lab |
|
| F-04199 |
PHENOL REAGENT (Folin & Ciocateu's Phenol Regent) CAS: |
250 ml |
113-Eur |
Oxford Lab |
|
| F-04199 |
PHENOL REAGENT (Folin & Ciocateu's Phenol Regent) |
125 ml |
107-Eur |
Oxford Lab |
|
| 620-45-1 |
2,6_Dichloro(phenol)indophenol sodium Dichloro(phenol)indoph |
1g |
----Eur |
chemotra |
|
| PIP031 |
NATIVE TREPONEMA PALLIDUM SOLUBLE ANTIGEN, Product Type Purified Protein, Specificity TREPONEMA PALLIDUM SOLUBLE ANTIGEN, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applicat |
1 ml |
3067-Eur |
AbD Serotec |
cat |
| 87835-14-1 |
Phenol,2-(2-aminopropyl)- Phenol,2-(2-aminoprop |
1g |
----Eur |
chemotra |
|
| EIAAB40113 |
Aryl sulfotransferase,Canis familiaris,Canis lupus familiaris,Dog,Phenol sulfotransferase,Phenol-sulfating phenol sulfotransferase,P-PST,ST1A1,Sulfotransferase 1A1,SULT1A1 |
|
1333-Eur |
EIAab |
|
| orb82245 |
Soluble Transferrin Receptor protein Transferrin Receptor, Soluble is a purified protein_bioactive peptide. For research use only. |
100 |
1030-Eur |
Biorb |
recombinant |
| RAF9267 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.2D2, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against soluble |
HRP Conjugate |
----Eur |
RANDOX |
|
| RAF9261 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.2A3, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against soluble |
100 |
846-Eur |
RANDOX |
|
| RAF9263 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.2A3, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against soluble |
HRP Conjugate |
----Eur |
RANDOX |
|
| RAF9264 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.2D2, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against soluble |
10 |
218-Eur |
RANDOX |
|
| RAF9265 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.2D2, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against soluble |
100 |
846-Eur |
RANDOX |
|
| RAF9260 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.2A3, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against soluble |
10 |
218-Eur |
RANDOX |
|
| RAF9266 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.2D2, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against soluble |
1000 |
----Eur |
RANDOX |
|
| RAF9262 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.2A3, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against soluble |
1000 |
----Eur |
RANDOX |
|
| F-04199 |
FOLIN & CIOCATEU'S 'PHENOL REAGENT (Phenol Reagent) CAS: |
500 ml |
126-Eur |
Oxford Lab |
|
| F-04199 |
FOLIN & CIOCATEU'S 'PHENOL REAGENT (Phenol Reagent) CAS: |
250 ml |
115-Eur |
Oxford Lab |
|
| F-04199 |
FOLIN & CIOCATEU'S 'PHENOL REAGENT (Phenol Reagent) |
125 ml |
107-Eur |
Oxford Lab |
|
| 85380-74-1 |
Phenol-13C6, pentachloro-(9ci) Phenol-13C6, pentachl |
1g |
----Eur |
chemotra |
|
| 70955-71-4 |
Phenol, 2-methoxy-, reaction products wi Phenol, 2-methoxy-, re |
1g |
----Eur |
chemotra |
|
| 13127-88-3 |
Phenol-d6 Phenol-d6 |
1g |
----Eur |
chemotra |
|
| 1003-66-3 |
Phenol,OD Phenol,OD |
1g |
----Eur |
chemotra |
|
| 4165-62-2 |
Phenol-2,3,4,5,6-d5 Phenol-2,3,4,5,6-d5 |
1g |
----Eur |
chemotra |
|
| 203645-65-2 |
Phenol-2,4,6-d3,OD Phenol-2,4,6-d3,OD |
1g |
----Eur |
chemotra |
|
| EIAAB40117 |
Aryl sulfotransferase 1A3_1A4,Catecholamine-sulfating phenol sulfotransferase,HAST3,Homo sapiens,Human,Monoamine-sulfating phenol sulfotransferase,M-PST,Placental estrogen sulfotransferase,ST1A3_ST1A4 |
|
1109-Eur |
EIAab |
|
| 372-44-1 |
phenol--boron trifluoride phenol--boron trifluorid |
1g |
----Eur |
chemotra |
|
| B-01821 |
2-BROMO PHENOL (Ortho-Bromo Phenol) CAS: 95-56-7 |
5 gm |
147-Eur |
Oxford Lab |
|
| B-01822 |
3-BROMO PHENOL (Meta-Bromo Phenol) CAS: 591-20-8 |
5 gm |
178-Eur |
Oxford Lab |
|
| B-01821 |
2-BROMO PHENOL (Ortho-Bromo Phenol) CAS: 95-56-7 |
25 gm |
277-Eur |
Oxford Lab |
|
| 51-19-4 |
2_Amino Phenol Hydrochloride 2_Amino Phenol Hydroc |
1g |
----Eur |
chemotra |
|
| orb62922 |
O-Phenyl phenol O-Phenyl phenol For research use only. |
100 g |
154-Eur |
Biorb |
|
| orb62894 |
4-(Trifluoromethoxy)phenol 4-(Trifluoromethoxy)phenol For research use only. |
1 g |
154-Eur |
Biorb |
|
| orb62898 |
4-nonyl phenol 4-nonyl phenol For research use only. |
100 g |
154-Eur |
Biorb |
|
| 101012-81-1 |
3_(diethylamino)phenol hydrochloride 3_(diethylamino)phenol |
1g |
----Eur |
chemotra |
|
| orb62893 |
3-(Trifluoromethoxy)phenol 3-(Trifluoromethoxy)phenol For research use only. |
1 g |
277-Eur |
Biorb |
|
| B-01822 |
3-BROMO PHENOL (Meta-Bromo Phenol) CAS: 591-20-8 |
25 gm |
313-Eur |
Oxford Lab |
|
| B-01823 |
4-BROMO PHENOL (Para-Bromo Phenol) CAS: 106-41-2 |
100 gm |
142-Eur |
Oxford Lab |
|
| B-01823 |
4-BROMO PHENOL (Para-Bromo Phenol) CAS: 106-41-2 |
25 gm |
113-Eur |
Oxford Lab |
|
| C-02663/100 |
4-CHLORO PHENOL 98% (For Synthesis) (P-Chloro Phenol ) CAS: 106-48-9 |
500 ml |
121-Eur |
Oxford Lab |
|
| 93920-37-7 |
m_(o_toluidino)phenol sulphate m_(o_toluidino)phenol s |
1g |
----Eur |
chemotra |
|
| 68213-80-9 |
phenol, compound with 1-aminopropane- phenol, compound with |
1g |
----Eur |
chemotra |
|
| 1936-57-8 |
p-(methylamino)phenol sulphate p-(methylamino)phenol |
1g |
----Eur |
chemotra |
|
| 100-95-2 |
Phenol detached crystals A.R. Phenol detached crysta |
1g |
----Eur |
chemotra |
|
| 96840-56-1 |
phenol, 2-ethoxy-4-[(1 -methylethoxy)m phenol, 2-ethoxy-4-[(1 - |
1g |
----Eur |
chemotra |
|
| B-01823 |
4-BROMO PHENOL (Para-Bromo Phenol) CAS: 106-41-2 |
500 gm |
269-Eur |
Oxford Lab |
|
| 16845-61-7 |
phenol, compound with N,N-dipentylpent phenol, compound with |
1g |
----Eur |
chemotra |
|
| 65886-46-6 |
phenol, compound with trimethylamine ( phenol, compound with |
1g |
----Eur |
chemotra |
|
| 28064-14-4 |
Phenol, Polymer with Formaldehyde, Gly Phenol, Polymer with F |
1g |
----Eur |
chemotra |
|
| 1622-79-3 |
1(4_Fluoro Phenol)_4_(4_Methyl_1_Piperid 1(4_Fluoro Phenol)_4_(4 |
1g |
----Eur |
chemotra |
|
| 64601-04-3 |
phenol, compound with 2-aminoethanol ( phenol, compound with |
1g |
----Eur |
chemotra |
|
| PRL01-100ML |
Buffers and Supplements,Phenol Red Solution,0.5% ( 5g_L)solution in purified water. Sterile filtered |
100ml |
60-Eur |
Caisson Laboratory |
|
| ECD-2 |
ECD_2 Soluble receptorsOvine growth hormone soluble receptor (oGH binding protein) |
1 mg |
1601-Eur |
PLR |
recombinant |
| ECD-16 |
ECD_16 Soluble receptors Rainbow trout prolactin soluble receptor |
1 mg |
2123-Eur |
PLR |
recombinant |
| ECD-1 |
ECD_1 Soluble receptors Human growth hormone soluble receptor (hGH binding protein) |
1 mg |
1601-Eur |
PLR |
recombinant |
| ECD-3 |
ECD_3 Soluble receptors Rabbit growth hormone soluble receptor (rbGH binding protein) |
1 mg |
1601-Eur |
PLR |
recombinant |
| ECD-14 |
ECD_14 Soluble receptors Rabbit prolactin soluble receptor |
1 mg |
2123-Eur |
PLR |
recombinant |
| ECD-13 |
ECD_13 Soluble receptors Ovine prolactin soluble receptor |
1 mg |
2123-Eur |
PLR |
recombinant |
| ECD-12 |
ECD_12 Soluble receptors Human prolactin soluble receptor |
1 mg |
2123-Eur |
PLR |
recombinant |
| ECD-11 |
ECD_11 Soluble receptors Bovine prolactin soluble receptor |
1 mg |
2123-Eur |
PLR |
recombinant |
| orb62928 |
2-amino-3-nitro phenol 2-amino-3-nitro phenol For research use only. |
5 g |
195-Eur |
Biorb |
|
| orb62944 |
4-Bromo-2-(trifluoromethyl)phenol 4-Bromo-2-(trifluoromethyl)phenol For research use only. |
1 g |
195-Eur |
Biorb |
|
| 30944-92-4 |
Phenol novolac cyanate ester Phenol novolac cyanate |
1g |
----Eur |
chemotra |
|
| 18-13001 |
Antigens Soluble CD4 (T-Cell) Purified, Recombinant |
5 |
270-Eur |
ARP |
|
| 18-13003 |
Antigens Soluble CD4 (T-Cell) Purified, Recombinant |
20 |
325-Eur |
ARP |
|
| ECD-15 |
ECD_15 Soluble receptors Rat prolactin soluble receptor |
1 mg |
2123-Eur |
PLR |
recombinant |
| 3307-00-4 |
p-(1-ethylhexyl)phenol p-(1-ethylhexyl)phenol |
1g |
----Eur |
chemotra |
|
| 2039-66-9 |
2_(2_aminoethyl)phenol 2_(2_aminoethyl)phenol |
1g |
----Eur |
chemotra |
|
| 4946-14-9 |
4_(Isopropylthio)phenol 4_(Isopropylthio)phenol |
1g |
----Eur |
chemotra |
|
| 21345-28-8 |
4_(4_Ethylphenyl)phenol 4_(4_Ethylphenyl)phenol |
1g |
----Eur |
chemotra |
|
| 64045-87-0 |
phenol-3 5-d2 97 atom% d phenol-3 5-d2 97 atom |
1g |
----Eur |
chemotra |
|
| 78210-35-2 |
o-(2-naphthyl)phenol o-(2-naphthyl)phenol |
1g |
----Eur |
chemotra |
|
| 59817-32-2 |
3_(1_Piperazino)Phenol 3_(1_Piperazino)Phenol |
1g |
----Eur |
chemotra |
|
| 61348-47-8 |
2_(5_Isoxazolyl)phenol 2_(5_Isoxazolyl)phenol |
1g |
----Eur |
chemotra |
|
| 29799-07-3 |
4_(1_Adamantyl)phenol 4_(1_adamantyl)phenol |
1g |
----Eur |
chemotra |
|
| 10041-02-8 |
4_(Imidazol_1_yl)phenol Imidazol_1_yl phenol |
1g |
----Eur |
chemotra |
|
| 34487-61-1 |
Phenol red sodium Phenol red sodium |
1g |
----Eur |
chemotra |
|
| 1745-81-9 |
2_Allyl Phenol 2_Allyl Phenol |
1g |
----Eur |
chemotra |
|
| 17404-66-9 |
p-(1-methyloctyl)phenol p-(1-methyloctyl)phenol |
1g |
----Eur |
chemotra |
|
| 1988-89-2 |
p-(1-phenylethyl)phenol p-(1-phenylethyl)phenol |
1g |
----Eur |
chemotra |
|
| 1008-97-5 |
p-(1-pyrrolidinyl)phenol p-(1-pyrrolidinyl)phenol |
1g |
----Eur |
chemotra |
|
| 13037-86-0 |
4_(Heptyloxy)phenol 4_(Heptyloxy)phenol |
1g |
----Eur |
chemotra |
|
| 27079-92-1 |
p-(Bromomethyl)phenol p-(Bromomethyl)phenol |
1g |
----Eur |
chemotra |
|
| 1563-38-8 |
Carbofuran Phenol Carbofuran Phenol |
1g |
----Eur |
chemotra |
|
| 81015-49-8 |
4_(2_Thiazolyl)phenol 95% 4_(2_Thiazolyl)phenol 9 |
1g |
----Eur |
chemotra |
|
| 2800-80-8 |
Bromo phenol red Bromo phenol red |
1g |
----Eur |
chemotra |
|
| 65996-83-0 |
Crude phenol Crude phenol |
1g |
----Eur |
chemotra |
|
| 4237-44-9 |
o-(1-Phenylethyl)phenol o-(1-phenylethyl)phenol |
1g |
----Eur |
chemotra |
|
| 50312-64-6 |
(aminomethyl)phenol (aminomethyl)phenol |
1g |
----Eur |
chemotra |
|
| 1073-29-6 |
2_(Methylthio)phenol 2_(Methylthio)phenol |
1g |
----Eur |
chemotra |
|
| 29549-60-8 |
2_(ethylthio)phenol 2_(ethylthio)phenol |
1g |
----Eur |
chemotra |
|
| A-00668 |
2-AMINO PHENOL 99% (o-Amino Phenol) CAS: 95-55-6 |
100 gm |
112-Eur |
Oxford Lab |
|
| A-00668 |
2-AMINO PHENOL 99% (o-Amino Phenol) CAS: 95-55-6 |
500 gm |
147-Eur |
Oxford Lab |
|
| A-00670 |
3-AMINO PHENOL 99% (m-Amino Phenol) CAS: 591-27-5 |
100 gm |
110-Eur |
Oxford Lab |
|
| 27985-70-2 |
(1_methylheptyl)phenol (1_methylheptyl)phenol |
1g |
----Eur |
chemotra |
|
| A-00670 |
3-AMINO PHENOL 99% (m-Amino Phenol) CAS: 591-27-5 |
500 gm |
147-Eur |
Oxford Lab |
|
| A-00672 |
4-AMINO PHENOL 98% (p-Amino Phenol) CAS: 123-30-8 |
100 gm |
107-Eur |
Oxford Lab |
|
| A-00673 |
4-AMINO PHENOL 98% (p-Amino Phenol) CAS: 123-30-9 |
500 gm |
120-Eur |
Oxford Lab |
|
| 26857-99-8 |
(1_phenylethyl)phenol (1_phenylethyl)phenol |
1g |
----Eur |
chemotra |
|
| 14140-15-9 |
4_(2_bromoethyl)phenol 4_(2_bromoethyl)phenol |
1g |
----Eur |
chemotra |
|
| 5770-44-5 |
4_(n_Octyloxy)phenol 4_(n_Octyloxy)phenol |
1g |
----Eur |
chemotra |
|
| 17404-44-3 |
o-(1-ethylhexyl)phenol o-(1-ethylhexyl)phenol |
1g |
----Eur |
chemotra |
|
| 6272-38-4 |
2_(Benzyloxy)phenol 2_(Benzyloxy)phenol |
1g |
----Eur |
chemotra |
|
| 58402-38-3 |
2_(Bromomethyl)phenol 2_(Bromomethyl)phenol |
1g |
----Eur |
chemotra |
|
| 61537-49-3 |
m_(p_toluidino)phenol m_(p_toluidino)phenol |
1g |
----Eur |
chemotra |
|
| 85049-96-3 |
m_(m_toluidino)phenol m_(m_toluidino)phenol |
1g |
----Eur |
chemotra |
|
| 25912-16-7 |
m_(1_pyrrolidinyl)phenol m_(1_pyrrolidinyl)phenol |
1g |
----Eur |
chemotra |
|
| 35974-37-9 |
o-(2-pyridyloxy)phenol o-(2-pyridyloxy)phenol |
1g |
----Eur |
chemotra |
|
| 4500-58-7 |
2_(Ethylthio)phenol 2_(Ethylthio)phenol |
1g |
----Eur |
chemotra |
|
| 73604-31-6 |
3_(Aminomethyl)phenol 3_(Aminomethyl)phenol |
1g |
----Eur |
chemotra |
|
| GTX102517 |
Guanylate cyclase soluble GUCY1A3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104443 |
Guanylate cyclase soluble GUCY1B3 antibody Ab Aff - Purified |
0.1 ml |
228-Eur |
ACR |
|
| 8Tr56 |
CD71 _ TFRC (soluble form) antigen Purified |
0.1 mg |
840-Eur |
ACR |
|
| AP20764PU-N |
Guanylate cyclase soluble GUCY1A3 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| AP10315PU-N |
Guanylate cyclase soluble GUCY1B3 (189-207) Rabbit IgG antibody Ab Aff - Purified |
0.1 mg |
345-Eur |
ACR |
|
| GTX114458 |
Guanylate cyclase soluble GUCY1A3 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| H01252M |
Guanylate Cyclase Beta 1 (Soluble)Mouse Purified IgG2b |
0.2mg |
508-Eur |
Meridian Life Science |
|
| H86502M |
Soluble Guanylate Cyclase (hsGC)Mouse Purified IgG2a |
1mg |
649-Eur |
Meridian Life Science |
|
| AP15591PU-M |
Guanylate cyclase soluble GUCY1B3 (189-207) Rabbit antibody Ab Purified |
0.5 ml |
291-Eur |
ACR |
|
| AP15591PU-N |
Guanylate cyclase soluble GUCY1B3 (189-207) Rabbit antibody Ab Purified |
1 ml |
390-Eur |
ACR |
|
| AP15591PU-S |
Guanylate cyclase soluble GUCY1B3 (189-207) Rabbit antibody Ab Purified |
0.1 ml |
183-Eur |
ACR |
|
| AP22710PU-N |
Guanylate cyclase soluble GUCY1B3 (189-207) Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| LF-PA41454 |
Guanylate cyclase soluble GUCY1B3 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| PIP031 |
NATIVE TREPONEMA PALLIDUM SOLUBLE ANTIGEN-PURIFIED PROTEIN |
1 ml |
3665-Eur |
AbD Serotec |
|
| AP06153PU-N |
Guanylate cyclase soluble GUCY1B3 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| AP08168PU-N |
Guanylate cyclase soluble GUCY1B3 (189-207) Rabbit IgG antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| TFR16-R-10 |
Purified Human soluble Transferrin receptor (TfR1) protein |
10 ug |
523-Eur |
Alpha Diagnostics |
recombinant |
| TFR16-R-50 |
Purified Human soluble Transferrin receptor (TfR1) protein |
50 ug |
1494-Eur |
Alpha Diagnostics |
recombinant |
| R20-020 |
RANKL, soluble, Host: E. coli, Species: Rat, Synonyms: soluble Receptor Activator of NFkB Ligand, TNFSF11, TRANCE, OPGL, ODF (Osteoclast differentiation factor) |
10 ug |
232-Eur |
Reliatech |
|
| AP10312PU-N |
Guanylate cyclase soluble GUCY1A3 (C-term) Rabbit IgG antibody Ab Aff - Purified |
0.1 mg |
345-Eur |
ACR |
|
| AM05610PU-N |
Guanylate cyclase soluble GUCY1A3 Mouse IgG1 antibody Ab Purified |
0.2 mg |
327-Eur |
ACR |
|
| AM05611PU-N |
Guanylate cyclase soluble GUCY1B3 Mouse IgG2b antibody Ab Purified |
0.2 mg |
327-Eur |
ACR |
|
| H86922M |
Lectin-like Oxidized LDL receptor-1 (sLOX-1) Soluble formMouse Purified IgG1 |
1mg |
713-Eur |
Meridian Life Science |
|
| H86917M |
Lectin-like Oxidized LDL receptor-1 (sLOX-1) Soluble formMouse Purified IgG1 |
1mg |
713-Eur |
Meridian Life Science |
|
| H86907M |
Lectin-like Oxidized LDL receptor-1 (sLOX-1) Soluble formMouse Purified IgG2a |
1mg |
713-Eur |
Meridian Life Science |
|
| AM26359PU-N |
CD295 _ Leptin Receptor (soluble) Mouse IgG1 antibody Ab Purified |
0.1 mg |
345-Eur |
ACR |
|
| AP13761PU-N |
Guanylate cyclase soluble GUCY1A3 (N-term) Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| TFR12-C |
Purified Human soluble Transferrin receptor (TfR1) protein WB +ve control |
100 ul |
335-Eur |
Alpha Diagnostics |
recombinant |
| 4Tr26-2B6 |
CD71 _ TFRC (soluble form) Mouse IgG2a antibody Ab Purified |
1 mg |
327-Eur |
ACR |
|
| 4Tr26-7-1 |
CD71 _ TFRC (soluble form) Mouse IgG2b antibody Ab Purified |
1 mg |
332-Eur |
ACR |
|
| AP15185PU-N |
Guanylate cyclase soluble GUCY1B3 (C-term) Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| S01-017 |
VEGFR-3_FLT-4, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-3; FLT4; PCL; LMPH1A; fms-related tyrosine kinase 4 |
10 |
147-Eur |
Reliatech |
|
| S01-018 |
VEGFR-3_FLT-4, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-3; FLT4; PCL; LMPH1A; fms-related tyrosine kinase 4 |
50 |
277-Eur |
Reliatech |
|
| 4Tr26-5B11 |
CD71 _ TFRC (soluble form) Mouse IgG2b antibody Ab Purified |
1 mg |
332-Eur |
ACR |
|
| 4Tr26-23D10 |
CD71 _ TFRC (soluble form) Mouse IgG2b antibody Ab Purified |
1 mg |
332-Eur |
ACR |
|
| 4Tr26-13E4 |
CD71 _ TFRC (soluble form) Mouse IgG2a antibody Ab Purified |
1 mg |
332-Eur |
ACR |
|
| 4Tr26-11F5 |
CD71 _ TFRC (soluble form) Mouse IgG2b antibody Ab Purified |
1 mg |
332-Eur |
ACR |
|
| S01-017S |
VEGFR-3_FLT-4, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-3; FLT4; PCL; LMPH1A; fms-related tyrosine kinase 4 |
5 |
108-Eur |
Reliatech |
|
| SFC-009 |
VEGFR-3_FLT-4_Fc Chimera, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-3; FLT4; PCL; LMPH1A; fms-related tyrosine kinase 4 |
10 |
108-Eur |
Reliatech |
|
| SFC-010 |
VEGFR-3_FLT-4_Fc Chimera, soluble Human Host: Insect cells soluble vascular endothelial growth factor receptor-3; FLT4; PCL; LMPH1A; fms-related tyrosine kinase 4 |
50 |
251-Eur |
Reliatech |
|
| 6380-21-8 |
o-(prop-1-enyl)phenol o-(prop-1-enyl)phenol |
1g |
----Eur |
chemotra |
|
| 4812-20-8 |
2_Iso Propoxy Phenol 2_Iso Propoxy Phenol |
1g |
----Eur |
chemotra |
|
| 34487-61-1 |
Phenol red sodium salt Phenol red sodium salt |
1g |
----Eur |
chemotra |
|
| 462-05-5 |
Boron trifluoride phenol complex (1 2) Boron trifluoride phenol |
1g |
----Eur |
chemotra |
|
| 27684-84-0 |
Phenol,5-bromo-2-nitro- Phenol,5-bromo-2-nitro |
1g |
----Eur |
chemotra |
|
| R20-020 |
RANKL, soluble Rat Host: E. coli soluble Receptor Activator of NFkB Ligand, TNFSF11, TRANCE (TNF-related activation-induced cytokine), OPGL, ODF (Osteoclast differentiation factor), Tumor necrosis fac |
10 |
232-Eur |
Reliatech |
|
| 4GC1-GC25 |
Guanylate cyclase soluble GUCY1B3 (beta subunit) Mouse IgG2a antibody Ab Purified |
1 mg |
440-Eur |
ACR |
|
| 101-M165 |
IL-2 receptor, soluble Anti-Human Host: Mouse IL-2 receptor, soluble |
500 |
310-Eur |
Reliatech |
|
| S01-M04 |
VEGFR-2_Flk-1 (native), soluble Mouse Host: Insect cells soluble vascular endothelial growth factor receptor-2; Kdr; Flk1; Ly73; Flk-1; VEGF receptor 2; VEGFR-2; sVEGFR-2 |
20 |
348-Eur |
Reliatech |
|
| S01-M03 |
VEGFR-2_Flk-1 (native), soluble Mouse Host: Insect cells soluble vascular endothelial growth factor receptor-2; Kdr; Flk1; Ly73; Flk-1; VEGF receptor 2; VEGFR-2; sVEGFR-2 |
5 |
154-Eur |
Reliatech |
|
| 103-PA18 |
VEGFR-2_Flk-1, soluble Anti-Mouse Host: Rabbit soluble vascular endothelial growth factor receptor-2 ; sKdr; sLy73; sFlk-1; sVEGFR2; sVEGF receptor 2; skinase insert domain protein receptor |
200 |
270-Eur |
Reliatech |
|
| 103-PA18S |
VEGFR-2_Flk-1, soluble Anti-Mouse Host: Rabbit soluble vascular endothelial growth factor receptor-2 ; sKdr; sLy73; sFlk-1; sVEGFR2; sVEGF receptor 2; skinase insert domain protein receptor |
100 |
180-Eur |
Reliatech |
|
| 103-PA19 |
VEGFR-2_Flk-1 (Peptide), soluble Anti-Mouse Host: Rabbit soluble vascular endothelial growth factor receptor-2 ; sKdr; sLy73; sFlk-1; sVEGFR2; sVEGF receptor 2; skinase insert domain protein receptor |
200 |
270-Eur |
Reliatech |
|
| E1348Rb |
ELISA ADCY10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Oryctolagus cuniculus,Rabbit,sAC,SAC,Testicular soluble adenylyl cyclase |
96T |
942-Eur |
EIAab |
|
| E1348m |
ELISA Adcy10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Mouse,Mus musculus,sAC,Sac,Sacy,Testicular soluble adenylyl cyclase |
96T |
826-Eur |
EIAab |
|
| U1348m |
CLIA Adcy10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Mouse,Mus musculus,sAC,Sac,Sacy,Testicular soluble adenylyl cyclase |
96T |
826-Eur |
EIAab |
|
| E1348Rb |
ELISA kit ADCY10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Oryctolagus cuniculus,Rabbit,sAC,SAC,Testicular soluble adenylyl cyclase |
96T |
1026-Eur |
EIAab |
|
| E1348m |
ELISA kit Adcy10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Mouse,Mus musculus,sAC,Sac,Sacy,Testicular soluble adenylyl cyclase |
96T |
899-Eur |
EIAab |
|
| U1348Rb |
CLIA ADCY10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Oryctolagus cuniculus,Rabbit,sAC,SAC,Testicular soluble adenylyl cyclase |
96T |
942-Eur |
EIAab |
|
| U1348r |
CLIA Adcy10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Rat,Rattus norvegicus,sAC,Sac,Testicular soluble adenylyl cyclase |
96T |
845-Eur |
EIAab |
|
| E1348r |
ELISA kit Adcy10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Rat,Rattus norvegicus,sAC,Sac,Testicular soluble adenylyl cyclase |
96T |
919-Eur |
EIAab |
|
| E1348r |
ELISA Adcy10,Adenylate cyclase type 10,Germ cell soluble adenylyl cyclase,Rat,Rattus norvegicus,sAC,Sac,Testicular soluble adenylyl cyclase |
96T |
845-Eur |
EIAab |
|
| 372-20-3 |
m-Fluoro Phenol m-Fluoro Phenol |
1g |
----Eur |
chemotra |
|
| 26718-75 |
Phenol |
500 g |
21-Eur |
Nacalai |
|
| 87-26-3 |
2_(1_methylbutyl)phenol 2_(1_methylbutyl)phenol |
1g |
----Eur |
chemotra |
|
| REA-205 |
Hanks’ BSS (1X) without Ca, Mg, with Phenol Red |
500 ml |
54-Eur |
LeeBio |
|
| 95-57-8 |
O-Chloro phenol |
1g |
----Eur |
chemotra |
|
| 774-94-7 |
4_(Pentafluorothio)phenol _ |
1g |
----Eur |
chemotra |
|
| M55900779 |
Phenol CAS: [108-95-2] |
1 kg |
79-Eur |
Molekula |
|
| M86776424 |
Phenol Red CAS: [143-74-8] |
100 g |
121-Eur |
Molekula |
|
| PB0420 |
Phenol red |
100G |
113-Eur |
Bio Basic Inc. |
|
| PB0420 |
Phenol red |
25G |
63-Eur |
Bio Basic Inc. |
|
| 119-34-6 |
4_Amino_2_Nitro Phenol 4_Amino_2_Nitro Phenol |
1g |
----Eur |
chemotra |
|
| 104-43-8 |
p-Dodecyl phenol p-Dodecyl phenol |
1g |
----Eur |
chemotra |
|
| 26719-65 |
Phenol |
500 g |
24-Eur |
Nacalai |
|
| 611-24-5 |
o-(methylamino)phenol o-(methylamino)phenol |
1g |
----Eur |
chemotra |
|
| 614-70-0 |
o-(ethylamino)phenol o-(ethylamino)phenol |
1g |
----Eur |
chemotra |
|
| 26807-21 |
Phenol Red |
1 g |
34-Eur |
Nacalai |
|
| 150-75-4 |
4_(Methylamino)phenol 4_(Methylamino)phenol |
1g |
----Eur |
chemotra |
|
| 26720-25 |
Phenol |
500 g |
31-Eur |
Nacalai |
|
| REA-203 |
Hanks’ BSS (1X) with Ca, Mg, without Phenol Red |
500 ml |
54-Eur |
LeeBio |
|
| 26807-92 |
Phenol Red |
25 g |
65-Eur |
Nacalai |
|
| REA-202 |
Hanks’ BSS (1X) with Ca, Mg, with Phenol Red |
500 ml |
55-Eur |
LeeBio |
|
| 26721-15 |
Phenol |
500 g |
31-Eur |
Nacalai |
|
| L 2203 |
Phenol red 0,5 % |
100 ml |
58-Eur |
Biochrom |
|
| 599-64-4 |
4_(alpha_Cumyl)phenol 4_(alpha_Cumyl)phenol |
1g |
----Eur |
chemotra |
|
| 932-30-9 |
2_(Aminomethyl)phenol 2_(Aminomethyl)phenol |
1g |
----Eur |
chemotra |
|
| 26728-45 |
Phenol |
500 g |
80-Eur |
Nacalai |
|
| 26728-74 |
Phenol |
100 g |
34-Eur |
Nacalai |
|
| REA-204 |
Hanks’ BSS (1X) without Ca, Mg, without Phenol Red |
500 ml |
54-Eur |
LeeBio |
|
| P07100 |
Phenol Red |
100 G |
233-Eur |
pfalslandbauer. |
|
| PB0420 |
Phenol red |
25G |
70-Eur |
BBI Biotech |
|
| 26721-15 |
Phenol CAS: 108-95-2 |
500G |
116-Eur |
Nacalai |
|
| 26720-25 |
Phenol CAS: 108-95-2 |
500G |
115-Eur |
Nacalai |
|
| 26728-45 |
Phenol CAS: 108-95-2 |
500G |
139-Eur |
Nacalai |
|
| 26728-74 |
Phenol CAS: 108-95-2 |
100G |
118-Eur |
Nacalai |
|
| 26719-65 |
Phenol CAS: 108-95-2 |
500G |
112-Eur |
Nacalai |
|
| 26718-75 |
Phenol CAS: 108-95-2 |
500G |
111-Eur |
Nacalai |
|
| 603-85-0 |
2_Amino_3_Nitro Phenol 2_Amino_3_Nitro Phenol |
1g |
----Eur |
chemotra |
|
| 614-80-2 |
2_Acetamido Phenol 2_Acetamido Phenol |
1g |
----Eur |
chemotra |
|
| 26718-75 |
Phenol |
500G |
115-Eur |
Nacalai |
|
| 26719-65 |
Phenol |
500G |
118-Eur |
Nacalai |
|
| 26728-74 |
Phenol |
100G |
123-Eur |
Nacalai |
|
| 26728-45 |
Phenol |
500G |
145-Eur |
Nacalai |
|
| 150-19-6 |
3_Methoxy Phenol 3_Methoxy Phenol |
1g |
----Eur |
chemotra |
|
| 26720-25 |
Phenol |
500G |
121-Eur |
Nacalai |
|
| 26721-15 |
Phenol |
500G |
121-Eur |
Nacalai |
|
| PB0420 |
Phenol red |
100G |
121-Eur |
BBI Biotech |
|
| 540-38-5 |
4_Iodo Phenol 4_Iodo Phenol |
1g |
----Eur |
chemotra |
|
| 26807-21 |
Phenol Red CAS: 143-74-8 |
1G |
117-Eur |
Nacalai |
|
| P07100 |
Phenol Red |
500 G |
596-Eur |
pfalslandbauer. |
|
| P07100 |
Phenol Red |
25 G |
125-Eur |
pfalslandbauer. |
|
| 672-31-1 |
3_(Pentafluorothio)phenol _ |
1g |
----Eur |
chemotra |
|
| 591-27-5 |
3_Amino Phenol 3_Amino Phenol |
1g |
----Eur |
chemotra |
|
| 103-14-0 |
4_(Benzylamino)phenol 4_(Benzylamino)phenol |
1g |
----Eur |
chemotra |
|
| REA-203 |
Hanks’ BSS (1x) with Ca & Mg without Phenol Red |
5x500ml |
62-Eur |
SeraLab |
|
| REA-205 |
Hanks’ BSS (1x) without Ca & Mg with Phenol Red |
5x500ml |
62-Eur |
SeraLab |
|
| REA-204 |
Hanks’ BSS (1x) without Ca & Mg without Phenol Red |
5x500ml |
62-Eur |
SeraLab |
|
| REA-202 |
Hanks’ BSS (1x) with Ca & Mg with Phenol Red |
5x500ml |
69-Eur |
SeraLab |
|
| A3616-5G |
Phenol Red ACS CAS: 143-74-8 |
5G |
64-Eur |
Biomatic |
|
| 591-20-8 |
3_Bromo Phenol 3_Bromo Phenol |
1g |
----Eur |
chemotra |
|
| 533-58-4 |
2_Iodo Phenol 2_Iodo Phenol |
1g |
----Eur |
chemotra |
|
| 367-12-4 |
2_Fluoro Phenol 2_Fluoro Phenol |
1g |
----Eur |
chemotra |
|
| 619-08-9 |
2_Chloro_4_Nitro Phenol 2_Chloro_4_Nitro Phenol |
1g |
----Eur |
chemotra |
|
| 100-02-7 |
4_Nitro Phenol 4_Nitro Phenol |
1g |
----Eur |
chemotra |
|
| 26807-92 |
Phenol Red CAS: 143-74-8 |
25G |
132-Eur |
Nacalai |
|
| 41640000-2 |
Phenol red |
50 g |
93-Eur |
Bioworld Consulting |
|
| 41640000-1 |
Phenol red |
25 g |
78-Eur |
Bioworld Consulting |
|
| 767-00-0 |
4_Cyano Phenol 4_Cyano Phenol |
1g |
----Eur |
chemotra |
|
| REA-205 |
Hanks’ BSS (1x) without Ca & Mg with Phenol Red |
500ml |
36-Eur |
SeraLab |
|
| 350-76-3 |
4_Bromo_2_fluoro_6_nitro phenol _ |
1g |
----Eur |
chemotra |
|
| 95-56-7 |
2_Bromo Phenol 2_Bromo Phenol |
1g |
----Eur |
chemotra |
|
| REA-202 |
Hanks’ BSS (1x) with Ca & Mg with Phenol Red |
500ml |
38-Eur |
SeraLab |
|
| REA-204 |
Hanks’ BSS (1x) without Ca & Mg without Phenol Red |
500ml |
36-Eur |
SeraLab |
|
| 1624132 |
PHENOL MB |
1000 g |
231-Eur |
Sisco Research |
|
| 1624132 |
PHENOL MB |
100 g |
118-Eur |
Sisco Research |
|
| 26807-21 |
Phenol Red |
1G |
122-Eur |
Nacalai |
|
| A3616-25G |
Phenol Red ACS CAS: 143-74-8 |
25G |
87-Eur |
Biomatic |
|
| 103-16-2 |
4_Benzyloxy Phenol 4_Benzyloxy Phenol |
1g |
----Eur |
chemotra |
|
| REA-203 |
Hanks’ BSS (1x) with Ca & Mg without Phenol Red |
500ml |
36-Eur |
SeraLab |
|
| 26807-92 |
Phenol Red |
25G |
138-Eur |
Nacalai |
|
| orb80877 |
Human VEGF receptor-2 protein Soluble VEGFR-2 Human Recombinant produced in baculovirus is monomeric, glycosylated, polypeptide having a molecular mass of 116 kDa. The soluble receptor protein contain |
2 |
154-Eur |
Biorb |
recombinant |
| EIAAB46564 |
Aminoacylproline aminopeptidase,Bos taurus,Bovine,Cytosolic aminopeptidase P,sAmp,Soluble aminopeptidase P,Xaa-Pro aminopeptidase 1,XPNPEP1,X-Pro aminopeptidase 1,X-prolyl aminopeptidase 1, soluble |
|
1333-Eur |
EIAab |
|
| EIAAB46565 |
Aminoacylproline aminopeptidase,Cytosolic aminopeptidase P,Mouse,Mus musculus,sAmp,Soluble aminopeptidase P,Xaa-Pro aminopeptidase 1,Xpnpep1,X-Pro aminopeptidase 1,X-prolyl aminopeptidase 1, soluble |
|
1164-Eur |
EIAab |
|
| 28-315 |
KCNRG is a soluble protein with characteristics suggesting it forms heterotetramers with voltage-gated K (+) channels and inhibits their function.KCNRG is a soluble protein with characteristics sugges |
0.1 mg |
496-Eur |
Prosci |
|
| TM 806 |
PEPTONE WATER W_ PHENOL RED |
500 gm |
107-Eur |
TitanBiotech |
|
| 3432-005-01 |
Cultrex BME, no phenol red |
5 ml |
205-Eur |
Trevigen |
|
| TM 252 |
PHENOL RED AGAR BASE |
500 gm |
117-Eur |
TitanBiotech |
|
| 3432-005-02 |
Cultrex BME, no phenol red (PC) |
5 ml |
216-Eur |
Trevigen |
|
| 177489-10-0 |
3_(4_methylpiperazin_1_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| 539-15-1 |
4_(2_Dimethylaminoethyl)phenol 4_(2_Dimethylaminoeth |
1g |
----Eur |
chemotra |
|
| USP4101 |
Phenol Red TS Conforms to USP 34 |
100ml |
53-Eur |
Reagecon |
|
| 63720-38-7 |
3_(1_aminoethyl)phenol |
1g |
----Eur |
chemotra |
|
| 160968-99-0 |
2_(2,2,2_Trifluoroethoxy)phenol _ |
1g |
----Eur |
chemotra |
|
| 139306-10-8 |
3_[(1S)_1_(Dimethylaminoethyl)]phenol _ |
1g |
----Eur |
chemotra |
|
| PM 053 |
Phenol Red Tartarate Agar |
500 gms |
312-Eur |
Sisco Research |
|
| D38173 |
p_(a a_Dimethylbenzyl)phenol |
500 G |
307-Eur |
pfalslandbauer. |
|
| 500-99-2 |
3,5_Di Methoxy Phenol 3,5_Di Methoxy Phenol |
1g |
----Eur |
chemotra |
|
| 591-35-5 |
3,5_Di Chloro Phenol 3,5_Di Chloro Phenol |
1g |
----Eur |
chemotra |
|
| 95-77-2 |
3,4_Di Chloro Phenol 3,4_Di Chloro Phenol |
1g |
----Eur |
chemotra |
|
| 836-79-3 |
4_(2_Hydroxyhexafluoroisopropyl)phenol 4_(2_Hydroxyhexafluoro |
1g |
----Eur |
chemotra |
|
| 221670-72-0 |
(R)_4_(1_aminoethyl)phenol _ |
1g |
----Eur |
chemotra |
|
| 123982-81-0 |
(S)_3_(1_aminoethyl)phenol |
1g |
----Eur |
chemotra |
|
| 52755-94-9 |
2_(1_Methyl_1H_imidazol_2_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| 3432-001-01 |
Cultrex BME, no phenol red |
1 ml |
88-Eur |
Trevigen |
|
| 3432-001-02 |
Cultrex BME, no phenol red (PC) |
1 ml |
93-Eur |
Trevigen |
|
| PM 053 |
Phenol Red Tartarate Agar |
100 gms |
151-Eur |
Sisco Research |
|
| 88-06-2 |
2,4,6_Tri Chloro Phenol 2,4,6_Tri Chloro Phenol |
1g |
----Eur |
chemotra |
|
| D38173 |
p_(a a_Dimethylbenzyl)phenol |
100 G |
148-Eur |
pfalslandbauer. |
|
| 2262-12-1 |
2_Methyl_4_bromo phenol _ |
1g |
----Eur |
chemotra |
|
| 120-84-2 |
2_Di Chloro Phenol 2_Di Chloro Phenol |
1g |
----Eur |
chemotra |
|
| 576-24-9 |
2,3_Di Chloro Phenol 2,3_Di Chloro Phenol |
1g |
----Eur |
chemotra |
|
| 140-66-9 |
4_(1,1,3,3_Tetramethylbutyl)phenol 4_(1,1,3,3_Tetramethylb |
1g |
----Eur |
chemotra |
|
| 371-42-6 |
4_Fluoro Thio Phenol 4_Fluoro Thio Phenol |
1g |
----Eur |
chemotra |
|
| 0409 |
HBS w_out Phenol Red |
1 |
62-Eur |
Athena |
|
| 10292-61-2 |
4_Cyclopropyl Phenol _ |
1g |
----Eur |
chemotra |
|
| 885280-46-6 |
2_Acetyl_4_butylamino phenol _ |
1g |
----Eur |
chemotra |
|
| 118-79-6 |
2,4,6_Tri Bromo Phenol 2,4,6_Tri Bromo Phenol |
1g |
----Eur |
chemotra |
|
| 1518-83-8 |
4_Cyclopentyl phenol _ |
1g |
----Eur |
chemotra |
|
| 1624162 |
PHENOL SATURATED MB |
500 ml |
173-Eur |
Sisco Research |
|
| 1624162 |
PHENOL SATURATED MB |
300 ml |
150-Eur |
Sisco Research |
|
| 1624162 |
PHENOL SATURATED MB |
100 ml |
126-Eur |
Sisco Research |
|
| 615-58-7 |
2,4_Di Bromo Phenol 2,4_Di Bromo Phenol |
1g |
----Eur |
chemotra |
|
| 120-83-2 |
2,4_Di Chloro Phenol 2,4_Di Chloro Phenol |
1g |
----Eur |
chemotra |
|
| 86-72-6 |
4_(9H_carbazol_3_ylamino)phenol 4_(9H_carbazol_3_ylami |
1g |
----Eur |
chemotra |
|
| 1640187 |
PHENOL RED INDICATOR |
25g |
115-Eur |
Sisco Research |
|
| MB-P1308M |
Phenol Red Agar |
(15.01) x10 |
94-Eur |
Kisan Biotech |
|
| 620-17-7 |
3_Ethyl phenol m_Ethylphenol |
1g |
----Eur |
chemotra |
|
| 18137-25-2 |
4_(morpholin_4_ylcarbonyl)phenol _ |
1g |
----Eur |
chemotra |
|
| 14763-64-5 |
4_(Methylsulphinyl)phenol _ |
1g |
----Eur |
chemotra |
|
| USP4105 |
Phenol Red TS Conforms to USP 34 |
500ml |
69-Eur |
Reagecon |
|
| 91-01-1 |
2,6_Di Methoxy Phenol 2,6_Di Methoxy Phenol |
1g |
----Eur |
chemotra |
|
| 658-46-8 |
4_(1,1,2,2,2_Pentafluoroethoxy)phenol 4_(1,1,2,2,2_Pentafluoro |
1g |
----Eur |
chemotra |
|
| 32858-93-8 |
2_(Trifluoromethoxy)phenol _ |
1g |
----Eur |
chemotra |
|
| 56781-71-9 |
4_(2_methoxyethyl)phenol _ |
1g |
----Eur |
chemotra |
|
| PC6910 |
Phenol, saturate (pH7.9) |
400ML |
130-Eur |
BBI Biotech |
rat |
| 6265-55-0 |
4_(1,3_benzothiazol_2_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| PC6910 |
Phenol, saturate (pH7.9) |
100ML |
74-Eur |
BBI Biotech |
rat |
| PB4112 |
Phenol, crystalline |
500G |
119-Eur |
BBI Biotech |
|
| 87-65-0 |
2,6_Di Chloro Phenol 2,6_Di Chloro Phenol |
1g |
----Eur |
chemotra |
|
| B08950 |
4_Benzyloxy phenol 98% |
|
188-Eur |
pfalslandbauer |
|
| 30611026-2 |
DMEM_Ham's F-12 (1:1) w_o Phenol red |
1 L |
77-Eur |
Bioworld Consulting |
|
| 30611026-1 |
DMEM_Ham's F-12 (1:1) w_o Phenol red |
500 mL |
70-Eur |
Bioworld Consulting |
|
| N000089 |
PHÉNOL 250X26RL_T1_LL_P21 |
1 |
81-Eur |
Brady |
|
| D-03281/100 |
2,6-DICHLORO PHENOL CAS: 87-65-0 |
100 gm |
123-Eur |
Oxford Lab |
|
| D-03281/100 |
2,6-DICHLORO PHENOL CAS: 87-65-0 |
500 gm |
173-Eur |
Oxford Lab |
|
| 7329-50-2 |
Phenol-2,4,6-d3 98 atom% d |
1g |
----Eur |
chemotra |
|
| 3432-010-01 |
CultrexBME, no phenol red (PC) |
2 x5ml |
269-Eur |
Trevigen |
|
| C-9013 |
Phenol Buffers |
500 ml |
181-Eur |
Bioneer |
|
| 3432-005-02 |
CultrexBME, no phenol red (PC) |
5 ml |
206-Eur |
Trevigen |
|
| CA013-010 |
Phenol Red Solution |
100ml x 5 |
61-Eur |
GenDepot |
|
| 3432-005-01 |
CultrexBME, no phenol red |
5 ml |
196-Eur |
Trevigen |
|
| TM 806 |
PEPTONE WATER W_ PHENOL RED |
500 gm |
107-Eur |
TitanBiotech |
|
| P07220 |
Phenol Violet |
10 G |
210-Eur |
pfalslandbauer. |
|
| N001813 |
PHÉNOL 127X33RL_T2_P21 |
1 |
339-Eur |
Brady |
|
| PC6920 |
Phenol, saturated (pH4.5) |
100ML |
74-Eur |
BBI Biotech |
rat |
| PC6920 |
Phenol, saturated (pH4.5) |
400ML |
130-Eur |
BBI Biotech |
rat |
| 3430-50-06 |
Phenol Red Solution |
6 x 50 µl |
152-Eur |
Trevigen |
|
| 80-46-6 |
p-tert-Amyl phenol p-tert-Amyl phenol |
1g |
----Eur |
chemotra |
|
| 3432-001-02 |
CultrexBME, no phenol red (PC) |
1 ml |
89-Eur |
Trevigen |
|
| N001950 |
PHÉNOL 450X52CARD_T1_P21 |
1 |
9-Eur |
Brady |
|
| B08950 |
4_Benzyloxy phenol 98% |
|
353-Eur |
pfalslandbauer |
|
| B08950 |
4_Benzyloxy phenol 98% |
|
1298-Eur |
pfalslandbauer |
|
| D20740 |
m_(Diethylamino)phenol |
|
160-Eur |
pfalslandbauer |
|
| D20740 |
m_(Diethylamino)phenol |
|
315-Eur |
pfalslandbauer |
|
| N001851 |
PHÉNOL 150X12CARD_T1_P21 |
1 |
9-Eur |
Brady |
|
| N001884 |
PHÉNOL 250X26CARD_T1_P21 |
1 |
12-Eur |
Brady |
|
| N001814 |
PHÉNOL 127X33RL_T3_P21 |
1 |
339-Eur |
Brady |
|
| D20740 |
m_(Diethylamino)phenol |
|
671-Eur |
pfalslandbauer |
|
| D38173 |
p_(a a_Dimethylbenzyl)phenol |
|
163-Eur |
pfalslandbauer |
|
| N001917 |
PHÉNOL 355X37CARD_T1_P21 |
1 |
11-Eur |
Brady |
|
| D38173 |
p_(a a_Dimethylbenzyl)phenol |
|
329-Eur |
pfalslandbauer |
|
| N000155 |
PHÉNOL 450X52RL_T1_LL_P21 |
1 |
123-Eur |
Brady |
|
| N000122 |
PHÉNOL 355X37RL_T1_LL_P21 |
1 |
97-Eur |
Brady |
|
| MB-P1308 |
Phenol Red Agar |
500g |
141-Eur |
Kisan Biotech |
|
| 3430-50-06 |
Phenol Red Solution |
6 x 50 |
150-Eur |
Trevigen |
|
| 41620084-2 |
Phenol, saturated, (pH 4.5) |
100 mL |
87-Eur |
Bioworld Consulting |
|
| 41620084-1 |
Phenol, saturated, (pH 4.5) |
400 mL |
167-Eur |
Bioworld Consulting |
|
| 3432-001-01 |
CultrexBME, no phenol red |
1 ml |
84-Eur |
Trevigen |
|
| D20740 |
m_(Diethylamino)phenol |
500 G |
649-Eur |
pfalslandbauer. |
|
| 19676-64-3 |
Phenol, 2,3,4-trimethoxy- - |
1g |
----Eur |
chemotra |
|
| BP028 |
Phenol saturated for RNA, pH4.5 |
5x500ml |
392-Eur |
BioSol |
|
| 106-41-2 |
Para Bromo Phenol Para Bromo Phenol |
1g |
----Eur |
chemotra |
|
| CM018-350 |
DMEM_Ham's F-12 11 М^иге), \o Phenol Rr) |
50x500ml |
503-Eur |
GenDepot |
|
| 978-86-9 |
p-(Triphenylmethyl)phenol p-Tritylphenol |
1g |
----Eur |
chemotra |
|
| BP072 |
0.04% Phenol Red Solution |
5x100 ml |
295-Eur |
BioSol |
|
| M21800 |
4_(Methylmercapto)phenol 97% |
25 G |
297-Eur |
pfalslandbauer. |
|
| PC6910 |
Phenol, saturate (pH7.9) |
400ML |
122-Eur |
Bio Basic Inc. |
rat |
| BP027 |
Phenol saturated for DNA, pH8.0 |
5x500ml |
392-Eur |
BioSol |
|
| PC6910 |
Phenol, saturate (pH7.9) |
100ML |
68-Eur |
Bio Basic Inc. |
rat |
| B08950 |
4_Benzyloxy phenol 98% |
25 G |
178-Eur |
pfalslandbauer. |
|
| B08950 |
4_Benzyloxy phenol 98% |
100 G |
340-Eur |
pfalslandbauer. |
|
| B08950 |
4_Benzyloxy phenol 98% |
500 G |
1261-Eur |
pfalslandbauer. |
|
| D20740 |
m_(Diethylamino)phenol |
25 G |
151-Eur |
pfalslandbauer. |
|
| D20740 |
m_(Diethylamino)phenol |
100 G |
302-Eur |
pfalslandbauer. |
|
| 137-99-5 |
Dinonylphenol Dinonyl phenol |
1g |
----Eur |
chemotra |
|
| PB4112 |
Phenol, crystalline |
500G |
112-Eur |
Bio Basic Inc. |
|
| CM018-320 |
DMEM_Ham's F-12 11 М^иге), \o Phenol |
20x500ml |
315-Eur |
GenDepot |
|
| CM018-310 |
DMEM_Ham's F-12 11 М^иге), \o Phenol Rr) |
10x500ml |
194-Eur |
GenDepot |
|
| P06890 |
Phenol liquefied 92% |
500 G |
85-Eur |
pfalslandbauer. |
|
| P06890 |
Phenol liquefied 92% |
1000 G |
102-Eur |
pfalslandbauer. |
|
| CM018-300 |
DMEM_Ham's F-12 11 М^иге), \o Phenol Red |
6x500ml |
141-Eur |
GenDepot |
|
| 7070-85-1 |
Phenol, 3-(1,3-dioxolan-2-yl)- - |
1g |
----Eur |
chemotra |
|
| 144900-34-5 |
Phenol, 4-(2,2-dichlorocyclopropyl)-, 1-a |
1g |
----Eur |
chemotra |
|
| C3320-050 |
Ceraplex , No Phenol red |
500ml |
126-Eur |
GenDepot |
|
| CM020-050 |
DMEM_Ham's F-12 11 М^иге), \o \o Phenol |
Red 500ml x 5 |
78-Eur |
GenDepot |
|
| P06890 |
Phenol liquefied 92% |
5000 G |
202-Eur |
pfalslandbauer. |
|
| P06900 |
Phenol Blue |
1 G |
211-Eur |
pfalslandbauer. |
|
| 20491-91-2 |
Phenol, 2,4,5-trimethoxy- - |
1g |
----Eur |
chemotra |
|
| 602-64-2 |
Anthracene Brown, water soluble water soluble |
1g |
----Eur |
chemotra |
|
| P07105 |
Phenol Red sodium salt |
25 G |
124-Eur |
pfalslandbauer. |
|
| B-01833 |
BROMO PHENOL RED CAS: 2800-80-8 |
5 gm |
139-Eur |
Oxford Lab |
|
| 1239 |
PHENOL RED SUCROSE BROTH |
50kg |
----Eur |
Condalab -BULK |
|
| 27292-49-5 |
3_(4_Morpholino)phenol 4_(3_Hydroxyphenyl)mo |
1g |
----Eur |
chemotra |
|
| 1235 |
PHENOL RED DEXTROSE BROTH |
50kg |
----Eur |
Condalab -BULK |
|
| T31586 |
2,4,6_Tris(1,1_Dimethylpropyl)phenol |
25 G |
152-Eur |
pfalslandbauer. |
|
| T31575 |
2 4 6_Tris(dimethylaminomethyl)phenol |
1000 G |
453-Eur |
pfalslandbauer. |
|
| 74597-04-9 |
3_Hydroxybenzylbromide 3_(Bromomethyl)phenol |
1g |
----Eur |
chemotra |
|
| 23351-09-9 |
4_((1H)_Pyrrol_1_yl)phenol H_Pyrrol_1_ylphenol] |
1g |
----Eur |
chemotra |
|
| B-01833 |
BROMO PHENOL RED CAS: 2800-80-8 |
25 gm |
282-Eur |
Oxford Lab |
|
| N11125 |
O_[n_(p_Nitrophenyl)formimidoyl]phenol |
10 G |
224-Eur |
pfalslandbauer. |
|
| T25270 |
2,4,6_Tri (1_Indanyl) Phenol |
1 G |
240-Eur |
pfalslandbauer. |
|
| T31575 |
2 4 6_Tris(dimethylaminomethyl)phenol |
250 G |
215-Eur |
pfalslandbauer. |
|
| PMED-025-10 |
Hanks' BSS Powder without Ca & Mg without phenol red |
5x10litre |
121-Eur |
SeraLab |
|
| 177596-38-2 |
3_Fluoro_4_(trifluoromethoxy)phenol _ |
1g |
----Eur |
chemotra |
|
| 85578-29-6 |
4_(1,1,2,2_Tetrafluoroethoxy)phenol 4_(1,1,2,2_Tetrafluoroet |
1g |
----Eur |
chemotra |
|
| M55900779 |
Phenol CAS Number [108_95_2] |
1KG |
88-Eur |
Molekula |
|
| TM 259 |
PHENOL RED SUCROSE BROTH (for determination of |
500 gm |
114-Eur |
TitanBiotech |
|
| TM 258 |
PHENOL RED MANNITOL BROTH (for determination of the a |
500 gm |
121-Eur |
TitanBiotech |
|
| TM 257 |
PHENOL RED LACTOSE BROTH (for deter |
500 gm |
114-Eur |
TitanBiotech |
|
| TM 253 |
PHENOL RED LACTOSE AGAR (for determination of the abi |
500 gm |
117-Eur |
TitanBiotech |
|
| CCM18-050 |
Ceraplex DMEM_F-12 without Phenol Red |
500ml x 5 |
73-Eur |
GenDepot |
|
| 60702-00-3 |
2_(1,1,2,2,2_Pentafluoroethoxy)phenol 2_(1,1,2,2,2_Pentafluoro |
1g |
----Eur |
chemotra |
|
| 1656 |
BROMO PHENOL BLUE |
25 gm |
77-Eur |
TitanBiotech |
|
| P-06745 |
PHENOL RED INDICATOR AR (PH 6.4-8.2 Yellow to Red) CAS: 143-74-8 |
25 gm |
109-Eur |
Oxford Lab |
|
| P-06745 |
PHENOL RED INDICATOR AR (PH 6.4-8.2 Yellow to Red) CAS: 143-74-8 |
100 gm |
134-Eur |
Oxford Lab |
|
| P-06752 |
PHENOL RED INDICATOR SOLUTION |
125 ml |
102-Eur |
Oxford Lab |
|
| P-06752 |
PHENOL RED INDICATOR SOLUTION CAS: |
500 ml |
105-Eur |
Oxford Lab |
|
| 1656 |
BROMO PHENOL BLUE |
5 gm |
63-Eur |
TitanBiotech |
|
| 56718-71-9 |
4_(2_Methoxyethyl)phenol Methoxyethylphenol |
1g |
----Eur |
chemotra |
|
| 866475-34-5 |
4_(4_(Methylamino)styryl)phenol _ |
1g |
----Eur |
chemotra |
|
| 212485-91-1 |
4_(4,5_Dihydro_1H_imidazol_2_yl)phenol 4_(4,5_Dihydro_1H_imid |
1g |
----Eur |
chemotra |
|
| TM 537 |
PHENOL RED DEXTROSE BROTH, (for determination of the a |
500 gm |
114-Eur |
TitanBiotech |
|
| R1153 |
Bromo Phenol Blue |
1kg |
465-Eur |
ACTGene |
|
| TM 818 |
PHENOL RED GALACTOSE BROTH (for determination of mic |
100 gm |
121-Eur |
TitanBiotech |
|
| 134855-87-1 |
4_(1_Aminoethyl)phenol 1_(p_Hydroxyphenyl)eth |
1g |
----Eur |
chemotra |
|
| 52427-13-1 |
4_(1_ethyl_1_methylhexyl)phenol 4_(1_ethyl_1_methylhexy |
1g |
----Eur |
chemotra |
|
| M86776424 |
Phenol Red CAS Number [143_74_8] |
100 G |
135-Eur |
Molekula |
|
| 1239 |
PHENOL RED SUCROSE BROTH |
500 grams |
78-Eur |
Condalab -BULK |
|
| 1235 |
PHENOL RED DEXTROSE BROTH |
500 grams |
75-Eur |
Condalab -BULK |
|
| 1115 |
PHENOL RED BROTH BASE |
500 grams |
78-Eur |
Condalab -BULK |
|
| 1023 |
PHENOL RED DEXTROSE AGAR |
500 grams |
89-Eur |
Condalab -BULK |
|
| AM |
Adipocyte Medium Phenol Red Free |
500ml |
179-Eur |
ZenBio |
cell culture |
| 306-21-8 |
4_(2_Aminopropyl)phenol hydrobromide Hydroxyamphetamine h |
1g |
----Eur |
chemotra |
|
| C-9016 |
5:1 Phenol:Chloroform Buffers |
500 ml |
181-Eur |
Bioneer |
|
| 88553-89-3 |
4_(2_Chloro_1,1,2_trifluoroethoxy)phenol _ |
1g |
----Eur |
chemotra |
|
| C-9015 |
Equilibrated Phenol B Buffers |
500 ml |
181-Eur |
Bioneer |
|
| C-9014 |
Equilibrated Phenol A Buffers |
500 ml |
181-Eur |
Bioneer |
|
| 56718-71-09 |
4_(2_Methoxy Ethyl)Phenol _ |
1g |
----Eur |
chemotra |
|
| TM 822 |
PHENOL RED STARCH BROTH (for determination |
100 gm |
88-Eur |
TitanBiotech |
|
| TM 538 |
PHENOL RED INOSITOL BROTH (for determ |
100 gm |
103-Eur |
TitanBiotech |
|
| B29808 |
4_Sec_Butyl_2_(a_Methylbenzyl) Phenol 95% |
25 G |
344-Eur |
pfalslandbauer. |
|
| N650430 |
4-Nonyl Phenol
C15H24O CAS: 104-40-5 |
1 g |
232-Eur |
TRC |
|
| D461300 |
3-(Dimethylamino)phenol C8H11NO CAS: 99-07-0 |
1 g |
193-Eur |
TRC |
|
| TM 253 |
PHENOL RED LACTOSE AGAR (for determination of the abi |
500 gm |
117-Eur |
TitanBiotech |
|
| LM-T1709/10 |
Phenol Red Sodium Salt _ 10g |
10g |
77-Eur |
Biosera |
|
| M83446977 |
4-(2-Methoxyethyl)phenol CAS: [56718-71-9] |
25 g |
121-Eur |
Molekula |
|
| M64514170 |
4-(1-Adamantyl)phenol CAS: [29799-07-3] |
1 g |
121-Eur |
Molekula |
|
| 16636-62-7 |
2_(Acetoacetyl)phenol Salicyloylacetone |
1g |
----Eur |
chemotra |
|
| 77585-94-5 |
2_(6_chloropyridazin_3_yl)phenol 2_(6_chloropyridazin_3_y |
1g |
----Eur |
chemotra |
|
| TM 537 |
PHENOL RED DEXTROSE BROTH, (for determination of the a |
500 gm |
114-Eur |
TitanBiotech |
|
| 4526-41-4 |
2_(Methyltiomethyl)phenol Methyltiomethylphenol |
1g |
----Eur |
chemotra |
|
| 25338-55-0 |
2,4_(Dimethylaminomethyl)phenol Dimethylaminomethylp |
1g |
----Eur |
chemotra |
|
| TM 257 |
PHENOL RED LACTOSE BROTH (for deter |
500 gm |
114-Eur |
TitanBiotech |
|
| 26776-51-9 |
2,3,6_Tribromo_4_methyl phenol 2,3,6_Tribromo_4_methy |
1g |
----Eur |
chemotra |
|
| 32858-93-5 |
2_(Trifluoromethoxy)phenol m_Hydroxytrifluorometh |
1g |
----Eur |
chemotra |
|
| TM 538 |
PHENOL RED INOSITOL BROTH (for determ |
100 gm |
103-Eur |
TitanBiotech |
|
| 32858-93-8 |
2_(Trifluormethoxy)phenol Trifluormethoxyphenol |
1g |
----Eur |
chemotra |
|
| T790900 |
3-(Trifluoromethoxy)phenol C7H5F3O2 CAS: 827-99-6 |
1 g |
206-Eur |
TRC |
|
| TM 818 |
PHENOL RED GALACTOSE BROTH (for determination of mic |
100 gm |
121-Eur |
TitanBiotech |
|
| MED-233 |
RPMI 1640 without L_Glutamine without Phenol Red |
500 ml |
55-Eur |
LeeBio |
|
| MED-234 |
RPMI 1640 with L_Glutamine without Phenol Red |
500 ml |
55-Eur |
LeeBio |
|
| 25969-54 |
Phenol, Saturated with TE Buffer |
100 ml |
96-Eur |
Nacalai |
rat |
| 26829-96 |
Phenol, Saturated with TE Buffer |
400 ml |
278-Eur |
Nacalai |
rat |
| 26829-54 |
Phenol, Saturated with TE Buffer |
100 ml |
133-Eur |
Nacalai |
rat |
| 17460-15 |
HBSS(_) without Ca and Mg, with Phenol Red, liquid |
500 ml |
18-Eur |
Nacalai |
|
| 65195-20-2 |
2_(1_Piperidino)phenol 1_(2_Hydroxyphenyl)pip |
1g |
----Eur |
chemotra |
|
| 17459-55 |
HBSS(+) with Ca, Mg and Phenol Red, liquid |
500 ml |
57-Eur |
Nacalai |
|
| 2219-12-7 |
2_(1_methyl_1H_benzimidazol_2_yl)phenol 2_(1_methyl_1H_benzimi |
1g |
----Eur |
chemotra |
|
| B15065 |
2 4_Bis(1_Methylbutyl)phenol |
25 G |
242-Eur |
pfalslandbauer. |
|
| 25969-96 |
Phenol, Saturated with TE Buffer |
400 ml |
238-Eur |
Nacalai |
rat |
| 26729-64 |
Phenol Chloroform 5 1 Mixed |
100 ml |
142-Eur |
Nacalai |
|
| PMED-012-10 |
RPMI without Glutamine, without Phenol Red |
10 litre |
70-Eur |
LeeBio |
|
| PMED-012-50 |
RPMI without Glutamine, without Phenol Red |
50 litre |
140-Eur |
LeeBio |
|
| 41536-44-1 |
2_(4_Morpholino)phenol 4_(2_Hydroxyphenyl)mo |
1g |
----Eur |
chemotra |
|
| 37205-45 |
Phenol Reagent Solution |
500 ml |
116-Eur |
Nacalai |
|
| 37205-74 |
Phenol Reagent Solution |
100 ml |
39-Eur |
Nacalai |
|
| 1565-39-5 |
2_(4,5_Dihydro_1H_imidazol_2_yl)phenol 2_(4,5_Dihydro_1H_imid |
1g |
----Eur |
chemotra |
|
| 79349-23-8 |
2_(3_Methyl_1,2,4_oxadiazol_5_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| 26729-06 |
Phenol Chloroform 5 1 Mixed |
400 ml |
334-Eur |
Nacalai |
|
| TM 258 |
PHENOL RED MANNITOL BROTH (for determination of the a |
500 gm |
121-Eur |
TitanBiotech |
|
| TM 822 |
PHENOL RED STARCH BROTH (for determination |
100 gm |
88-Eur |
TitanBiotech |
|
| TM 259 |
PHENOL RED SUCROSE BROTH (for determination of |
500 gm |
114-Eur |
TitanBiotech |
|
| 1023 |
PHENOL RED DEXTROSE AGAR |
10kg |
----Eur |
Condalab -BULK |
|
| 1115 |
PHENOL RED BROTH BASE |
10kg |
----Eur |
Condalab -BULK |
|
| 1239 |
PHENOL RED SUCROSE BROTH |
5kg |
----Eur |
Condalab -BULK |
|
| 444341-80-4 |
2_Chloro_4_(2,2,2_trifluoroethoxy)phenol _ |
1g |
----Eur |
chemotra |
|
| 81107-97-3 |
2_Bromo_4_(trifluoromethyl)phenol _ |
1g |
----Eur |
chemotra |
|
| MB-P0619M |
Phenol Red Glucose Broth |
(10.01) x10 |
74-Eur |
Kisan Biotech |
|
| MB-P0619 |
Phenol Red Glucose Broth |
500g |
110-Eur |
Kisan Biotech |
|
| MB-P1174M |
Phenol Red Broth Base |
(9.01) x10 |
74-Eur |
Kisan Biotech |
|
| 1235 |
PHENOL RED DEXTROSE BROTH |
10kg |
----Eur |
Condalab -BULK |
|
| 207291-85-8 |
2_Fluoro_3_(trifluoromethyl)phenol _ |
1g |
----Eur |
chemotra |
|
| 1023 |
PHENOL RED DEXTROSE AGAR |
50kg |
----Eur |
Condalab -BULK |
|
| 1115 |
PHENOL RED BROTH BASE |
50kg |
----Eur |
Condalab -BULK |
|
| 1239 |
PHENOL RED SUCROSE BROTH |
25kg |
----Eur |
Condalab -BULK |
|
| 1235 |
PHENOL RED DEXTROSE BROTH |
25kg |
----Eur |
Condalab -BULK |
|
| 1023 |
PHENOL RED DEXTROSE AGAR |
25kg |
----Eur |
Condalab -BULK |
|
| 925889-93-6 |
2_methoxy_4_(piperazin_1_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| 1115 |
PHENOL RED BROTH BASE |
25kg |
----Eur |
Condalab -BULK |
|
| 1239 |
PHENOL RED SUCROSE BROTH |
10kg |
----Eur |
Condalab -BULK |
|
| 1235 |
PHENOL RED DEXTROSE BROTH |
5kg |
----Eur |
Condalab -BULK |
|
| MB-L2186M |
Lactose Phenol Red Broth |
(12.51) x10 |
74-Eur |
Kisan Biotech |
|
| 17460-15 |
HBSS(-) without Ca and Mg, with Phenol Red, liquid CAS: |
500ML |
109-Eur |
Nacalai |
|
| 135043-64-0 |
2_Aminomethyl_p_Amino Phenol 2HCl |
1g |
----Eur |
chemotra |
|
| 17459-55 |
HBSS(+) with Ca, Mg and Phenol Red, liquid CAS: |
500ML |
113-Eur |
Nacalai |
|
| 41640004-2 |
Phenol red, sodium salt |
50 g |
100-Eur |
Bioworld Consulting |
|
| 41640004-1 |
Phenol red, sodium salt |
25 g |
83-Eur |
Bioworld Consulting |
|
| 47157-01-7 |
2,6_Dibenzyl phenol 2,6_Dibenzylphenol |
1g |
----Eur |
chemotra |
|
| 30620065-1 |
Phenol Red Broth Base |
500 g |
122-Eur |
Bioworld Consulting |
|
| 30611047-1 |
Iscove's DMEM w_o Phenol red |
500 mL |
75-Eur |
Bioworld Consulting |
|
| 201-11-1450 |
Rat Phenol Sulfotransferase(PST)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 26829-54 |
Phenol, Saturated with TE Buffer CAS: |
100ML |
163-Eur |
Nacalai |
|
| 1023 |
PHENOL RED DEXTROSE AGAR |
5kg |
----Eur |
Condalab -BULK |
|
| 1115 |
PHENOL RED BROTH BASE |
5kg |
----Eur |
Condalab -BULK |
|
| QY-E10195 |
Rat Phenol Sulfotransferase(PST)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 26729-06 |
Phenol:Chloroform 5:1 Mixed CAS: |
400ML |
258-Eur |
Nacalai |
|
| 26729-64 |
Phenol:Chloroform 5:1 Mixed CAS: |
100ML |
167-Eur |
Nacalai |
|
| 25969-96 |
Phenol, Saturated with TE Buffer CAS: |
400ML |
213-Eur |
Nacalai |
|
| 25969-54 |
Phenol, Saturated with TE Buffer CAS: |
100ML |
162-Eur |
Nacalai |
|
| 26829-96 |
Phenol, Saturated with TE Buffer CAS: |
400ML |
232-Eur |
Nacalai |
|
| 834884-99-0 |
3_(4,5_Dihydro_1H_imidazol_2_yl)phenol 3_(4,5_Dihydro_1H_imid |
1g |
----Eur |
chemotra |
|
| 52857-30-4 |
benzyl_p_cresol 4_(1_Phenylethyl)phenol |
1g |
----Eur |
chemotra |
|
| 2460 |
Phenol Red, sodium salt |
5 g |
83-Eur |
FanBo Biochemicals |
|
| 1115 |
PHENOL RED BROTH BASE |
500 grams |
78-Eur |
Condalab |
|
| 934986-65-9 |
Phenol, 2,3,4,5,6-pentafluoro-, 1-benzen - |
1g |
----Eur |
chemotra |
|
| 934180-45-7 |
Phenol, 2,3-dichloro-4-fluoro- - |
1g |
----Eur |
chemotra |
|
| 1239 |
PHENOL RED SUCROSE BROTH |
500 grams |
78-Eur |
Condalab |
|
| 37155-50-3 |
Phenol, 2-[(4-methoxyphenyl)methyl]- - |
1g |
----Eur |
chemotra |
|
| 3534-87-0 |
Phenol, 2-[[[(2-hydroxyphenyl)methyl]met - |
1g |
----Eur |
chemotra |
|
| 88-30-2 |
4_Nitro_3_(trifluoromethyl)phenol 5_Hydroxy_2_nitrobenzo |
1g |
----Eur |
chemotra |
|
| 3411-95-8 |
o-(2-Benzothiazolyl)phenol 2-(o-Hydroxyphenyl)be |
1g |
----Eur |
chemotra |
|
| 3884-95-5 |
o-(1,1,3,3-tetramethylbutyl)phenol o-(1,1,3,3-tetramethylb |
1g |
----Eur |
chemotra |
|
| 1535-76-8 |
4_amino_2_(trifluoromethyl)phenol _ |
1g |
----Eur |
chemotra |
|
| 1115 |
PHENOL RED BROTH BASE |
500 grams |
78-Eur |
Condalab |
|
| 1235 |
PHENOL RED DEXTROSE BROTH |
500 grams |
72-Eur |
Condalab |
|
| PMED-025-50 |
Hanks' BSS Powder without Ca & Mg without phenol red |
50litre |
95-Eur |
SeraLab |
|
| PMED-025-10 |
Hanks' BSS Powder without Ca & Mg without phenol red |
10litre |
49-Eur |
SeraLab |
|
| 1239 |
PHENOL RED SUCROSE BROTH |
500 grams |
78-Eur |
Condalab |
|
| 1063601 |
Indicator Solution Phenol Red, 0.02% |
100ml |
67-Eur |
Reagecon |
cat |
| LM-T1709/10 |
Phenol Red Sodium Salt _ 10g |
|
42-Eur |
Biosera |
|
| 51387-92-9 |
4_Amino_2_(diethylaminomethyl)phenol 2 _ |
1g |
----Eur |
chemotra |
|
| 13319-71-6 |
Phenol, 2-bromo-6-methyl- - |
1g |
----Eur |
chemotra |
|
| 18113-04-7 |
Phenol, 2-chloro-5-methoxy- - |
1g |
----Eur |
chemotra |
|
| F 0723 |
Ham's F-10 without phenol red, with 1,2 g_l NaHCO3, with 10 mM HEPES |
100 ml |
39-Eur |
Biochrom |
|
| 23576-79-6 |
Phenol, 4-[(1-methylethyl)amino]- - |
1g |
----Eur |
chemotra |
|
| F 0715 |
Ham's F-10 with 10 mg_l phenol red, with 1,2 g_l NaHCO3 |
500 ml |
42-Eur |
Biochrom |
|
| 1150618-08- |
4_chloro_3_(pyridin_2_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| 1150617-95- |
4_chloro_3_(3_methylpyridin_2_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| 1150617-99- |
4_chloro_3_(4_methylpyridin_2_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| 1150618-01- |
4_chloro_3_(5_methylpyridin_2_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| 3164-07-6 |
Phenol, 4-(2-benzoxazolyl)-2-methoxy- - |
1g |
----Eur |
chemotra |
|
| F 0815 |
Ham's F-12 with 10 mg_l phenol red, with 1,176 g_l NaHCO3 |
500 ml |
42-Eur |
Biochrom |
|
| 13523-62-1 |
Phenol, 4-methoxy-3-(1-methylethyl)- - |
1g |
----Eur |
chemotra |
|
| 25345-77-1 |
Phenol, 4-phenoxy-2-(2-propen-1-yl)- - |
1g |
----Eur |
chemotra |
|
| 1235 |
PHENOL RED DEXTROSE BROTH |
500 grams |
72-Eur |
Condalab |
|
| 35705-71 |
Tyramine 〔p‐(2‐Aminoethyl)phenol〕 |
1G |
136-Eur |
Nacalai |
|
| 1023 |
PHENOL RED DEXTROSE AGAR |
500 grams |
86-Eur |
Condalab |
|
| 102771-00-6 |
Phenol, 2-iodo-5-(trifluoromethyl)- - |
1g |
----Eur |
chemotra |
|
| 32560-53-5 |
Phenol, 4-(2-aminoethyl)-2-chloro- - |
1g |
----Eur |
chemotra |
|
| PD0424 |
Phenol red, sodium salt |
25G |
61-Eur |
BBI Biotech |
|
| PD0424 |
Phenol red, sodium salt |
100G |
98-Eur |
BBI Biotech |
|
| 5950-82-3 |
Phenol, compound with N,N-dibutylbutyla (1 1) |
1g |
----Eur |
chemotra |
|
| 1150618-03- |
4_chloro_3_(6_methylpyridin_2_yl)phenol _ |
1g |
----Eur |
chemotra |
|
| B29808 |
4-sec-Butyl-2-(a-methylbenzyl)phenol 95% |
25 G |
476-Eur |
pfalslandbauer |
|
| 1023 |
PHENOL RED DEXTROSE AGAR |
500 grams |
86-Eur |
Condalab |
|
| 2461 |
Phenol Red, sodium salt |
25 g |
131-Eur |
FanBo Biochemicals |
|
| 2460 |
Phenol Red, sodium salt |
5 g |
83-Eur |
FanBo Biochemicals |
|
| 1073-72-9 |
4_(Methylthio)phenol Methylthiophenol |
1g |
----Eur |
chemotra |
|
| 17460-15 |
HBSS(-) without Ca and Mg, with Phenol Red, liquid |
500ML |
114-Eur |
Nacalai |
|
| MB-L2186 |
Lactose Phenol Red Broth |
500g |
92-Eur |
Kisan Biotech |
|
| MB-P1174 |
Phenol Red Broth Base |
500g |
102-Eur |
Kisan Biotech |
|
| 1649142 |
PHENOL crystalline extrapure AR |
500 g |
117-Eur |
Sisco Research |
|
| 1624262 |
PHENOL TRIS EQUILIBRATED |
60 ml |
139-Eur |
Sisco Research |
|
| 17459-55 |
HBSS(+) with Ca, Mg and Phenol Red, liquid |
500ML |
133-Eur |
Nacalai |
|
| 161841-12-9 |
4_(6_Acryloxy_hex_1_yl_oxy)phenol 4_(6_Acryloxy_hex_1_yl_ |
1g |
----Eur |
chemotra |
|
| B29808 |
4_Sec_Butyl_2_(a_Methylbenzyl) Phenol 95% |
|
368-Eur |
pfalslandbauer |
|
| 044770 |
2,5-DIMETHYL PHENOL pure |
100 g |
141-Eur |
Sisco Research |
|
| MED-234 |
RPMI 1640 with L_Glutamine without Phenol Red |
500ml |
65-Eur |
SeraLab |
|
| MED-233 |
RPMI 1640 without L Glutamine without Phenol Red |
500ml |
65-Eur |
SeraLab |
|
| E91268Hu |
ELISA Kit for Phenol Sulfotransferase (PST) |
96T/Kit |
682-Eur |
USCNLife |
|
| 197770-48-2 |
4_(4_Fluorophenylethynyl)phenol 4_(4_Fluorophenylethyn |
1g |
----Eur |
chemotra |
|
| 148254-32-4 |
5_Bromo_2_Chloro_4_Fluoro phenol 5_Bromo_2_Chloro_4_Fl |
1g |
----Eur |
chemotra |
|
| 35094-91-8 |
4_(4_METHYLPHENOXY)PHENOL 4_(4_METHYLPHENOX |
1g |
----Eur |
chemotra |
|
| B15065 |
2 4_Bis(1_Methylbutyl)phenol |
|
253-Eur |
pfalslandbauer |
|
| 26829-54 |
Phenol, Saturated with TE Buffer |
100ML |
172-Eur |
Nacalai |
rat |
| 89100-78-2 |
4_(trans_4_Ethylcyclohexyl)phenol 4_(trans_4_Ethylcyclohe |
1g |
----Eur |
chemotra |
|
| 88581-00-4 |
4_(trans_4_n_Butylcyclohexyl)phenol 4_(trans_4_n_Butylcyclo |
1g |
----Eur |
chemotra |
|
| PM013 |
Phenol Red Agar, Base |
100 gms |
120-Eur |
Sisco Research |
|
| PM021 |
Peptone Water with Phenol Red |
500 gms |
151-Eur |
Sisco Research |
|
| PM013 |
Phenol Red Agar, Base |
500 gms |
163-Eur |
Sisco Research |
|
| 2461 |
Phenol Red, sodium salt |
25 g |
131-Eur |
FanBo Biochemicals |
|
| E91268Mu |
ELISA Kit for Phenol Sulfotransferase (PST) |
96T/Kit |
702-Eur |
USCNLife |
|
| 26729-06 |
Phenol Chloroform 5 1 Mixed |
400ML |
271-Eur |
Nacalai |
|
| B29808 |
4-sec-Butyl-2-(a-methylbenzyl)phenol 95% |
5 G |
264-Eur |
pfalslandbauer |
|
| PM021 |
Peptone Water with Phenol Red |
100 gms |
115-Eur |
Sisco Research |
|
| 26729-64 |
Phenol Chloroform 5 1 Mixed |
100ML |
176-Eur |
Nacalai |
|
| 89100-78-7 |
4_(trans_4_n_ethylcyclohexyl)phenol 4_(trans_4_n_ethylcycloh |
1g |
----Eur |
chemotra |
|
| 26829-96 |
Phenol, Saturated with TE Buffer |
400ML |
244-Eur |
Nacalai |
rat |
| 1624262 |
PHENOL TRIS EQUILIBRATED |
100 ml |
158-Eur |
Sisco Research |
|
| 25969-54 |
Phenol, Saturated with TE Buffer |
100ML |
170-Eur |
Nacalai |
rat |
| 25969-96 |
Phenol, Saturated with TE Buffer |
400ML |
223-Eur |
Nacalai |
rat |
| 82575-69-7 |
4_(trans_4_n_Pentylcyclohexyl)phenol 4_(trans_4_n_Pentylcycl |
1g |
----Eur |
chemotra |
|
| 81936-33-6 |
4_(Trans_4_n_Propylcyclohexyl)phenol 4_(Trans_4_n_Propylcycl |
1g |
----Eur |
chemotra |
|
| PIP026 |
NATIVE TOXOPLASMA GONDII SOLUBLE ANTIGEN , Product Type Antigen, Specificity TOXOPLASMA GONDII SOLUBLE ANTIGEN, Target Species Protozoan, Host N_A, Format Inactivated Pathogen, Isotypes , Applic |
1 ml |
1690-Eur |
AbD Serotec |
|
| EIAAB39867 |
Homo sapiens,Human,Soluble scavenger protein with 5 SRCR domains,Soluble scavenger receptor cysteine-rich domain-containing protein SSC5D,SSc5D,SSC5D |
|
1109-Eur |
EIAab |
|
| orb81928 |
Human sRANKL, recombinant protein Soluble RANKL (sRANKL), Recombinant is a purified apoptosis and signal transduction reagent. For research use only. |
20 |
588-Eur |
Biorb |
recombinant |
| orb82224 |
sLOX-1 recombinant protein Lectin-like Oxidized LDL receptor-1 (sLOX) Soluble form, Recombinant is a purified cardiac marker. For research use only. |
100 |
1735-Eur |
Biorb |
recombinant |
| 15-288-22303B |
Xaa-Pro aminopeptidase 1 - EC 3.4.11.9; X-Pro aminopeptidase 1; X-prolyl aminopeptidase 1. soluble; Cytosolic aminopeptidase P; Soluble aminopeptidase P; sAmp; Aminoacylproline aminopeptidase Polyclon |
0.05 mg |
248-Eur |
GenWay |
|
| 15-288-22303B |
Xaa-Pro aminopeptidase 1 - EC 3.4.11.9; X-Pro aminopeptidase 1; X-prolyl aminopeptidase 1. soluble; Cytosolic aminopeptidase P; Soluble aminopeptidase P; sAmp; Aminoacylproline aminopeptidase Polyclon |
0.1 mg |
353-Eur |
GenWay |
|
| orb81867 |
sLOX-1 glycosylated, Recomb protein Lectin-like Oxidized LDL receptor-1 (sLOX-1), Soluble form, glycosylated, is a purified cardiac marker. For research use only. |
100 |
2095-Eur |
Biorb |
recombinant |
| M262665 |
2-(2-Methoxyethyl)phenol C9H12O2 CAS: 330976-39-1 |
250 mg |
245-Eur |
TRC |
|
| 10760056-1 |
Phenol-free Plant RNA isolation Kit |
50 Preps |
285-Eur |
Bioworld Consulting |
|
| TM 541 |
PHENOL RED XYLOSE BROTH (for determination of the ability |
100 gm |
103-Eur |
TitanBiotech |
|
| 30611019-1 |
DMEM, low gluc w_o L-Glut-Phenol |
500 mL |
70-Eur |
Bioworld Consulting |
|
| CZ--114 |
2-methoxy-5-(5-phenyl-1H-benzo[d]imidazol-1-yl)phenol, CAS Nr: |
1 g |
485-Eur |
YP |
|
| 30611019-2 |
DMEM, low gluc w_o L-Glut-Phenol |
1 L |
74-Eur |
Bioworld Consulting |
|
| 30611048-1 |
Iscove's DMEM w_o Phenol red (powder) |
1 L |
62-Eur |
Bioworld Consulting |
|
| CZ--081 |
6-fluoro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, CAS Nr: |
11 g |
485-Eur |
YP |
|
| 41620088-1 |
Phenol:Chloroform:Isoamyl alcohol, 25:2 |
100 mL |
99-Eur |
Bioworld Consulting |
|
| 1624284 |
PHENOL EQUILIBRATED WITH 0.1 M CITRATE BUFFER pH 4.5 |
500 ml |
211-Eur |
Sisco Research |
|
| 1379 |
PHENOL RED SALINE LACTOSE BROTH |
5kg |
----Eur |
Condalab -BULK |
|
| S - 07703 |
SESAMOL 98% (For Synthesis) {3,4(Methylenedioxy) Phenol} CAS: 533-31-3 |
50 gm |
203-Eur |
Oxford Lab |
|
| P06885 |
Phenol crystals Tech. Grade |
500 G |
147-Eur |
pfalslandbauer. |
|
| N650450 |
4-Nonyl Phenol Monoethoxylate C17H28O2 CAS: 104-35-8 |
5 mg |
258-Eur |
TRC |
|
| P06885 |
Phenol crystals Tech. Grade |
1000 G |
195-Eur |
pfalslandbauer. |
|
| P06885 |
Phenol crystals Tech. Grade |
5000 G |
486-Eur |
pfalslandbauer. |
|
| 273759 |
PMF-Phénol-PR1-37X284 _ AC Signs;Pack-CD; |
3 pipem Pcs Per Pack |
11-Eur |
Brady |
|
| 273758 |
PMF-Phénol-PR1-26X200 _ AC Signs;Pack-CD; |
3 pipem Pcs Per Pack |
9-Eur |
Brady |
|
| CZ--116 |
2-methoxy-5-(5-(pyridin-4-yl)-1H-benzo[d]imidazol-1-yl)phenol, CAS Nr: |
1 g |
485-Eur |
YP |
|
| CZ--115 |
2-methoxy-4-(5-phenyl-1H-benzo[d]imidazol-1-yl)phenol, CAS Nr: |
1 g |
485-Eur |
YP |
|
| TM 539 |
PHENOL RED MALTOSE BROTH (for determination of the abilit |
500 gm |
121-Eur |
TitanBiotech |
|
| TM 540 |
PHENOL RED SORBITOL BROTH (for determination of the ability |
100 gm |
92-Eur |
TitanBiotech |
|
| 1624284 |
PHENOL EQUILIBRATED WITH 0.1 M CITRATE BUFFER pH 4.5 |
100 ml |
130-Eur |
Sisco Research |
|
| N000155 |
Phénol 450x52RL-T1-LL-P21 _ AC Signs;Pack-RL; |
30 Pcs Per Pack |
120-Eur |
Brady |
|
| N000122 |
Phénol 355x37RL-T1-LL-P21 _ AC Signs;Pack-RL; |
30 Pcs Per Pack |
95-Eur |
Brady |
|
| 062015 |
FOLIN & CIOCALTEU'S PHENOL REAGENT AR |
250 ml |
126-Eur |
Sisco Research |
|
| 062015 |
FOLIN & CIOCALTEU'S PHENOL REAGENT AR |
100 ml |
115-Eur |
Sisco Research |
|
| MED-234 |
RPMI 1640 Liquid with L-Glutamine without Phenol Red |
500ml |
37-Eur |
SeraLab |
|
| MED-233 |
RPMI 1640 Liquid without L-Glutamine without Phenol Red |
500ml |
37-Eur |
SeraLab |
|
| QY-E21157 |
Mouse Phenol Sulfotransferase(PST)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| LM-T1705/100 |
Trypsin_EDTA 1X in PBS w_o Calcium w_o Magnesium w_ Phenol Red _ 100 ml |
100 ml |
71-Eur |
Biosera |
|
| LM-T1705/500 |
Trypsin_EDTA 1X in PBS w_o Calcium w_o Magnesium w_ Phenol Red _ 500 ml |
500 ml |
94-Eur |
Biosera |
|
| 25-535 |
Hank's Balanced Salt Solution, w_ ca, mg & phenol red |
6 x 500ml/Unit |
91-Eur |
Genesee |
|
| LM-T1706/100 |
Trypsin_EDTA 1X in PBS w_o Calcium w_o Magnesium w_o Phenol Red _ 100 ml |
100 ml |
71-Eur |
Biosera |
|
| LF-P0049 |
Catecholamine_Sulfating Phenol Sulfotransferase, Human |
0.25 mg |
257-Eur |
Abfrontier |
human |
| B-01834 |
BROMO PHENOL RED INDICATOR SOLUTION |
125 ml |
105-Eur |
Oxford Lab |
|
| 25968-64 |
Phenol, Saturated with Citrate Buffer CAS: |
100ML |
159-Eur |
Nacalai |
|
| B-01831 |
BROMO PHENOL BLUE INDICATOR AR CAS: 115-39-9 |
5 gm |
104-Eur |
Oxford Lab |
|
| XC-T1716/100 |
Trypsin 2.5 % in PBS w_o Calcium w_o Magnesium w_o Phenol Red _ 100 ml |
100 ml |
71-Eur |
Biosera |
|
| B-01831 |
BROMO PHENOL BLUE INDICATOR AR CAS: 115-39-9 |
25 gm |
116-Eur |
Oxford Lab |
|
| 25968-64 |
Phenol, Saturated with Citrate Buffer |
100ML |
168-Eur |
Nacalai |
rat |
| B-01831 |
BROMO PHENOL BLUE INDICATOR AR CAS: 115-39-9 |
100 gm |
149-Eur |
Oxford Lab |
|
| A16390 |
Aluminum Phenol Sulfonate Tech |
|
354-Eur |
pfalslandbauer |
|
| 90-72-2 |
2,4,6_Tris(dimethylaminomethyl)phenol Tris(dimethylaminomet |
1g |
----Eur |
chemotra |
|
| A16390 |
Aluminum Phenol Sulfonate Tech |
|
161-Eur |
pfalslandbauer |
|
| 062015 |
FOLIN & CIOCALTEU'S PHENOL REAGENT AR |
500 ml |
145-Eur |
Sisco Research |
|
| N000089 |
Phénol 250x26RL-T1-LL-P21 _ AC Signs;Pack-RL; |
30 Pcs Per Pack |
79-Eur |
Brady |
|
| B-01834 |
BROMO PHENOL RED INDICATOR SOLUTION CAS: |
500 ml |
116-Eur |
Oxford Lab |
|
| M262585 |
3-(2-Methoxyethyl)phenol C9H12O2 CAS: 32846-01-8 |
100 mg |
245-Eur |
TRC |
|
| MED-249 |
DMEM High Glucose without Phenol Red, with L_Glutamine |
500 ml |
56-Eur |
LeeBio |
|
| 06261-65 |
RPMI 1640 with L_ Gln, without Phenol Red, liquid |
500 ml |
23-Eur |
Nacalai |
|
| 15969-10-5 |
Phenol, 2-bromo-4-chloro-6-nitro - |
1g |
----Eur |
chemotra |
|
| TM 812 |
PHENOL RED SUCROSE AGAR (for determination of the abili |
500 gm |
117-Eur |
TitanBiotech |
|
| 2321-95-1 |
Phenol, 2-[(methyl-2-propyn-1-ylamino)m - |
1g |
----Eur |
chemotra |
|
| TM 255 |
PHENOL RED BROTH BASE (for determination of fermenta |
500 gm |
114-Eur |
TitanBiotech |
|
| TM 815 |
PHENOL RED ADONITOL BROTH (for determination of the ability of mic |
100 gm |
179-Eur |
TitanBiotech |
|
| A602500 |
rac 4-(3-Aminobutyl)phenol C10H15NO CAS: 52846-75-0 |
100 mg |
232-Eur |
TRC |
|
| BP027 |
Phenol saturated for DNA, pH8.0, Plasmid DNA Purification |
5x500ml |
392-Eur |
BioSol |
|
| A602502 |
rac 4-(3-Aminobutyl)phenol-d6 C10H9D6NO CAS: 1189890-45-6 |
2.5 mg |
232-Eur |
TRC |
|
| 1379 |
PHENOL RED SALINE LACTOSE BROTH |
10kg |
----Eur |
Condalab -BULK |
|
| DMN2XPS |
2X Happy Cell, DMEM, No Phenol Red |
25ml |
166-Eur |
Biocroi |
|
| 1379 |
PHENOL RED SALINE LACTOSE BROTH |
500 grams |
106-Eur |
Condalab |
|
| MED-248 |
DMEM High Glucose without Phenol Red, without L_Glutamine |
500 ml |
56-Eur |
LeeBio |
|
| 13278-70-1 |
Phenol, 4-[methyl(1-methylethyl)amino]- - |
1g |
----Eur |
chemotra |
|
| 20294-50-2 |
Phenol, 4-bromo-2-methyl-6-nitro- - |
1g |
----Eur |
chemotra |
|
| 3431-005-01 |
CultrexBME with phenol red, RGF (3433-005-01 & 3430-50-01) |
5 ml |
226-Eur |
Trevigen |
|
| 3431-005-02 |
CultrexBME with phenol red, RGF (PC) (3433-005-02 & 3430-50-01) |
5 ml |
235-Eur |
Trevigen |
|
| TM 516 |
CULTURE MEDIUM FOR RWC (as per BIS) (for determination of phenol coefficient of |
100 gm |
74-Eur |
TitanBiotech |
cell culture |
| TM 516 |
CULTURE MEDIUM FOR RWC (as per BIS) (for determination of phenol coefficient of |
500 gm |
121-Eur |
TitanBiotech |
cell culture |
| BQ015D-CR |
Cholesterol, Phenol Free, 5 Minutes |
200 Tests / Kit |
216-Eur |
Bioquant |
|
| 3431-001-02 |
CultrexBME with phenol red, RGF (PC) (3433-001-02 & 3430-50-01) |
1 ml |
89-Eur |
Trevigen |
|
| RPN2XPS |
2X Happy Cell, RPMI, No Phenol Red |
25ml |
166-Eur |
Biocroi |
|
| 25968-64 |
Phenol, Saturated with Citrate Buffer |
100 ml |
125-Eur |
Nacalai |
rat |
| 1761-56-4 |
o-(o-Hydroxybenzylideneamino)phenol Salicylidene o-aminoph |
1g |
----Eur |
chemotra |
|
| E892552 |
2-Ethoxy-d5-phenol C8H5D5O2 CAS: 117320-30-6 |
100 mg |
193-Eur |
TRC |
|
| P318002 |
Phenol-13C6 13C6H6O CAS: 89059-34-7 |
25 mg |
212-Eur |
TRC |
|
| N495845 |
5-(2-Nitroethenyl)-2-(benzyloxy)phenol C15H13NO4 CAS: |
50 mg |
232-Eur |
TRC |
|
| UTB108 |
Nonyl Phenol , conjugated antigen |
mg |
750-Eur |
Unibio |
|
| CSB-E15893Fh |
Fish phenol oxidase(PO) ELISA Kit |
96T |
710-Eur |
Cusabio |
|
| TM 817 |
PHENOL RED DULCITOL BROTH (for determination of the ability of |
100 gm |
167-Eur |
TitanBiotech |
|
| 273762 |
PMF-Phénol-PR4-RLL120 _ AC Signs;Pack-RL; |
33 m Pcs Per Pack |
337-Eur |
Brady |
|
| 06261-65 |
RPMI 1640 with L‐Gln, without Phenol Red, liquid |
500ML |
115-Eur |
Nacalai |
|
| 273761 |
PMF-Phénol-PR3-RLL120 _ AC Signs;Pack-RL; |
33 m Pcs Per Pack |
337-Eur |
Brady |
|
| MED-234 |
RPMI 1640 Liquid with L-Glutamine without Phenol Red |
5x500ml |
69-Eur |
SeraLab |
|
| MED-233 |
RPMI 1640 Liquid without L-Glutamine without Phenol Red |
5x500ml |
69-Eur |
SeraLab |
|
| 1379 |
PHENOL RED SALINE LACTOSE BROTH |
25kg |
----Eur |
Condalab -BULK |
|
| D473190 |
3-(1,1-Dimethylheptyl)phenol C15H24O CAS: 70120-12-6 |
100 mg |
232-Eur |
TRC |
|
| 3431-010-02 |
CultrexBME with phenol red, RGF (PC) (3433-005-02 & 3430-50-01) |
2 x5ml |
318-Eur |
Trevigen |
|
| A3619-25G |
Phenol Red, Sodium salt ACS CAS: 34487-61-1 |
25G |
93-Eur |
Biomatic |
|
| A3619-5G |
Phenol Red, Sodium salt ACS CAS: 34487-61-1 |
5G |
64-Eur |
Biomatic |
|
| 103-16-2 |
Hydroquinone monobenzyl ether 4_(Benzyloxy)phenol |
1g |
----Eur |
chemotra |
|
| 20395 |
Human Phenol Sulfotransferase (PST) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| H951290 |
4-[3-(4-Hydroxyphenylethylamino)butyl]phenol C18H23NO2 CAS: |
100 mg |
245-Eur |
TRC |
|
| 1379 |
PHENOL RED SALINE LACTOSE BROTH |
50kg |
----Eur |
Condalab -BULK |
|
| M262575 |
4-(2-Methoxyethyl)phenol C9H12O2 CAS: 56718-71-9 |
10 mg |
193-Eur |
TRC |
|
| 273760 |
PMF-Phénol-PR1-52X402 _ AC Signs;Pack-CD; |
2 Pcs Per Pack |
9-Eur |
Brady |
|
| F 0723 |
Ham's F_10 without phenol red, with 1,2 g_l NaHCO3, with 10 mM HEPES |
100 ml |
61-Eur |
Biochrom |
|
| DF |
Dermal Fibroblast Basal Medium, Phenol Red |
50ml |
170-Eur |
ZenBio |
cell culture |
| TM 815 |
PHENOL RED ADONITOL BROTH (for determination of the ability of mic |
100 gm |
179-Eur |
TitanBiotech |
|
| DM |
Adipocyte Differentiation Medium Phenol Red Free |
100ml |
179-Eur |
ZenBio |
cell culture |
| F 0715 |
Ham's F_10 with 10 mg_l phenol red, with 1,2 g_l NaHCO3 |
500 ml |
63-Eur |
Biochrom |
|
| DM |
Adipocyte Differentiation Medium, phenol red free, |
500ml |
615-Eur |
ZenBio |
cell culture |
| TM 812 |
PHENOL RED SUCROSE AGAR (for determination of the abili |
500 gm |
117-Eur |
TitanBiotech |
|
| DM |
Adipocyte Differentiation Medium, WITHOUT Dexamethasone, WITHOUT Phenol Red |
100ml |
179-Eur |
ZenBio |
cell culture |
| MED-249 |
DMEM High Glucose without Phenol Red, with L_Glutamine |
500ml |
66-Eur |
SeraLab |
|
| OM |
Omental Preadipocyte Medium Phenol Red Free |
500ml |
179-Eur |
ZenBio |
cell culture |
| OM |
Omental Differentiation Medium Phenol Red Free |
100ml |
179-Eur |
ZenBio |
cell culture |
| N001813 |
Phénol 127x33RL-T2-P21 _ AC Signs;Pack-RL; |
505 Pcs Per Pack |
330-Eur |
Brady |
|
| OM |
Omental Adipocyte Medium Phenol Red Free |
500ml |
179-Eur |
ZenBio |
cell culture |
| PM |
Subcutaneous Preadipocyte Medium Phenol Red Free |
500ml |
179-Eur |
ZenBio |
cell culture |
| BM |
Subcutaneous Basal Medium Phenol Red Free |
500ml |
170-Eur |
ZenBio |
cell culture |
| 1379 |
PHENOL RED SALINE LACTOSE BROTH |
500 grams |
106-Eur |
Condalab |
|
| PD0424(D0424) |
Phenol red, sodium salt |
100G |
88-Eur |
Bio Basic Inc. |
|
| PD0424(D0424) |
Phenol red, sodium salt |
100G |
94-Eur |
BBI Biotech |
|
| PD0424(D0424) |
Phenol red, sodium salt |
25G |
52-Eur |
BBI Biotech |
|
| F 0815 |
Ham's F_12 with 10 mg_l phenol red, with 1,176 g_l NaHCO3 |
500 ml |
63-Eur |
Biochrom |
|
| F 1125 |
Williams' Medium E with 2,2 g_l NaHCO3, without phenol red |
500 ml |
52-Eur |
Biochrom |
cell culture |
| F 1275 |
RPMI 1640 with 2,0 g_l NaHCO3 without phenol red |
500 ml |
65-Eur |
Biochrom |
|
| 79352-72-0 |
4_Amino_2_(Aminomethyl)phenol 2HCL _ |
1g |
----Eur |
chemotra |
|
| BQ015D-CR |
Cholesterol, Phenol Free, 5 Minutes |
200/kit |
212-Eur |
Bioquant |
|
| PD0424(D0424) |
Phenol red, sodium salt |
25G |
47-Eur |
Bio Basic Inc. |
|
| TM 817 |
PHENOL RED DULCITOL BROTH (for determination of the ability of |
100 gm |
167-Eur |
TitanBiotech |
|
| C-9017 |
Phenol:Chloroform:Isoamylalcohol (25:24:1) Buffers |
500 ml |
181-Eur |
Bioneer |
|
| G-04474 |
GUAIACOL 99% (Liquid) (O-Methoxy Phenol) CAS: 90-05-1 |
500 ml |
139-Eur |
Oxford Lab |
|
| C-02665 |
CHLORO PHENOL RED INDICATOR SOLUTION CAS: |
500 ml |
105-Eur |
Oxford Lab |
|
| C-02665 |
CHLORO PHENOL RED INDICATOR SOLUTION |
125 ml |
102-Eur |
Oxford Lab |
|
| 1379 |
PHENOL RED SALINE LACTOSE BROTH |
500 grams |
106-Eur |
Condalab -BULK |
|
| TM 541 |
PHENOL RED XYLOSE BROTH (for determination of the ability |
100 gm |
103-Eur |
TitanBiotech |
|
| TM 540 |
PHENOL RED SORBITOL BROTH (for determination of the ability |
100 gm |
92-Eur |
TitanBiotech |
|
| 3430-001-01 |
Cultrex BME with phenol red (3432_001_01 & 3430_50_01) |
1 ml |
88-Eur |
Trevigen |
|
| S - 07703 |
SESAMOL 98% (For Synthesis) {3,4(Methylenedioxy) Phenol} CAS: 533-31-3 |
250 gm |
503-Eur |
Oxford Lab |
|
| MED-248 |
DMEM High Glucose without Phenol Red, without L_Glutamine |
500ml |
66-Eur |
SeraLab |
|
| 3430-001-02 |
Cultrex BME with phenol red (PC) (3432_001_02 & 3430_50_01) |
1 ml |
93-Eur |
Trevigen |
|
| 3430-005-01 |
Cultrex BME with phenol red (3432_005_01 & 3430_50_01) |
5 ml |
205-Eur |
Trevigen |
|
| 3430-005-02 |
Cultrex BME with phenol red (PC) (3432_005_02 & 3430_50_01) |
5 ml |
216-Eur |
Trevigen |
|
| 3431-001-02 |
Cultrex BME with phenol red, RGF (PC) (3433_001_02 & 3430_50_01) |
1 ml |
93-Eur |
Trevigen |
|
| 0247145 |
p-tert BUTYL PHENOL pure |
500 g |
120-Eur |
Sisco Research |
|
| LM-R1643/100 |
RPMI 1640 w_o L_Glutamine w_o Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| LM-T1703/100 |
Trypsin 0.25 % in PBS w_o Calcium w_o Magnesium w_ Phenol red _ 100 ml |
100 ml |
71-Eur |
Biosera |
|
| LM-T1706/500 |
Trypsin_EDTA 1X in PBS w_o Calcium w_o Magnesium w_o Phenol Red _ 500 ml |
500 ml |
94-Eur |
Biosera |
|
| 3431-005-01 |
Cultrex BME with phenol red, RGF (3433_005_01 & 3430_50_01) |
5 ml |
237-Eur |
Trevigen |
|
| 3431-005-02 |
Cultrex BME with phenol red, RGF (PC) (3433_005_02 & 3430_50_01) |
5 ml |
246-Eur |
Trevigen |
|
| LM-R1643/500 |
RPMI 1640 w_o L_Glutamine w_o Phenol Red _ 500 ml |
500 ml |
65-Eur |
Biosera |
|
| 1021 |
BROMO PHENOL BLUE SODIUM |
100 gm |
128-Eur |
TitanBiotech |
|
| TM 539 |
PHENOL RED MALTOSE BROTH (for determination of the abilit |
500 gm |
121-Eur |
TitanBiotech |
|
| TM 516 |
CULTURE MEDIUM FOR RWC (as per BIS) (for determination of phenol coefficient of |
500 gm |
121-Eur |
TitanBiotech |
cell culture |
| TM 516 |
CULTURE MEDIUM FOR RWC (as per BIS) (for determination of phenol coefficient of |
100 gm |
74-Eur |
TitanBiotech |
cell culture |
| M83446977 |
4_(2_Methoxyethyl)phenol CAS Number [56718_71_9] |
25 G |
135-Eur |
Molekula |
|
| M64514170 |
4_(1_Adamantyl)phenol CAS Number [29799_07_3] |
1 G |
135-Eur |
Molekula |
|
| TM 255 |
PHENOL RED BROTH BASE (for determination of fermenta |
500 gm |
114-Eur |
TitanBiotech |
|
| N001814 |
Phénol 127x33RL-T3-P21 _ AC Signs;Pack-RL; |
220 Pcs Per Pack |
330-Eur |
Brady |
|
| F 1275 |
RPMI 1640 with 2,0 g_l NaHCO3 without phenol red |
500 ml |
44-Eur |
Biochrom |
|
| P-06720 |
PHENOL CRYSTALS (Carbolic Acid) CAS: 108-95-2 |
500 gm |
110-Eur |
Oxford Lab |
|
| 1021 |
BROMO PHENOL BLUE SODIUM |
5 gm |
63-Eur |
TitanBiotech |
|
| 1021 |
BROMO PHENOL BLUE SODIUM |
25 gm |
77-Eur |
TitanBiotech |
|
| 63659-16-5 |
4_[2_(Cyclopropylmethoxy)ethyl]phenol 4_[2_(Cyclopropylmetho |
1g |
----Eur |
chemotra |
|
| T-08867 |
4-(1.1.3,3-TETRA METHYL BUTYL)PHENOL CAS: 140-66-9 |
250 gm |
178-Eur |
Oxford Lab |
|
| F 0385 |
MEM with Earle's salts without NaHCO3, without phenol red |
500 ml |
46-Eur |
Biochrom |
|
| 20-783-74979 |
MOUSE ANTI HUMAN GUANYLATE CYCLASE BETA 1 (SOLUBLE) - hsGCbeta1; EC 4.6.1.2; GCS-beta-1; Soluble guanylate cyclase small subunit; GCS-beta-3 Monoclonal |
0.2 mg |
380-Eur |
GenWay |
monoclonal |
| E1348h |
ELISA ADCY10,Adenylate cyclase homolog,Adenylate cyclase type 10,AH-related protein,Germ cell soluble adenylyl cyclase,Homo sapiens,hsAC,Human,sAC,SAC,Testicular soluble adenylyl cyclase |
96T |
788-Eur |
EIAab |
|
| E1348h |
ELISA kit ADCY10,Adenylate cyclase homolog,Adenylate cyclase type 10,AH-related protein,Germ cell soluble adenylyl cyclase,Homo sapiens,hsAC,Human,sAC,SAC,Testicular soluble adenylyl cyclase |
96T |
858-Eur |
EIAab |
|
| U1348h |
CLIA ADCY10,Adenylate cyclase homolog,Adenylate cyclase type 10,AH-related protein,Germ cell soluble adenylyl cyclase,Homo sapiens,hsAC,Human,sAC,SAC,Testicular soluble adenylyl cyclase |
96T |
788-Eur |
EIAab |
|
| 18-272-196477 |
soluble TNF Receptor I prediluted - Rabbit polyclonal to soluble TNF Receptor I prediluted; p60; TNF-R1; TNF-RI; TNFR-I; p55; CD120a antigen Polyclonal |
7 ml |
407-Eur |
GenWay |
recombinant |
| 32778-34 |
0.5g/l‐Trypsin/0.53mmol/l‐EDTA Solution, with Phenol Red |
100ML |
118-Eur |
Nacalai |
|
| PC6920 |
Phenol, saturated (pH4.5) pH 4.5±0.2 High Purity Grade |
400ml |
185-Eur |
Bio Basic Inc. |
rat |
| F 1295 |
RPMI 1640 with 2,0 g_l NaHCO3, with 5 mg_l phenol red |
500 ml |
65-Eur |
Biochrom |
|
| 30611009-2 |
DMEM, high gluc w_o L-Glut, Phenol Red |
1 L |
78-Eur |
Bioworld Consulting |
|
| TM 256 |
PHENOL RED DEXTROSE AGAR (for determination of the ability of microorgan |
500 gm |
117-Eur |
TitanBiotech |
|
| 82654-98-6 |
Vanillyl Butyl Ether Phenol, 4-(butoxymethy |
1g |
----Eur |
chemotra |
|
| TM 254 |
PHENOL RED MANNITOL AGAR (for determination of the ability of micr |
500 gm |
125-Eur |
TitanBiotech |
|
| F 1295 |
RPMI 1640 with 2,0 g_l NaHCO3, with 5 mg_l phenol red |
500 ml |
44-Eur |
Biochrom |
|
| 30611009-1 |
DMEM, high gluc w_o L-Glut, Phenol Red |
500 mL |
70-Eur |
Bioworld Consulting |
|
| PMED-015-10 |
DMEM (4,5g_l) Powder without L-Glutamine without phenol red |
10litre |
54-Eur |
SeraLab |
|
| PMED-015-50 |
DMEM (4,5g_l) Powder without L-Glutamine without phenol red |
50litre |
115-Eur |
SeraLab |
|
| TM 256 |
PHENOL RED DEXTROSE AGAR (for determination of the ability of microorgan |
500 gm |
117-Eur |
TitanBiotech |
|
| TM 813 |
PHENOL RED TARTRATE AGAR (for identification and differentiation of Salmon |
100 gm |
106-Eur |
TitanBiotech |
cat |
| 1853-5 |
WHI-P131 4-[(6,7-dimethoxy-4-quinazolinyl)amino]-phenol |
5 mg |
162-Eur |
Biovision |
|
| 1853-25 |
WHI-P131 4-[(6,7-dimethoxy-4-quinazolinyl)amino]-phenol |
25 mg |
405-Eur |
Biovision |
|
| F 0475 |
DMEM with 4,5 g_l D_Glucose, with 3,7 g_l NaHCO3, with Na_pyruvate, without phenol red |
500 ml |
42-Eur |
Biochrom |
|
| 32777-44 |
2.5g_l_ Trypsin_1mmol_l_ EDTA Solution, with Phenol Red |
100 ml |
26-Eur |
Nacalai |
|
| 30611001-1 |
DMEM, high gluc w_ L-Glut w_o Phenol red |
500 mL |
77-Eur |
Bioworld Consulting |
|
| 30611001-2 |
DMEM, high gluc w_ L-Glut w_o Phenol red |
1 L |
87-Eur |
Bioworld Consulting |
|
| 0409 |
Cell Culture Products: HBS w_out Phenol Red, 500 ml |
|
63-Eur |
AthenaES - GENIE Products |
|
| FG 0715 |
Ham's F-10 with 10 mg_l phenol red, with 1,2 g_l NaHCO3, with stable glutamine |
500 ml |
42-Eur |
Biochrom |
|
| 26058-96 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH5.2 |
400 ml |
334-Eur |
Nacalai |
|
| 26058-54 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH5.2 |
100 ml |
142-Eur |
Nacalai |
|
| 25967-16 |
Phenol:Chloroform:Isoamyl Alcohol 25:24:1 Mixed, pH6.7 CAS: |
400ML |
258-Eur |
Nacalai |
|
| 25967-74 |
Phenol:Chloroform:Isoamyl Alcohol 25:24:1 Mixed, pH6.7 CAS: |
100ML |
167-Eur |
Nacalai |
|
| XC-T1716/100 |
Trypsin 2.5 % in PBS w_o Calcium w_o Magnesium w_o Phenol Red _ 100ml |
|
40-Eur |
Biosera |
|
| 26058-96 |
Phenol:Chloroform:Isoamyl Alcohol 25:24:1 Mixed, pH5.2 CAS: |
400ML |
258-Eur |
Nacalai |
|
| 26058-54 |
Phenol:Chloroform:Isoamyl Alcohol 25:24:1 Mixed, pH5.2 CAS: |
100ML |
167-Eur |
Nacalai |
|
| 3433-001-01 |
Cultrex BME, no phenol red, reduced growth factor |
1 ml |
88-Eur |
Trevigen |
|
| 25967-74 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH6.7 |
100 ml |
142-Eur |
Nacalai |
|
| 25970-14 |
Phenol:Chloroform:Isoamyl Alcohol 25:24:1 Mixed, pH7.9 CAS: |
100ML |
167-Eur |
Nacalai |
|
| AM |
Adipocyte Maintenance Medium, WITHOUT Dexamethasone, phenol red free |
500ml |
179-Eur |
ZenBio |
cell culture |
| FG 0815 |
Ham's F-12 with 10 mg_l phenol red, with 1,176 g_l NaHCO3, with stable glutamine |
500 ml |
42-Eur |
Biochrom |
|
| H-04740 |
P-PHENYL PHENOL (Para-Hydroxy Diphenyl) CAS: 92-69-3 |
100 gm |
117-Eur |
Oxford Lab |
|
| H-04740 |
P-PHENYL PHENOL (Para-Hydroxy Diphenyl) CAS: 92-69-3 |
500 gm |
155-Eur |
Oxford Lab |
|
| 25970-56 |
Phenol:Chloroform:Isoamyl Alcohol 25:24:1 Mixed, pH7.9 CAS: |
400ML |
258-Eur |
Nacalai |
|
| 25970-56 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH7.9 |
400 ml |
334-Eur |
Nacalai |
|
| 25970-14 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH7.9 |
100 ml |
142-Eur |
Nacalai |
|
| 25967-16 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH6.7 |
400 ml |
334-Eur |
Nacalai |
|
| 3433-001-02 |
Cultrex BME, no phenol red, reduced growth factor (PC) |
1 ml |
93-Eur |
Trevigen |
|
| TM 811 |
PHENOL RED MALTOSE AGAR (for determination of the ability of microorganisms |
500 gm |
125-Eur |
TitanBiotech |
|
| N650452 |
4-Nonyl Phenol-13C6 Monoethoxylate C1113C6H28O3 CAS: |
2.5 mg |
2325-Eur |
TRC |
|
| D473132 |
4-(3’,6’-Dimethyl-3’-heptyl)phenol-13C6 C913C6H24O CAS: |
5 mg |
1675-Eur |
TRC |
|
| 25970-56 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH7.9 |
400ML |
271-Eur |
Nacalai |
|
| D474260 |
3,5-Dimethyl-4-isothiocyanato-phenol C9H9NOS CAS: 1246818-00-7 |
5 mg |
232-Eur |
TRC |
|
| 25970-14 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH7.9 |
100ML |
176-Eur |
Nacalai |
|
| 25967-16 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH6.7 |
400ML |
271-Eur |
Nacalai |
|
| D473130 |
4-(3’,6’-Dimethyl-3’-heptyl)phenol C15H24O CAS: 142731-63-3 |
10 mg |
232-Eur |
TRC |
|
| 25967-74 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH6.7 |
100ML |
176-Eur |
Nacalai |
|
| 3433-001-01 |
CultrexBME, no phenol red, reduced growth factor |
1 ml |
84-Eur |
Trevigen |
|
| I823300 |
4-[(2-Isopropoxyethoxy)methyl]phenol C12H18O3 CAS: 177034-57-0 |
25 mg |
212-Eur |
TRC |
|
| 3433-005-01 |
CultrexBME, no phenol red, reduced growth factor |
5 ml |
226-Eur |
Trevigen |
|
| TM 819 |
PHENOL RED RAFFINOSE BROTH (for determination of the ability of microorganisms to |
100 gm |
121-Eur |
TitanBiotech |
|
| N650440 |
4-Nonyl Phenol Diethoxylate C19H32O3 CAS: 20427-84-3 |
50 mg |
258-Eur |
TRC |
|
| P318000 |
Phenol, Glass Distilled Under Argon C6H6O CAS: 108-95-2 |
2 kg |
342-Eur |
TRC |
|
| TM 820 |
PHENOL RED RHAMNOSE BROTH (for determination of the ability of microorganis |
100 gm |
179-Eur |
TitanBiotech |
|
| N650432 |
4-Nonyl Phenol-13C6 C913C6H24O CAS: 211947-56-7 |
1 mg |
375-Eur |
TRC |
|
| N650442 |
4-Nonyl Phenol-13C6 Diethoxylate C1313C6H32O3 CAS: |
0.5 mg |
570-Eur |
TRC |
|
| 3433-001-02 |
CultrexBME, no phenol red, reduced growth factor (PC) |
1 ml |
89-Eur |
Trevigen |
|
| 26058-96 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH5.2 |
400ML |
271-Eur |
Nacalai |
|
| H288500 |
2-(2-Heptynylthio)phenol Acetate C15H18O2S CAS: 209125-28-0 |
10 mg |
212-Eur |
TRC |
|
| TM 820 |
PHENOL RED RHAMNOSE BROTH (for determination of the ability of microorganis |
100 gm |
179-Eur |
TitanBiotech |
|
| TM 816 |
PHENOL RED ARABINOSE BROTH (for determination of the ability of microorga |
100 gm |
150-Eur |
TitanBiotech |
|
| B690285 |
2-(tert-Butoxycarbonylaminomethyl)phenol C12H17NO3 CAS: 390427-07-3 |
1 g |
206-Eur |
TRC |
|
| 26058-54 |
Phenol Chloroform Isoamyl Alcohol 25 24 1 Mixed, pH5.2 |
100ML |
176-Eur |
Nacalai |
|
| 3433-010-02 |
CultrexBME, no phenol red, reduced growth factor (PC) |
2 x 5ml |
318-Eur |
Trevigen |
|
| TM 813 |
PHENOL RED TARTRATE AGAR (for identification and differentiation of Salmon |
100 gm |
106-Eur |
TitanBiotech |
cat |
| 1728-1 |
PI-103 3-(4-(4-Morpholinyl)pyrido[3′,2′:4,5]furo[3,2-d]pyrimidin-2-yl)phenol |
1 mg |
131-Eur |
Biovision |
|
| TM 254 |
PHENOL RED MANNITOL AGAR (for determination of the ability of micr |
500 gm |
125-Eur |
TitanBiotech |
|
| A165595 |
4-(2-Acetoxy-ethyl)phenol C10H12O3 CAS: 58556-55-1 |
250 mg |
212-Eur |
TRC |
|
| C988665 |
4-[2-(Cyclopropylmethoxy)ethyl]phenol C12H16O2 CAS: 63659-16-5 |
50 mg |
212-Eur |
TRC |
|
| TM 819 |
PHENOL RED RAFFINOSE BROTH (for determination of the ability of microorganisms to |
100 gm |
121-Eur |
TitanBiotech |
|
| TM 816 |
PHENOL RED ARABINOSE BROTH (for determination of the ability of microorga |
100 gm |
150-Eur |
TitanBiotech |
|
| D470820 |
3-[1-(Dimethylamino)ethyl]phenol C10H15NO CAS: 105601-04-5 |
50 mg |
193-Eur |
TRC |
|
| 32777-44 |
2.5g/l‐Trypsin/1mmol/l‐EDTA Solution, with Phenol Red |
100ML |
118-Eur |
Nacalai |
|
| B684135 |
2-Bromo-5-(1,1-dimethylheptyl)phenol C15H23BrO CAS: 70120-14-8 |
100 mg |
277-Eur |
TRC |
|
| A187500 |
N-Acetylpiperazine-N’-(4-phenol) Ketoconazole C38H42Cl2N6O6 CAS: 1346598-39-7 |
2.5 mg |
277-Eur |
TRC |
|
| PC6910 |
Phenol, saturated (pH7.9) pH 7.9±0.2 High Purity Grade |
|
185-Eur |
Bio Basic Inc. |
rat |
| AM |
Adipocyte Maintenance Medium Phenol Red Free _ WITHOUT Serum |
500ml |
179-Eur |
ZenBio |
cell culture |
| 3433-005-02 |
CultrexBME, no phenol red, reduced growth factor (PC) |
5 ml |
235-Eur |
Trevigen |
|
| M03375 |
P_[[(2_Mercaptobenzimidazol_1_yl)methyl]amino]phenol Dihydrochloride |
5 G |
188-Eur |
pfalslandbauer. |
|
| LM-T1703/100 |
Trypsin 0.25 % in PBS w_o Calcium w_o Magnesium w_ Phenol red _ 100ml |
|
38-Eur |
Biosera |
|
| PMED-014-50 |
DMEM (4,5g_l) Powder without L-Glutamine with Phenol Red |
50litre |
110-Eur |
SeraLab |
|
| LM-R1643/100 |
RPMI 1640 w_o L_Glutamine w_o Phenol Red _ 100ml |
|
55-Eur |
Biosera |
|
| N001950 |
Phénol 450x52CARD-T1-P21 _ AC Signs;Pack-CARD; |
2 Pcs Per Pack |
9-Eur |
Brady |
|
| LM-R1643/500 |
RPMI 1640 w_o L_Glutamine w_o Phenol Red _ 500ml |
|
36-Eur |
Biosera |
|
| PMED-014-10 |
DMEM (4,5g_l) Powder without L-Glutamine with Phenol Red |
5x10litre |
147-Eur |
SeraLab |
|
| C08817 |
4-Chloro-2-amino phenol-6-sulfonic acid 99% |
100 G |
456-Eur |
pfalslandbauer |
|
| PMED-015-10 |
DMEM (4,5g_l) Powder without L-Glutamine without Phenol Red |
5x10litre |
154-Eur |
SeraLab |
|
| C08817 |
4-Chloro-2-amino phenol-6-sulfonic acid 99% |
25 G |
212-Eur |
pfalslandbauer |
|
| B-01832 |
BROMO PHENOL BLUE INDICATOR SOLUTION 0.04% CAS: |
500 ml |
105-Eur |
Oxford Lab |
|
| B-01832 |
BROMO PHENOL BLUE INDICATOR SOLUTION 0.04% |
125 ml |
102-Eur |
Oxford Lab |
|
| PC6920 |
Phenol, saturated (pH4.5) pH 4.5±0.2 High Purity Grade |
400ml |
196-Eur |
BBI Biotech |
rat |
| PC6910 |
Phenol, saturated (pH7.9) pH 7.9±0.2 High Purity Grade |
|
196-Eur |
BBI Biotech |
rat |
| 0409 |
Cell Culture Products HBS w_out Phenol Red, 500 ml |
|
66-Eur |
AthenaES - GENIE Products |
|
| 1728-5 |
PI-103 3-(4-(4-Morpholinyl)pyrido[3′,2′:4,5]furo[3,2-d]pyrimidin-2-yl)phenol |
5 mg |
342-Eur |
Biovision |
|
| H-04740 |
p-HYDROXY DIPHENYL 98% (Para Phenyl Phenol) CAS: 92-69-3 |
500 gm |
155-Eur |
Oxford Lab |
|
| H-04740 |
p-HYDROXY DIPHENYL 98% (Para Phenyl Phenol) CAS: 92-69-3 |
100 gm |
117-Eur |
Oxford Lab |
|
| M03375 |
P_[[(2_Mercaptobenzimidazol_1_yl)methyl]amino]phenol Dihydrochloride |
25 G |
471-Eur |
pfalslandbauer. |
|
| M03375 |
P_[[(2_Mercaptobenzimidazol_1_yl)methyl]amino]phenol Dihydrochloride |
1 G |
113-Eur |
pfalslandbauer. |
|
| N001917 |
Phénol 355x37CARD-T1-P21 _ AC Signs;Pack-CARD; |
3 Pcs Per Pack |
11-Eur |
Brady |
|
| LM-T1706/500 |
Trypsin_EDTA 1X in PBS w_o Calcium w_o Magnesium w_o Phenol Red _ 500ml |
|
61-Eur |
Biosera |
|
| 226831 |
PMFL-Phénol-PR1-37X305 _ AC Signs;Pack-PK; |
3RL-10pc/RL Pcs Per Pack |
97-Eur |
Brady |
|
| C08817 |
4-Chloro-2-amino phenol-6-sulfonic acid 99% |
500 G |
1012-Eur |
pfalslandbauer |
|
| LM-T1706/100 |
Trypsin_EDTA 1X in PBS w_o Calcium w_o Magnesium w_o Phenol Red _ 100ml |
|
36-Eur |
Biosera |
|
| 1063601 |
European Pharmacopoeia Reagent Phenol red solution |
100ml |
67-Eur |
Reagecon |
elisa |
| 1063603 |
European Pharmacopoeia Reagent Phenol red solution R2 |
500ml |
98-Eur |
Reagecon |
elisa |
| 226832 |
PMFL-Phénol-PR1-52X402 _ AC Signs;Pack-PK; |
2RL-15pc/RL Pcs Per Pack |
123-Eur |
Brady |
|
| LM-T1705/500 |
Trypsin_EDTA 1X in PBS w_o Calcium w_o Magnesium w_ Phenol Red _ 500ml |
|
61-Eur |
Biosera |
|
| 226833 |
PMFL-Phénol-PR3-RLL120 _ AC Signs;Pack-RL; |
33 m Pcs Per Pack |
337-Eur |
Brady |
|
| 226834 |
PMFL-Phénol-PR4-RLL120 _ AC Signs;Pack-RL; |
33 m Pcs Per Pack |
337-Eur |
Brady |
|
| LM-T1705/100 |
Trypsin_EDTA 1X in PBS w_o Calcium w_o Magnesium w_ Phenol Red _ 100ml |
|
36-Eur |
Biosera |
|
| SEB268Ra |
ELISA Kit for Phenol Sulfotransferase (PST) Rattus norvegicus (Rat) |
96T |
706-Eur |
USCNLife |
|
| XC-T1726/100 |
Trypsin 2.5 % in HBSS w_o Calcium w_o Magnesium w_o Phenol Red _ 100 ml |
100 ml |
71-Eur |
Biosera |
|
| A3651-100G |
Phenol, Crystalline Ultra Pure CAS: 108-95-2 |
100G |
87-Eur |
Biomatic |
|
| A3651-500G |
Phenol, Crystalline Ultra Pure CAS: 108-95-2 |
500G |
144-Eur |
Biomatic |
|
| 3433-005-01 |
Cultrex BME, no phenol red, reduced growth factor |
5 ml |
237-Eur |
Trevigen |
|
| 10341-45-4 |
2,4_Dimethyl_6_(methylthiomethyl)phenol Dimethyl_6_(methylthio |
1g |
----Eur |
chemotra |
|
| N001851 |
Phénol 150x12CARD-T1-P21 _ AC Signs;Pack-CARD; |
5 Pcs Per Pack |
9-Eur |
Brady |
|
| 226830 |
PMFL-Phénol-PR1-26X200 _ AC Signs;Pack-PK; |
3RL-10pc/RL Pcs Per Pack |
81-Eur |
Brady |
|
| 3433-005-01 |
Cultrex BME, no phenol red, reduced growth factor |
5 ml |
237-Eur |
Trevigen |
|
| 4626-23-7 |
2,5_Dimethyl_6_(methylthiomethyl)phenol Dimethyl_6_(methylthio |
1g |
----Eur |
chemotra |
|
| 3433-005-02 |
Cultrex BME, no phenol red, reduced growth factor (PC) |
5 ml |
246-Eur |
Trevigen |
|
| TM 811 |
PHENOL RED MALTOSE AGAR (for determination of the ability of microorganisms |
500 gm |
125-Eur |
TitanBiotech |
|
| 25-503C |
DMEM_Ham's F-12, No Phenol Red w_ L-glutamine & 15mM HEPES |
6 x 500ml/Unit |
110-Eur |
Genesee |
|
| N001884 |
Phénol 250x26CARD-T1-P21 _ AC Signs;Pack-CARD; |
4 Pcs Per Pack |
11-Eur |
Brady |
|
| SEB268Mu |
ELISA Kit for Phenol Sulfotransferase (PST) Mus musculus (Mouse) |
96T |
675-Eur |
USCNLife |
|
| PMED-014-10 |
DMEM (4,5g_l) Powder without L-Glutamine with Phenol Red |
10litre |
53-Eur |
SeraLab |
|
| 25-510X |
0.5% Trypsin-EDTA Solution,10X No Phenol Red, Sterile |
6 x 100ml/Unit |
136-Eur |
Genesee |
|
| orb80584 |
Human Soluble RANK Ligand GST tag protein RANKL Human Recombinant fused to GST tag produced in E.coli is a single, non-glycosylated polypeptide having a molecular mass of 47 kDa. RANKL is purified by |
2 |
154-Eur |
Biorb |
recombinant |
| 20-783-74978 |
MOUSE ANTI GUANYLATE CYCLASE ALPHA 1 (SOLUBLE) - hs-GC-alpha1; EC 4.6.1.2; GCS-alpha-3; Soluble guanylate cyclase large subunit; GCS-alpha-1 Monoclonal |
0.2 mg |
380-Eur |
GenWay |
monoclonal |
| orb80418 |
Human Soluble IIL2 Receptor alpha GST tag protein IL-2R Human Recombinant full length protein expressed in E.coli, shows 53 kDa band on SDS-PAGE (Including GST tag). The IL-2R is purified by proprieta |
2 |
277-Eur |
Biorb |
recombinant |
| XC-S2065/100 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| D470822 |
3-[1-[Di(methyl-d3)amino]ethyl]phenol C10H9D6NO CAS: 194930-03-5 |
1 mg |
193-Eur |
TRC |
|
| 2073-5 |
Pterostilbene 4-[(E)-2-(3,5-Dimethoxyphenyl)ethenyl]phenol; 3',5'-Dimethoxy-4-stilbenol |
5 mg |
108-Eur |
Biovision |
|
| 1655-2 |
GSK-3β Inhibitor, TWS119 3-[[6-(3-Aminophenyl)-1H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]-phenol |
2 mg |
162-Eur |
Biovision |
|
| D473115 |
4-(3’,6’-Dimethyl-3’-heptyl)phenol Monoethoxylate C17H28O2 CAS: 1119449-37-4 |
100 mg |
193-Eur |
TRC |
|
| H825390 |
4-{1-Hydroxy-2-[3-(4-hydroxyphenyl)-5-methylcyclohexylamino]ethyl}phenol C21H27NO3 CAS: |
25 mg |
245-Eur |
TRC |
|
| LF-P0049 |
Catecholamine-Sulfating Phenol Sulfotransferase, Human , Protein |
0.25 mg |
298-Eur |
Abfrontier |
|
| F 0465 |
Iscove's Medium, not compl., with 15 mg_l phenol red, with 3,024 g_l NaHCO3 |
500 ml |
46-Eur |
Biochrom |
cell culture |
| D416325 |
4-(2,4-Diamino-6-ethyl-5-pyrimidinyl)-phenol C12H14N4O CAS: 1397693-25-2 |
100 mg |
245-Eur |
TRC |
|
| D492060 |
2-(4,6-Diphenyl-1,3,5-triazine-2-yl)-5-[(hexyl)oxy]phenol C27H27N3O2 CAS: 147315-50-2 |
10 g |
206-Eur |
TRC |
|
| F595722 |
4-{[(p-Fluorophenyl)imino]methyl}phenol-d4 C13H6D4FNO CAS: 1185243-77-9 |
10 mg |
212-Eur |
TRC |
|
| H-04722 |
HYDROQUINONE MONO METHYL ETHER 99% (4-Methoxy Phenol) CAS: 150-76-5 |
100 gm |
117-Eur |
Oxford Lab |
|
| D473135 |
4-(3’,6’-Dimethyl-3’-heptyl)phenol Diethoxylate C19H32O3 CAS: 1119449-38-5 |
10 mg |
232-Eur |
TRC |
|
| MED-248 |
DMEM (45g_l) High Glucose Liquid without Phenol Red, without L-Glutamine |
500ml |
38-Eur |
SeraLab |
|
| 2073-25 |
Pterostilbene 4-[(E)-2-(3,5-Dimethoxyphenyl)ethenyl]phenol; 3',5'-Dimethoxy-4-stilbenol |
25 mg |
279-Eur |
Biovision |
|
| LM-S2034/100 |
Hanks' Balanced Salts Solution w_o Ca w_o Mg w_o Na Bicarbonate w_o Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| 36300 |
Screen Quest™ 10X cell staining buffer with Phenol Red Plus™ |
10 Plates |
108-Eur |
AAT Bioquest |
Cells |
| P2077 |
Phenol Chloroform Isoamyl alcohol 25 24 1 pH 4.9_5.5+0.2 . ( v_v). Biotech Grade |
400ml |
177-Eur |
BBI Biotech |
|
| 36301 |
Screen Quest™ 10X calcium assay buffer with Phenol Red Plus™ |
10 Plates |
108-Eur |
AAT Bioquest |
elisa |
| XC-S2065/500 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 500 ml |
500 ml |
71-Eur |
Biosera |
|
| XC-S2062/500 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_o Phenol Red _ 500 ml |
500 ml |
71-Eur |
Biosera |
|
| LM-S2034/500 |
Hanks' Balanced Salts Solution w_o Ca w_o Mg w_o Na Bicarbonate w_o Phenol Red _ 500 ml |
500 ml |
71-Eur |
Biosera |
|
| XC-S2062/100 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_o Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| XC-S2063/100 |
HBSS 10X w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| XC-S2063/500 |
HBSS 10X w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 500 ml |
500 ml |
71-Eur |
Biosera |
|
| D473117 |
4-(3’,6’-Dimethyl-3’-heptyl)phenol Monoethoxylate-13C6 C1113C6H28O2 CAS: |
5 mg |
2325-Eur |
TRC |
|
| C-02664 |
CHLORO PHENOL RED INDICATOR 99% AR (pH 4.8-6.4 Yellow To Purple) CAS: 4430-20-0 |
5 gm |
110-Eur |
Oxford Lab |
|
| C-02664 |
CHLORO PHENOL RED INDICATOR 99% AR (pH 4.8-6.4 Yellow To Purple) CAS: 4430-20-0 |
25 gm |
139-Eur |
Oxford Lab |
|
| C-02664 |
CHLORO PHENOL RED INDICATOR 99% AR (pH 4.8-6.4 Yellow To Purple) CAS: 4430-20-0 |
100 gm |
230-Eur |
Oxford Lab |
|
| MED-249 |
DMEM (45g_l) High Glucose Liquid without Phenol Red, with L-Glutamine |
500ml |
38-Eur |
SeraLab |
|
| XC-S2064/500 |
HBSS 10X w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 500 ml |
500 ml |
71-Eur |
Biosera |
|
| XC-S2064/100 |
HBSS 10X w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| M265000 |
2-Methoxy-4-(2-nitro-1-propenyl)phenol C10H11NO4 CAS: 5395-47-1 |
500 mg |
232-Eur |
TRC |
|
| 479458-0000 |
Short Stem Outlet Tube for Phenol |
Case Qty:1 x 10 |
206-Eur |
Kleinfeld Labortechnik |
|
| PM-B2090/1 |
Hanks' Balanced Salts w_o Ca w_o Mg w_o Na Bicarbonate w_o Phenol Red _ powder for 1L |
|
33-Eur |
Biosera |
|
| L 2055 |
Hanks' salt solution (HBSS) without Ca2+, Mg2+, with phenol red, with 0,35 g_l NaHCO3 |
500 ml |
42-Eur |
Biochrom |
|
| 2460 |
Phenol Red, sodium salt *Cell culture tested* |
50 g |
202-Eur |
AAT Bioquest |
assays |
| 36300 |
Screen Quest™ 10X cell staining buffer with Phenol Red Plus™ |
10 Plates |
108-Eur |
AAT Bioquest |
Cells |
| A16390 |
Aluminum phenol sulfonate octahydrate Tech. Grade |
500 G |
340-Eur |
pfalslandbauer. |
rat |
| PM-B2090/10 |
Hanks' Balanced Salts w_o Ca w_o Mg w_o Na Bicarbonate w_o Phenol Red - powder for 10L |
|
47-Eur |
Biosera |
|
| 05177-15 |
DMEM_Ham's F‐12 with L‐Gln, Sodium Pyruvate and HEPES, without Phenol Red, liquid CAS: |
500ML |
118-Eur |
Nacalai |
|
| A611870 |
4-Amino-2-mercapto-phenol Hydrochloride C6H8ClNOS CAS: 98140-58-0 |
1 g |
232-Eur |
TRC |
|
| L 2055 |
Hanks' salt solution (HBSS) without Ca2+, Mg2+, with phenol red, with 0,35 g_l NaHCO3 |
500 ml |
64-Eur |
Biochrom |
|
| L 2045 |
Hanks' salt solution (HBSS) without Ca2+,Mg2+, without phenol red, with 0,35 g_l NaHCO3 |
500 ml |
64-Eur |
Biochrom |
|
| L 2035 |
Hanks' salt solution (HBSS) without phenol red, with 0,35 g_l NaHCO3 |
500 ml |
64-Eur |
Biochrom |
|
| FG 0815 |
Ham's F_12 with 10 mg_l phenol red, with 1,176 g_l NaHCO3, with stable glutamine |
500 ml |
64-Eur |
Biochrom |
|
| FG 0715 |
Ham's F_10 with 10 mg_l phenol red, with 1,2 g_l NaHCO3, with stable glutamine |
500 ml |
64-Eur |
Biochrom |
|
| SEB268Hu |
ELISA Kit for Phenol Sulfotransferase (PST) Homo sapiens (Human) |
96T |
659-Eur |
USCNLife |
|
| 05177-15 |
DMEM/Ham's F‐12 with L‐Gln, Sodium Pyruvate and HEPES, without Phenol Red, liquid |
500ML |
123-Eur |
Nacalai |
|
| 08489-45 |
DMEM(4.5g/l Glucose) without L‐Gln, Sodium Pyruvate and Phenol Red, liquid |
500ML |
115-Eur |
Nacalai |
|
| 08490-05 |
DMEM(1.0g/l Glucose) with Sodium Pyruvate, without L‐Gln and Phenol Red, liquid |
500ML |
115-Eur |
Nacalai |
|
| LM-R1650/10 |
RPMI 1640 w_ L_Glutamine w_o Sodium Bicarbonate w_o Phenol Red _ For 10L |
For 10L |
77-Eur |
Biosera |
|
| LM-R1650/1 |
RPMI 1640 w_ L_Glutamine w_o Sodium Bicarbonate w_o Phenol Red _ For 1L |
For 1L |
65-Eur |
Biosera |
|
| XC-T1726/100 |
Trypsin 2.5 % in HBSS w_o Calcium w_o Magnesium w_o Phenol Red _ 100ml |
|
38-Eur |
Biosera |
|
| 05177-15 |
DMEM_Ham's F_ 12 with L_ Gln, Sodium Pyruvate and HEPES, without Phenol Red, liquid |
500 ml |
39-Eur |
Nacalai |
|
| 68527-76-4 |
Phenol 2-Ethoxy-4(4-Methyl-1,3-Dioxola Ethylvanillin propylene |
1g |
----Eur |
chemotra |
|
| LM-R1647/10 |
RPMI 1640 w_o L_Glutamine w_o Sodium Bicarbonate w_o Phenol Red _ For 10L |
For 10L |
88-Eur |
Biosera |
|
| LM-R1646/1 |
RPMI 1640 w_o L_Glutamine w_o Sodium Bicarbonate w_o Phenol Red _ For 1L |
For 1L |
65-Eur |
Biosera |
|
| A16390 |
Aluminum phenol sulfonate octahydrate Tech. Grade |
100 G |
152-Eur |
pfalslandbauer. |
rat |
| H-04722 |
4-METHOXY PHENOL (Hydeoquinone Mono Mehtyl Ether 99%) CAS: 107-13-1 |
250 gm |
149-Eur |
Oxford Lab |
|
| L 2045 |
Hanks' salt solution (HBSS) without Ca2+,Mg2+, without phenol red, with 0,35 g_l NaHCO3 |
500 ml |
42-Eur |
Biochrom |
|
| LM-I1094/1 |
Iscove's Modified DMEM w_ L_Glutamine w_ 25 mM Hepes w_o Phenol Red _ For 1L |
For 1L |
71-Eur |
Biosera |
|
| L 2035 |
Hanks' salt solution (HBSS) without phenol red, with 0,35 g_l NaHCO3 |
500 ml |
42-Eur |
Biochrom |
|
| E91268Mu |
ELISA Kit for Phenol Sulfotransferase (PST) Organism: Mus musculus (Mouse) |
96T |
618-Eur |
USCNLife |
|
| P2077 |
Phenol Chloroform Isoamyl alcohol 25 24 1 pH 4.9_5.5+0.2 . ( v_v). Biotech Grade |
400ml |
167-Eur |
Bio Basic Inc. |
|
| MED-248 |
DMEM (4.5g_l) High Glucose Liquid without Phenol Red, without L-Glutamine |
500ml |
39-Eur |
SeraLab |
|
| E91268Ra |
ELISA Kit for Phenol Sulfotransferase (PST) Organism: Rattus norvegicus (Rat) |
96T |
647-Eur |
USCNLife |
|
| LM-R1646/1 |
RPMI 1640 w_o L_Glutamine w_o Sodium Bicarbonate w_o Phenol Red _ For 1L |
|
34-Eur |
Biosera |
|
| LM-R1650/1 |
RPMI 1640 w_ L_Glutamine w_o Sodium Bicarbonate w_o Phenol Red _ For 1L |
|
33-Eur |
Biosera |
|
| D473137 |
4-(3’,6’-Dimethyl-3’-heptyl)phenol diethoxylate-13C6 C1313C6H32O3 CAS: |
2.5 mg |
1675-Eur |
TRC |
|
| H-04722 |
HYDROQUINONE MONO METHYL ETHER 99% (4-Methoxy Phenol) CAS: 150-76-5 |
250 gm |
134-Eur |
Oxford Lab |
|
| LM-R1647/10 |
RPMI 1640 w_o L_Glutamine w_o Sodium Bicarbonate w_o Phenol Red _ For 10L |
|
55-Eur |
Biosera |
|
| B429900 |
2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(octyloxy)phenol C33H39N3O2 CAS: 2725-22-6 |
1 g |
206-Eur |
TRC |
|
| UTB32 |
Nonyl Phenol , Mouse monoclonal Ab, sensitivity: 1ng_mL |
mg |
1400-Eur |
Unibio |
|
| PM-B2090/1 |
Hanks' Balanced Salts w_o Ca w_o Mg w_o Na Bicarbonate w_o Phenol Red _ powder for 1L |
for 1L |
65-Eur |
Biosera |
|
| A618475 |
2-Amino-5-nitro-4-(trifluoromethyl)phenol (FLU-3) C7H5F3N2O3 CAS: 56987-02-1 |
2.5 mg |
232-Eur |
TRC |
|
| 2460 |
Phenol Red, sodium salt *Cell culture tested* |
50 g |
202-Eur |
AAT Bioquest |
assays |
| 36301 |
Screen Quest™ 10X calcium assay buffer with Phenol Red Plus™ |
10 Plates |
108-Eur |
AAT Bioquest |
elisa |
| LM-I1094/1 |
Iscove's Modified DMEM w_ L_Glutamine w_ 25 mM Hepes w_o Phenol Red _ For 1L |
|
60-Eur |
Biosera |
|
| LM-R1650/10 |
RPMI 1640 w_ L_Glutamine w_o Sodium Bicarbonate w_o Phenol Red _ For 10L |
|
44-Eur |
Biosera |
|
| MED-248 |
DMEM (4.5g_l) High Glucose Liquid without Phenol Red, without L-Glutamine |
5x500ml |
69-Eur |
SeraLab |
|
| MED-249 |
DMEM (4.5g_l) High Glucose Liquid without Phenol Red, with L-Glutamine |
5x500ml |
69-Eur |
SeraLab |
|
| A628830 |
2-(4-Amino-1H-pyrazolo[3,4-d]pyrimidin-3-yl)-phenol C11H9N5O CAS: 1092787-78-4 |
2.5 mg |
277-Eur |
TRC |
|
| MED-249 |
DMEM (4.5g_l) High Glucose Liquid without Phenol Red, with L-Glutamine |
500ml |
39-Eur |
SeraLab |
|
| 32778-34 |
0.5g_l_ Trypsin_0.53mmol_l_ EDTA Solution, with Phenol Red |
100 ml |
26-Eur |
Nacalai |
|
| H-04722 |
4-METHOXY PHENOL (Hydeoquinone Mono Mehtyl Ether 99%) CAS: 107-13-1 |
100 gm |
123-Eur |
Oxford Lab |
|
| CSB-PA012888GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 3 binding protein polyclonal Antibody Primary antibody Host:Antigen Affinity Purified PBS with 0.1% Sodium Azide, 50% Glycerol, pH 7.3. -20oC, |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA012888GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 3 binding protein polyclonal Antibody Primary antibody Host:Antigen Affinity Purified PBS with 0.1% Sodium Azide, 50% Glycerol, pH 7.3. -20oC, |
50ul |
425-Eur |
Cusabio |
|
| LM-S2034/100 |
Hanks' Balanced Salts Solution w_o Ca w_o Mg w_o Na Bicarbonate w_o Phenol Red _ 100ml |
|
56-Eur |
Biosera |
|
| 08489-45 |
DMEM(4.5g_l Glucose) without L‐Gln, Sodium Pyruvate and Phenol Red, liquid CAS: |
500ML |
111-Eur |
Nacalai |
|
| TM 516 |
DISINFECTANT TEST BROTH (CULTURE MEDIUM FOR RWC) (as per BIS) (for determination of phenol coefficient of d |
100 gm |
75-Eur |
TitanBiotech |
assays |
| 2047-5 |
Sphingosine Kinase Inhibitor, SKI-II 4-[[4-(4-Chlorophenyl)-2-thiazolyl]amino]phenol |
5 mg |
135-Eur |
Biovision |
|
| 08490-05 |
DMEM(1.0g_l Glucose) with Sodium Pyruvate, without L‐Gln and Phenol Red, liquid CAS: |
500ML |
111-Eur |
Nacalai |
|
| LM-S2031/500 |
Earle's Balanced Salts w_o Calcium w_o Magnesium w_o Phenol Red _ 500 ml _ NOW A0444 |
500 ml |
71-Eur |
Biosera |
|
| LM-R1648/1 |
RPMI 1640 w_ L_ Glutamine w_o Sodium Bicarbonate w_ 25 mM Hepes w_o Phenol Red _ For 1L |
For 1L |
65-Eur |
Biosera |
|
| 2047-25 |
Sphingosine Kinase Inhibitor, SKI-II 4-[[4-(4-Chlorophenyl)-2-thiazolyl]amino]phenol |
25 mg |
387-Eur |
Biovision |
|
| LM-S2034/500 |
Hanks' Balanced Salts Solution w_o Ca w_o Mg w_o Na Bicarbonate w_o Phenol Red _ 500ml |
|
38-Eur |
Biosera |
|
| LM-S2031/100 |
Earle's Balanced Salts w_o Calcium w_o Magnesium w_o Phenol Red _ 100 ml _ NOW A0444 |
100 ml |
65-Eur |
Biosera |
|
| E91268Hu |
ELISA Kit for Phenol Sulfotransferase (PST) Organism: Homo sapiens (Human) |
96T |
604-Eur |
USCNLife |
|
| 25-501P |
DMEM w_ high-glucose, L-glut & no Sodium Pyruvate or Phenol R |
6 x 500ml/Unit |
91-Eur |
Genesee |
|
| XC-S2064/100 |
HBSS 10X w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 100ml |
|
57-Eur |
Biosera |
|
| 68527-74-2 |
Phenol, 2-methoxy-4-(4-methyl-1,3-dioxo Vanillin propylene glyco |
1g |
----Eur |
chemotra |
|
| LM-R1648/10 |
RPMI 1640 w_ L- Glutamine w_o Sodium Bicarbonate w_ 25 mM Hepes w_o Phenol Red - For 10L |
|
62-Eur |
Biosera |
|
| PD0419 |
Phenol Chloroform Isoamyl alcohol 25 24 1 Premixed . ( v_v). Biotech Grade |
400ml |
165-Eur |
Bio Basic Inc. |
|
| B478 |
RWC Medium USE : For determination of phenol coefficients of disinfectants using S.typhi as per ISI specifications. |
5x500gm |
277-Eur |
biomarkt |
|
| TM 516 |
DISINFECTANT TEST BROTH (CULTURE MEDIUM FOR RWC) (as per BIS) (for determination of phenol coefficient of d |
100 gm |
75-Eur |
TitanBiotech |
assays |
| LM-R1648/1 |
RPMI 1640 w_ L_ Glutamine w_o Sodium Bicarbonate w_ 25 mM Hepes w_o Phenol Red _ For 1L |
|
36-Eur |
Biosera |
|
| 3431-001-01 |
CultrexBME with phenol red, reduced growth factor (3433-001-01 & 3430-50-01) |
1 ml |
84-Eur |
Trevigen |
|
| DM |
Adipocyte Differentiation Medium, WITHOUT PPAR gamma agonist,phenol red free |
100ml |
179-Eur |
ZenBio |
cell culture |
| B478 |
RWC Medium USE For determination of phenol coefficients of disinfectants using S.typhi as per ISI specifications. |
Qty per Litre of Medium: 50 |
3-Eur |
biomarkt |
cell culture |
| XC-S2062/100 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_o Phenol Red _ 100ml |
|
57-Eur |
Biosera |
|
| XC-S2062/500 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_o Phenol Red _ 500ml |
|
40-Eur |
Biosera |
|
| M-05995 |
METOL 99% (Photographic Grade) (4-Methyl Amino Phenol Sulphate) CAS: 55-55-0 |
500 gm |
183-Eur |
Oxford Lab |
|
| XC-S2065/100 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 100ml |
|
56-Eur |
Biosera |
|
| XC-S2065/500 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 500ml |
|
40-Eur |
Biosera |
|
| XC-S2063/500 |
HBSS 10X w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 500ml |
|
40-Eur |
Biosera |
|
| 3431-001-01 |
Cultrex BME with phenol red, reduced growth factor (3433_001_01 & 3430_50_01) |
1 ml |
88-Eur |
Trevigen |
|
| 08489-45 |
DMEM(4.5g_l Glucose) without L_ Gln, Sodium Pyruvate and Phenol Red, liquid |
500 ml |
23-Eur |
Nacalai |
|
| 08490-05 |
DMEM(1.0g_l Glucose) with Sodium Pyruvate, without L_ Gln and Phenol Red, liquid |
500 ml |
23-Eur |
Nacalai |
|
| XC-S2063/100 |
HBSS 10X w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 100ml |
|
57-Eur |
Biosera |
|
| XC-S2064/500 |
HBSS 10X w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 500ml |
|
40-Eur |
Biosera |
|
| M-05995 |
METOL 99% (Photographic Grade) (4-Methyl Amino Phenol Sulphate) CAS: 55-55-0 |
100 gm |
118-Eur |
Oxford Lab |
|
| A187490 |
4-(N-Acetyl)piperidinyl 2-(5-Methoxy)phenol Ketone C15H19NO4 CAS: 64671-18-7 |
100 mg |
232-Eur |
TRC |
|
| M265310 |
2-(5-Methoxy)phenol 4-(N-Benzyloxycarbonyl)piperidinyl Ketone C21H23NO5 CAS: 84162-91-4 |
25 mg |
193-Eur |
TRC |
|
| PD0419 |
Phenol Chloroform Isoamyl alcohol 25 24 1 Premixed . ( v_v). Biotech Grade |
400ml |
175-Eur |
BBI Biotech |
|
| P550705 |
1-Pivaloyl-4,4',4''-(1-ethyl-1-ethenyl-2-ylidene)tris-phenol C27H28O4 CAS: |
100 mg |
245-Eur |
TRC |
|
| 1239 |
PHENOL RED SUCROSE BROTH Dehydrated Culture Media for Microbiology |
500 grams |
66-Eur |
Condalab |
|
| 1115 |
PHENOL RED BROTH BASE Dehydrated Culture Media for Microbiology |
500 grams |
66-Eur |
Condalab |
|
| PD0252 |
Phenol, (Carbolic acid ) Double distilled for Molecular Biology |
500G |
121-Eur |
Bio Basic Inc. |
|
| PD0252 |
Phenol, (Carbolic acid ) Double distilled for Molecular Biology |
500G |
129-Eur |
BBI Biotech |
|
| M271650
|
[R,R-(E)]-4-Methoxy-2,3,6-trimethyl-5-(3,7,11,15-tetramethyl-2-hexadecenyl)phenol
C30H52O2 CAS: 86993-71-7
|
10 mg |
2130-Eur |
TRC |
|
| 1235 |
PHENOL RED DEXTROSE BROTH Dehydrated Culture Media for Microbiology |
500 grams |
61-Eur |
Condalab |
|
| T293865 |
cis-4-(1,2,3,4-Tetrahydro-6-methoxy-2-phenyl-1-naphthalenyl)phenol C23H22O2 CAS: 14089-22-6 |
25 mg |
245-Eur |
TRC |
|
| HCM086 |
Brilliant Green, Phenol Red, Lactose Monohydrate, Sucrose Agar) |
500g |
----Eur |
HKM |
|
| E91268Hu |
ELISA Kit for Phenol Sulfotransferase (PST) Organism Homo sapiens (Human) |
96T |
639-Eur |
USCNLife |
elisa |
| TM 823 |
PHENOL RED TREHALOSE BROTH (for determination of the ability of microorganisms to ferment treh |
100 gm |
179-Eur |
TitanBiotech |
|
| TM 823 |
PHENOL RED TREHALOSE BROTH (for determination of the ability of microorganisms to ferment treh |
100 gm |
179-Eur |
TitanBiotech |
|
| M265340 |
2-(5-Methoxy)phenol 4-Piperidinyl Ketone Hydrochloride C13H18ClNO3 CAS: 84162-88-9 |
50 mg |
232-Eur |
TRC |
|
| M320102 |
4-[(2-Methyl-1-isopropyl-d6)pentyl]phenol
(Mixture of Diastereomers) C15H18D6O CAS: |
2.5 mg |
232-Eur |
TRC |
|
| T293500 |
4-[[1,2,5,6-Tetrahydro-3,4-dimethyl-1-(phenylethyl)-2-pyridinyl]methyl]phenol C22H27NO CAS: |
25 mg |
232-Eur |
TRC |
|
| 1023 |
PHENOL RED DEXTROSE AGAR Dehydrated Culture Media for Microbiology |
500 grams |
71-Eur |
Condalab |
|
| MED-207 |
DMEM (45g_l) High Glucose Liquid with Sodium Pyruvate without L-Glutamine with Phenol Red |
500ml |
37-Eur |
SeraLab |
|
| XC-S2064/1000 |
HBSS 10X w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 1000ml |
|
73-Eur |
Biosera |
|
| LM-S2031/1000 |
Earle's Balanced Salts w_o Calcium w_o Magnesium w_o Phenol Red _ 1000ml |
|
72-Eur |
Biosera |
|
| B-01915 |
BUTYLATED HYDROXY ANISOLE 98 % (B.H.A) (Z-Tert-Butyl-4-Methoxy Phenol) CAS: 25013-16-3 |
10 x100 gm |
266-Eur |
Oxford Lab |
|
| B-01915 |
BUTYLATED HYDROXY ANISOLE 98 % (B.H.A) (Z-Tert-Butyl-4-Methoxy Phenol) CAS: 25013-16-3 |
100 gm |
123-Eur |
Oxford Lab |
|
| MED-207 |
DMEM (4.5g_l) High Glucose Liquid with Sodium Pyruvate without L-Glutamine with Phenol Red |
5x500ml |
62-Eur |
SeraLab |
|
| LM-S2031/100 |
Earle's Balanced Salts w_o Calcium w_o Magnesium w_o Phenol Red _ 100ml _ NOW A0444 |
|
58-Eur |
Biosera |
|
| FG 0465 |
Iscove's Medium, not compl., with 15 mg_l phenol red, with 3,024 g_l NaHCO3, with stab. Glutamin |
500 ml |
68-Eur |
Biochrom |
cell culture |
| FG 0465 |
Iscove's Medium, not compl., with 15 mg_l phenol red, with 3,024 g_l NaHCO3, with stab. glutamine |
500 ml |
46-Eur |
Biochrom |
cell culture |
| LM-S2031/500 |
Earle's Balanced Salts w_o Calcium w_o Magnesium w_o Phenol Red _ 500ml _ NOW A0444 |
|
62-Eur |
Biosera |
|
| B-01915 |
BUTYLATED HYDROXY ANISOLE 98 % (B.H.A) (Z-Tert-Butyl-4-Methoxy Phenol) CAS: 25013-16-3 |
500 gm |
168-Eur |
Oxford Lab |
|
| B-01915 |
BUTYLATED HYDROXY ANISOLE 98 % (B.H.A) (Z-Tert-Butyl-4-Methoxy Phenol) CAS: 25013-16-3 |
5 x 500 gm |
350-Eur |
Oxford Lab |
|
| XC-S2062/1000 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_o Phenol Red _ 1000ml |
|
73-Eur |
Biosera |
|
| FAMIK001 |
miRNA Isola6on Kit Rxns 100 Lysis Buffer_ 10 ml Acid]Phenol]10 ml RNA Column |
1 kit |
474-Eur |
Favorgen - plastics |
assays |
| 201-20-5698 |
SULT1A1{sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| 201-20-6742 |
SULT1A1{sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1}mouse.mAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| LM-S2040/500 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 500 ml |
500 ml |
71-Eur |
Biosera |
|
| RPP11-10LT |
Cell Culture Media,RPMI 1640 With L-glutamine. No phenol red. |
10L |
60-Eur |
Caisson Laboratory |
|
| TM 516 |
DISINFECTANT TEST BROTH (CULTURE MEDIUM FOR RWC) (as per BIS) (for determination of phenol coefficient of disin |
500 gm |
121-Eur |
TitanBiotech |
assays |
| TM 814 |
PHENOL RED BROTH BASE W_ MEAT EXTRACT (basal medium for determination of fermentation of |
500 gm |
114-Eur |
TitanBiotech |
cell culture |
| RPP11-50LT |
Cell Culture Media,RPMI 1640 With L-glutamine. No phenol red. |
50L |
72-Eur |
Caisson Laboratory |
|
| M320100 |
4-[(2-Methyl-1-isopropyl)pentyl]phenol
(Mixture of Diastereomers) C15H24O CAS: 1158978-65-4 |
50 mg |
206-Eur |
TRC |
|
| 201-20-5699 |
SULT1A3{sulfotransferase family, cytosolic, 1A, phenol-preferring, member 3}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| 201-20-5700 |
SULT1A4{sulfotransferase family, cytosolic, 1A, phenol-preferring, member 3}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| TM 814 |
PHENOL RED BROTH BASE W_ MEAT EXTRACT (basal medium for determination of fermentation of |
500 gm |
114-Eur |
TitanBiotech |
cell culture |
| LM-S2037/100 |
Hanks' Balanced salts w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| LM-S2037/500 |
Hanks' Balanced salts w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 500 ml |
500 ml |
71-Eur |
Biosera |
|
| TM 516 |
DISINFECTANT TEST BROTH (CULTURE MEDIUM FOR RWC) (as per BIS) (for determination of phenol coefficient of disin |
500 gm |
121-Eur |
TitanBiotech |
assays |
| TM 1626 |
TRYPTONE SOYA BROTH WITH PHENOL RED (sterility and general purpose medium and als |
500 gm |
86-Eur |
TitanBiotech |
cell culture |
| LM-S2039/100 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| LM-S2036/100 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| LM-S2039/500 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 500 ml |
500 ml |
65-Eur |
Biosera |
|
| M265320 |
(Z)-2-(5-Methoxy)phenol 4-(N-Benzyloxycarbonyl)piperidinyl-methanone Oxime C21H24N2O5 CAS: 84163-00-8 |
25 mg |
232-Eur |
TRC |
|
| M265315 |
(E)-2-(5-Methoxy)phenol 4-(N-Benzyloxycarbonyl)piperidinyl-methanone Oxime C21H24N2O5 CAS: 84163-47-3 |
10 mg |
245-Eur |
TRC |
|
| LM-S2040/100 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| LM-S2036/500 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 500 ml |
500 ml |
65-Eur |
Biosera |
|
| TM 1626 |
TRYPTONE SOYA BROTH WITH PHENOL RED (sterility and general purpose medium and als |
500 gm |
86-Eur |
TitanBiotech |
cell culture |
| LM-S2035/500 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 500 ml |
500 ml |
65-Eur |
Biosera |
|
| LM-S2035/100 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 100 ml |
100 ml |
65-Eur |
Biosera |
|
| 1379 |
PHENOL RED SALINE LACTOSE BROTH Dehydrated Culture Media for Microbiology |
500 grams |
87-Eur |
Condalab |
|
| RPP11-10X1LT |
Cell Culture Media,RPMI 1640 With L-glutamine. No phenol red. |
10 x 1 L |
66-Eur |
Caisson Laboratory |
|
| HFL05-500ML |
Cell Culture Media,Ham's F-12 Nutrient Mixtures,Ham's F-12 With L-glutamine. No phenol red. |
500ml |
59-Eur |
Caisson Laboratory |
|
| MD-14-0366P |
Soluble Transferrin Receptor Transferrin Receptor, Soluble Proteins |
100 |
931-Eur |
Ray Biotech |
|
| LM-S2040/100 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 100ml |
|
55-Eur |
Biosera |
|
| LM-S2039/500 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 500ml |
|
35-Eur |
Biosera |
|
| FG 1383 |
RPMI 1640 with 2,0 g_l NaHCO3, 25 mM HEPES, 5,5 g_l NaCl, 5 mg_l phenol red, stable glutamine |
100 ml |
37-Eur |
Biochrom |
|
| LM-S2039/100 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 100ml |
|
55-Eur |
Biosera |
|
| LM-S2040/500 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 500ml |
|
36-Eur |
Biosera |
|
| LM-S2037/500 |
Hanks' Balanced salts w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 500ml |
|
40-Eur |
Biosera |
|
| LM-S2037/100 |
Hanks' Balanced salts w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 100ml |
|
58-Eur |
Biosera |
|
| LM-S2036/500 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 500ml |
|
35-Eur |
Biosera |
|
| FG 1385 |
RPMI 1640 with 2,0 g_l NaHCO3, 25 mM HEPES, 5,5 g_l NaCl, 5 mg_l phenol red, stable glutamine |
500 ml |
46-Eur |
Biochrom |
|
| LM-S2036/100 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 100ml |
|
55-Eur |
Biosera |
|
| LM-S2035/100 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 100ml |
|
54-Eur |
Biosera |
|
| FG 1385 |
RPMI 1640 with 2,0 g_l NaHCO3, 25 mM HEPES, 5,5 g_l NaCl, 5 mg_l phenol red, stable glutamine |
500 ml |
68-Eur |
Biochrom |
|
| LM-S2035/500 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 500ml |
|
34-Eur |
Biosera |
|
| FG 1383 |
RPMI 1640 with 2,0 g_l NaHCO3, 25 mM HEPES, 5,5 g_l NaCl, 5 mg_l phenol red, stable glutamine |
100 ml |
59-Eur |
Biochrom |
|
| TA891 |
TB Pack Fluorescent Auramine-Phenol, 3x250ml, Stain Packs for Histology & Microbiology |
5 |
216-Eur |
Tayec |
|
| 1967-5 |
StemRegenin 1 4-(2-((2-Benzo[b]thiphen-3-yl)-9-isopropyl-9H-purin-6-yl)amino)ethyl)phenol hydrochloride; SR2 |
5 mg |
284-Eur |
Biovision |
|
| 1967-1 |
StemRegenin 1 4-(2-((2-Benzo[b]thiphen-3-yl)-9-isopropyl-9H-purin-6-yl)amino)ethyl)phenol hydrochloride; SR1 |
1 mg |
117-Eur |
Biovision |
|
| M265325 |
(E)-2-(5-Methoxy)phenol 4-(N-Benzyloxycarbonyl)piperidinyl-methanone O-Acetyl Oxime C23H26N2O6 CAS: 84163-48-4 |
10 mg |
245-Eur |
TRC |
|
| 76639-92-3 |
Florfenicol(Soluble) Florfenicol(Soluble) |
1g |
----Eur |
chemotra |
|
| RAF9284 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.10B9, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
10 |
218-Eur |
RANDOX |
|
| RAF9279 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.4F12, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
10 |
218-Eur |
RANDOX |
|
| SCH-MCA2755 |
MOUSE ANTI HUMAN CD154 (SOLUBLE), Product Type Monoclonal Antibody, Specificity CD154 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG1, Applications E, WB, Clone 1H4 |
0.2 mg |
409-Eur |
Serotech |
monoclonal |
| RAF9283 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.10B7, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
HRP Conjugate |
----Eur |
RANDOX |
|
| RAF9287 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.10B9, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
HRP Conjugate |
----Eur |
RANDOX |
|
| SCH-MCA2756 |
MOUSE ANTI HUMAN CD154 (SOLUBLE), Product Type Monoclonal Antibody, Specificity CD154 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG1, Applications E, WB, Clone 2A3 |
0.2 mg |
409-Eur |
Serotech |
monoclonal |
| RAF9286 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.10B9, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
1000 |
----Eur |
RANDOX |
|
| RAF9285 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.10B9, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
100 |
846-Eur |
RANDOX |
|
| MCA2756 |
MOUSE ANTI HUMAN CD154 (SOLUBLE), Product Type Monoclonal Antibody, Specificity CD154 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG1, Applications E, WB, Clone 2A3 |
0.2 mg |
409-Eur |
AbD Serotec |
monoclonal |
| MCA2755 |
MOUSE ANTI HUMAN CD154 (SOLUBLE), Product Type Monoclonal Antibody, Specificity CD154 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG1, Applications E, WB, Clone 1H4 |
0.2 mg |
409-Eur |
AbD Serotec |
monoclonal |
| RAF9282 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.4F12, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
HRP Conjugate |
----Eur |
RANDOX |
|
| RAF9282 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.10B7, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
1000 |
----Eur |
RANDOX |
|
| RAF9281 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.10B7, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
100 |
846-Eur |
RANDOX |
|
| RAF9280 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.4F12, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
100 |
846-Eur |
RANDOX |
|
| RAF9281 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.4F12, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
1000 |
----Eur |
RANDOX |
|
| RAF9280 |
Cancer: soluble VEGFR-1 (sVEGFR1 or FLT-1) antibody scFv clone 867.10B7, Affinity-purified monoclonal antibody scFv fragment (single chain variable fragment) expressed in E.Coli to bind against solubl |
10 |
218-Eur |
RANDOX |
|
| DFL14-500ML |
Cell Culture Media,DMEM _ Ham's F-12,DMEM_F-12,With L-glutamine and 15mM HEPES. No phenol red. |
500ml |
58-Eur |
Caisson Laboratory |
|
| YCC320-209 |
Streptococcus (Hemolytic), Typing Reagents (Pancreatic extr., pH adjustment sol., Phenol Red sol.); Agglutination test |
set |
399-Eur |
Accurate |
assays |
| DFP16-10X1LT |
Cell Culture Media,DMEM _ Ham's F-12,DMEM_F-12,With L-glutamine. No phenol red or sodium bicarbonate. |
10 x 1 L |
66-Eur |
Caisson Laboratory |
|
| B283 |
Phenol Red Agar Base USE As a basal medium to which carbohydrates may be added for use in fermentation studies of microorganisms. |
Qty per Litre of Medium: 31 |
2-Eur |
biomarkt |
cell culture |
| DFP16-10LT |
Cell Culture Media,DMEM _ Ham's F-12,DMEM_F-12,With L-glutamine. No phenol red or sodium bicarbonate. |
10L |
60-Eur |
Caisson Laboratory |
|
| B283 |
Phenol Red Agar Base USE: As a basal medium to which carbohydrates may be added for use in fermentation studies of microorganisms. |
5x500gm |
265-Eur |
biomarkt |
|
| LM-S2037/1000 |
Hanks' Balanced salts w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 1000ml |
|
64-Eur |
Biosera |
|
| DFP16-50LT |
Cell Culture Media,DMEM _ Ham's F-12,DMEM_F-12,With L-glutamine. No phenol red or sodium bicarbonate. |
50L |
72-Eur |
Caisson Laboratory |
|
| RPP13-50LT |
Cell Culture Media,RPMI 1640,No L-glutamine, phenol red, or sodium bicarbonate |
50L |
72-Eur |
Caisson Laboratory |
|
| LM-S2035/1000 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 1000ml |
|
60-Eur |
Biosera |
|
| TM 156 |
LETHEEN AGAR (for determination of phenol coefficient of quarternary ammonium compounds using E.coli or Staphylococcus aureus) |
500 gm |
133-Eur |
TitanBiotech |
recombinant |
| RPP13-10X1LT |
Cell Culture Media,RPMI 1640, No L-glutamine, phenol red, or sodium bicarbonate |
10 x 1 L |
66-Eur |
Caisson Laboratory |
|
| FAMIK 001 |
miRNA Isolation Kit; Content: Rxns: 100 Lysis Buffer-10 ml
Acid-Phenol-10 ml
RNA Column and Collec |
5kits |
2000-Eur |
Faworgen |
|
| RPP13-10LT |
Cell Culture Media,RPMI 1640,No L-glutamine, phenol red, or sodium bicarbonate |
10L |
60-Eur |
Caisson Laboratory |
|
| MDL06-500ML |
Cell Culture Media,Medium 199 ,E199 With Earle's salts and L-glutamine. No phenol red. |
500ml |
57-Eur |
Caisson Laboratory |
|
| LM-S2039/1000 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 1000ml |
|
61-Eur |
Biosera |
|
| TA892 |
TB Pack Fluorescent Auramine-Rhodamine-Phenol, 3x250ml, Stain Packs for Histology & Microbiology |
5 |
236-Eur |
Tayec |
|
| GS-2170a |
sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| TM 968 |
GLUTAMATE STARCH PHENOL RED AGAR BASE (for detection of Pseudomonas and Aeromonas species in food and water) |
500 gm |
121-Eur |
TitanBiotech |
assays |
| MCA2776 |
MOUSE ANTI HUMAN CD71 (SOLUBLE), Product Type Monoclonal Antibody, Specificity CD71 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG2a, Applications E, WB, Clone 13E4 |
0.2 mg |
326-Eur |
AbD Serotec |
monoclonal |
| MCA2765 |
MOUSE ANTI HUMAN LOX_1 (SOLUBLE), Product Type Monoclonal Antibody, Specificity LOX_1 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG1, Applications E, WB, Clone LOX19_22 |
0.2 mg |
409-Eur |
AbD Serotec |
monoclonal |
| SCH-MCA2766 |
MOUSE ANTI HUMAN LOX_1 (SOLUBLE), Product Type Monoclonal Antibody, Specificity LOX_1 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG2a, Applications E, WB, Clone LOX20_7 |
0.2 mg |
409-Eur |
Serotech |
monoclonal |
| SCH-MCA2765 |
MOUSE ANTI HUMAN LOX_1 (SOLUBLE), Product Type Monoclonal Antibody, Specificity LOX_1 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG1, Applications E, WB, Clone LOX19_22 |
0.2 mg |
409-Eur |
Serotech |
monoclonal |
| MCA2775 |
MOUSE ANTI HUMAN CD71 (SOLUBLE), Product Type Monoclonal Antibody, Specificity CD71 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG2b, Applications E, WB, Clone 23D10 |
0.2 mg |
326-Eur |
AbD Serotec |
monoclonal |
| SCH-MCA2776 |
MOUSE ANTI HUMAN CD71 (SOLUBLE), Product Type Monoclonal Antibody, Specificity CD71 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG2a, Applications E, WB, Clone 13E4 |
0.2 mg |
326-Eur |
Serotech |
monoclonal |
| MCA2766 |
MOUSE ANTI HUMAN LOX_1 (SOLUBLE), Product Type Monoclonal Antibody, Specificity LOX_1 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG2a, Applications E, WB, Clone LOX20_7 |
0.2 mg |
409-Eur |
AbD Serotec |
monoclonal |
| SCH-MCA2775 |
MOUSE ANTI HUMAN CD71 (SOLUBLE), Product Type Monoclonal Antibody, Specificity CD71 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG2b, Applications E, WB, Clone 23D10 |
0.2 mg |
326-Eur |
Serotech |
monoclonal |
| B478 |
Culture Medium For RWC (Disinfectant test broth) USE For determination of phenol coefficients of disinfectants using S.typhi as per ISI specifications. |
Qty per Litre of Medium: 50 |
3-Eur |
biomarkt |
assays |
| B478 |
Culture Medium For RWC (Disinfectant test broth) USE : For determination of phenol coefficients of disinfectants using S.typhi as per ISI specifications. |
5x500gm |
277-Eur |
biomarkt |
|
| B674 |
Phenol Red Broth Base w_Meat Extract USE : Highly nutritive basal medium which can be used to study fermentation of carbohydrates. |
5x500gm |
256-Eur |
biomarkt |
|
| B674 |
Phenol Red Broth Base w_Meat Extract USE Highly nutritive basal medium which can be used to study fermentation of carbohydrates. |
Qty per Litre of Medium: 16 |
2-Eur |
biomarkt |
cell culture |
| PKI-R107-010 |
Kinase inhibitors: Aloisine A, small molecule, CAS number: 496864-16-5, Chemical name: 4-(7-Butyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenol |
10 mg |
348-Eur |
BIaff |
|
| PKI-SB202-010 |
Kinase inhibitors: SB202190, small molecule, CAS number: 152121-30-7, Chemical name: 4-[4-(4-Fluorophenyl)-5-(4-pyridinyl)-1H-imidazol-2-yl]phenol |
10 mg |
318-Eur |
BIaff |
|
| PKI-R107-005 |
Kinase inhibitors: Aloisine A, small molecule, CAS number: 496864-16-5, Chemical name: 4-(7-Butyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenol |
5 mg |
222-Eur |
BIaff |
|
| orb90551 |
Water Soluble Sealing Reagent Water Soluble Sealing Reagent For research use only. |
50 ml |
244-Eur |
Biorb |
|
| CSB-EL022933DO |
Dog sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 (SULT1A1) ELISA kit, Species Dog, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| B284 |
Phenol Red Broth Base USE : As a basal medium to which carbohydrates are added for determination of fermentation reactions of pure cultures of microorganisms. |
5x500gm |
256-Eur |
biomarkt |
|
| B284 |
Phenol Red Broth Base USE As a basal medium to which carbohydrates are added for determination of fermentation reactions of pure cultures of microorganisms. |
Qty per Litre of Medium: 16 |
2-Eur |
biomarkt |
cell culture |
| CSB-EL022933RA |
Rat sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 (SULT1A1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| B505 |
Glutamate Starch Phenol Red Agar USE For detection of Pseudomonas and Aeromonas species in foodstuffs and wastewater and equipments in food industry. |
Qty per Litre of Medium: 45 |
3-Eur |
biomarkt |
assays |
| B505 |
Glutamate Starch Phenol Red Agar USE : For detection of Pseudomonas and Aeromonas species in foodstuffs and wastewater and equipments in food industry. |
5x500gm |
277-Eur |
biomarkt |
|
| SCH-MCA2623 |
MOUSE ANTI GUANYLATE CYCLASE ALPHA 1 (SOLUBLE), Product Type Monoclonal Antibody, Specificity GUANYLATE CYCLASE ALPHA 1 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG1, Applic |
0.2 mg |
314-Eur |
Serotech |
monoclonal |
| MCA2623 |
MOUSE ANTI GUANYLATE CYCLASE ALPHA 1 (SOLUBLE), Product Type Monoclonal Antibody, Specificity GUANYLATE CYCLASE ALPHA 1 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG1, Applic |
0.2 mg |
314-Eur |
AbD Serotec |
monoclonal |
| B223 |
Letheen Agar USE : For determination of the phenol coefficient of quaternary ammonium compounds using Escherichia coli or Staphylococcus aureus ATCC 6538. |
5x500gm |
313-Eur |
biomarkt |
|
| B223 |
*Letheen Agar USE For determination of the phenol coefficient of quaternary ammonium compounds using Escherichia coli or Staphylococcus aureus ATCC 6538. |
Qty per Litre of Medium: 32 |
3-Eur |
biomarkt |
recombinant |
| SULT1A4 |
SULT1A4 Gene sulfotransferase family, cytosolic, 1A, phenol-preferring, member 4 |
|
----Eur |
Transposagen |
|
| EIAAB40124 |
Mouse,Mus musculus,Phenol sulfotransferase,ST1C1,Sulfotransferase 1C1,Sult1a2,Sult1c1 |
|
1164-Eur |
EIAab |
|
| LM-S2031/1000 |
Earle's Balanced Salts w_o Calcium w_o Magnesium w_o Phenol Red _ 1000 ml |
1000 ml |
83-Eur |
Biosera |
|
| SULT1A3 |
SULT1A3 Gene sulfotransferase family, cytosolic, 1A, phenol-preferring, member 3 |
|
----Eur |
Transposagen |
|
| XC-S2064/1000 |
HBSS 10X w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_o Phenol Red _ 1000 ml |
1000 ml |
83-Eur |
Biosera |
|
| XC-S2062/1000 |
HBSS 10X w_o Calcium w_o Magnesium w_o Sodium Bicarbonate w_o Phenol Red _ 1000 ml |
1000 ml |
83-Eur |
Biosera |
|
| SULT1A1 |
SULT1A1 Gene sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 |
|
----Eur |
Transposagen |
|
| SULT1A2 |
SULT1A2 Gene sulfotransferase family, cytosolic, 1A, phenol-preferring, member 2 |
|
----Eur |
Transposagen |
|
| B643 |
Phenol Red Rhamnose Broth USE For Rhamnose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
6-Eur |
biomarkt |
|
| B681 |
Phenol Red Xylose Broth USE For Xylose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
2-Eur |
biomarkt |
|
| B642 |
Phenol Red Trehalose Broth USE For Trehalose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
6-Eur |
biomarkt |
|
| B679 |
Phenol Red Raffinose Broth USE For Raffinose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
3-Eur |
biomarkt |
|
| B092 |
Phenol Red Adonitol Broth USE For Adonitol fermentation studies of microorganisms |
Qty per Litre of Medium: 21 |
6-Eur |
biomarkt |
|
| B675 |
Phenol Red Dulcitol Broth USE For Dulcitol fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
5-Eur |
biomarkt |
|
| B678 |
Phenol Red Sorbitol Broth USE For Sorbitol fementation studies of microorganisms. |
Qty per Litre of Medium: 21 |
1-Eur |
biomarkt |
|
| B673 |
Phenol Red Arabinose Broth USE For Arabinose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
4-Eur |
biomarkt |
|
| B677 |
Phenol Red Salicin Broth USE For Salicin fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
4-Eur |
biomarkt |
|
| B1104 |
Phenol Red Galactose Broth USE For Galactose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
3-Eur |
biomarkt |
|
| B289I |
Phenol Red Lactose Broth USE : For Lactose fermentation studies of coliforms. |
5x500gm |
256-Eur |
biomarkt |
|
| B093 |
Phenol Red Lactose Agar USE For Lactose fermentation studies of microorganisms |
Qty per Litre of Medium: 41 |
2-Eur |
biomarkt |
|
| B292 |
Phenol Red Mannitol Agar USE : For Mannitol fermentation studies of microorganisms |
5x500gm |
287-Eur |
biomarkt |
|
| B294 |
Phenol Red Sucrose Agar USE For Sucrose fermentation studies of microorganisms |
Qty per Litre of Medium: 41 |
2-Eur |
biomarkt |
|
| B295 |
Phenol Red Sucrose Broth USE For Sucrose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
2-Eur |
biomarkt |
|
| B680 |
Phenol Red Starch Broth USE : For Starch fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B642 |
Phenol Red Trehalose Broth USE : For Trehalose fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B681 |
Phenol Red Xylose Broth USE : For Xylose fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B286 |
Phenol Red Dextrose Broth USE : For Dextrose fermentation studies of microorganisms |
5x500gm |
256-Eur |
biomarkt |
|
| B092 |
Phenol Red Adonitol Broth USE : For Adonitol fermentation studies of microorganisms |
5x500gm |
----Eur |
biomarkt |
|
| B289 |
Phenol Red Lactose Broth USE : For lactose fermentation studies of microorganisms. |
5x500gm |
256-Eur |
biomarkt |
|
| B290 |
Phenol Red Maltose Agar USE : For Maltose fermentation studies of microorganisms |
5x500gm |
287-Eur |
biomarkt |
|
| B295 |
Phenol Red Sucrose Broth USE : For Sucrose fermentation studies of microorganisms. |
5x500gm |
256-Eur |
biomarkt |
|
| B285 |
Phenol Red Dextrose Agar USE : For Dextrose fermentation studies of microorganisms |
5x500gm |
265-Eur |
biomarkt |
|
| B093 |
Phenol Red Lactose Agar USE : For Lactose fermentation studies of microorganisms |
5x500gm |
265-Eur |
biomarkt |
|
| B294 |
Phenol Red Sucrose Agar USE : For Sucrose fermentation studies of microorganisms |
5x500gm |
265-Eur |
biomarkt |
|
| B291 |
Phenol Red Maltose Broth USE : For Maltose fermentation studies of microorganisms. |
5x500gm |
277-Eur |
biomarkt |
|
| B293 |
Phenol Red Mannitol Broth USE : For Mannitol fermentation studies of microorganisms. |
5x500gm |
277-Eur |
biomarkt |
|
| TM 821 |
PHENOL RED SALICIN BROTH (for determination of the ability of microorganisms to ferment salicin.) |
100 gm |
156-Eur |
TitanBiotech |
|
| B678 |
Phenol Red Sorbitol Broth USE : For Sorbitol fementation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B293 |
Phenol Red Mannitol Broth USE For Mannitol fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
3-Eur |
biomarkt |
|
| B677 |
Phenol Red Salicin Broth USE : For Salicin fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B289 |
Phenol Red Lactose Broth USE For lactose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
2-Eur |
biomarkt |
|
| B287 |
Phenol Red Inositol Broth USE For Inositol fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
2-Eur |
biomarkt |
|
| B286 |
Phenol Red Dextrose Broth USE For Dextrose fermentation studies of microorganisms |
Qty per Litre of Medium: 21 |
2-Eur |
biomarkt |
|
| B290 |
Phenol Red Maltose Agar USE For Maltose fermentation studies of microorganisms |
Qty per Litre of Medium: 41 |
3-Eur |
biomarkt |
|
| B291 |
Phenol Red Maltose Broth USE For Maltose fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
3-Eur |
biomarkt |
|
| B292 |
Phenol Red Mannitol Agar USE For Mannitol fermentation studies of microorganisms |
Qty per Litre of Medium: 41 |
3-Eur |
biomarkt |
|
| B285 |
Phenol Red Dextrose Agar USE For Dextrose fermentation studies of microorganisms |
Qty per Litre of Medium: 41 |
2-Eur |
biomarkt |
|
| B673 |
Phenol Red Arabinose Broth USE : For Arabinose fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B675 |
Phenol Red Dulcitol Broth USE : For Dulcitol fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B643 |
Phenol Red Rhamnose Broth USE : For Rhamnose fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B679 |
Phenol Red Raffinose Broth USE : For Raffinose fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B287 |
Phenol Red Inositol Broth USE : For Inositol fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B680 |
Phenol Red Starch Broth USE For Starch fermentation studies of microorganisms. |
Qty per Litre of Medium: 21 |
1-Eur |
biomarkt |
|
| B289I |
Phenol Red Lactose Broth USE For Lactose fermentation studies of coliforms. |
Qty per Litre of Medium: 25 |
2-Eur |
biomarkt |
recombinant |
| B1104 |
Phenol Red Galactose Broth USE : For Galactose fermentation studies of microorganisms. |
5x500gm |
----Eur |
biomarkt |
|
| B641 |
Phenol Red Tartrate Agar USE : For identification and differentiation of Salmonellae on the basis of tartrate utilization. |
5x500gm |
----Eur |
biomarkt |
|
| B641 |
Phenol Red Tartrate Agar USE For identification and differentiation of Salmonellae on the basis of tartrate utilization. |
Qty per Litre of Medium: 40 |
2-Eur |
biomarkt |
cat |
| LM-S2035/1000 |
Hanks' Balanced Salts w_ Calcium w_ Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 1000 ml |
1000 ml |
71-Eur |
Biosera |
|
| CSB-E15893Fh |
Fish phenol oxidase(PO) ELISA Kit, Species Fish, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| LM-S2037/1000 |
Hanks' Balanced salts w_ Calcium w_ Magnesium w_o Sodium Bicarbonate w_ Phenol Red _ 1000 ml |
1000 ml |
71-Eur |
Biosera |
|
| LM-S2039/1000 |
Hanks' Balanced Salts w_o Calcium w_o Magnesium w_ Sodium Bicarbonate w_ Phenol Red _ 1000 ml |
1000 ml |
71-Eur |
Biosera |
|
| 43100-74-9 |
o-[(2-hydroxyethyl)amino]phenol sulphat o-[(2-hydroxyethyl)amin |
1g |
----Eur |
chemotra |
|
| 13921-03-4 |
2_amino_4_(ethylsulphonyl)phenol hydroc 2_amino_4_(ethylsulpho |
1g |
----Eur |
chemotra |
|
| 61721-07-1 |
4_Fluoro_3_(trifluoromethyl)phenol alpha,alpha,alpha_4_Tet |
1g |
----Eur |
chemotra |
|
| 94031-00-2 |
bis[[(2_aminoethyl)amino]methyl]phenol bis[[(2_aminoethyl)amin |
1g |
----Eur |
chemotra |
|
| 32190-99-1 |
2,6_diamino_4_(diethylamino)phenol trihy 2,6_diamino_4_(diethyla |
1g |
----Eur |
chemotra |
|
| 85409-80-9 |
2,4,6_tris[(dimethylamino)methyl]phenol 2,4,6_tris[(dimethylamin |
1g |
----Eur |
chemotra |
|
| 85305-20-0 |
2,4,6_tris[1_(methylphenyl)ethyl]phenol 2,4,6_tris[1_(methylphen |
1g |
----Eur |
chemotra |
|
| SCH-MCA2624 |
MOUSE ANTI HUMAN GUANYLATE CYCLASE BETA 1 (SOLUBLE), Product Type Monoclonal Antibody, Specificity GUANYLATE CYCLASE BETA 1 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG2b, A |
0.2 mg |
314-Eur |
Serotech |
monoclonal |
| MCA2624 |
MOUSE ANTI HUMAN GUANYLATE CYCLASE BETA 1 (SOLUBLE), Product Type Monoclonal Antibody, Specificity GUANYLATE CYCLASE BETA 1 , Target Species Human, Host Mouse, Format Purified, Isotypes IgG2b, A |
0.2 mg |
314-Eur |
AbD Serotec |
monoclonal |
| 170434-11-4 |
5_Bromo_2_(hydroxymethyl)phenol 5_Bromo_2_(hydroxymet |
1g |
----Eur |
chemotra |
|
| 2622-83-5 |
4_sec_Butyl_2_(a_methylbenzyl)phenol 4_sec_Butyl_2_(a_methyl |
1g |
----Eur |
chemotra |
|
| 663602-53-7 |
3,5_Difluoro_4_(phenyldiazenyl)phenol 3,5_Difluoro_4_(phenyldi |
1g |
----Eur |
chemotra |
|
| 53940-49-1 |
2_methoxy_4_(oxiranylmethyl)phenol 2_methoxy_4_(oxiranylm |
1g |
----Eur |
chemotra |
|
| 886498-03-9 |
2_Fluoro_5_(triflioromethoxy)phenol 2_Fluoro_5_(trifliorometh |
1g |
----Eur |
chemotra |
|
| 6294-93-5 |
4_Chloro_3_(trifluoromethyl)phenol 4_Chloro_3_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 63216-93-3 |
4_dodecyl_2_[(2_nitrophenyl)azo]phenol 4_dodecyl_2_[(2_nitroph |
1g |
----Eur |
chemotra |
|
| 288401-64-9 |
4_fluoro_2_(1H_pyrazol_3_yl)phenol 4_fluoro_2_(1H_pyrazol_ |
1g |
----Eur |
chemotra |
|
| 130047-19-7 |
4_Fluoro_2_(trifluoromethyl)phenol 4_Fluoro_2_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 172333-87-8 |
3_Fluoro_5_(trifluoromethyl)phenol 3_Fluoro_5_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 351003-12-8 |
4_Nitro_2_(1H_pyrazol_3_yl)phenol 4_Nitro_2_(1H_pyrazol_3 |
1g |
----Eur |
chemotra |
|
| 94200-70-1 |
4_(3_chloro_2,4,6_trinitrophenoxy)phenol 4_(3_chloro_2,4,6_trinitro |
1g |
----Eur |
chemotra |
|
| 94200-68-7 |
3_(3_chloro_2,4,6_trinitrophenoxy)phenol 3_(3_chloro_2,4,6_trinitro |
1g |
----Eur |
chemotra |
|
| TM 045 |
BPL AGAR (BRILLIANT GREEN PHENOL RED LACTOSE AGAR) |
500 gm |
123-Eur |
TitanBiotech |
|
| 690264-39-2 |
4_Bromo_2_(trifluoromethoxy)phenol 4_Bromo_2_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 50824-04-9 |
4_Bromo_2_(trifluoromethyl)phenol 4_Bromo_2_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 213690-27-8 |
4_Bromo_2_(5_isoxazolyl)phenol 4_Bromo_2_(5_isoxazoly |
1g |
----Eur |
chemotra |
|
| 84604-85-3 |
4_bromo_2_(4_nitrophenoxy)phenol 4_bromo_2_(4_nitrophen |
1g |
----Eur |
chemotra |
|
| 5533-03-9 |
2_methoxy_4_(methoxymethyl)phenol 2_methoxy_4_(methoxy |
1g |
----Eur |
chemotra |
|
| 99067-15-9 |
4_Bromo_2_(1H_pyrazol_3_yl)phenol 4_Bromo_2_(1H_pyrazol_ |
1g |
----Eur |
chemotra |
|
| 175276-78-5 |
4_bromo_2_(1,3_dithiolan_2_yl)phenol 4_bromo_2_(1,3_dithiola |
1g |
----Eur |
chemotra |
|
| 141483-15-0 |
2_Fluoro_5_(trifluoromethyl)phenol 2_Fluoro_5_(trifluoromet |
1g |
----Eur |
chemotra |
|
| C-02663 |
2-CHLORO PHENOL98% (For Synthesis) (O-Chloro Phenol ) CAS: 95-57-8 |
500 ml |
116-Eur |
Oxford Lab |
|
| 6172-34-5 |
4_Benzyloxy_2,5_dichloro phenol 4_Benzyloxy_2,5_dichlor |
1g |
----Eur |
chemotra |
|
| 6297-14-9 |
4_Amino_2_diethyl aminomethyl phenol di 4_Amino_2_diethyl amin |
1g |
----Eur |
chemotra |
|
| 57634-55-6 |
4_(2_Amino_1,3_thiazol_4_yl)phenol 4_(2_Amino_1,3_thiazol_ |
1g |
----Eur |
chemotra |
|
| 84604-84-2 |
4,5_dibromo_2_(4_nitrophenoxy)phenol 4,5_dibromo_2_(4_nitrop |
1g |
----Eur |
chemotra |
|
| 6178-42-3 |
2_Methoxy_4_(2_nitrovinyl)phenol 2_Methoxy_4_(2_nitrovin |
1g |
----Eur |
chemotra |
|
| 82566-19-6 |
2_chloro_4_(1_phenylethyl)phenol 2_chloro_4_(1_phenyleth |
1g |
----Eur |
chemotra |
|
| 138377-34-1 |
2_Chloro_3_(trifluoromethyl)phenol 2_Chloro_3_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 205371-26-2 |
2_Bromo_5_(trifluoromethoxy)phenol 2_Bromo_5_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 56935-71-8 |
5_Fluoro_2_(trifluoromethyl)phenol 5_Fluoro_2_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 5828-70-6 |
dl_4_chloro_2_(alpha_methylbenzyl)phenol dl_4_chloro_2_(alpha_me |
1g |
----Eur |
chemotra |
|
| 32074-74-1 |
dithiobis[4_(1,1_dimethylpropyl)phenol] dithiobis[4_(1,1_dimethy |
1g |
----Eur |
chemotra |
|
| 97552-88-0 |
cyclohexyl_2_(2_phenylethyl)phenol cyclohexyl_2_(2_phenyle |
1g |
----Eur |
chemotra |
|
| 116640-12-1 |
2,3_Difluoro_4_(trifluoromethyl)phenol 2,3_Difluoro_4_(trifluoro |
1g |
----Eur |
chemotra |
|
| 847872-04-2 |
2,3_Difluoro_4_(phenyldiazenyl)phenol 2,3_Difluoro_4_(phenyldi |
1g |
----Eur |
chemotra |
|
| 25963-47-7 |
4_[(4_aminophenyl)sulphonyl]phenol 4_[(4_aminophenyl)sulp |
1g |
----Eur |
chemotra |
|
| 5932-68-3 |
(E)_2_methoxy_4_(prop_1_enyl)phenol (E)_2_methoxy_4_(prop_ |
1g |
----Eur |
chemotra |
|
| 3430-001-02 |
CultrexBME with phenol red, PathClear (3432-001-02 & 3430-50-01) |
1 ml |
89-Eur |
Trevigen |
|
| 5912-86-7 |
(Z)_2_methoxy_4_(prop_1_enyl)phenol (Z)_2_methoxy_4_(prop_ |
1g |
----Eur |
chemotra |
|
| 84878-46-6 |
[[(aminocyclohexyl)amino]methyl]phenol [[(aminocyclohexyl)ami |
1g |
----Eur |
chemotra |
|
| 243459-91-8 |
5_Fluoro_2_(trifluoromethyl)phenol 5_Fluoro_2_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 94200-69-8 |
2_(3_chloro_2,4,6_trinitrophenoxy)phenol 2_(3_chloro_2,4,6_trinitro |
1g |
----Eur |
chemotra |
|
| 164171-56-6 |
2_(5_Isoxazolyl)_4_Methyl Phenol 2_(5_Isoxazolyl)_4_Meth |
1g |
----Eur |
chemotra |
|
| 68937-41-7 |
Isopropylphenyl phosphate Phenol phosphate isopr |
1g |
----Eur |
chemotra |
|
| 30748-85-7 |
2,4,6_tris(1_methyl_1_phenylethyl)phenol 2,4,6_tris(1_methyl_1_ph |
1g |
----Eur |
chemotra |
|
| 3430-010-02 |
CultrexBME with phenol red, PathClear (3432-005-02 & 3430-50-01) |
2x 5ml |
269-Eur |
Trevigen |
|
| 3430-005-02 |
CultrexBME with phenol red, PathClear (3432-005-02 & 3430-50-01) |
5 ml |
206-Eur |
Trevigen |
|
| 43115-40-8 |
2_amino_4_(ethylsulphonyl)phenol 2_amino_4_(ethylsulpho |
1g |
----Eur |
chemotra |
|
| 5882-48-4 |
P-(dimethylamino)phenol hydrochloride P-(dimethylamino)phen |
1g |
----Eur |
chemotra |
|
| 262291-90-7 |
2,6_Dibromo_4_(1,3_dithiolan_2_yl)phenol 2,6_Dibromo_4_(1,3_dith |
1g |
----Eur |
chemotra |
|
| 6641-02-7 |
2,4_Dichloro_6_(hydroxymethyl)phenol 2,4_Dichloro_6_(hydroxy |
1g |
----Eur |
chemotra |
|
| 288401-44-5 |
2,4_Dichloro_6_(5_isoxazolyl)phenol 2,4_Dichloro_6_(5_isoxa |
1g |
----Eur |
chemotra |
|
| 94201-88-4 |
m_[5_(methylthio)_1H_tetrazol_1_yl]phenol m_[5_(methylthio)_1H_te |
1g |
----Eur |
chemotra |
|
| 21454-20-6 |
2,4,6_tris(dimethylamino)phenol 2,4,6_tris(dimethylamin |
1g |
----Eur |
chemotra |
|
| 122489-60-5 |
2,4,6_Tris(trifluoromethyl)phenol 2,4,6_Tris(trifluorometh |
1g |
----Eur |
chemotra |
|
| 5806-72-4 |
2,4_bis(1,1,3,3_tetramethylbutyl)phenol 2,4_bis(1,1,3,3_tetramet |
1g |
----Eur |
chemotra |
|
| 2772-45-4 |
2,4_Bis(a,a_dimethylbenzyl)phenol 2,4_Bis(1_methyl_1_phe |
1g |
----Eur |
chemotra |
|
| TM 045 |
BPL AGAR (BRILLIANT GREEN PHENOL RED LACTOSE AGAR) |
500 gm |
123-Eur |
TitanBiotech |
|
| 86176-56-9 |
2_(5_Isoxazole)_4_Chloro Phenol 2_(5_Isoxazole)_4_Chlor |
1g |
----Eur |
chemotra |
|
| DML12-500ML |
Cell Culture Media,Dulbecco's Modified Eagle Medium,DMEM (HG),With high-glucose, L-glutamine, and 25mM HEPES. No sodium pyruvate or phenol red. |
500ml |
56-Eur |
Caisson Laboratory |
|
| B091 |
Trytpose Yeast Extract Broth (AOAC) USE : For detection of Clostridium perfringens with the addition of salicin,raffinose and phenol red as per AOAC. |
5x500gm |
277-Eur |
biomarkt |
|
| B091 |
Trytpose Yeast Extract Broth (AOAC) USE For detection of Clostridium perfringens with the addition of salicin,raffinose and phenol red as per AOAC. |
Qty per Litre of Medium: 30 |
3-Eur |
biomarkt |
assays |
| B478 |
Disinfectant Test Broth (Culture Medium for RWC) USE : For determination of phenol coefficients of disinfectants using Salmonella typhi as a test organism, as per ISI specification. |
5x500gm |
277-Eur |
biomarkt |
|
| B478 |
Disinfectant Test Broth (Culture Medium for RWC) USE For determination of phenol coefficients of disinfectants using Salmonella typhi as a test organism, as per ISI specification. |
Qty per Litre of Medium: 50 |
3-Eur |
biomarkt |
assays |
| CSB-EL022933BO |
Bovine sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 (SULT1A1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022933HU |
Human sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 (SULT1A1) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022934HU |
Human sulfotransferase family, cytosolic, 1A, phenol-preferring, member 2 (SULT1A2) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022933MO |
Mouse sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 (SULT1A1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022935HU |
Human sulfotransferase family, cytosolic, 1A, phenol-preferring, member 3 (SULT1A3) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 39138-90-4 |
o-(p-nitrophenoxy)phenol o-(p-nitrophenoxy)phen |
1g |
----Eur |
chemotra |
|
| 6219-89-2 |
4_[(4_amino_m_tolyl)amino]phenol 4_[(4_amino_m_tolyl)ami |
1g |
----Eur |
chemotra |
|
| 37631-10-0 |
o-(1-propylpentyl)phenol o-(1-propylpentyl)pheno |
1g |
----Eur |
chemotra |
|
| 18626-98-7 |
o-(1-methylheptyl)phenol o-(1-methylheptyl)phen |
1g |
----Eur |
chemotra |
|
| 34810-67-8 |
o-(1H-pyrazol-3-yl)phenol o-(1H-pyrazol-3-yl)phen |
1g |
----Eur |
chemotra |
|
| 105601-04-5 |
3_[1_(Dimethylamino)ethyl] phenol 3_[1_(Dimethylamino)et |
1g |
----Eur |
chemotra |
|
| 3823-40-3 |
3_((Trifluoromethyl)mercapto)phenol 3_((Trifluoromethyl)mer |
1g |
----Eur |
chemotra |
|
| 1818-08-2 |
p-(1-methylheptyl)phenol p-(1-methylheptyl)phen |
1g |
----Eur |
chemotra |
|
| 23567-67-1 |
p-(1,2,3,4-thiatriazol-5-ylamino)phenol p-(1,2,3,4-thiatriazol-5-y |
1g |
----Eur |
chemotra |
|
| 39634-42-9 |
p-[4-(trifluoromethyl)phenoxy]phenol p-[4-(trifluoromethyl)ph |
1g |
----Eur |
chemotra |
|
| 57400-89-2 |
4_(3_Aminopropyl)Phenol 4_(3_Aminopropyl)Phen |
1g |
----Eur |
chemotra |
|
| 14763-60-1 |
4_(Methylsulfonyl)phenol 4_(Methylsulfonyl)phen |
1g |
----Eur |
chemotra |
|
| 28444-50-7 |
2_Amino_5_chloro phenol 2_Amino_5_chloro phen |
1g |
----Eur |
chemotra |
|
| 167145-13-3 |
2_[2_(3_Methoxyphenyl)ethyl]phenol 2_[2_(3_Methoxyphenyl) |
1g |
----Eur |
chemotra |
|
| 3307-01-5 |
p-(1-Propylpentyl)phenol p-(1-Propylpentyl)phen |
1g |
----Eur |
chemotra |
|
| 6370-47-4 |
p-(1-naphthylazo)phenol p-(1-naphthylazo)pheno |
1g |
----Eur |
chemotra |
|
| 29886-67-7 |
4_(Thiophen_3_yl)phenol 4_(Thiophen_3_yl)pheno |
1g |
----Eur |
chemotra |
|
| 501-20-2 |
2_methoxy_5_(1_propenyl)phenol 2_methoxy_5_(1_propen |
1g |
----Eur |
chemotra |
|
| 622-91-3 |
hydroquinone__4_(methylamino)phenol (1 hydroquinone__4_(meth |
1g |
----Eur |
chemotra |
|
| 1075-61-2 |
3_(2_aminopropyl)phenol 3_(2_aminopropyl)phen |
1g |
----Eur |
chemotra |
|
| 1624296 |
PHENOL CHLOROFORM ISOAMYL ISOAMYL 25 24 1 |
100ml |
135-Eur |
Sisco Research |
|
| 83804-00-6 |
bis[1_(methylphenyl)ethyl]phenol bis[1_(methylphenyl)eth |
1g |
----Eur |
chemotra |
|
| 71074-89-0 |
Bis[(dimethylamino)methyl]phenol Bis[(dimethylamino)met |
1g |
----Eur |
chemotra |
|
| 17408-59-2 |
4_(1_methylnonyl)phenol 4_(1_methylnonyl)pheno |
1g |
----Eur |
chemotra |
|
| 3964-56-53 |
4_Bromo_4_chloro phenol 4_Bromo_4_chloro phen |
1g |
----Eur |
chemotra |
|
| 85068-38-8 |
4_(1_aminopropyl)phenol 4_(1_aminopropyl)phen |
1g |
----Eur |
chemotra |
|
| 14475-14-1 |
3_Methyl_4_bromo phenol 3_Methyl_4_bromo phen |
1g |
----Eur |
chemotra |
|
| 30498-86-3 |
bis(2_phenylvinyl)phenol bis(2_phenylvinyl)pheno |
1g |
----Eur |
chemotra |
|
| 349-57-5 |
3_Nitro_5_(trifluoromethyl)phenol 3_Nitro_5_(trifluorometh |
1g |
----Eur |
chemotra |
|
| 2835-95-2 |
3_Methyl_4_Amino Phenol 3_Methyl_4_Amino Phen |
1g |
----Eur |
chemotra |
|
| 4338-64-1 |
2_(1_methylnonyl)phenol 2_(1_methylnonyl)pheno |
1g |
----Eur |
chemotra |
|
| 1624296 |
PHENOL CHLOROFORM ISOAMYL ISOAMYL 25 24 1 |
250 ml |
163-Eur |
Sisco Research |
|
| 1624296 |
PHENOL CHLOROFORM ISOAMYL ISOAMYL 25 24 1 |
500 ml |
186-Eur |
Sisco Research |
|
| 716-61-0 |
(1R,2R)_2_Amino_1_(4_nitro Phenol)Prop (1R,2R)_2_Amino_1_(4_ |
1g |
----Eur |
chemotra |
|
| 25666-51-7 |
2_(Trifluoroacetyl)phenol 2_(Trifluoroacetyl)phen |
1g |
----Eur |
chemotra |
|
| 320-49-0 |
4_Bromo_3_(trifluoromethyl)phenol 4_Bromo_3_(trifluoromet |
1g |
----Eur |
chemotra |
|
| 50634-76-9 |
4_(2_aminoethoxy)phenol 4_(2_aminoethoxy)phen |
1g |
----Eur |
chemotra |
|
| 51251-96-8 |
bis(phenylmethyl)phenol bis(phenylmethyl)pheno |
1g |
----Eur |
chemotra |
|
| 3430-001-01 |
CultrexBME with phenol red (3432-001-01 & 3430-50-01) |
1 ml |
84-Eur |
Trevigen |
|
| 25640-70-4 |
bis(1_phenylethyl)phenol bis(1_phenylethyl)phen |
1g |
----Eur |
chemotra |
|
| 3430-005-01 |
CultrexBME with phenol red (3432-005-01 & 3430-50-01) |
5 ml |
196-Eur |
Trevigen |
|
| DML20-500ML |
Cell Culture Media,Dulbecco's Modified Eagle Medium,DMEM (HG),With high-glucose. No L-glutamine, sodium pyruvate, phenol red or sodium bicarbonate. |
500ml |
70-Eur |
Caisson Laboratory |
|
| 184-01671 |
RANK Receptor Soluble, Human, recombinant RANK Receptor Soluble, Human, recombinant |
100 ug |
494-Eur |
B-Bridge |
recombinant |
| DMP17-10X1LT |
Cell Culture Media,Dulbecco's Modified Eagle Medium,DMEM (HG),With high-glucose, L-glutamine, and 25mM HEPES. No sodium pyruvate, phenol red, or sodium bicarbonate. |
10 x 1 L |
66-Eur |
Caisson Laboratory |
|
| DMP17-50LT |
Cell Culture Media,Dulbecco's Modified Eagle Medium,DMEM (HG),With high-glucose, L-glutamine, and 25mM HEPES. No sodium pyruvate, phenol red, or sodium bicarbonate. |
50L |
72-Eur |
Caisson Laboratory |
|
| DMP17-10LT |
Cell Culture Media,Dulbecco's Modified Eagle Medium,DMEM (HG),With high-glucose, L-glutamine, and 25mM HEPES. No sodium pyruvate, phenol red, or sodium bicarbonate. |
10L |
60-Eur |
Caisson Laboratory |
|
| TM 1237 |
MYP AGAR BASE (PHENOL RED EGG YOLK POLYMYXIN AGAR BASE) (as per BIS) (for isolation and identification of pathogenic Staphylococci and Bacillu |
500 gm |
125-Eur |
TitanBiotech |
cat |
| LF-PA0219 |
anti-CSPS (Catecholamine-Sulfating Phenol Sulfotransferase), Rabbit polyclonal to CSPS, Isotype IgG, Host Rabbit |
100 ul |
355-Eur |
Abfrontier |
|
| TM 1237 |
MYP AGAR BASE (PHENOL RED EGG YOLK POLYMYXIN AGAR BASE) (as per BIS) (for isolation and identification of pathogenic Staphylococci and Bacillu |
500 gm |
125-Eur |
TitanBiotech |
cat |
| TM 1237 |
MYP AGAR BASE (PHENOL RED EGG YOLK POLYMYXIN AGAR BASE) (as per BIS) (for isolation and identification of pathogenic Staphylococci and Bacillu |
100 gm |
74-Eur |
TitanBiotech |
cat |
| TM 1237 |
MYP AGAR BASE (PHENOL RED EGG YOLK POLYMYXIN AGAR BASE) (as per BIS) (for isolation and identification of pathogenic Staphylococci and Bacillu |
100 gm |
74-Eur |
TitanBiotech |
cat |
| B672 |
MYP Agar Base (Phenol Red Egg Yolk Polymyxin Agar Base) USE : For isolation and identification of pathogenic Staphylococci and Bacillus species. |
5x500gm |
287-Eur |
biomarkt |
|
| BW672 |
MYP Agar Base (Phenol Red Egg Yolk Polymyxin Agar Base) USE : For isolation and identification of pathogenic Staphylococci and Bacillus species. |
5x500gm |
290-Eur |
biomarkt |
|
| B672 |
Phenol Red Egg Yolk Polymyxin Agar Base (MYP Agar Base) USE : For isolation and identification of pathogenic Staphylococci and Bacillus species. |
5x500gm |
287-Eur |
biomarkt |
|
| B672 |
Phenol Red Egg Yolk Polymyxin Agar Base (MYP Agar Base) USE For isolation and identification of pathogenic Staphylococci and Bacillus species. |
Qty per Litre of Medium: 46 |
3-Eur |
biomarkt |
cat |
| B672 |
MYP Agar Base (Phenol Red Egg Yolk Polymyxin Agar Base) USE For isolation and identification of pathogenic Staphylococci and Bacillus species. |
Qty per Litre of Medium: 46 |
3-Eur |
biomarkt |
cat |
| BW672 |
MYP Agar Base (Phenol Red Egg Yolk Polymyxin Agar Base) USE For isolation and identification of pathogenic Staphylococci and Bacillus species. |
Qty per Litre of Medium: 46 |
3-Eur |
biomarkt |
cat |
| EBP01-10LT |
Balanced Salts,Earle's Balanced Salts,EBS,With calcium, magnesium, and phenol red. Without sodium bicarbonate. |
10L |
60-Eur |
Caisson Laboratory |
|
| EBP01-10X1LT |
Balanced Salts,Earle's Balanced Salts,EBS,With calcium, magnesium, and phenol red. Without sodium bicarbonate. |
10 x 1 L |
63-Eur |
Caisson Laboratory |
|
| EBL01-500ML |
Balanced Salts,Earle's Balanced Salts,EBS,With calcium, magnesium, and phenol red. Sterile filtered. |
500ml |
56-Eur |
Caisson Laboratory |
|
| HBL02-500ML |
Balanced Salts,Hank's Balanced Salts,HBS,With calcium, magnesium, and phenol red. Sterile filtered. |
500ml |
56-Eur |
Caisson Laboratory |
|
| HBP01-10LT |
Balanced Salts,Hank's Balanced Salts,HBS,With calcium, magnesium, and phenol red. Without sodium bicarbonate. |
10L |
60-Eur |
Caisson Laboratory |
|
| HBP01-50LT |
Balanced Salts,Hank's Balanced Salts,HBS,With calcium, magnesium, and phenol red. Without sodium bicarbonate. |
50L |
63-Eur |
Caisson Laboratory |
|
| HBP01-10X1LT |
Balanced Salts,Hank's Balanced Salts,HBS,With calcium, magnesium, and phenol red. Without sodium bicarbonate. |
10 x 1 L |
63-Eur |
Caisson Laboratory |
|
| EBP01-50LT |
Balanced Salts,Earle's Balanced Salts,EBS,With calcium, magnesium, and phenol red. Without sodium bicarbonate. |
50L |
63-Eur |
Caisson Laboratory |
|
| 184-01791 |
RANK Ligand Soluble, Mouse, recombinant (RANKL) RANK Ligand Soluble, Mouse, recombinant (RANKL) |
10 ug |
520-Eur |
B-Bridge |
recombinant |
| TM 197 |
MYP AGAR BASE (PHENOL RED EGG YOLK POLYMYXIN AGAR BASE) (for isolation and identification of pathogenic Staphylococci a |
100 gm |
74-Eur |
TitanBiotech |
cat |
| B-01920 |
BUTYLATED HYDROXY TOLUENE 99% (B.H.T) (2,6-di-Tert-Butyl-p-Cresol) (2,6-Di-Tert-Butyl-4-Methyl Phenol) CAS: 128-37-0 |
10 x 500 gm |
269-Eur |
Oxford Lab |
|
| B-01920 |
BUTYLATED HYDROXY TOLUENE 99% (B.H.T) (2,6-di-Tert-Butyl-p-Cresol) (2,6-Di-Tert-Butyl-4-Methyl Phenol) CAS: 128-37-0 |
500 gm |
120-Eur |
Oxford Lab |
|
| TM 197 |
MYP AGAR BASE (PHENOL RED EGG YOLK POLYMYXIN AGAR BASE) (for isolation and identification of pathogenic Staphylococci a |
100 gm |
74-Eur |
TitanBiotech |
cat |
| TM 197 |
MYP AGAR BASE (PHENOL RED EGG YOLK POLYMYXIN AGAR BASE) (for isolation and identification of pathogenic Staphylococci a |
500 gm |
125-Eur |
TitanBiotech |
cat |
| TM 197 |
MYP AGAR BASE (PHENOL RED EGG YOLK POLYMYXIN AGAR BASE) (for isolation and identification of pathogenic Staphylococci a |
500 gm |
125-Eur |
TitanBiotech |
cat |
| 59834-05-8 |
4_(1,2,3_Thiadiazol_4_yl)phenol 4_(1,2,3_Thiadiazol_4_yl |
1g |
----Eur |
chemotra |
|
| 3279-27-4 |
2_(1,1_dimethylpropyl)phenol 2_(1,1_dimethylpropyl)p |
1g |
----Eur |
chemotra |
|
| 61131-60-0 |
m_(2_nitro_1_propenyl)phenol m_(2_nitro_1_propenyl)p |
1g |
----Eur |
chemotra |
|
| 88798-13-4 |
3_(Difluoromethoxy)phenol 3_(Difluoromethoxy)phe |
1g |
----Eur |
chemotra |
|
| 4792-78-3 |
2_(2_Hydroxyethoxy)phenol 2_(2_Hydroxyethoxy)ph |
1g |
----Eur |
chemotra |
|
| 619-60-3 |
4_(Dimethylamino)phenol 4_(Dimethylamino)phen |
1g |
----Eur |
chemotra |
|
| 1008-65-7 |
2_(1,3,4_Oxadiazol_2_yl)phenol 4_(1,3,4_Oxadiazol_2_yl) |
1g |
----Eur |
chemotra |
|
| 101-74-6 |
p-(p-anilinoanilino)phenol p-(p-anilinoanilino)phen |
1g |
----Eur |
chemotra |
|
| 30784-30-6 |
p-(1,1-dimethylheptyl)phenol p-(1,1-dimethylheptyl)p |
1g |
----Eur |
chemotra |
|
| 70216-96-5 |
2_(2_benzothiazolyloxy)phenol 2_(2_benzothiazolyloxy) |
1g |
----Eur |
chemotra |
|
| 53104-96-4 |
2_(Difluoromethoxy)phenol 2_(Difluoromethoxy)phe |
1g |
----Eur |
chemotra |
|
| 90-03-9 |
2_(Chloromercury)phenol 2_(Chloromercury)phen |
1g |
----Eur |
chemotra |
|
| 84083-16-9 |
p-[(p-Anilinophenyl)azo]phenol p-[(p-Anilinophenyl)azo] |
1g |
----Eur |
chemotra |
|
| 87789-47-7 |
4_(Difluoromethoxy)phenol 4_(Difluoromethoxy)phe |
1g |
----Eur |
chemotra |
|
| 102127-34-4 |
4_Bromo_3_Methoxy Phenol 4_Bromo_3_Methoxy Ph |
1g |
----Eur |
chemotra |
|
| 103-86-6 |
4_(2_aminopropyl)phenol 4_(2_aminopropyl)phen |
1g |
----Eur |
chemotra |
|
| 40843-73-0 |
4_(2,4_Dichlorophenoxy)phenol 4_(2,4_Dichlorophenoxy |
1g |
----Eur |
chemotra |
|
| 14472-14-1 |
4_Bromo_3_Methyl Phenol 4_Bromo_3_Methyl Phe |
1g |
----Eur |
chemotra |
|
| 73279-04-6 |
3_(1_Piperidinylmethyl)phenol 3_(1_Piperidinylmethyl)p |
1g |
----Eur |
chemotra |
|
| 1435-60-5 |
4_(4_Nitrophenylazo)phenol 4_(4_Nitrophenylazo)ph |
1g |
----Eur |
chemotra |
|
| 1156-78-1 |
4_(Trifluoromethylthio)phenol 4_(Trifluoromethylthio)p |
1g |
----Eur |
chemotra |
|
| 61760-85-8 |
4_(4_n_Pentylphenyl)phenol 4_(4_n_Pentylphenyl)ph |
1g |
----Eur |
chemotra |
|
| 36429-48-8 |
m_(2_phenoxyethoxy)phenol m_(2_phenoxyethoxy)ph |
1g |
----Eur |
chemotra |
|
| 23478-16-2 |
m_(Isopropylamino)phenol m_(Isopropylamino)phe |
1g |
----Eur |
chemotra |
|
| 21022-74-2 |
6_Isopropyl_2_Methoxy Phenol 6_Isopropyl_2_Methoxy |
1g |
----Eur |
chemotra |
|
| 59748-39-9 |
4_(4_n_Propylphenyl)phenol 4_(4_n_Propylphenyl)ph |
1g |
----Eur |
chemotra |
|
| 22068-49-1 |
4_(1,3_Dithiolan_2_yl)phenol 4_(1,3_Dithiolan_2_yl)ph |
1g |
----Eur |
chemotra |
|
| 49650-88-6 |
3_(2_Hydroxyethoxy)phenol 3_(2_Hydroxyethoxy)ph |
1g |
----Eur |
chemotra |
|
| 84016-40-0 |
4_(4_n_Butylphenyl)phenol 4_(4_n_Butylphenyl)phe |
1g |
----Eur |
chemotra |
|
| 27576-86-9 |
(1_methyl_1_phenylethyl)phenol (1_methyl_1_phenylethyl |
1g |
----Eur |
chemotra |
|
| 68337-15-5 |
4_(1,2,4_Triazol_1_yl)phenol 4_(1,2,4_Triazol_1_yl)ph |
1g |
----Eur |
chemotra |
|
| CSB-PA022935GA01HU |
Rabbit anti-human sulfotransferase family, cytosolic, 1A, phenol-preferring, member 3 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| TM 1492 |
AGAR MEDIUM L (as per EP) (BRILLIANT GREEN, PHENOL RED, LACTOSE, SUCROSE AGAR) (for selective isolation of Salmonella other than Salmonella serotype Typhi from foods and |
100 gm |
71-Eur |
TitanBiotech |
cell culture |
| CSB-PA022933GA01HU |
Rabbit anti-human sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| TM 1492 |
AGAR MEDIUM L (as per EP) (BRILLIANT GREEN, PHENOL RED, LACTOSE, SUCROSE AGAR) (for selective isolation of Salmonella other than Salmonella serotype Typhi from foods and |
100 gm |
71-Eur |
TitanBiotech |
cell culture |
| CSB-PA022933GA01HU |
Rabbit anti-human sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA022935GA01HU |
Rabbit anti-human sulfotransferase family, cytosolic, 1A, phenol-preferring, member 3 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| TM 1492 |
AGAR MEDIUM L (as per EP) (BRILLIANT GREEN, PHENOL RED, LACTOSE, SUCROSE AGAR) (for selective isolation of Salmonella other than Salmonella serotype Typhi from foods and |
500 gm |
113-Eur |
TitanBiotech |
cell culture |
| TM 1492 |
AGAR MEDIUM L (as per EP) (BRILLIANT GREEN, PHENOL RED, LACTOSE, SUCROSE AGAR) (for selective isolation of Salmonella other than Salmonella serotype Typhi from foods and |
500 gm |
113-Eur |
TitanBiotech |
cell culture |
| PR-680 |
CD40L, soluble |
50 |
273-Eur |
Jena Bioscience |
|
| RP17630430002 |
CD4 soluble |
2 µg |
143-Eur |
Biovendor |
|
| RP17630460001 |
CD4 soluble |
1 mg |
5292-Eur |
Biovendor |
|
| RP17630430010 |
CD4 soluble |
10 µg |
238-Eur |
Biovendor |
|
| TRL02-100ML |
Buffers and Supplements,Trypsin-EDTA Solution 0.5% (10X),Contains 0.5% trypsin, 5.3mM EDTA , and 8.5 g_L NaCl. No phenol red. Sterile filtered. Porcine parvovirus and mycoplasma tested. |
100ml |
61-Eur |
Caisson Laboratory |
|
| TM 197 |
PHENOL RED EGG YOLK POLYMYXIN AGAR BASE (MYP AGAR BASE) ( for isolation and identification of path |
100 gm |
74-Eur |
TitanBiotech |
cat |
| TM 197 |
PHENOL RED EGG YOLK POLYMYXIN AGAR BASE (MYP AGAR BASE) ( for isolation and identification of path |
500 gm |
125-Eur |
TitanBiotech |
cat |
| TM 197 |
PHENOL RED EGG YOLK POLYMYXIN AGAR BASE (MYP AGAR BASE) ( for isolation and identification of path |
100 gm |
74-Eur |
TitanBiotech |
cat |
| TM 197 |
PHENOL RED EGG YOLK POLYMYXIN AGAR BASE (MYP AGAR BASE) ( for isolation and identification of path |
500 gm |
125-Eur |
TitanBiotech |
cat |
| 1762-10 |
Honokiol 2-(4-hydroxy-3-prop-2-enyl-phenyl)- 4-prop-2-enyl-phenol; HNK; Houpa |
10 mg |
108-Eur |
Biovision |
|
| 1762-50 |
Honokiol 2-(4-hydroxy-3-prop-2-enyl-phenyl)- 4-prop-2-enyl-phenol; HNK; Houpa |
50 mg |
284-Eur |
Biovision |
|
| CYT-304 |
Recombinant Human Soluble CD4 |
10µg |
198-Eur |
Prospecbio |
recombinant |
| 32131-42 |
Starch, Soluble |
25 g |
26-Eur |
Nacalai |
|
| KG573 |
Soluble CD147 |
|
1419-Eur |
Sceti K.K. |
|
| 32122-75 |
Starch, Soluble |
500G |
117-Eur |
Nacalai |
|
| 32122-75 |
Starch, Soluble |
500 g |
24-Eur |
Nacalai |
|
| 8-TRs |
Transferrin Receptor, Soluble |
500ug |
1242-Eur |
Advenced Immuno Chemical |
recombinant |
| 32131-42 |
Starch, Soluble |
25G |
118-Eur |
Nacalai |
|
| E-EL-R0911 |
Rat sFLT1_sVEGFR1 (Soluble |
96T |
583-Eur |
Elabscience |
|
| 32122-62 |
Starch, Soluble |
25Kg |
274-Eur |
Nacalai |
|
| FL-101 |
Fas Ligand Protein, soluble |
10 µg |
327-Eur |
Kamiya Biomedical KB |
|
| 32126-64 |
Starch, Soluble |
100G |
168-Eur |
Nacalai |
|
| 32131-55 |
Starch, Soluble |
500G |
144-Eur |
Nacalai |
|
| CYT-304 |
Recombinant Human Soluble CD4 |
2µg |
113-Eur |
Prospecbio |
recombinant |
| 32126-64 |
Starch, Soluble |
100 g |
123-Eur |
Nacalai |
|
| E02P0042 |
Rat soluble P53 ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| ARP42228_P050 |
GPD1 (soluble) |
50 µg |
513-Eur |
ACR |
|
| FL-101 |
Fas Ligand Protein, soluble |
10 µg |
327-Eur |
Kamiya Biomedical KB |
|
| V03250 |
Vitamin K3 (Oil Soluble) |
100 G |
195-Eur |
pfalslandbauer. |
|
| V03250 |
Vitamin K3 (Oil Soluble) |
25 G |
107-Eur |
pfalslandbauer. |
|
| S08583 |
Starch, Soluble |
500 G |
227-Eur |
pfalslandbauer. |
|
| KG573 |
Soluble CD147 |
96well |
1340-Eur |
Sceti K.K. |
|
| S-1004-105 |
S-4FB Crosslinker (DMF Soluble) |
5 x 1.0 mg |
134-Eur |
Solulink |
|
| KG573 |
Soluble CD147 |
- |
1001-Eur |
TransGenic |
|
| 1909-1 |
KN-93, Water-Soluble |
1 mg |
172-Eur |
Biovision |
|
| PA107-02 |
Soluble TMB Substrate |
500 ml |
166-Eur |
Tiangen |
rat |
| RP-1127 |
rh Soluble CD_4 |
50 µg |
523-Eur |
LeeBio |
|
| ARP42227_P050 |
GPD1 (soluble) |
50 µg |
513-Eur |
ACR |
|
| CYT-304 |
Recombinant Human Soluble CD4 |
1mg |
6846-Eur |
Prospecbio |
recombinant |
| 1909-5 |
KN-93, Water-Soluble |
5 mg |
464-Eur |
Biovision |
|
| KG573 |
Soluble CD147 |
|
1419-Eur |
Sceti K.K. |
|
| 32131-55 |
Starch, Soluble |
500 g |
77-Eur |
Nacalai |
|
| E02S0221 |
Rat soluble protein-100 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| PA107-01 |
Soluble TMB Substrate |
100 ml |
109-Eur |
Tiangen |
rat |
| FL-101 |
Fas Ligand Protein, soluble |
10 |
421-Eur |
Kamiya Biomedical KB |
|
| 8-TRs |
Transferrin Receptor, Soluble |
100ug |
802-Eur |
Advenced Immuno Chemical |
recombinant |
| S-1004-010 |
S-4FB Crosslinker (DMF Soluble) |
10 mg |
177-Eur |
Solulink |
|
| SB0904 |
Starch soluble |
500G |
66-Eur |
BBI Biotech |
|
| TM 434 |
SYNTHETIC BROTH, AOAC (WRIGHT AND MUNDY BROTH) (as per AOAC) (for determination of phenol c |
500 gm |
124-Eur |
TitanBiotech |
|
| TM 434 |
SYNTHETIC BROTH, AOAC (WRIGHT AND MUNDY BROTH) (as per AOAC) (for determination of phenol c |
500 gm |
124-Eur |
TitanBiotech |
|
| TMA500 |
TMB Soluble Reagent (Aqueous) |
500 ml |
139-Eur |
Scy tek |
|
| E11P0042 |
Bovine soluble P53 ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| PA124X |
KITLG _ SCF (soluble form) |
10 µg |
296-Eur |
ACR |
assays |
| E01S0230 |
Human soluble CD36 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03S0221 |
Mouse soluble protein-100 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E11S0221 |
Bovine soluble protein-100 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E01S0221 |
Human soluble protein-100 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| CSB-E07446r |
Rat soluble interleukin_1 receptor |
96tests |
722-Eur |
Cusabio |
recombinant |
| GTX29980 |
CD120a _ TNFR1 (Soluble) |
20 µg |
415-Eur |
ACR |
|
| PA124 |
KITLG _ SCF (soluble form) |
2 µg |
177-Eur |
ACR |
assays |
| E02P0042 |
Rat anti-soluble P53 ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| TMA999 |
TMB Soluble Reagent (Aqueous) |
1000 ml |
195-Eur |
Scy tek |
|
| TN-001 |
TNF_alpha, Soluble (mouse recombinant) |
50 |
492-Eur |
Kamiya Biomedical KB |
recombinant |
| F00930 |
Ferric Pyrophosphate Soluble |
200 G |
131-Eur |
pfalslandbauer. |
|
| KT-586 |
Human Soluble Alpha_Klotho ELISA Kit |
96 tests |
1490-Eur |
Kamiya Biomedical KB |
elisa |
| C18300 |
Chlorophyll water soluble |
500 G |
799-Eur |
pfalslandbauer |
|
| E02S0221 |
Rat anti-soluble protein-100 |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| 8Tr56 |
Transferrin Receptor, Soluble |
0,1mg |
830-Eur |
Hytest |
recombinant |
| C18300 |
Chlorophyll water soluble |
100 G |
301-Eur |
pfalslandbauer |
|
| ACLCYT304 |
Soluble CD4, Human, recombinant |
50 µg. |
----Eur |
Accurate |
recombinant |
| D26010 |
Digitonin water-soluble |
250 MG |
364-Eur |
pfalslandbauer |
|
| TK1 |
TK1 Gene thymidine kinase 1, soluble |
|
----Eur |
Transposagen |
|
| PR27033-10 |
CD154 _ CD40L (Soluble) |
10 µg |
427-Eur |
ACR |
|
| PR27033-50 |
CD154 _ CD40L (Soluble) |
50 µg |
569-Eur |
ACR |
|
| FL-101 |
Biochemical: Fas Ligand Protein, soluble |
10 |
444-Eur |
Kamiya Biomedical KB |
|
| D26010 |
Digitonin water-soluble |
1000 MG |
1039-Eur |
pfalslandbauer |
|
| S01-062 |
Human Thrombomodulin, soluble Source Hek 293 |
20 µg |
265-Eur |
Reliatech |
human |
| TN-002 |
TNF_alpha, soluble (human recombinant) |
50 |
504-Eur |
Kamiya Biomedical KB |
recombinant |
| E04S0221 |
Rabbit soluble protein-100 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| ACLCYT304B |
Soluble CD4, Human, recombinant |
100 µg. |
----Eur |
Accurate |
recombinant |
| C16855 |
Chlorophenol Red Water Soluble |
5 G |
129-Eur |
pfalslandbauer. |
|
| U0567r |
Rat Soluble protein_100B CLIA KIT |
96T |
755-Eur |
EIAab |
assays |
| CSB-E07446r |
Rat soluble interleukin_1 receptor |
96T |
781-Eur |
Cusabio |
recombinant |
| E0568r |
Rat Soluble protein_100 ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| CSB-E07448r |
Rat soluble interleukin_1 receptor |
96T |
856-Eur |
Cusabio |
recombinant |
| E03P0042 |
Mouse soluble P53 ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| TN-002 |
TNF_alpha, soluble (human recombinant) |
50 µg |
404-Eur |
Kamiya Biomedical KB |
recombinant |
| OETCGF304 |
Soluble CD4 Human Recombinant |
10 |
171-Eur |
OET |
|
| QY-E11568 |
Rat Soluble protein-100(S-100)ELISA Kit |
96T |
482-Eur |
SQBIO |
|
| TN-001 |
TNF_alpha, Soluble (mouse recombinant) |
50 µg |
404-Eur |
Kamiya Biomedical KB |
recombinant |
| E07P0042 |
Porcine soluble P53 ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| PR27032-2 |
Recombinant Human Soluble CD4, 10 ug. |
|
176-Eur |
Neuromics |
|
| PR27032-10 |
Recombinant Human Soluble CD4, 10 ug. |
|
290-Eur |
Neuromics |
|
| RP-1129 |
rh Soluble RANK ligand |
10 µg |
291-Eur |
LeeBio |
|
| cyt-304 |
Recombinant Human Soluble CD4 sCD4 |
2 |
100-Eur |
Prospecbio |
|
| cyt-304 |
Recombinant Human Soluble CD4 sCD4 |
10 |
175-Eur |
Prospecbio |
|
| CYT-533 |
Recombinant Rat Prolactin Soluble Receptor |
1mg |
1524-Eur |
Prospecbio |
recombinant |
| SU8Tr56-1 |
Transferrin Receptor, soluble |
1 mg. |
4200-Eur |
Accurate |
recombinant |
| E0076Ra |
Rat Soluble protein-100,S-100 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| BC-097 |
APRIL, soluble human recombinant |
30 ug |
753-Eur |
Kamiya Biomedical KB |
recombinant |
| BC-311 |
Visfatin, soluble, human recombinant, His |
50 ug |
658-Eur |
Kamiya Biomedical KB |
recombinant |
| BC-312 |
Visfatin, soluble, mouse recombinant, His |
50 ug |
658-Eur |
Kamiya Biomedical KB |
recombinant |
| E0569r |
Rat soluble platelet_selectin ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| 201-11-0077 |
Rat Soluble protein-100,S-100 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| CYT-533 |
Recombinant Rat Prolactin Soluble Receptor |
10µg |
113-Eur |
Prospecbio |
recombinant |
| TN-001 |
TNF_alpha, Soluble (mouse recombinant) |
50 µg |
404-Eur |
Kamiya Biomedical KB |
recombinant |
| TN-002 |
TNF_alpha, soluble (human recombinant) |
50 µg |
404-Eur |
Kamiya Biomedical KB |
recombinant |
| cyt-304 |
Recombinant Human Soluble CD4 sCD4 |
1mg |
6058-Eur |
Prospecbio |
|
| U0568r |
Rat Soluble protein_100 CLIA KIT |
96T |
755-Eur |
EIAab |
assays |
| C18300 |
Chlorophyll water soluble |
10 G |
172-Eur |
pfalslandbauer. |
|
| C16855 |
Chlorophenol Red Water Soluble |
100 G |
391-Eur |
pfalslandbauer. |
|
| 2081-100 |
Digitonin, Water-Soluble |
100 mg |
133-Eur |
Biovision |
|
| 2081-250 |
Digitonin, Water-Soluble |
250 mg |
240-Eur |
Biovision |
|
| C16855 |
Chlorophenol Red Water Soluble |
25 G |
157-Eur |
pfalslandbauer. |
|
| E01P0042 |
Human soluble P53 ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| BC-091 |
TRAIL_His tag, soluble (human recombinant) |
20 ug |
581-Eur |
Kamiya Biomedical KB |
recombinant |
| BC-322 |
BAFF(mouse recombinant soluble) |
10 ug |
575-Eur |
Kamiya Biomedical KB |
recombinant |
| 7-01458 |
Recombinant Human Soluble CD4 |
1mg |
10469-Eur |
CHI |
|
| CYT-533 |
Recombinant Rat Prolactin Soluble Receptor |
50µg |
198-Eur |
Prospecbio |
recombinant |
| BC-321 |
BAFF (human recombinant soluble) |
10 ug |
587-Eur |
Kamiya Biomedical KB |
recombinant |
| BC-321 |
BAFF (human recombinant soluble) |
10 ug |
587-Eur |
Kamiya Biomedical KB |
recombinant |
| BC-312 |
Visfatin, soluble, mouse recombinant, His |
50 ug |
658-Eur |
Kamiya Biomedical KB |
recombinant |
| BC-311 |
Visfatin, soluble, human recombinant, His |
50 ug |
658-Eur |
Kamiya Biomedical KB |
recombinant |
| BC-097 |
APRIL, soluble human recombinant |
30 ug |
753-Eur |
Kamiya Biomedical KB |
recombinant |
| BC-091 |
TRAIL_His tag, soluble (human recombinant) |
20 ug |
581-Eur |
Kamiya Biomedical KB |
recombinant |
| E07S0221 |
Porcine soluble protein-100 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| BC-322 |
BAFF(mouse recombinant soluble) |
10 ug |
575-Eur |
Kamiya Biomedical KB |
recombinant |
| TMA125 |
TMB Soluble Reagent (Aqueous) |
125 ml |
92-Eur |
Scy tek |
|
| E02S0222 |
Rat Soluble thrombomodulin ELISA , sTM |
|
689-Eur |
Blue Gene Biotech |
|
| E-EL-R0903 |
Rat S-100 (Soluble Protein-100) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| IRKTAH1292-1 Kit |
Human Soluble AXL ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| CSB-E07448r |
Rat soluble interleukin_1 receptor |
96tests |
856-Eur |
Cusabio |
recombinant |
| CSB-E07446r |
Rat soluble interleukin_1 receptor |
96tests |
781-Eur |
Cusabio |
recombinant |
| CK-E30416 |
Rat Soluble protein-100,S-100 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| OETCGF304 |
Soluble CD4 Human Recombinant |
2 |
92-Eur |
OET |
|
| M56616949 |
Starch, soluble CAS: [9005-84-9] |
1 kg |
140-Eur |
Molekula |
|
| U0046r |
Rat soluble glucoprotein 130 CLIA KIT |
96T |
755-Eur |
EIAab |
assays |
| U0549r |
Rat soluble endothelium_selectin CLIA KIT |
96T |
755-Eur |
EIAab |
assays |
| E02S0294 |
Rat soluble toll-like receptor 6 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0293 |
Rat soluble toll-like receptor 2 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| 81-6363-07 |
Organically-Soluble eFluor |
|
501-Eur |
eBioscience |
|
| 82-6363-07 |
Organically-Soluble eFluor |
|
501-Eur |
eBioscience |
|
| 91-6363-07 |
Organically-Soluble eFluor |
|
501-Eur |
eBioscience |
|
| 92-6363-07 |
Organically-Soluble eFluor |
|
501-Eur |
eBioscience |
|
| 93-6363-07 |
Organically-Soluble eFluor |
|
501-Eur |
eBioscience |
|
| 56360-46-4 |
Eosin B spirit soluble 90% |
1g |
----Eur |
chemotra |
|
| E02P0042 |
Rat Soluble P53 ELISA , sP53 |
|
689-Eur |
Blue Gene Biotech |
|
| E02P0042 |
Rat Soluble P53 ELISA , sP53 |
96 Tests/kit |
601-Eur |
BGene |
|
| RP17647230025 |
CD40 soluble Ligand_TRAP |
25 µg |
238-Eur |
Biovendor |
|
| RP17647230005 |
CD40 soluble Ligand_TRAP |
5 µg |
143-Eur |
Biovendor |
|
| RP17624560001 |
CD40 soluble Ligand_TRAP |
1 mg |
1772-Eur |
Biovendor |
|
| RP17624530050 |
CD40 soluble Ligand_TRAP |
50 µg |
238-Eur |
Biovendor |
|
| C18300 |
Chlorophyll water soluble |
|
188-Eur |
pfalslandbauer |
|
| RP17624530010 |
CD40 soluble Ligand_TRAP |
10 µg |
143-Eur |
Biovendor |
|
| E06P0042 |
Goat soluble P53 ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E0567r |
Rat Soluble protein_100B ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| S-1002-010 |
S-HyNic Crosslinker (DMF Soluble) |
10 mg |
240-Eur |
Solulink |
|
| S-1002-105 |
S-HyNic Crosslinker (DMF Soluble) |
5 x 1.0 mg |
177-Eur |
Solulink |
|
| 24404-22 |
Nigrosine(alcohol soluble) |
25 g |
51-Eur |
Nacalai |
|
| 24403-32 |
Nigrosine(water soluble) |
25 g |
57-Eur |
Nacalai |
|
| 1949150 |
STARCH SOLUBLE extrapure AR |
500 g |
133-Eur |
Sisco Research |
|
| E0046r |
Rat soluble glucoprotein 130 ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| 1948195 |
STARCH SOLUBLE extrapure |
500 g |
132-Eur |
Sisco Research |
|
| 94-6363-07 |
Organically-Soluble eFluor |
|
501-Eur |
eBioscience |
|
| 95-6363-07 |
Organically-Soluble eFluor |
|
501-Eur |
eBioscience |
|
| E02R0361 |
Rat soluble Retinoid X Receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02P0110 |
Rat soluble P-selectin Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| A86650H |
Soluble Transferrin Receptor |
100ug |
1143-Eur |
Meridian Life Science |
recombinant |
| GTX29980 |
soluble TNF Receptor I protein |
20 µg |
499-Eur |
ACR |
recombinant |
| GTX15567 |
soluble TNF Receptor I prediluted |
7 ml |
499-Eur |
ACR |
recombinant |
| IRKTAH1520 |
Human Soluble IL-1R II ELISA Kit |
1 kit(96 Wells) |
818-Eur |
Innovative Research INC |
|
| E02L0297 |
Rat soluble Liver Receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02I0381 |
Rat Soluble Interleukin 2β receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02I0379 |
Rat Soluble Interleukin 2a receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02E0021 |
Rat soluble E-selectin ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02I0378 |
Rat soluble Interleukin 2 recepter |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0549r |
Rat soluble endothelium_selectin ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| E02I0368 |
Rat soluble interleukin-1 receptor II |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02I0366 |
Rat soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| IRKTAH1523 |
Human Soluble LOX-1 ELISA Kit |
1 kit(96 Wells) |
818-Eur |
Innovative Research INC |
|
| 201-20-7002 |
SGC{soluble glycoprotein C}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| SB0904(C8560) |
Starch soluble |
500G |
55-Eur |
Bio Basic Inc. |
|
| E02S0281 |
Rat soluble platelet-selectin |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0266 |
Rat leptin soluble receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0263 |
Rat soluble liver antigen |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0262 |
Rat soluble interleukin 8 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0261 |
Rat soluble interleukin 7 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E08P0042 |
Canine soluble P53 ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E02S0260 |
Rat soluble interleukin 6 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0252 |
Rat soluble endothelium-selectin |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| BQ016A-CR |
ã_GT Soluble, Kinetic, 10 x 15 ml |
150 Tests / Kit |
301-Eur |
Bioquant |
|
| E08S0221 |
Canine soluble protein-100 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| BQ016B-CR |
ã_GT Soluble, Kinetic, 8 x 50 ml |
400 Tests / Kit |
470-Eur |
Bioquant |
|
| E02S0239 |
Rat soluble cluster of differentiation 86 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| RP-1128 |
rh soluble CD40 Ligand_TRAP |
50 µg |
291-Eur |
LeeBio |
|
| E02S0233 |
Rat soluble adhesion molecules |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0226 |
Rat Soluble protein-100B |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02F0265 |
Rat soluble Farnesoid Xreceptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| RP17647260001 |
CD40 soluble Ligand_TRAP |
1 mg |
2911-Eur |
Biovendor |
|
| RP17633430002 |
RANK soluble Ligand |
2 µg |
143-Eur |
Biovendor |
|
| E05S0221 |
Guinea soluble protein-100 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 24403-32 |
Nigrosine(water soluble) |
25G |
133-Eur |
Nacalai |
|
| A36272 |
Aurantia Water Soluble |
|
356-Eur |
pfalslandbauer |
Antibodies |
| N001015 |
HUILE SOLUBLE 250X26RL_T1_LL_P18 |
1 |
81-Eur |
Brady |
|
| N001115 |
HUILE SOLUBLE 355X37RL_T1_LL_P18 |
1 |
97-Eur |
Brady |
|
| N001215 |
HUILE SOLUBLE 450X52RL_T1_LL_P18 |
1 |
123-Eur |
Brady |
|
| RP17663160001 |
RANK soluble Ligand, GST Tag |
1 mg |
5006-Eur |
Biovendor |
|
| RP17663130010 |
RANK soluble Ligand, GST Tag |
10 µg |
238-Eur |
Biovendor |
|
| 7-01456 |
Recombinant Human Soluble CD4 |
2 |
164-Eur |
CHI |
|
| RP17663130002 |
RANK soluble Ligand, GST Tag |
2 µg |
143-Eur |
Biovendor |
|
| RP17633460001 |
RANK soluble Ligand |
1 mg |
5006-Eur |
Biovendor |
|
| RP17633430010 |
RANK soluble Ligand |
10 µg |
238-Eur |
Biovendor |
|
| N002658 |
HUILE SOLUBLE 100X33RL_T2_P18 |
1 |
261-Eur |
Brady |
|
| N002659 |
HUILE SOLUBLE 100X33RL_T3_P18 |
1 |
261-Eur |
Brady |
|
| E06S0221 |
Goat soluble protein-100 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| CK-E98451 |
Rat Soluble protein-100,S-100 ELISAkit |
|
----Eur |
Glory |
|
| E05P0042 |
Guinea soluble P53 ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E04P0042 |
Rabbit soluble P53 ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| CSB-E07448r |
Rat soluble interleukin_1 receptor |
96tests |
797-Eur |
Cusabio |
recombinant |
| 85169-06-8 |
Manganese(II) citrate Soluble |
1g |
----Eur |
chemotra |
rat |
| C18300 |
Chlorophyll water soluble |
25 G |
151-Eur |
pfalslandbauer |
|
| SB0904(C8560) |
Starch soluble |
500G |
60-Eur |
BBI Biotech |
|
| 01735-15 |
Aluminium Acetate, soluble CAS: 142-03-0 |
500G |
113-Eur |
Nacalai |
|
| PR27032-10 |
Recombinant Human Soluble CD4, 10 ug. |
1 |
344-Eur |
Neuromics |
recombinant |
| PR27032-50 |
Recombinant Human Soluble CD4, 50 ug. |
1 |
817-Eur |
Neuromics |
recombinant |
| 228-10191-1 |
Recombinant Human Soluble CD4 |
2 |
201-Eur |
Ray Biotech |
recombinant |
| 228-10191-2 |
Recombinant Human Soluble CD4 |
10 |
290-Eur |
Ray Biotech |
recombinant |
| 201-11-0077 |
Rat Soluble protein-100(S-100)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| E0076Ra |
Rat Soluble protein-100,S-100 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| 7-01457 |
Recombinant Human Soluble CD4 |
10 |
346-Eur |
CHI |
|
| E13P0042 |
Anserine soluble P53 ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| RP17632060001 |
RANK soluble Ligand |
1 mg |
5006-Eur |
Biovendor |
|
| N002840 |
HUILE SOLUBLE 150X12CARD_T1_P18 |
1 |
9-Eur |
Brady |
|
| C16855 |
Chlorophenol Red Water Soluble |
|
407-Eur |
pfalslandbauer |
|
| 24404-22 |
Nigrosine(alcohol soluble) |
25G |
131-Eur |
Nacalai |
|
| RP17629430050 |
Prolactin Soluble Receptor |
50 µg |
238-Eur |
Biovendor |
recombinant |
| RP17629430010 |
Prolactin Soluble Receptor |
10 µg |
143-Eur |
Biovendor |
recombinant |
| RP17629360001 |
Prolactin Soluble Receptor |
1 mg |
1703-Eur |
Biovendor |
recombinant |
| RP17629330050 |
Prolactin Soluble Receptor |
50 µg |
238-Eur |
Biovendor |
recombinant |
| RP17629330010 |
Prolactin Soluble Receptor |
10 µg |
143-Eur |
Biovendor |
recombinant |
| RP17626860001 |
Prolactin Soluble Receptor |
1 mg |
1703-Eur |
Biovendor |
recombinant |
| RP17626830050 |
Prolactin Soluble Receptor |
50 µg |
238-Eur |
Biovendor |
recombinant |
| RP17626830010 |
Prolactin Soluble Receptor |
10 µg |
143-Eur |
Biovendor |
recombinant |
| 01735-15 |
Aluminium Acetate, soluble |
500 g |
24-Eur |
Nacalai |
|
| E13S0221 |
Anserine soluble protein-100 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| U0569r |
Rat soluble platelet_selectin CLIA KIT |
96T |
755-Eur |
EIAab |
assays |
| 01735-15 |
Aluminium Acetate, soluble |
500G |
118-Eur |
Nacalai |
|
| C16855 |
Chlorophenol Red Water Soluble |
|
137-Eur |
pfalslandbauer |
|
| C16855 |
Chlorophenol Red Water Soluble |
|
166-Eur |
pfalslandbauer |
|
| RP17629460001 |
Prolactin Soluble Receptor |
1 mg |
1703-Eur |
Biovendor |
recombinant |
| E02S0222 |
Rat Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
601-Eur |
BGene |
|
| RP17632030002 |
RANK soluble Ligand |
2 µg |
143-Eur |
Biovendor |
|
| N003139 |
HUILE SOLUBLE 450X52CARD_T1_P18 |
1 |
9-Eur |
Brady |
|
| 20815 |
Rat Soluble Protein-100(S-100) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| RP17632030010 |
RANK soluble Ligand |
10 µg |
238-Eur |
Biovendor |
|
| RP17653360001 |
Prolactin Soluble Receptor |
1 mg |
1703-Eur |
Biovendor |
recombinant |
| N002939 |
HUILE SOLUBLE 250X26CARD_T1_P18 |
1 |
12-Eur |
Brady |
|
| N002938 |
HUILE SOLUBLE 250X26CARD_T1 |
1 |
12-Eur |
Brady |
|
| RP17653330050 |
Prolactin Soluble Receptor |
50 µg |
238-Eur |
Biovendor |
recombinant |
| RP17653330010 |
Prolactin Soluble Receptor |
10 µg |
143-Eur |
Biovendor |
recombinant |
| RP17653260001 |
Prolactin Soluble Receptor |
1 mg |
1703-Eur |
Biovendor |
recombinant |
| RP17653230050 |
Prolactin Soluble Receptor |
50 µg |
238-Eur |
Biovendor |
recombinant |
| RP17653230010 |
Prolactin Soluble Receptor |
10 µg |
143-Eur |
Biovendor |
recombinant |
| N003039 |
HUILE SOLUBLE 355X37CARD_T1_P18 |
1 |
11-Eur |
Brady |
|
| 94031-01-3 |
Tris[[(2-aminoethyl)amino]methyl]phenol Tris[[(2-aminoethyl)ami |
1g |
----Eur |
chemotra |
|
| 37205-74 |
Phenol Reagent Solution 〔Folin‐Ciocalteu's Reagent Solution〕 |
100ML |
126-Eur |
Nacalai |
|
| 37205-45 |
Phenol Reagent Solution 〔Folin‐Ciocalteu's Reagent Solution〕 |
500ML |
164-Eur |
Nacalai |
|
| 37205-74 |
Phenol Reagent Solution 〔Folin‐Ciocalteu's Reagent Solution〕 CAS: |
100ML |
119-Eur |
Nacalai |
|
| 37205-45 |
Phenol Reagent Solution 〔Folin‐Ciocalteu's Reagent Solution〕 CAS: |
500ML |
156-Eur |
Nacalai |
|
| BW672 |
Phenol Red Egg Yolk Polymyxin Agar Base USE : For see MYP Agar Base |
5x500gm |
290-Eur |
biomarkt |
|
| 15860-96-5 |
4_nonyl_2,6_bis(1_phenylethyl)phenol 4_nonyl_2,6_bis(1_pheny |
1g |
----Eur |
chemotra |
|
| BW672 |
Phenol Red Egg Yolk Polymyxin Agar Base USE For see MYP Agar Base |
Qty per Litre of Medium: 46 |
3-Eur |
biomarkt |
|
| 68443-37-8 |
tris[p-(1-methyl-1-phenylethyl)phenol], tri tris[p-(1-methyl-1-phen |
1g |
----Eur |
chemotra |
|
| P-06724 |
PHENOL DISULPHONIC ACID SOLUTION (25% solution w_v in sulphuric acid ) CAS: 96-77-5 |
500 ml |
129-Eur |
Oxford Lab |
|
| 06880-42 |
Aniline Blue(water soluble) |
25 g |
71-Eur |
Nacalai |
|
| E05S0263 |
Guinea soluble liver antigen |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E09S0222 |
Monkey Soluble thrombomodulin ELISA , sTM |
|
715-Eur |
Blue Gene Biotech |
|
| E05S0266 |
Guinea leptin soluble receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E13S0233 |
Anserine soluble adhesion molecules |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E0417Ra |
Rat Leptin Soluble Receptor,sLR ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E13S0239 |
Anserine soluble cluster of differentiation 86 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E09P0042 |
Monkey Soluble P53 ELISA , sP53 |
|
715-Eur |
Blue Gene Biotech |
|
| E05S0239 |
Guinea soluble cluster of differentiation 86 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E13S0226 |
Anserine Soluble protein-100B |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E13P0110 |
Anserine soluble P-selectin Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E05S0252 |
Guinea soluble endothelium-selectin |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E04I0368 |
Rabbit soluble interleukin-1 receptor II |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E13R0361 |
Anserine soluble Retinoid X Receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E02S0158 |
Rat Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0222 |
Human Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
601-Eur |
BGene |
|
| E05S0260 |
Guinea soluble interleukin 6 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0261 |
Guinea soluble interleukin 7 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0262 |
Guinea soluble interleukin 8 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 14410-42 |
Eosin Yellowish(water soluble) |
25 g |
55-Eur |
Nacalai |
|
| CSB-E09905Rb |
Rabbit soluble interleukin_1 receptor |
96tests |
896-Eur |
Cusabio |
recombinant |
| E13S0263 |
Anserine soluble liver antigen |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CSB-E08069r |
Rat Soluble protein_100,S_100 ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| E13S0266 |
Anserine leptin soluble receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E13S0281 |
Anserine soluble platelet-selectin |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| U0074r |
Rat soluble interleukin_2 receptor CLIA KIT |
96T |
755-Eur |
EIAab |
recombinant |
| CSB-E08066r |
Rat Soluble protein_100B,S_100B ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| E02S0266 |
Rat Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
601-Eur |
BGene |
|
| CSB-E07996r |
Rat soluble E_selectin,sE_selectin ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| CSB-E08078r |
Rat soluble P_selectin,sP_selectin ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| E13S0262 |
Anserine soluble interleukin 8 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E13S0261 |
Anserine soluble interleukin 7 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E02S0008 |
Rat Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E05S0293 |
Guinea soluble toll-like receptor 2 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0294 |
Guinea soluble toll-like receptor 6 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06P0042 |
Goat Soluble P53 ELISA , sP53 |
96 Tests/kit |
608-Eur |
BGene |
|
| E02R0361 |
Rat Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
601-Eur |
BGene |
|
| U0075r |
Rat soluble interleukin_2 receptor CLIA KIT |
96T |
755-Eur |
EIAab |
recombinant |
| E13S0252 |
Anserine soluble endothelium-selectin |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E13S0260 |
Anserine soluble interleukin 6 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E05S0281 |
Guinea soluble platelet-selectin |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| CSB-E13261h |
Human Soluble Thromobomodulin (STM) ELISA KIT |
96tests |
781-Eur |
Cusabio |
elisa |
| E11P0042 |
Bovine Soluble P53 ELISA , sP53 |
|
715-Eur |
Blue Gene Biotech |
|
| E1289Hu |
Human Soluble protein-100,S-100 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E05E0021 |
Guinea soluble E-selectin ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| S01-030 |
Human FAS receptor, soluble Source E. coli |
20 µg |
265-Eur |
Reliatech |
recombinant |
| E04I0379 |
Rabbit Soluble Interleukin 2a receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E05F0265 |
Guinea soluble Farnesoid Xreceptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05I0366 |
Guinea soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| CK-E98069 |
Rat soluble Interleukin 6 receptor,sIL-6R ELISAkit |
|
----Eur |
Glory |
|
| DEBMS6010 |
CD40L, soluble, Species mouse |
96 tests |
823-Eur |
Demeditec |
mouse |
| DEBMS652 |
VE_cadherin, soluble, Species monkey |
96 tests |
781-Eur |
Demeditec |
|
| CK-E98057 |
Rat soluble Interleukin 2 recepter,IL-2sR ELISAkit |
|
----Eur |
Glory |
|
| AR1018 |
Water Soluble Sealing Reagent |
50ml |
97-Eur |
SDlabs |
|
| E01S0293 |
Human soluble toll-like receptor 2 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| DEBMS651 |
PECAM_1, soluble, Species monkey |
96 tests |
781-Eur |
Demeditec |
|
| E01S0294 |
Human soluble toll-like receptor 6 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0549Ch |
Chicken soluble endothelium_selectin ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E04L0297 |
Rabbit soluble Liver Receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0875Hu |
Human soluble Phospholipase A2,sPL-A2 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E04I0381 |
Rabbit Soluble Interleukin 2β receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| DEBMS650/2 |
P_selectin, soluble, Species monkey |
96 tests |
781-Eur |
Demeditec |
|
| E04P0042 |
Rabbit Soluble P53 ELISA , sP53 |
|
689-Eur |
Blue Gene Biotech |
|
| E13L0297 |
Anserine soluble Liver Receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| RCYT-304B |
Recombinant Human Soluble CD4 |
10µg |
234-Eur |
SeraLab |
recombinant |
| E0127Ra |
Rat soluble Interleukin 2 recepter,IL-2sR ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E05P0110 |
Guinea soluble P-selectin Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05R0361 |
Guinea soluble Retinoid X Receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0226 |
Guinea Soluble protein-100B |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0233 |
Guinea soluble adhesion molecules |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| RCYT-304A |
Recombinant Human Soluble CD4 |
2µg |
127-Eur |
SeraLab |
recombinant |
| E04I0378 |
Rabbit soluble Interleukin 2 recepter |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| S01-063 |
Human CD100, soluble Source CHO cells |
20 µg |
265-Eur |
Reliatech |
human |
| E05L0297 |
Guinea soluble Liver Receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05I0381 |
Guinea Soluble Interleukin 2β receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05I0368 |
Guinea soluble interleukin-1 receptor II |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| S01-051 |
Human DLL_4, soluble Source 293 cells |
25 µg |
265-Eur |
Reliatech |
human |
| DEBMS649 |
E_selectin, soluble, Species monkey |
96 tests |
781-Eur |
Demeditec |
|
| MA-CD4-6 |
Anti_human CD4 (soluble receptor) IgG fraction (monoclonal) |
200 µg |
225-Eur |
AustralBiologicals |
recombinant |
| DEBMS648 |
ICAM_1, soluble, Species monkey |
96 tests |
781-Eur |
Demeditec |
|
| E05I0378 |
Guinea soluble Interleukin 2 recepter |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05I0379 |
Guinea Soluble Interleukin 2a receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E01P0042 |
Human Soluble P53 ELISA , sP53 |
96 Tests/kit |
601-Eur |
BGene |
|
| E08S0252 |
Canine soluble endothelium-selectin |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| U0219r |
Rat Leptin Soluble Receptor CLIA KIT |
96T |
755-Eur |
EIAab |
recombinant |
| IRKTAH1406 |
Human HBEGF (Soluble) ELISA Kit |
1 kit(96 Wells) |
652-Eur |
Innovative Research INC |
|
| IRKTAH1513 |
Human Soluble CD36 ELISA Kit |
1 kit(96 Wells) |
696-Eur |
Innovative Research INC |
|
| E04E0021 |
Rabbit soluble E-selectin ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E07S0222 |
Porcine Soluble thrombomodulin ELISA , sTM |
|
715-Eur |
Blue Gene Biotech |
|
| U0567Rb |
Rabbit Soluble protein_100B CLIA KIT |
96T |
839-Eur |
EIAab |
polyclonal |
| U0568Rb |
Rabbit Soluble protein_100 CLIA KIT |
96T |
839-Eur |
EIAab |
polyclonal |
| E08S0239 |
Canine soluble cluster of differentiation 86 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E07P0042 |
Porcine Soluble P53 ELISA , sP53 |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0233 |
Canine soluble adhesion molecules |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08R0361 |
Canine soluble Retinoid X Receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| 228-11262-2 |
Recombinant Rat Prolactin Soluble Receptor |
50 |
290-Eur |
Ray Biotech |
recombinant |
| K24005R |
Rabbit anti Ox_Fibrinogen (Soluble) |
20ul |
----Eur |
Meridian Life Science |
polyclonal |
| E08S0222 |
Canine Soluble thrombomodulin ELISA , sTM |
|
715-Eur |
Blue Gene Biotech |
|
| 228-11262-3 |
Recombinant Rat Prolactin Soluble Receptor |
1 mg |
2068-Eur |
Ray Biotech |
recombinant |
| E04F0265 |
Rabbit soluble Farnesoid Xreceptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E08P0042 |
Canine Soluble P53 ELISA , sP53 |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0226 |
Canine Soluble protein-100B |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| U0569Rb |
Rabbit soluble platelet_selectin CLIA KIT |
96T |
839-Eur |
EIAab |
polyclonal |
| E08S0260 |
Canine soluble interleukin 6 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08S0293 |
Canine soluble toll-like receptor 2 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11E0021 |
Bovine soluble E-selectin ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E02F0265 |
Rat Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
601-Eur |
BGene |
|
| E02I0366 |
Rat Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
601-Eur |
BGene |
|
| E02F0103 |
Rat soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02I0368 |
Rat Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
601-Eur |
BGene |
|
| E02I0378 |
Rat Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
601-Eur |
BGene |
|
| 200-04 |
Proteins: Mouse soluble RANK Ligand |
10ug |
196-Eur |
Shenandoah Biotechnology, Inc. |
|
| E02C0053 |
Rat Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
601-Eur |
BGene |
|
| E02C0044 |
Rat Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
601-Eur |
BGene |
|
| IRKTAH1514 |
Mouse Soluble CD36 ELISA Kit |
1 kit(96 Wells) |
696-Eur |
Innovative Research INC |
|
| E08S0261 |
Canine soluble interleukin 7 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08S0262 |
Canine soluble interleukin 8 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08S0263 |
Canine soluble liver antigen |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| U0549Rb |
Rabbit soluble endothelium_selectin CLIA KIT |
96T |
839-Eur |
EIAab |
polyclonal |
| OETCGF533 |
Prolactin Soluble Receptor Rat Recombinant |
50 |
171-Eur |
OET |
|
| IRKTAH1517 |
Human Soluble IL-1R 4_ST2 ELISA Kit |
1 kit(96 Wells) |
818-Eur |
Innovative Research INC |
|
| E08S0266 |
Canine leptin soluble receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08S0281 |
Canine soluble platelet-selectin |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| 100-19 |
Proteins: Human soluble RANK Ligand |
100ug |
523-Eur |
Shenandoah Biotechnology, Inc. |
|
| E02S0260 |
Rat Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
601-Eur |
BGene |
|
| E13S0293 |
Anserine soluble toll-like receptor 2 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| SMUPAR-HIS |
Soluble Mouse uPAR, His-tagged |
0.1 mg |
564-Eur |
Molinn |
|
| OETCGF472 |
Soluble CD-40 Ligand_TRAP Mouse Recombinant |
5 |
92-Eur |
OET |
|
| E0549h |
Human soluble endothelium_selectin ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E02S0290 |
Rat Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
601-Eur |
BGene |
|
| E08E0021 |
Canine soluble E-selectin ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E04I0366 |
Rabbit soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| OETCGF245 |
Soluble CD-40 Ligand_TRAP Human Recombinant |
10 |
92-Eur |
OET |
|
| E08F0265 |
Canine soluble Farnesoid Xreceptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| 201-02-0191 |
Mouse Soluble protein-100(S-100)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| U1837r |
Rat soluble Interleukin 2 recepter CLIA KIT |
96T |
755-Eur |
EIAab |
recombinant |
| U0569p |
Porcine soluble platelet_selectin CLIA KIT |
96T |
839-Eur |
EIAab |
assays |
| 201-09-0025 |
Rabbit Soluble protein-100(S-100)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| E0190Mo |
Mouse Soluble protein-100,S-100 ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| CSB-E07449m |
Mouse soluble interleukin_1 receptor |
96tests |
781-Eur |
Cusabio |
recombinant |
| U0066r |
Rat soluble interleukin_1 receptor ⅡELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| CSB-E07447m |
Mouse soluble interleukin_1 receptor |
96tests |
781-Eur |
Cusabio |
recombinant |
| E02L0297 |
Rat Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
601-Eur |
BGene |
|
| U0065r |
Rat soluble interleukin_1 receptor Ⅰ CLIA KIT |
96T |
755-Eur |
EIAab |
recombinant |
| U1815r |
Rat soluble Interleukin 6 receptor,sIL_6R_CD126 CL |
96T |
755-Eur |
EIAab |
recombinant |
| E02C0044 |
Rat soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| CSB-E04842r |
Rat Leptin Soluble Receptor,sLR ELISA Kit |
96tests |
662-Eur |
Cusabio |
elisa |
| AP02138SU-N |
Fibrinogen (Oxidized), (Soluble Fraction) |
100 µl |
332-Eur |
ACR |
|
| KG573 |
Soluble CD147（EMMPRIN） ELISA Kit |
96well |
1351-Eur |
Sceti K.K. |
|
| U0824r |
Rat soluble Cluster of differentiation 86 CLIA KIT |
96T |
755-Eur |
EIAab |
assays |
| U0119r |
Rat Soluble Cluster of differentiation 40 ligand C |
96T |
755-Eur |
EIAab |
rat |
| E08L0297 |
Canine soluble Liver Receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| U0118r |
Rat Soluble Cluster of differentiation 30 ligand C |
96T |
755-Eur |
EIAab |
rat |
| CSB-E04611h |
Human soluble interleukin_1 receptor |
96tests |
781-Eur |
Cusabio |
recombinant |
| 228-11262-1 |
Recombinant Rat Prolactin Soluble Receptor |
10 |
201-Eur |
Ray Biotech |
recombinant |
| AP02138SU-S |
Fibrinogen (Oxidized), (Soluble Fraction) |
20 µl |
166-Eur |
ACR |
|
| E08I0381 |
Canine Soluble Interleukin 2β receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08I0379 |
Canine Soluble Interleukin 2a receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| ARP46012_P050 |
Guanylate cyclase soluble GUCY1B3 |
50 µg |
427-Eur |
ACR |
|
| AP20764PU-N |
Guanylate cyclase soluble GUCY1A3 |
100 µg |
391-Eur |
ACR |
|
| GTX102517 |
Guanylate cyclase soluble GUCY1A3 |
100 µl |
261-Eur |
ACR |
|
| BP2227 |
Fibrinogen (Oxidized), (Soluble Fraction) |
20 µl |
462-Eur |
ACR |
|
| E08I0366 |
Canine soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08I0368 |
Canine soluble interleukin-1 receptor II |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CSB-E04612h |
Human soluble interleukin_1 receptor |
96tests |
781-Eur |
Cusabio |
recombinant |
| E08I0378 |
Canine soluble Interleukin 2 recepter |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08P0110 |
Canine soluble P-selectin Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CK-E98028 |
Mouse Soluble protein-100,S-100 ELISAkit |
|
----Eur |
Glory |
|
| E14S0222 |
Sheep Soluble thrombomodulin ELISA , sTM |
|
715-Eur |
Blue Gene Biotech |
|
| U0549m |
Mouse soluble endothelium_selectin CLIA KIT |
96T |
739-Eur |
EIAab |
assays |
| 074 |
ANILINE BLUE (Spirit Soluble) (China Bl |
25 gm |
87-Eur |
TitanBiotech |
|
| E02S0253 |
Rat Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
601-Eur |
BGene |
|
| BQ016A-CR |
CLINICAL CHEMISTRY-Y-GT Soluble, Kinetic, 10 x 15 ml |
150 |
313-Eur |
Smart Serology |
|
| BQ016B-CR |
CLINICAL CHEMISTRY-Y-GT Soluble, Kinetic, 8 x 50 ml |
400 |
449-Eur |
Smart Serology |
|
| cyt-533 |
Recombinant Rat Prolactin Soluble Receptor rPrl R |
5 |
100-Eur |
Prospecbio |
|
| U0046m |
Mouse soluble glucoprotein 130 CLIA KIT |
96T |
739-Eur |
EIAab |
assays |
| E03I0378 |
Mouse soluble Interleukin 2 recepter |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| U0663r |
Rat soluble Toll_like receptor 2 CLIA KIT |
96T |
755-Eur |
EIAab |
recombinant |
| 074 |
ANILINE BLUE (Spirit Soluble) (China Bl |
100 gm |
142-Eur |
TitanBiotech |
|
| E0127Ra |
Rat soluble Interleukin 2 recepter,IL-2sR ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| 100-19 |
Human soluble RANK Ligand_RANK Ligand |
1Mg |
4966-Eur |
Shenandoah Biotechnology, Inc. |
|
| U0980m |
Mouse Soluble Endoglin CLIA KIT |
96T |
739-Eur |
EIAab |
assays |
| 200-04 |
Mouse soluble RANK Ligand_RANK Ligand |
1Mg |
4966-Eur |
Shenandoah Biotechnology, Inc. |
|
| E14P0042 |
Sheep Soluble P53 ELISA , sP53 |
|
715-Eur |
Blue Gene Biotech |
|
| E03I0381 |
Mouse Soluble Interleukin 2β receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03I0379 |
Mouse Soluble Interleukin 2a receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| U0683r |
Rat soluble Toll_like receptor 6 CLIA KIT |
96T |
755-Eur |
EIAab |
recombinant |
| cyt-286 |
Recombinant Human Soluble IL-6 Receptor alpha sIL 6R |
5 |
100-Eur |
Prospecbio |
|
| E07F0265 |
Porcine soluble Farnesoid Xreceptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07I0366 |
Porcine soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| cyt-533 |
Recombinant Rat Prolactin Soluble Receptor rPrl R |
20 |
175-Eur |
Prospecbio |
|
| YCC410-421 |
Adenovirus, Type 3, soluble, CF Antigen |
1 ml. |
446-Eur |
Accurate |
Antibodies |
| E07L0297 |
Porcine soluble Liver Receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E03E0021 |
Mouse soluble E-selectin ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06P0042 |
Goat Soluble P53 ELISA , sP53 |
|
715-Eur |
Blue Gene Biotech |
|
| E0568h |
Human Soluble protein_100 ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| YSRTMPP001 |
Adenovirus Type 5, Soluble Antigen |
1 ml. |
1045-Eur |
Accurate |
Antibodies |
| E03F0265 |
Mouse soluble Farnesoid Xreceptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03I0366 |
Mouse soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E07I0368 |
Porcine soluble interleukin-1 receptor II |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E03I0368 |
Mouse soluble interleukin-1 receptor II |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0417Ra |
Rat Leptin Soluble Receptor,sLR ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E07I0378 |
Porcine soluble Interleukin 2 recepter |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| cyt-286 |
Recombinant Human Soluble IL-6 Receptor alpha sIL 6R |
20 |
175-Eur |
Prospecbio |
|
| E07I0379 |
Porcine Soluble Interleukin 2a receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07I0381 |
Porcine Soluble Interleukin 2β receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| OETCGF533 |
Prolactin Soluble Receptor Rat Recombinant |
10 |
92-Eur |
OET |
|
| E0568m |
Mouse Soluble protein_100 ELISA Kit |
96T |
739-Eur |
EIAab |
elisa |
| 200-04 |
Mouse soluble RANK Ligand_RANK Ligand |
100ug |
549-Eur |
Shenandoah Biotechnology, Inc. |
|
| E11S0222 |
Bovine Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
622-Eur |
BGene |
|
| E03S0226 |
Mouse Soluble protein-100B |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| 201-09-0025 |
Rabbit Soluble protein-100,S-100 ELISA Kit |
96T |
719-Eur |
SunBT |
|
| 201-12-0876 |
Human soluble Phospholipase A2,sPL-A2 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| E07E0021 |
Porcine soluble E-selectin ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 201-12-1290 |
Human Soluble protein-100,S-100 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| E03S0263 |
Mouse soluble liver antigen |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| CK-E97491 |
Human Soluble protein-100,S-100 ELISAkit |
|
----Eur |
Glory |
|
| E03S0266 |
Mouse leptin soluble receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03S0233 |
Mouse soluble adhesion molecules |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03S0262 |
Mouse soluble interleukin 8 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03S0261 |
Mouse soluble interleukin 7 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| 201-12-1290 |
Human Soluble protein-100,S-100 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E03S0252 |
Mouse soluble endothelium-selectin |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E11P0042 |
Bovine Soluble P53 ELISA , sP53 |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-12-0876 |
Human soluble Phospholipase A2,sPL-A2 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 2081-1000 |
Digitonin, Water-Soluble |
1 g |
562-Eur |
Biovision |
|
| E03S0239 |
Mouse soluble cluster of differentiation 86 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E8992h |
Human Phosphoenolpyruvate Carboxykinase 1, Soluble |
96T |
706-Eur |
EIAab |
human |
| E03S0260 |
Mouse soluble interleukin 6 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| 201-11-0128 |
Rat soluble Interleukin 2 recepter,IL-2sR ELISA Kit |
96T |
490-Eur |
SunBT |
|
| orb50114 |
Human soluble TNFR II ELISA Kit |
96 well |
560-Eur |
Biorb |
elisa |
| E03P0110 |
Mouse soluble P-selectin Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03L0297 |
Mouse soluble Liver Receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| 100-19 |
Human soluble RANK Ligand_RANK Ligand |
2ug |
113-Eur |
Shenandoah Biotechnology, Inc. |
|
| 200-04 |
Mouse soluble RANK Ligand_RANK Ligand |
2ug |
113-Eur |
Shenandoah Biotechnology, Inc. |
|
| E12P0042 |
Chicken Soluble P53 ELISA , sP53 |
96 Tests/kit |
622-Eur |
BGene |
|
| 100-19 |
Human soluble RANK Ligand_RANK Ligand |
10ug |
205-Eur |
Shenandoah Biotechnology, Inc. |
|
| 200-04 |
Mouse soluble RANK Ligand_RANK Ligand |
10ug |
205-Eur |
Shenandoah Biotechnology, Inc. |
|
| 100-19 |
Human soluble RANK Ligand_RANK Ligand |
100ug |
549-Eur |
Shenandoah Biotechnology, Inc. |
|
| E1289Hu |
Human Soluble protein-100,S-100 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| 201-11-0418 |
Rat Leptin Soluble Receptor,sLR ELISA Kit |
96T |
490-Eur |
SunBT |
|
| E03R0361 |
Mouse soluble Retinoid X Receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E05S0222 |
Guinea pig Soluble thrombomodulin ELISA , sTM |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0281 |
Mouse soluble platelet-selectin |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| OETCGF472 |
Soluble CD-40 Ligand_TRAP Mouse Recombinant |
25 |
171-Eur |
OET |
|
| E05P0042 |
Guinea pig Soluble P53 ELISA , sP53 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0293 |
Mouse soluble toll-like receptor 2 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0875Hu |
Human soluble Phospholipase A2,sPL-A2 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E03S0294 |
Mouse soluble toll-like receptor 6 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| OETCGF245 |
Soluble CD-40 Ligand_TRAP Human Recombinant |
50 |
171-Eur |
OET |
|
| E12S0222 |
Chicken Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
622-Eur |
BGene |
|
| B24950 |
Bromothymol Blue, Water soluble |
5 G |
168-Eur |
pfalslandbauer. |
|
| E14S0222 |
Sheep Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
622-Eur |
BGene |
|
| E07S0263 |
Porcine soluble liver antigen |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07S0266 |
Porcine leptin soluble receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E04S0226 |
Rabbit Soluble protein-100B |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0252 |
Human soluble endothelium-selectin |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0260 |
Human soluble interleukin 6 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0261 |
Human soluble interleukin 7 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E07P0042 |
Porcine Soluble P53 ELISA , sP53 |
96 Tests/kit |
608-Eur |
BGene |
|
| B09978 |
Berlin Blue Soluble C.I. No.7520 |
25 G |
137-Eur |
pfalslandbauer. |
|
| E04S0233 |
Rabbit soluble adhesion molecules |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| B10620 |
Biebrich Scarlet Water Soluble |
50 G |
101-Eur |
pfalslandbauer. |
|
| E01R0361 |
Human soluble Retinoid X Receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E04S0239 |
Rabbit soluble cluster of differentiation 86 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E07S0260 |
Porcine soluble interleukin 6 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07S0261 |
Porcine soluble interleukin 7 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07S0262 |
Porcine soluble interleukin 8 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E01S0226 |
Human Soluble protein-100B |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| B10620 |
Biebrich Scarlet Water Soluble |
100 G |
116-Eur |
pfalslandbauer. |
|
| E01S0239 |
Human soluble cluster of differentiation 86 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| Y103815 |
Transferrin receptor, Human Soluble |
1 mg |
1083-Eur |
ABM Goods |
recombinant |
| Y103814 |
Transferrin receptor, Human Soluble |
1 mg |
1083-Eur |
ABM Goods |
recombinant |
| E01S0281 |
Human soluble platelet-selectin |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E04S0222 |
Rabbit Soluble thrombomodulin ELISA , sTM |
|
689-Eur |
Blue Gene Biotech |
|
| E11S0222 |
Bovine Soluble thrombomodulin ELISA , sTM |
|
715-Eur |
Blue Gene Biotech |
|
| 12768-44-4 |
Rutin water-soluble in chips |
1g |
----Eur |
chemotra |
|
| 9005-25-8 |
Starch soluble, 500g; Bacto |
1g |
----Eur |
chemotra |
|
| Y059689 |
Anti_Human Soluble Transferrin Receptor |
100ug |
443-Eur |
ABM Goods |
recombinant |
| 9005-84-9 |
Starch cold-soluble; 1 kg; Appli |
1g |
----Eur |
chemotra |
|
| E04R0361 |
Rabbit soluble Retinoid X Receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0266 |
Human leptin soluble receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| RCYT-304C |
Recombinant Human Soluble CD4 |
1mg |
8610-Eur |
SeraLab |
recombinant |
| U0549p |
Porcine soluble endothelium_selectin CLIA KIT |
96T |
839-Eur |
EIAab |
assays |
| Y103813 |
Transferrin receptor, Human Soluble |
1 mg |
1083-Eur |
ABM Goods |
recombinant |
| E01S0262 |
Human soluble interleukin 8 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| S01-061 |
Human IL_1RA, soluble Source E. coli |
100 µg |
265-Eur |
Reliatech |
recombinant |
| Y080011 |
Guanylate Cyclase β1 subunit(soluble) |
100ul |
147-Eur |
ABM Goods |
|
| E07S0281 |
Porcine soluble platelet-selectin |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07S0293 |
Porcine soluble toll-like receptor 2 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E01S0263 |
Human soluble liver antigen |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E07S0222 |
Porcine Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
608-Eur |
BGene |
|
| E04P0110 |
Rabbit soluble P-selectin Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| B24950 |
Bromothymol Blue, Water soluble |
25 G |
241-Eur |
pfalslandbauer. |
|
| E06S0222 |
Goat Soluble thrombomodulin ELISA , sTM |
|
715-Eur |
Blue Gene Biotech |
|
| E04S0266 |
Rabbit leptin soluble receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E07R0361 |
Porcine soluble Retinoid X Receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E12S0222 |
Chicken Soluble thrombomodulin ELISA , sTM |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0226 |
Porcine Soluble protein-100B |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| U0569m |
Mouse soluble platelet_selectin CLIA KIT |
96T |
739-Eur |
EIAab |
assays |
| E12P0042 |
Chicken Soluble P53 ELISA , sP53 |
|
715-Eur |
Blue Gene Biotech |
|
| E0190Mo |
Mouse Soluble protein-100,S-100 ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E07S0233 |
Porcine soluble adhesion molecules |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E02S0233 |
Rat Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0281 |
Rabbit soluble platelet-selectin |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| YSRTPHP191 |
CD54 (soluble), Human, Recombinant |
50 µg. |
632-Eur |
Accurate |
recombinant |
| YSRTPHP192 |
CD95 (soluble), Human, Recombinant |
25 µg. |
632-Eur |
Accurate |
recombinant |
| E0549m |
Mouse soluble endothelium_selectin ELISA Kit |
96T |
739-Eur |
EIAab |
elisa |
| E04S0293 |
Rabbit soluble toll-like receptor 2 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06S0222 |
Goat Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
608-Eur |
BGene |
|
| E07P0110 |
Porcine soluble P-selectin Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E0569m |
Mouse soluble platelet_selectin ELISA Kit |
96T |
739-Eur |
EIAab |
elisa |
| U0568m |
Mouse Soluble protein_100 CLIA KIT |
96T |
739-Eur |
EIAab |
assays |
| E04S0252 |
Rabbit soluble endothelium-selectin |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01F0265 |
Human soluble Farnesoid Xreceptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01I0366 |
Human soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01I0368 |
Human soluble interleukin-1 receptor II |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01I0378 |
Human soluble Interleukin 2 recepter |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01I0379 |
Human Soluble Interleukin 2a receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01I0381 |
Human Soluble Interleukin 2β receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01L0297 |
Human soluble Liver Receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| cyt-533 |
Recombinant Rat Prolactin Soluble Receptor rPrl R |
1mg |
3260-Eur |
Prospecbio |
|
| E01E0021 |
Human soluble E-selectin ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E07S0252 |
Porcine soluble endothelium-selectin |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E04S0263 |
Rabbit soluble liver antigen |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E04S0262 |
Rabbit soluble interleukin 8 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| cyt-286 |
Recombinant Human Soluble IL-6 Receptor alpha sIL 6R |
1mg |
4147-Eur |
Prospecbio |
|
| E04S0261 |
Rabbit soluble interleukin 7 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E04S0260 |
Rabbit soluble interleukin 6 receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0230 |
Rat Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
601-Eur |
BGene |
|
| E14P0042 |
Sheep Soluble P53 ELISA , sP53 |
96 Tests/kit |
622-Eur |
BGene |
|
| E07S0239 |
Porcine soluble cluster of differentiation 86 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E01P0110 |
Human soluble P-selectin Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| 301COP002_N |
CopAb, B.subtilis, soluble domain B, 15N |
|
----Eur |
ProtEra |
polyclonal |
| SU4TR26 |
Transferrin Receptor Soluble, Mab anti_ |
1 mg. |
796-Eur |
Accurate |
recombinant |
| 301CUA01 |
CuA, T.Thermophilus, soluble fragment of subunit 2 of CCO |
200ug |
272-Eur |
ProtEra |
|
| 2-TRs |
Transferrin Receptor _ Soluble, human, antibody |
200ug |
340-Eur |
Advenced Immuno Chemical |
recombinant |
| E0824r |
Rat soluble Cluster of differentiation 86 ELISA Ki |
96T |
755-Eur |
EIAab |
elisa |
| FL-103 |
Fas Ligand, Soluble Human (no enhancer required) |
5 ug |
480-Eur |
Kamiya Biomedical KB |
human |
| E11P0042 |
Bovine anti-soluble P53 ELISA Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| 2-TRs |
Transferrin Receptor _ Soluble, human, antibody |
500ug |
531-Eur |
Advenced Immuno Chemical |
recombinant |
| E11S0221 |
Bovine anti-soluble protein-100 |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| 301CUA01 |
CuA, T.Thermophilus, soluble fragment of subunit 2 of CCO |
1mg |
390-Eur |
ProtEra |
|
| 301CUA01 |
CuA, T.Thermophilus, soluble fragment of subunit 2 of CCO |
10mg |
1953-Eur |
ProtEra |
|
| TM4125 |
TMB Soluble Reagent (High Sensitivity) |
125 ml |
80-Eur |
Scy tek |
|
| TM4500 |
TMB Soluble Reagent (High Sensitivity) |
500 ml |
115-Eur |
Scy tek |
|
| 501CB501_N |
Cytochrome b5, soluble domain, rabbit, 15N |
|
----Eur |
ProtEra |
polyclonal |
| TM1999 |
TMB Soluble Reagent (Standard Sensitivity) |
1000 ml |
147-Eur |
Scy tek |
|
| E0980h |
Human Soluble Endoglin ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E06P0042 |
Goat anti-soluble P53 ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| 301COX005_C |
Cox11, S.meliloti, soluble domain, 13C |
|
----Eur |
ProtEra |
|
| E0046h |
Human soluble glucoprotein 130 ELISA KIT |
96T |
706-Eur |
EIAab |
elisa |
| 18-13002 |
Antigens Soluble CD4 (T-Cell) HRP, Recombinant |
20 |
325-Eur |
ARP |
|
| 301COX005_N |
Cox11, S.meliloti, soluble domain, 15N |
|
----Eur |
ProtEra |
|
| E06S0221 |
Goat anti-soluble protein-100 |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| 301CUA01_N |
CuA, T.Thermophilus, soluble fragment of subunit 2 of CCO, 15N |
|
----Eur |
ProtEra |
|
| 301CUA01_C |
CuA, T.Thermophilus, soluble part of subunit 2 of CCO, 13C |
|
----Eur |
ProtEra |
|
| 301CUA01_CN |
CuA, T.Thermophilus, soluble part of subunit 2 of CCO, 13C, 15N |
|
----Eur |
ProtEra |
|
| 501CB501_C |
Cytochrome b5, soluble domain, rabbit, 13C |
|
----Eur |
ProtEra |
polyclonal |
| 501CB501_CN |
Cytochrome b5, soluble domain, rabbit, 13C, 15N |
|
----Eur |
ProtEra |
polyclonal |
| CSB-E07437r |
Rat soluble interleukin-2 receptor,sIL-2Rβ ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-E07439r |
Rat soluble interleukin-2 receptor,sIL-2Rα ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E08S0222 |
Canine Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
622-Eur |
BGene |
|
| GTX104443 |
Guanylate cyclase soluble GUCY1B3 |
100 µl |
261-Eur |
ACR |
|
| GTX114458 |
Guanylate cyclase soluble GUCY1A3 |
0.1 ml |
379-Eur |
ACR |
|
| CSB-E04611h |
Human soluble interleukin_1 receptor |
96tests |
722-Eur |
Cusabio |
recombinant |
| CSB-E04612h |
Human soluble interleukin_1 receptor |
96tests |
722-Eur |
Cusabio |
recombinant |
| PA232 |
CD25 _ IL2RA (soluble, sIL2RA) |
5 µg |
177-Eur |
ACR |
|
| PA232X |
CD25 _ IL2RA (soluble, sIL2RA) |
25 µg |
296-Eur |
ACR |
|
| CSB-E04698h |
rowth factor soluble receptor |
96tests |
722-Eur |
Cusabio |
recombinant |
| E1815r |
Rat soluble Interleukin 6 receptor,sIL_6R_CD126 EL |
96T |
755-Eur |
EIAab |
recombinant |
| CSB-E15854h |
Human soluble CD40 ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-E04842r |
Rat Leptin Soluble Receptor,sLR ELISA Kit |
96tests |
602-Eur |
Cusabio |
elisa |
| E04P0042 |
Rabbit Soluble P53 ELISA , sP53 |
96 Tests/kit |
601-Eur |
BGene |
|
| E0663r |
Rat soluble Toll_like receptor 2 ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| AP06153PU-N |
Guanylate cyclase soluble GUCY1B3 |
100 µg |
391-Eur |
ACR |
|
| CSB-E07446r |
Rat soluble interleukin-1 receptor Ⅱ,sIL-1RⅡ ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-E15820r |
Rat soluble CD23(sCD23) ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| E0549p |
Porcine soluble endothelium_selectin ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| TM4999 |
TMB Soluble Reagent (High Sensitivity) |
1000 ml |
162-Eur |
Scy tek |
|
| 61489-48-3 |
Aniline blue alcohol soluble C.I.427 |
1g |
----Eur |
chemotra |
|
| 73570-52-2 |
Aniline blue alcohol soluble c.i. no. |
1g |
----Eur |
chemotra |
|
| 4Tr26-2B6 |
CD71 _ TFRC (soluble form) |
1 mg |
427-Eur |
ACR |
|
| E0683r |
Rat soluble Toll_like receptor 6 ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| 4Tr26-7-1 |
CD71 _ TFRC (soluble form) |
1 mg |
427-Eur |
ACR |
|
| 4Tr26-7F8 |
CD71 _ TFRC (soluble form) |
1 mg |
427-Eur |
ACR |
|
| AM05610PU-N |
Guanylate cyclase soluble GUCY1A3 |
0.2 mg |
344-Eur |
ACR |
|
| AM05611PU-N |
Guanylate cyclase soluble GUCY1B3 |
0.2 mg |
344-Eur |
ACR |
|
| MDK |
MDH1B Gene malate dehydrogenase 1B, NAD (soluble) |
|
----Eur |
Transposagen |
|
| CSB-E08066r |
Rat Soluble protein_100B,S_100B ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| E02I0379 |
Rat anti-Soluble Interleukin 2a receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E02I0381 |
Rat anti-Soluble Interleukin 2β receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E02L0297 |
Rat anti-soluble Liver Receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CSB-E09905Rb |
Rabbit soluble interleukin_1 receptor |
96T |
896-Eur |
Cusabio |
recombinant |
| BC-322 |
Biochemical: BAFF(mouse recombinant soluble) |
10 ug |
584-Eur |
Kamiya Biomedical KB |
|
| BC-321 |
Biochemical: BAFF (human recombinant soluble) |
10 ug |
600-Eur |
Kamiya Biomedical KB |
|
| BC-312 |
Biochemical: Visfatin, soluble, mouse recombinant, His |
50 ug |
721-Eur |
Kamiya Biomedical KB |
|
| BC-311 |
Biochemical: Visfatin, soluble, human recombinant, His |
50 ug |
721-Eur |
Kamiya Biomedical KB |
|
| BC-091 |
Biochemical: TRAIL-His tag, soluble (human recombinant) |
20 ug |
621-Eur |
Kamiya Biomedical KB |
|
| E02P0110 |
Rat anti-soluble P-selectin Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E02R0361 |
Rat anti-soluble Retinoid X Receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E13I0379 |
Anserine Soluble Interleukin 2a receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E02I0378 |
Rat anti-soluble Interleukin 2 recepter |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E02I0368 |
Rat anti-soluble interleukin-1 receptor II |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CSB-E08069r |
Rat Soluble protein_100,S_100 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| E13E0021 |
Anserine soluble E-selectin ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CSB-E08078r |
Rat soluble P_selectin,sP_selectin ELISA Kit |
96T |
701-Eur |
Cusabio |
elisa |
| E13F0265 |
Anserine soluble Farnesoid Xreceptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| TM1500 |
TMB Soluble Reagent (Standard Sensitivity) |
500 ml |
108-Eur |
Scy tek |
|
| E13I0366 |
Anserine soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E13I0368 |
Anserine soluble interleukin-1 receptor II |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E13I0378 |
Anserine soluble Interleukin 2 recepter |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E02E0021 |
Rat anti-soluble E-selectin ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| U0549Ch |
Chicken soluble endothelium_selectin CLIA KIT |
96T |
839-Eur |
EIAab |
assays |
| E02F0265 |
Rat anti-soluble Farnesoid Xreceptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E02I0366 |
Rat anti-soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| QY-E11517 |
Rat soluble Interleukin 2 recepter(IL-2sR)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E02S0226 |
Rat anti-Soluble protein-100B |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| 301CC2A01_C |
Ccc2a, S.cervisiae, soluble domain A, 13C |
|
----Eur |
ProtEra |
|
| E02S0294 |
Rat anti-soluble toll-like receptor 6 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| 301CC2A01_CN |
Ccc2a, S.cervisiae, soluble domain A, 13C, 15N |
|
----Eur |
ProtEra |
|
| 301CC2A01_N |
Ccc2a, S.cervisiae, soluble domain A, 15N |
|
----Eur |
ProtEra |
|
| 301COP001_CN |
CopAa, B.subtilis, soluble domain A, 13C, 15N |
|
----Eur |
ProtEra |
|
| 301COP001_C |
CopAa, B.subtilis, soluble domain A, 13C |
|
----Eur |
ProtEra |
|
| 301COP001_N |
CopAa, B.subtilis, soluble domain A, 15N |
|
----Eur |
ProtEra |
|
| 301COP003_C |
CopAab, B.subtilis, soluble domain AB, 13C |
|
----Eur |
ProtEra |
|
| 301COP003_CN |
CopAab, B.subtilis, soluble domain AB, 13C, 15N |
|
----Eur |
ProtEra |
|
| 301COP003_N |
CopAab, B.subtilis, soluble domain AB, 15N |
|
----Eur |
ProtEra |
|
| 301COP002_C |
CopAb, B.subtilis, soluble domain B, 13C |
|
----Eur |
ProtEra |
polyclonal |
| QY-E02463 |
Human soluble Phospholipase A2(sPL-A2)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E02S0293 |
Rat anti-soluble toll-like receptor 2 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CSB-E13482r |
Rat Soluble Glycoprotein VI (SGPVI) ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| E0568Rb |
Rabbit Soluble protein_100 ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E02S0233 |
Rat anti-soluble adhesion molecules |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| E13I0381 |
Anserine Soluble Interleukin 2β receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| QY-E04630 |
Human Soluble protein-100(S-100)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E02S0239 |
Rat anti-soluble cluster of differentiation 86 |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| E02S0252 |
Rat anti-soluble endothelium-selectin |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| E02S0260 |
Rat anti-soluble interleukin 6 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E02S0261 |
Rat anti-soluble interleukin 7 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E02S0262 |
Rat anti-soluble interleukin 8 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E02S0266 |
Rat anti-leptin soluble receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CSB-E13261h |
Human Soluble Thromobomodulin (STM) ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| E02S0281 |
Rat anti-soluble platelet-selectin |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| 301COP002_CN |
CopAb, B.subtilis, soluble domain B, 13C, 15N |
|
----Eur |
ProtEra |
polyclonal |
| CSB-E07437r |
Rat soluble interleukin_2 receptor,sIL_2R |
96tests |
722-Eur |
Cusabio |
recombinant |
| E-EL-H1087 |
Human sVEGFR1_FLT1 (Soluble Vascular |
96T |
583-Eur |
Elabscience |
|
| CG108-050 |
Recombinant Rat Prolactin Soluble Receptor |
50ug |
282-Eur |
GenDepot |
|
| IRKTAH1520-1 Kit |
Human Soluble IL1R II ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| IRKTAH1523-1 Kit |
Human Soluble LOX1 ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| CG108-101 |
Recombinant Rat Prolactin Soluble Receptor |
1mg |
2171-Eur |
GenDepot |
|
| IRKTAH1533-1 Kit |
Hman Soluble GP130 ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| CK-E98666 |
Rat Leptin Soluble Receptor,sLR ELISAkit |
|
----Eur |
Glory |
|
| IRKTAH1536-1 Kit |
Mouse Soluble GP130 ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| E0118r |
Rat Soluble Cluster of differentiation 30 ligand E |
96T |
755-Eur |
EIAab |
rat |
| IRKTAH1549-1 Kit |
Human Soluble Flt1_VEGFR1 ELISA |
1 Kit |
858-Eur |
Innovative Research INC |
|
| 201-20-5912 |
TK1{thymidine kinase 1, soluble}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| IRKTAH1553-1 Kit |
Mouse Soluble Flt1_VEGFR1 ELISA |
1 Kit |
858-Eur |
Innovative Research INC |
|
| 40-056-205027 |
Soluble Tumor Necrosis Factor Rec II - |
96 TESTS |
694-Eur |
GenWay |
recombinant |
| IRKTAH1514-1 Kit |
Mouse Soluble CD36 ELISA Kit |
1 Kit |
1071-Eur |
Innovative Research INC |
|
| IRKTAH1513-1 Kit |
Human Soluble CD36 ELISA Kit |
1 Kit |
1071-Eur |
Innovative Research INC |
|
| E-EL-H0927 |
Human S-100 (Soluble Protein-100) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| orb85509 |
CD40L (soluble) protein Proteins |
50 |
389-Eur |
Biorb |
|
| IRKTAH1308-1 Kit |
Human CD14 Soluble ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| IRKTAH1402-1 Kit |
Human Soluble GP130 ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| E09S0222 |
Monkey Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
622-Eur |
BGene |
|
| IRKTAH1450-1 Kit |
Human Soluble LIGHT_TNFSF14 ELISA Kit |
1 Kit |
858-Eur |
Innovative Research INC |
|
| IRKTAH1462-1 Kit |
Human Neuropilin1 Soluble ELISA Kit |
1 Kit |
1174-Eur |
Innovative Research INC |
|
| CG108-010 |
Recombinant Rat Prolactin Soluble Receptor |
10ug |
199-Eur |
GenDepot |
|
| IRKTAH1499-1 Kit |
Human RANK soluble ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| DAG259 |
Recombinant Human Soluble RANKL |
20ug |
1025-Eur |
CDiagnostic |
|
| orb80573 |
Human Soluble CD4 protein Proteins |
2 |
159-Eur |
Biorb |
|
| I-04910 |
IRON PYROPHPSPHATE SOLUBLE CAS: 10058-44-3 |
250 gm |
131-Eur |
Oxford Lab |
|
| CK-E99201 |
rabbit Soluble protein-100,S-100 ELISAkit |
|
----Eur |
Glory |
|
| 4Tr26-2B6 |
CD71 _ TFRC (soluble form) |
1 mg |
513-Eur |
ACR |
|
| ARP46012_P050 |
Guanylate cyclase soluble GUCY1B3 |
50 µg |
513-Eur |
ACR |
|
| ABS12321 |
ADENOVIRUS TYPE 11 SOLUBLE ANTIGEN |
1 ml |
543-Eur |
AbD Serotec |
Antibodies |
| ARP48564_P050 |
HMGCS1(3_hydroxy_3_methylglutaryl_Coenzyme A synthase 1 (soluble)) |
50 µg |
513-Eur |
ACR |
|
| ABS12320 |
ADENOVIRUS TYPE 3 SOLUBLE ANTIGEN |
1 ml |
543-Eur |
AbD Serotec |
Antibodies |
| ABS12317 |
ADENOVIRUS TYPE 5 SOLUBLE ANTIGEN |
1 ml |
543-Eur |
AbD Serotec |
Antibodies |
| E0569p |
Porcine soluble platelet_selectin ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E0119r |
Rat Soluble Cluster of differentiation 40 ligand E |
96T |
755-Eur |
EIAab |
rat |
| GTX104443 |
Guanylate cyclase soluble GUCY1B3 |
100 µl |
331-Eur |
ACR |
|
| BP2227 |
Fibrinogen (Oxidized), (Soluble Fraction) |
20 µl |
555-Eur |
ACR |
|
| E0569h |
Human soluble platelet_selectin ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| S-08558 |
STARCH SOLUBLE AR (Ex-Potato) CAS: 9005-84-9 |
500 gm |
120-Eur |
Oxford Lab |
|
| E0549Rb |
Rabbit soluble endothelium_selectin ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| ARP32801_T100 |
PCK1 (phosphoenolpyruvate carboxykinase 1 (soluble)) |
100 µg |
457-Eur |
ACR |
|
| ARP32801_P050 |
PCK1 (phosphoenolpyruvate carboxykinase 1 (soluble)) |
50 µg |
513-Eur |
ACR |
|
| IRKTAH1554-1 Kit |
Human Soluble VEGF R2 ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| 4Tr26-7-1 |
CD71 _ TFRC (soluble form) |
1 mg |
513-Eur |
ACR |
|
| 4Tr26-7F8 |
CD71 _ TFRC (soluble form) |
1 mg |
513-Eur |
ACR |
|
| AP02138SU-N |
Fibrinogen (Oxidized), (Soluble Fraction) |
100 µl |
345-Eur |
ACR |
|
| AP02138SU-S |
Fibrinogen (Oxidized), (Soluble Fraction) |
20 µl |
143-Eur |
ACR |
|
| IRKTAH1558-1 Kit |
Human Soluble VEGF R3 ELISA Kit |
1 Kit |
1262-Eur |
Innovative Research INC |
|
| AP06153PU-N |
Guanylate cyclase soluble GUCY1B3 |
100 µg |
513-Eur |
ACR |
|
| 201-20-0135 |
ACO1{aconitase 1, soluble}rabbit.pAb |
0.1ml |
378-Eur |
Shanghai Sunred |
|
| PA124X |
KITLG _ SCF (soluble form) antigen |
10 |
237-Eur |
ACR |
|
| PA124 |
KITLG _ SCF (soluble form) antigen |
2 |
147-Eur |
ACR |
|
| ABS12373 |
RECOMBINANT HUMAN CD95 (SOLUBLE) |
25 µg |
335-Eur |
AbD Serotec |
|
| ABS12372 |
RECOMBINANT HUMAN CD54 (SOLUBLE) |
50 µg |
335-Eur |
AbD Serotec |
|
| BP2227 |
Fibrinogen (Oxidized), (Soluble Fraction) |
20 µl |
555-Eur |
ACR |
|
| E00915 |
Eosin Alcohol Soluble C.I. No. 45386 |
25 G |
171-Eur |
pfalslandbauer. |
|
| E0075r |
Rat soluble interleukin_2 receptor ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| E04S0222 |
Rabbit Soluble thrombomodulin ELISA , sTM |
96 Tests/kit |
601-Eur |
BGene |
|
| CSB-E08078r |
Rat soluble P_selectin,sP_selectin ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| E0074r |
Rat soluble interleukin_2 receptor ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| E0066r |
Rat soluble interleukin_1 receptor ⅡELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| E0065r |
Rat soluble interleukin_1 receptor Ⅰ ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| 7-01448 |
Recombinant Rat Prolactin Soluble Receptor |
20 |
346-Eur |
CHI |
|
| CSB-E09905Rb |
Rabbit soluble interleukin_1 receptor |
96tests |
837-Eur |
Cusabio |
recombinant |
| B09978 |
Berlin Blue Soluble C.I. No.77520 |
25 G |
176-Eur |
pfalslandbauer |
|
| E0046m |
Mouse soluble glucoprotein 130 ELISA KIT |
96T |
739-Eur |
EIAab |
elisa |
| E0980m |
Mouse Soluble Endoglin ELISA Kit |
96T |
739-Eur |
EIAab |
elisa |
| E0567h |
Human Soluble protein_100B ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| CSB-E08069r |
Rat Soluble protein_100,S_100 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E08066r |
Rat Soluble protein_100B,S_100B ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| I02028 |
Indulin Water Soluble C.i.no. 50405 |
25 G |
116-Eur |
pfalslandbauer. |
|
| CSB-E07439r |
Rat soluble interleukin_2 receptor,sIL_2R |
96tests |
722-Eur |
Cusabio |
recombinant |
| CSB-E07447m |
Mouse soluble interleukin_1 receptor |
96tests |
722-Eur |
Cusabio |
recombinant |
| M27770 |
Methyl Red Water Soluble C.I. No. 13020 |
100 G |
118-Eur |
pfalslandbauer. |
|
| M27770 |
Methyl Red Water Soluble C.I. No. 13020 |
500 G |
261-Eur |
pfalslandbauer. |
|
| M27770 |
Methyl Red Water Soluble C.I. No. 13020 |
1000 G |
367-Eur |
pfalslandbauer. |
|
| N05506 |
Nigrosine Alcohol Soluble C.I. No.50415 |
100 G |
133-Eur |
pfalslandbauer. |
|
| N05510 |
Nigrosine Water Soluble C. I No. 50420 |
100 G |
131-Eur |
pfalslandbauer. |
|
| 7-01449 |
Recombinant Rat Prolactin Soluble Receptor |
1mg |
7122-Eur |
CHI |
|
| CSB-E07449m |
Mouse soluble interleukin_1 receptor |
96tests |
722-Eur |
Cusabio |
recombinant |
| E0219r |
Rat Leptin Soluble Receptor ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| CSB-E07996r |
Rat soluble E_selectin,sE_selectin ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| 22163 |
Rat Leptin Soluble Receptor(sLR) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| 20814 |
Mouse Soluble Protein-100(S-100) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| RP17628530005 |
Interleukin_2 soluble Receptor alpha |
5 µg |
143-Eur |
Biovendor |
recombinant |
| E-EL-R0896 |
Rat SIL-6R (Soluble Interleukin 6 Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R0895 |
Rat IL-2SR (Soluble Interleukin 2 Recepter) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| 21874 |
Mouse Soluble Endoglin ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E1151h |
Human soluble Phospholipase A2 ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E0569Rb |
Rabbit soluble platelet_selectin ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E0567Rb |
Rabbit Soluble protein_100B ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| ACOT1 |
ACO1 Gene aconitase 1, soluble |
|
----Eur |
Transposagen |
|
| E92823Hu |
ELISA Kit for Thymidine Kinase 1, Soluble (TK1) |
96T/Kit |
682-Eur |
USCNLife |
|
| E1837r |
Rat soluble Interleukin 2 recepter ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| E0978h |
Human soluble protein 185 ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| IRKTAH1254-1 Kit |
Human ACTR IIA Soluble ELISA Kit |
1 Kit |
1244-Eur |
Innovative Research INC |
|
| RP17628530025 |
Interleukin_2 soluble Receptor alpha |
25 µg |
238-Eur |
Biovendor |
recombinant |
| RP17628560001 |
Interleukin_2 soluble Receptor alpha |
1 mg |
3546-Eur |
Biovendor |
recombinant |
| 7-01447 |
Recombinant Rat Prolactin Soluble Receptor |
5 |
164-Eur |
CHI |
|
| MA-CD4-6 |
Anti_human CD4 (soluble receptor) IgG fraction (monoclonal) |
200µg |
293-Eur |
AustralBiologicals |
recombinant |
| E-EL-MK0148 |
Monkey S-100 (Soluble Protein-100) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-Ch1059 |
Chicken S-100 (Soluble Protein-100) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| RP17628660001 |
Interleukin_6 soluble Receptor alpha |
1 mg |
4622-Eur |
Biovendor |
recombinant |
| E-EL-P0287 |
Porcine S-100 (Soluble Protein-100) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-M1082 |
Mouse S-100 (Soluble protein-100) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| RP17628630020 |
Interleukin_6 soluble Receptor alpha |
20 µg |
238-Eur |
Biovendor |
recombinant |
| RP17628630005 |
Interleukin_6 soluble Receptor alpha |
5 µg |
143-Eur |
Biovendor |
recombinant |
| RP17658930010 |
Interleukin_2 soluble Receptor alpha, GST tag |
10 µg |
749-Eur |
Biovendor |
recombinant |
| RP17658930005 |
Interleukin_2 soluble Receptor alpha, GST tag |
5 µg |
449-Eur |
Biovendor |
recombinant |
| RP17658930002 |
Interleukin_2 soluble Receptor alpha, GST tag |
2 µg |
322-Eur |
Biovendor |
recombinant |
| E09P0042 |
Monkey Soluble P53 ELISA , sP53 |
96 Tests/kit |
622-Eur |
BGene |
|
| S-1008-105 |
Sulfo S-4FB Crosslinker (Water Soluble) |
5 x 1.0 mg |
177-Eur |
Solulink |
|
| 201-12-0876 |
Human soluble Phospholipase A2(sPL-A2)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-1290 |
Human Soluble protein-100(S-100)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E06S0226 |
Goat Soluble protein-100B |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E02I0378 |
Rat Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
689-Eur |
Blue Gene Biotech |
|
| E02I0368 |
Rat Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
689-Eur |
Blue Gene Biotech |
|
| E02I0366 |
Rat Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
689-Eur |
Blue Gene Biotech |
|
| E02C0053 |
Rat Soluble CD 44v9 ELISA , SCD44V9 |
|
689-Eur |
Blue Gene Biotech |
|
| E02C0044 |
Rat Soluble CD44s ELISA , sCD44s |
|
689-Eur |
Blue Gene Biotech |
|
| E06S0233 |
Goat soluble adhesion molecules |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 201-11-0128 |
Rat soluble Interleukin 2 recepter(IL-2sR)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| E06S0239 |
Goat soluble cluster of differentiation 86 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E02S0008 |
Rat Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
689-Eur |
Blue Gene Biotech |
|
| E06R0361 |
Goat soluble Retinoid X Receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| B09978 |
Berlin Blue Soluble C.I. No.7520 |
|
151-Eur |
pfalslandbauer |
|
| B10620 |
Biebrich Scarlet Water Soluble |
|
114-Eur |
pfalslandbauer |
|
| S-1008-010 |
Sulfo S-4FB Crosslinker (Water Soluble) |
10 mg |
261-Eur |
Solulink |
|
| 14410-42 |
Eosin Yellowish(water soluble) |
25G |
135-Eur |
Nacalai |
|
| E06L0297 |
Goat soluble Liver Receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 06880-42 |
Aniline Blue(water soluble) |
25G |
141-Eur |
Nacalai |
|
| C26225 |
M_Cresol Purple Water Soluble |
|
148-Eur |
pfalslandbauer |
|
| C26225 |
M_Cresol Purple Water Soluble |
|
115-Eur |
pfalslandbauer |
|
| 2081-100 |
Digitonin, Water-Soluble Digitin |
100 mg |
126-Eur |
Biovision |
|
| 2081-250 |
Digitonin, Water-Soluble Digitin |
250 mg |
225-Eur |
Biovision |
|
| B24950 |
Bromothymol Blue, Water soluble |
|
253-Eur |
pfalslandbauer |
|
| B24950 |
Bromothymol Blue, Water soluble |
|
178-Eur |
pfalslandbauer |
|
| E06P0110 |
Goat soluble P-selectin Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| B10620 |
Biebrich Scarlet Water Soluble |
|
131-Eur |
pfalslandbauer |
|
| E02S0260 |
Rat Soluble interleukin 6 receptor ELISA, sIL-6R |
|
689-Eur |
Blue Gene Biotech |
|
| E04P0042 |
Rabbit anti-soluble P53 ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E06S0252 |
Goat soluble endothelium-selectin |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| U0549h |
Human soluble endothelium_selectin CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| E01P0042 |
Human Soluble P53 ELISA , sP53 |
|
689-Eur |
Blue Gene Biotech |
|
| U0980h |
Human Soluble Endoglin CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| QY-E21382 |
Mouse Soluble protein-100(S-100)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E11F0265 |
Bovine soluble Farnesoid Xreceptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E03P0042 |
Mouse anti-soluble P53 ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E11I0366 |
Bovine soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| QY-E30103 |
rabbit Soluble protein-100,S-100 ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| E11I0368 |
Bovine soluble interleukin-1 receptor II |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E03S0221 |
Mouse anti-soluble protein-100 |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| E11I0378 |
Bovine soluble Interleukin 2 recepter |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CK-E96859 |
Human soluble Phospholipase A2,sPL-A2 ELISAkit |
|
----Eur |
Glory |
|
| E06S0293 |
Goat soluble toll-like receptor 2 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06S0281 |
Goat soluble platelet-selectin |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06S0266 |
Goat leptin soluble receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E04S0221 |
Rabbit anti-soluble protein-100 |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| SMUPAR-HIS |
Soluble mouse urokinase receptor, His tag |
1.0 mg |
6846-Eur |
Molecular Innovations |
recombinant |
| E06S0260 |
Goat soluble interleukin 6 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06S0261 |
Goat soluble interleukin 7 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 201-11-0418 |
Rat Leptin Soluble Receptor(sLR)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| SMUPAR-HIS |
Soluble mouse urokinase receptor, His tag |
0.1 mg |
669-Eur |
Molecular Innovations |
recombinant |
| U0046h |
Human soluble glucoprotein 130 CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| E06S0262 |
Goat soluble interleukin 8 receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06S0263 |
Goat soluble liver antigen |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 24404-22 |
Nigrosine(alcohol soluble) CAS: 11099-03-9 |
25G |
125-Eur |
Nacalai |
|
| 24403-32 |
Nigrosine(water soluble) CAS: 8005-03-6 |
25G |
127-Eur |
Nacalai |
|
| SMUPAR-HIS |
Soluble Mouse uPAR, His-tagged |
1.0 mg |
4163-Eur |
Molinn |
|
| E11I0379 |
Bovine Soluble Interleukin 2a receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| 200-04 |
Proteins: Mouse soluble RANK Ligand |
100ug |
523-Eur |
Shenandoah Biotechnology, Inc. |
|
| E02S0249 |
Rat soluble endothelial protein C receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0230 |
Human Anti-soluble CD36 |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| E02S0254 |
Rat soluble Factor-related Apoptosis |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0258 |
Rat Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| 301COX005_CN |
Cox11, S.meliloti, soluble domain, 13C,15N |
|
----Eur |
ProtEra |
|
| U0567h |
Human Soluble protein_100B CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| U0568h |
Human Soluble protein_100 CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| CK-E11053 |
Human soluble Phospholipase A2,sPL-A2 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| CK-E11685 |
Human Soluble protein-100,S-100 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| CSB-E13261h |
Human Soluble Thromobomodulin (STM) ELISA KIT |
96tests |
722-Eur |
Cusabio |
elisa |
| U0978h |
Human soluble protein 185 CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| CK-E20531 |
Mouse Soluble protein-100,S-100 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E01S0221 |
Human Anti-soluble protein-100 |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| E02S0238 |
Rat soluble cluster of differentiation 30 ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01P0042 |
Human Anti-soluble P53 ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| 100-19 |
Proteins: Human soluble RANK Ligand |
1 Mg |
4730-Eur |
Shenandoah Biotechnology, Inc. |
|
| 200-04 |
Proteins: Mouse soluble RANK Ligand |
1 Mg |
4730-Eur |
Shenandoah Biotechnology, Inc. |
|
| S-1004-105 |
Reagents - 4FB Crosslinkers: S-4FB Crosslinker (DMF Soluble) |
5 x 1.0 mg |
134-Eur |
Solulink |
|
| S-1004-010 |
Reagents - 4FB Crosslinkers: S-4FB Crosslinker (DMF Soluble) |
10 mg |
177-Eur |
Solulink |
|
| E03S0222 |
Mouse Soluble thrombomodulin ELISA , sTM |
|
689-Eur |
Blue Gene Biotech |
|
| E03P0042 |
Mouse Soluble P53 ELISA , sP53 |
|
689-Eur |
Blue Gene Biotech |
|
| DS-01-0482 |
Recombinant Human CD54 (Soluble) |
50 |
793-Eur |
Ray Biotech |
recombinant |
| DS-01-0483 |
Recombinant Human CD95 (Soluble) |
25 |
793-Eur |
Ray Biotech |
recombinant |
| E02S0008 |
Rat Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| RCYT-304C |
Recombinant Human Soluble CD4 |
1 mg |
8787-Eur |
LeeBio |
recombinant |
| RCYT-304B |
Recombinant Human Soluble CD4 |
10 µg |
226-Eur |
LeeBio |
recombinant |
| RCYT-304A |
Recombinant Human Soluble CD4 |
2 µg |
117-Eur |
LeeBio |
recombinant |
| CK-E30022 |
Rat soluble Interleukin 2 recepter,IL-2sR ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E30034 |
Rat soluble Interleukin 6 receptor,sIL-6R ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| DEBMS653 |
TNF-soluble Receptor I monkey ELISA |
96 |
645-Eur |
Demeditec |
|
| E02S0158 |
Rat Soluble programmed death-1 ELISA, sPD-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E02R0361 |
Rat Soluble Retinoid X Receptor ELISA, RXR |
|
689-Eur |
Blue Gene Biotech |
|
| CK-E80180 |
rabbit Soluble protein-100,S-100 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E02L0297 |
Rat Soluble Liver X Receptor ELISA, LXR |
|
689-Eur |
Blue Gene Biotech |
|
| E02F0265 |
Rat Soluble Farnesoid X receptor ELISA, FXR |
|
689-Eur |
Blue Gene Biotech |
|
| E06F0265 |
Goat soluble Farnesoid Xreceptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06I0366 |
Goat soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06I0368 |
Goat soluble interleukin-1 receptor II |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06I0378 |
Goat soluble Interleukin 2 recepter |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06I0379 |
Goat Soluble Interleukin 2a receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06I0381 |
Goat Soluble Interleukin 2β receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| IRKTAH1406-1 Kit |
Human HBEGF Soluble ELISA Kit |
1 Kit |
1000-Eur |
Innovative Research INC |
|
| E01S0233 |
Human soluble adhesion molecules |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| CK-E30631 |
Rat Leptin Soluble Receptor,sLR ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E02S0230 |
Rat Soluble CD36 ELISA , sCD36 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0290 |
Rat Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
689-Eur |
Blue Gene Biotech |
|
| U0569h |
Human soluble platelet_selectin CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| E02S0266 |
Rat Soluble Leptin Receptor ELISA, SLR |
|
689-Eur |
Blue Gene Biotech |
|
| 074 |
ANILINE BLUE (Spirit Soluble) (China Bl |
25 gm |
87-Eur |
TitanBiotech |
|
| 074 |
ANILINE BLUE (Spirit Soluble) (China Bl |
100 gm |
142-Eur |
TitanBiotech |
|
| DEBMS6010 |
CD40L, soluble mouse ELISA |
96 |
645-Eur |
Demeditec |
|
| E06E0021 |
Goat soluble E-selectin ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| U1151h |
Human soluble Phospholipase A2 CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| E05P0042 |
Guinea anti-soluble P53 ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E02S0253 |
Rat Soluble Glucoprotein 130 ELISA , sGP130 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0233 |
Rat Soluble adhesion molecules ELISA, Sam |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0221 |
Guinea anti-soluble protein-100 |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| JP27998 |
soluble α-Klotho human ELISA |
96 |
756-Eur |
Demeditec |
|
| E11I0381 |
Bovine Soluble Interleukin 2β receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| FL-103 |
Fas Ligand, Soluble Human (no enhancer required) |
5 ug |
480-Eur |
Kamiya Biomedical KB |
human |
| E11S0260 |
Bovine soluble interleukin 6 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| 1571 |
HEPATIC SOLUBLE ANTIGEN, SERUM |
1 |
116-Eur |
Keynova |
Antibodies |
| CSB-E04842r |
Rat Leptin Soluble Receptor,sLR ELISA Kit |
96T |
524-Eur |
Cusabio |
elisa |
| E08P0042 |
Canine Soluble P53 ELISA , sP53 |
96 Tests/kit |
622-Eur |
BGene |
|
| E07P0042 |
Porcine anti-soluble P53 ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| TN-002 |
Biochemical: TNF-alpha, soluble (human recombinant) |
50 |
518-Eur |
Kamiya Biomedical KB |
|
| 4TR26 |
Transferrin Receptor Soluble, Human |
1mg |
321-Eur |
Hytest |
recombinant |
| E11S0262 |
Bovine soluble interleukin 8 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11S0263 |
Bovine soluble liver antigen |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11S0266 |
Bovine leptin soluble receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CYT-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
2µg |
113-Eur |
Prospecbio |
recombinant |
| TM1125 |
TMB Soluble Reagent (Standard Sensitivity) |
125 ml |
76-Eur |
Scy tek |
|
| E11S0261 |
Bovine soluble interleukin 7 receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CYT-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
10µg |
198-Eur |
Prospecbio |
recombinant |
| E11S0281 |
Bovine soluble platelet-selectin |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CYT-294 |
Recombinant Bovine Prolactin Soluble Receptor |
50µg |
198-Eur |
Prospecbio |
recombinant |
| E07S0221 |
Porcine anti-soluble protein-100 |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| E11S0252 |
Bovine soluble endothelium-selectin |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CYT-320 |
Recombinant Mouse Soluble RANK Ligand |
2µg |
113-Eur |
Prospecbio |
recombinant |
| CYT-631 |
Recombinant Human Soluble RANK Ligand, GST Tag |
2µg |
113-Eur |
Prospecbio |
recombinant |
| CYT-334 |
Recombinant Human Soluble RANK Ligand |
2µg |
113-Eur |
Prospecbio |
recombinant |
| 8SLX1 |
Recombinant soluble LOX_1, Human |
0,1mg |
599-Eur |
Hytest |
recombinant |
| CYT-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP |
5µg |
113-Eur |
Prospecbio |
recombinant |
| CYT-268 |
Recombinant Rabbit Prolactin Soluble Receptor |
50µg |
198-Eur |
Prospecbio |
recombinant |
| CYT-245 |
Recombinant Human soluble CD40 Ligand_TRAP |
50µg |
198-Eur |
Prospecbio |
recombinant |
| CYT-293 |
Recombinant Ovine Prolactin Soluble Receptor |
50µg |
198-Eur |
Prospecbio |
recombinant |
| CSB-E04612h |
Human soluble interleukin_1 receptor |
96T |
781-Eur |
Cusabio |
recombinant |
| CYT-245 |
Recombinant Human soluble CD40 Ligand_TRAP |
10µg |
113-Eur |
Prospecbio |
recombinant |
| CYT-294 |
Recombinant Bovine Prolactin Soluble Receptor |
10µg |
113-Eur |
Prospecbio |
recombinant |
| CYT-293 |
Recombinant Ovine Prolactin Soluble Receptor |
10µg |
113-Eur |
Prospecbio |
recombinant |
| CSB-E04611h |
Human soluble interleukin_1 receptor |
96T |
781-Eur |
Cusabio |
recombinant |
| CYT-268 |
Recombinant Rabbit Prolactin Soluble Receptor |
10µg |
113-Eur |
Prospecbio |
recombinant |
| CYT-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP |
25µg |
198-Eur |
Prospecbio |
recombinant |
| E01S0222 |
Human Soluble thrombomodulin ELISA , sTM |
|
689-Eur |
Blue Gene Biotech |
|
| TN-001 |
Biochemical: TNF-alpha, Soluble (mouse recombinant) |
50 |
521-Eur |
Kamiya Biomedical KB |
|
| E11S0226 |
Bovine Soluble protein-100B |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CYT-245 |
Recombinant Human soluble CD40 Ligand_TRAP |
1mg |
1586-Eur |
Prospecbio |
recombinant |
| CYT-320 |
Recombinant Mouse Soluble RANK Ligand |
10µg |
198-Eur |
Prospecbio |
recombinant |
| SU8SLX1-01 |
Recombinant soluble LOX_1, human |
0.1 mg. |
3015-Eur |
Accurate |
recombinant |
| CYT-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
1mg |
5241-Eur |
Prospecbio |
recombinant |
| E03P0042 |
Mouse Soluble P53 ELISA ,sP53 |
96 Tests/kit |
601-Eur |
BGene |
|
| E11R0361 |
Bovine soluble Retinoid X Receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11P0110 |
Bovine soluble P-selectin Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| QY-E11227 |
Rat Leptin Soluble Receptor(sLR)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| CYT-320 |
Recombinant Mouse Soluble RANK Ligand |
1mg |
5149-Eur |
Prospecbio |
recombinant |
| CYT-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP |
1mg |
2989-Eur |
Prospecbio |
recombinant |
| E11L0297 |
Bovine soluble Liver Receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CYT-334 |
Recombinant Human Soluble RANK Ligand |
1mg |
5149-Eur |
Prospecbio |
recombinant |
| CYT-631 |
Recombinant Human Soluble RANK Ligand, GST Tag |
1mg |
6229-Eur |
Prospecbio |
recombinant |
| CSB-E07996r |
Rat soluble E_selectin,sE_selectin ELISA Kit |
96T |
701-Eur |
Cusabio |
elisa |
| E11S0233 |
Bovine soluble adhesion molecules |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11S0239 |
Bovine soluble cluster of differentiation 86 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CSB-E07447m |
Mouse soluble interleukin_1 receptor |
96T |
781-Eur |
Cusabio |
recombinant |
| E13P0042 |
Anserine anti - soluble P53 ELISA Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| CYT-334 |
Recombinant Human Soluble RANK Ligand |
10µg |
198-Eur |
Prospecbio |
recombinant |
| CSB-E07449m |
Mouse soluble interleukin_1 receptor |
96T |
781-Eur |
Cusabio |
recombinant |
| E03S0222 |
Mouse Soluble thrombomodulin ELISA ,sTM |
96 Tests/kit |
601-Eur |
BGene |
|
| CYT-631 |
Recombinant Human Soluble RANK Ligand, GST Tag |
10µg |
198-Eur |
Prospecbio |
recombinant |
| E11S0293 |
Bovine soluble toll-like receptor 2 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CYT-268 |
Recombinant Rabbit Prolactin Soluble Receptor |
1mg |
1524-Eur |
Prospecbio |
recombinant |
| CYT-293 |
Recombinant Ovine Prolactin Soluble Receptor |
1mg |
1524-Eur |
Prospecbio |
recombinant |
| CYT-294 |
Recombinant Bovine Prolactin Soluble Receptor |
1mg |
1524-Eur |
Prospecbio |
recombinant |
| E13S0221 |
Anserine anti - soluble protein-100 |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| EIAAB40112 |
Aryl sulfotransferase,Mouse,mSTp1,Mus musculus,Phenol sulfotransferase,Phenol_aryl sulfotransferase,ST1A1,St1a1,ST1A4,Stp,Stp1,Sulfokinase,Sulfotransferase 1A1,Sult1a1 |
|
1164-Eur |
EIAab |
|
| E03S0249 |
Mouse soluble endothelial protein C receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0075h |
Human soluble interleukin_2 receptor ELISA kit |
96T |
706-Eur |
EIAab |
elisa |
| E11S0249 |
Bovine soluble endothelial protein C receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E06C0044 |
Goat soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| OETCGF320 |
RANK Ligand Soluble Mouse Recombinant |
2 |
92-Eur |
OET |
|
| IRKTAH1518-1 Kit |
Mouse Soluble IL1R 4_ST2 ELISA Kit |
1 Kit |
858-Eur |
Innovative Research INC |
|
| IRKTAH1517-1 Kit |
Human Soluble IL1R 4_ST2 ELISA Kit |
1 Kit |
858-Eur |
Innovative Research INC |
|
| OETCGF334 |
RANK Ligand Soluble Human Recombinant |
2 |
92-Eur |
OET |
|
| E11F0103 |
Bovine soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E13S0258 |
Anserine Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E0074h |
Human soluble interleukin_2 receptor ELISA kit |
96T |
706-Eur |
EIAab |
elisa |
| IRKTAH1532-1 Kit |
Human Soluble Neuregulin4 NRG4 ELISA kit |
1 Kit |
1071-Eur |
Innovative Research INC |
|
| E06I0366 |
Goat Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
608-Eur |
BGene |
|
| E0754r |
Rat soluble myosin heavy chain 1 ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| E13F0103 |
Anserine soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E0685h |
Human soluble cluster of differentiation 14 ELISA |
96T |
706-Eur |
EIAab |
elisa |
| E02C0209 |
Rat soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0522h |
Human soluble adhesion molecules Elisa Kit |
96T |
706-Eur |
EIAab |
elisa |
| E06F0265 |
Goat Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
608-Eur |
BGene |
|
| E04C0044 |
Rabbit soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E13C0044 |
Anserine soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E04S0290 |
Rabbit Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
601-Eur |
BGene |
|
| E0548Rb |
Rabbit Soluble Intercellular Adhesion Molecule_1 E |
96T |
839-Eur |
EIAab |
polyclonal |
| OETCGF595 |
Prolactin Soluble Receptor Human Recombinant |
50 |
171-Eur |
OET |
|
| E0548r |
Rat Soluble Intercellular Adhesion Molecule 1 ELIS |
96T |
755-Eur |
EIAab |
rat |
| E06I0378 |
Goat Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
608-Eur |
BGene |
|
| E0750h |
Human Soluble Cluster of differentiation 21 ELISA |
96T |
706-Eur |
EIAab |
elisa |
| E0652h |
human soluble cluster of differentiation 28 ELISA |
96T |
706-Eur |
EIAab |
elisa |
| ISMUPAR-HIS-1mg |
Soluble Mouse Urokinase Receptor, His Tagged 1mg |
1mg |
8990-Eur |
Innovative Research INC |
|
| E02A0223 |
Rat soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03S0258 |
Mouse Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E11S0254 |
Bovine soluble Factor-related Apoptosis |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11S0258 |
Bovine Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E07F0103 |
Porcine soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E0752h |
Human Soluble Cluster of differentiation 38 ELISA |
96T |
706-Eur |
EIAab |
elisa |
| OETCGF595 |
Prolactin Soluble Receptor Human Recombinant |
10 |
92-Eur |
OET |
|
| OETCGF631 |
Soluble RANK Ligand Human Recombinant, GST tag |
2 |
92-Eur |
OET |
|
| OETCGF334 |
RANK Ligand Soluble Human Recombinant |
10 |
171-Eur |
OET |
|
| ISMUPAR-HIS-0.1mg |
Soluble Mouse Urokinase Receptor, His Tagged 0.1mg |
0.1mg |
1250-Eur |
Innovative Research INC |
|
| E04F0103 |
Rabbit soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02C0053 |
Rat soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| OETCGF670 |
soluble CD40 Ligand_TRAP Human Recombinant, His Tag |
5 |
92-Eur |
OET |
|
| E04S0266 |
Rabbit Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
601-Eur |
BGene |
|
| AS09 538 |
SOD1 aa 80_96 | superoxide dismutase 1, soluble |
50 ul |
499-Eur |
Agrisera |
elisa |
| E07S0254 |
Porcine soluble Factor-related Apoptosis |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| AS09 536 |
SOD1 aa 43_57 | superoxide dismutase 1, soluble |
50 ul |
499-Eur |
Agrisera |
|
| E03S0254 |
Mouse soluble Factor-related Apoptosis |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| AS09 535 |
SOD1 aa 24_39 | superoxide dismutase 1, soluble |
50 ul |
499-Eur |
Agrisera |
|
| AS09 534 |
SOD1 aa 03_20 | superoxide dismutase 1, soluble |
100 ul |
499-Eur |
Agrisera |
|
| E04S0008 |
Rabbit Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0075m |
Mouse soluble interleukin_2 receptor ELISA kit |
96T |
739-Eur |
EIAab |
elisa |
| E02T0527 |
Rat Tumor necrosis factor soluble receptor II |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06C0053 |
Goat Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
608-Eur |
BGene |
|
| OETCGF268 |
Prolactin Rabbit Soluble Receptor Recombinant |
50 |
171-Eur |
OET |
|
| OETCGF469 |
Prolactin Soluble Receptor Human Recombinant, GST tag |
5 |
291-Eur |
OET |
|
| E03C0044 |
Mouse soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06S0258 |
Goat Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06S0254 |
Goat soluble Factor-related Apoptosis |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| OETCGF286 |
Interleukin-6 Soluble Receptor Human Recombinant |
20 |
171-Eur |
OET |
|
| E04S0238 |
Rabbit soluble cluster of differentiation 30 ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06F0103 |
Goat soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| OETCGF294 |
Prolactin Soluble Receptor Bovine Recombinant |
50 |
171-Eur |
OET |
|
| AS09 540 |
SOD1 aa 131_153 | superoxide dismutase 1, soluble |
50 ul |
499-Eur |
Agrisera |
|
| E04S0258 |
Rabbit Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E04S0254 |
Rabbit soluble Factor-related Apoptosis |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E11S0008 |
Bovine Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| OETCGF293 |
Prolactin Soluble Receptor Ovine Recombinant |
50 |
171-Eur |
OET |
|
| OETCGF294 |
Prolactin Soluble Receptor Bovine Recombinant |
10 |
92-Eur |
OET |
|
| E07S0258 |
Porcine Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07C0044 |
Porcine soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| OETCGF293 |
Prolactin Soluble Receptor Ovine Recombinant |
10 |
92-Eur |
OET |
|
| E06I0368 |
Goat Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
608-Eur |
BGene |
|
| E04S0249 |
Rabbit soluble endothelial protein C receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| AS09 537 |
SOD1 aa 58_72 | superoxide dismutase 1, soluble |
50 ul |
499-Eur |
Agrisera |
|
| E0118h |
Human Soluble Cluster of differentiation 30 ligand |
96T |
706-Eur |
EIAab |
human |
| E02T0526 |
Rat Tumor necrosis factor soluble receptor I |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| YSRTPHP193 |
VEGF Receptor 1 (soluble), Human Recombinant |
10 µg. |
1136-Eur |
Accurate |
recombinant |
| AS09 539 |
SOD1 aa 100_115 | superoxide dismutase 1, soluble |
50 ul |
499-Eur |
Agrisera |
|
| E13S0008 |
Anserine Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| OETCGF320 |
RANK Ligand Soluble Mouse Recombinant |
10 |
171-Eur |
OET |
|
| E0065h |
Human soluble interleukin_1 receptorⅠ ELISA kit |
96T |
706-Eur |
EIAab |
elisa |
| E07S0008 |
Porcine Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E13S0238 |
Anserine soluble cluster of differentiation 30 ligand |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E0066h |
Human soluble interleukin_1 receptor Ⅱ ELISA kit |
96T |
706-Eur |
EIAab |
elisa |
| E1837h |
Human soluble Interleukin 2 recepter ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E03S0008 |
Mouse Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E13S0249 |
Anserine soluble endothelial protein C receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| B10620 |
Biebrich Scarlet Water Soluble C.I. No. 26905 |
250 G |
215-Eur |
pfalslandbauer |
|
| E13S0254 |
Anserine soluble Factor-related Apoptosis |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| OETCGF469 |
Prolactin Soluble Receptor Human Recombinant, GST tag |
2 |
199-Eur |
OET |
|
| E1837p |
Porcine soluble Interleukin 2 recepter ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E1153Rb |
Rabbit soluble Factor_related Apoptosis ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E03S0238 |
Mouse soluble cluster of differentiation 30 ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E1956h |
Human soluble receptor for advanced glycation end |
96T |
706-Eur |
EIAab |
recombinant |
| E06S0008 |
Goat Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| OETCGF268 |
Prolactin Rabbit Soluble Receptor Recombinant |
10 |
92-Eur |
OET |
|
| E06S0249 |
Goat soluble endothelial protein C receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E11S0238 |
Bovine soluble cluster of differentiation 30 ligand |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E03F0103 |
Mouse soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0074m |
Mouse soluble interleukin_2 receptor ELISA kit |
96T |
739-Eur |
EIAab |
elisa |
| E0066m |
Mouse soluble interleukin_1 receptor Ⅱ ELISA kit |
96T |
739-Eur |
EIAab |
elisa |
| E06S0238 |
Goat soluble cluster of differentiation 30 ligand |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E2042h |
Human soluble Farnesoid X Receptor ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E07S0249 |
Porcine soluble endothelial protein C receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E0065m |
Mouse soluble interleukin_1 receptor Ⅰ ELISA kit |
96T |
739-Eur |
EIAab |
elisa |
| E06C0044 |
Goat Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
608-Eur |
BGene |
|
| AS09 578 |
A set of 7 antibodies against SOD1 | superoxide dismutase 1, soluble |
6x 50 ul + 1x 100 ul |
2636-Eur |
Agrisera |
Antibodies |
| B10620 |
Biebrich Scarlet Water Soluble C.I. No. 26905 |
1000 G |
443-Eur |
pfalslandbauer |
|
| E07S0238 |
Porcine soluble cluster of differentiation 30 ligand |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| B10620 |
Biebrich Scarlet Water Soluble C.I. No. 26905 |
50 G |
107-Eur |
pfalslandbauer |
|
| OETCGF286 |
Interleukin-6 Soluble Receptor Human Recombinant |
5 |
92-Eur |
OET |
|
| E11C0044 |
Bovine soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E03S0260 |
Mouse anti-soluble interleukin 6 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E07R0361 |
Porcine anti-soluble Retinoid X Receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07S0226 |
Porcine anti-Soluble protein-100B |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| 8GSL1 |
Glycosylated Soluble LOX_1, Human, recombinant |
0,1mg |
1216-Eur |
Hytest |
recombinant |
| 21776 |
Rat soluble Cluster of differentiation 86(sCD86) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E08L0297 |
Canine Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E08R0361 |
Canine Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
622-Eur |
BGene |
|
| 4GC1 |
Guanylate cyclase (hsGC,) Human soluble |
1mg |
488-Eur |
Hytest |
human |
| E07S0233 |
Porcine anti-soluble adhesion molecules |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| E07S0239 |
Porcine anti-soluble cluster of differentiation 86 |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| E07S0252 |
Porcine anti-soluble endothelium-selectin |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| E07S0260 |
Porcine anti-soluble interleukin 6 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07S0261 |
Porcine anti-soluble interleukin 7 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07S0262 |
Porcine anti-soluble interleukin 8 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07P0110 |
Porcine anti-soluble P-selectin Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E07L0297 |
Porcine anti-soluble Liver Receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E03S0261 |
Mouse anti-soluble interleukin 7 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03S0262 |
Mouse anti-soluble interleukin 8 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03S0266 |
Mouse anti-leptin soluble receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03S0281 |
Mouse anti-soluble platelet-selectin |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| E03S0293 |
Mouse anti-soluble toll-like receptor 2 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03S0294 |
Mouse anti-soluble toll-like receptor 6 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E07E0021 |
Porcine anti-soluble E-selectin ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E07F0265 |
Porcine anti-soluble Farnesoid Xreceptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07I0366 |
Porcine anti-soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07I0368 |
Porcine anti-soluble interleukin-1 receptor II |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07I0378 |
Porcine anti-soluble Interleukin 2 recepter |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07I0379 |
Porcine anti-Soluble Interleukin 2a receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07I0381 |
Porcine anti-Soluble Interleukin 2β receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07S0266 |
Porcine anti-leptin soluble receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07S0281 |
Porcine anti-soluble platelet-selectin |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| E07S0293 |
Porcine anti-soluble toll-like receptor 2 |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E02S0008 |
Rat anti-Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E02S0238 |
Rat anti-soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| E02S0249 |
Rat anti-soluble endothelial protein C receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E02S0254 |
Rat anti-soluble Factor-related Apoptosis |
96 Tests/kit |
1087-Eur |
BlueGen |
apoptosis |
| E02S0258 |
Rat anti-Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| 205027 |
ELISA_Kits,Soluble Tumor Necrosis Factor Rec II |
96 TESTS |
795-Eur |
GenWay |
elisa |
| E06E0021 |
Goat anti-soluble E-selectin ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E06F0265 |
Goat anti-soluble Farnesoid Xreceptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06I0368 |
Goat anti-soluble interleukin-1 receptor II |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06I0378 |
Goat anti-soluble Interleukin 2 recepter |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06I0379 |
Goat anti-Soluble Interleukin 2a receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06I0381 |
Goat anti-Soluble Interleukin 2β receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06L0297 |
Goat anti-soluble Liver Receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E02F0103 |
Rat anti-soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E02C0044 |
Rat anti-soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E13L0297 |
Anserine anti - soluble Liver Receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13P0110 |
Anserine anti - soluble P-selectin Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| E13R0361 |
Anserine anti - soluble Retinoid X Receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13S0226 |
Anserine anti - Soluble protein-100B |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| E13S0233 |
Anserine anti - soluble adhesion molecules |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| E13S0239 |
Anserine anti - soluble cluster of differentiation 86 |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| E13S0252 |
Anserine anti - soluble endothelium-selectin |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| E13S0260 |
Anserine anti - soluble interleukin 6 receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13S0261 |
Anserine anti - soluble interleukin 7 receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13S0262 |
Anserine anti - soluble interleukin 8 receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13S0266 |
Anserine anti - leptin soluble receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13S0281 |
Anserine anti - soluble platelet-selectin |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| E13S0293 |
Anserine anti - soluble toll-like receptor 2 |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E06P0110 |
Goat anti-soluble P-selectin Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E05S0252 |
Guinea anti-soluble endothelium-selectin |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| 23849 |
Rat Soluble Toll-Like Receptor 2(sTLR-2) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| A32780 |
Aniline Yellow Alcohol Soluble C.I. No. 11000 |
|
619-Eur |
pfalslandbauer |
|
| A32780 |
Aniline Yellow Alcohol Soluble C.I. No. 11000 |
|
310-Eur |
pfalslandbauer |
|
| A32780 |
Aniline Yellow Alcohol Soluble C.I. No. 11000 |
|
143-Eur |
pfalslandbauer |
|
| A32580 |
Aniline Blue Water Soluble C.I. No. 42755 |
|
269-Eur |
pfalslandbauer |
|
| A32580 |
Aniline Blue Water Soluble C.I. No. 42755 |
|
209-Eur |
pfalslandbauer |
|
| A32578 |
Aniline Blue Alcohol Soluble C.I. No. 51004 |
|
106-Eur |
pfalslandbauer |
|
| 22080 |
Rat soluble interleukin-1 receptor Ⅱ(IL-1sRⅡ) ELISA kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E08C0044 |
Canine Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
622-Eur |
BGene |
|
| E08C0053 |
Canine Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
622-Eur |
BGene |
|
| E04I0378 |
Rabbit anti-soluble Interleukin 2 recepter |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04I0379 |
Rabbit anti-Soluble Interleukin 2a receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04I0381 |
Rabbit anti-Soluble Interleukin 2β receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| 23850 |
Rat Soluble Toll-Like Receptor 6(sTLR-6) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| MA-CD4-6 |
Anti-human CD4 (soluble receptor) IgG fraction (monoclonal) |
200 |
311-Eur |
AustralBiologicals |
recombinant |
| E05S0260 |
Guinea anti-soluble interleukin 6 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05S0261 |
Guinea anti-soluble interleukin 7 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05S0262 |
Guinea anti-soluble interleukin 8 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05S0266 |
Guinea anti-leptin soluble receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05S0281 |
Guinea anti-soluble platelet-selectin |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| E05S0293 |
Guinea anti-soluble toll-like receptor 2 |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05S0294 |
Guinea anti-soluble toll-like receptor 6 |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E04E0021 |
Rabbit anti-soluble E-selectin ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E04F0265 |
Rabbit anti-soluble Farnesoid Xreceptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04I0366 |
Rabbit anti-soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04I0368 |
Rabbit anti-soluble interleukin-1 receptor II |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E07S0266 |
Porcine Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0290 |
Porcine Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
608-Eur |
BGene |
|
| E04L0297 |
Rabbit anti-soluble Liver Receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04P0110 |
Rabbit anti-soluble P-selectin Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E04R0361 |
Rabbit anti-soluble Retinoid X Receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03E0021 |
Mouse anti-soluble E-selectin ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E03F0265 |
Mouse anti-soluble Farnesoid Xreceptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03I0366 |
Mouse anti-soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03I0368 |
Mouse anti-soluble interleukin-1 receptor II |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03I0378 |
Mouse anti-soluble Interleukin 2 recepter |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03I0379 |
Mouse anti-Soluble Interleukin 2a receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03I0381 |
Mouse anti-Soluble Interleukin 2β receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03L0297 |
Mouse anti-soluble Liver Receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03P0110 |
Mouse anti-soluble P-selectin Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E03R0361 |
Mouse anti-soluble Retinoid X Receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03S0226 |
Mouse anti-Soluble protein-100B |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| E03S0233 |
Mouse anti-soluble adhesion molecules |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| E03S0239 |
Mouse anti-soluble cluster of differentiation 86 |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| E04S0293 |
Rabbit anti-soluble toll-like receptor 2 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04S0281 |
Rabbit anti-soluble platelet-selectin |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| E04S0226 |
Rabbit anti-Soluble protein-100B |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| E04S0233 |
Rabbit anti-soluble adhesion molecules |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| E04S0239 |
Rabbit anti-soluble cluster of differentiation 86 |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| E04S0252 |
Rabbit anti-soluble endothelium-selectin |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| E04S0260 |
Rabbit anti-soluble interleukin 6 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04S0261 |
Rabbit anti-soluble interleukin 7 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04S0262 |
Rabbit anti-soluble interleukin 8 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| 22077 |
Rat soluble interleukin-1 receptor Ⅰ(IL-1sRⅠ) ELISA kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E08F0265 |
Canine Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E08I0366 |
Canine Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
622-Eur |
BGene |
|
| E08I0368 |
Canine Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
622-Eur |
BGene |
|
| E08I0378 |
Canine Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
622-Eur |
BGene |
|
| E04S0266 |
Rabbit anti-leptin soluble receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03S0252 |
Mouse anti-soluble endothelium-selectin |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| E06R0361 |
Goat anti-soluble Retinoid X Receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| CSB-E09349h |
Human Soluble Adenylate Cyclase,sAC ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| E08S0290 |
Canine Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
622-Eur |
BGene |
|
| E09C0044 |
Monkey Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
622-Eur |
BGene |
|
| E09C0053 |
Monkey Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
622-Eur |
BGene |
|
| E09F0265 |
Monkey Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E09I0366 |
Monkey Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
622-Eur |
BGene |
|
| E09I0368 |
Monkey Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
622-Eur |
BGene |
|
| E09I0378 |
Monkey Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
622-Eur |
BGene |
|
| E09L0297 |
Monkey Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E09R0361 |
Monkey Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E09S0008 |
Monkey Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E09S0158 |
Monkey Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| 272804 |
PMF-Huile soluble-BR4-RLL090 _ AC Signs;Pack-RL; |
33 m Pcs Per Pack |
259-Eur |
Brady |
|
| E09S0230 |
Monkey Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0266 |
Canine Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
622-Eur |
BGene |
|
| 22161 |
Human Leptin Soluble Receptor(sLR) ELISA kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| CSB-E09578h |
Human soluble adhesion molecules,Sam ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E09823h |
Human Leptin Soluble Receptor,sLR ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| CSB-E09869Ch |
Chicken soluble E_selectin,sE_selectin ELISA Kit |
96tests |
602-Eur |
Cusabio |
elisa |
| CSB-E09921m |
Mouse Soluble Endoglin,ENG_sCD105 ELISA Kit |
96tests |
837-Eur |
Cusabio |
elisa |
| CSB-E10030h |
Human Soluble Endoglin,ENG_sCD105 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E10051m |
Mouse Leptin Soluble Receptor,sLR ELISA Kit |
96tests |
557-Eur |
Cusabio |
elisa |
| E08S0230 |
Canine Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0233 |
Canine Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0253 |
Canine Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
622-Eur |
BGene |
|
| 22162 |
Mouse Leptin Soluble Receptor(sLR) ELISA KIT |
96T |
878-Eur |
Bio-Medical |
elisa |
| 23568 |
Human Soluble Protein 185 (sp185) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| E08S0260 |
Canine Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
622-Eur |
BGene |
|
| 20088 |
Human soluble interleukin-6 receptor (sIL-6R) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| E09S0233 |
Monkey Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
622-Eur |
BGene |
|
| 272803 |
PMF-Huile soluble-BR3-RLL090 _ AC Signs;Pack-RL; |
33 m Pcs Per Pack |
259-Eur |
Brady |
|
| 272802 |
PMF-Huile soluble-BR1-52X402 _ AC Signs;Pack-CD; |
2 Pcs Per Pack |
9-Eur |
Brady |
|
| CK-E99214 |
Rabbit soluble adhesion molecules,Sam ELISAkit |
|
----Eur |
Glory |
|
| PA232X |
CD25 _ IL2RA (soluble, sIL2RA) antigen |
25 |
237-Eur |
ACR |
|
| PA232 |
CD25 _ IL2RA (soluble, sIL2RA) antigen |
5 |
147-Eur |
ACR |
|
| ABS12374 |
RECOMBINANT HUMAN VEGF RECEPTOR 1 (SOLUBLE) |
10 µg |
636-Eur |
AbD Serotec |
|
| E09S0290 |
Monkey Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
622-Eur |
BGene |
|
| ABS11702 |
MOUSE ANTI HUMAN CD71 (SOLUBLE) |
0.2 mg |
277-Eur |
AbD Serotec |
Antibodies |
| ABS11701 |
MOUSE ANTI HUMAN CD71 (SOLUBLE) |
0.2 mg |
277-Eur |
AbD Serotec |
Antibodies |
| ABS11692 |
MOUSE ANTI HUMAN LOX_1 (SOLUBLE) |
0.2 mg |
358-Eur |
AbD Serotec |
Antibodies |
| ABS11691 |
MOUSE ANTI HUMAN LOX_1 (SOLUBLE) |
0.2 mg |
358-Eur |
AbD Serotec |
Antibodies |
| ABS11682 |
MOUSE ANTI HUMAN CD154 (SOLUBLE) |
0.2 mg |
358-Eur |
AbD Serotec |
Antibodies |
| ABS11681 |
MOUSE ANTI HUMAN CD154 (SOLUBLE) |
0.2 mg |
358-Eur |
AbD Serotec |
Antibodies |
| Z5010471 |
Recombinant Human Soluble RANK ligand |
10 µg |
295-Eur |
Biochain |
recombinant |
| Z5010466 |
Recombinant Human soluble CD40 Ligand_TRAP |
50 µg |
295-Eur |
Biochain |
recombinant |
| E09S0266 |
Monkey Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
622-Eur |
BGene |
|
| E09S0260 |
Monkey Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
622-Eur |
BGene |
|
| 272801 |
PMF-Huile soluble-BR1-37X284 _ AC Signs;Pack-CD; |
3 pipem Pcs Per Pack |
11-Eur |
Brady |
|
| 272800 |
PMF-Huile soluble-BR1-26X200 _ AC Signs;Pack-CD; |
3 pipem Pcs Per Pack |
9-Eur |
Brady |
|
| E09S0253 |
Monkey Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E98516 |
Rat soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISAkit |
|
----Eur |
Glory |
|
| CK-E98518 |
Rat soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISAkit |
|
----Eur |
Glory |
|
| CK-E98522 |
Rat soluble interleukin-2 receptor,IL-2sRα ELISAkit |
|
----Eur |
Glory |
|
| CK-E98523 |
Rat soluble interleukin-2 receptor,IL-2sRβ ELISAkit |
|
----Eur |
Glory |
|
| N001215 |
Huile soluble 450x52RL-T1-LL-P18 _ AC Signs;Pack-RL; |
30 Pcs Per Pack |
120-Eur |
Brady |
|
| N001115 |
Huile soluble 355x37RL-T1-LL-P18 _ AC Signs;Pack-RL; |
30 Pcs Per Pack |
95-Eur |
Brady |
|
| N001015 |
Huile soluble 250x26RL-T1-LL-P18 _ AC Signs;Pack-RL; |
30 Pcs Per Pack |
79-Eur |
Brady |
|
| N002659 |
Huile soluble 100x33RL-T3-P18 _ AC Signs;Pack-RL; |
220 Pcs Per Pack |
254-Eur |
Brady |
|
| N002658 |
Huile soluble 100x33RL-T2-P18 _ AC Signs;Pack-RL; |
505 Pcs Per Pack |
254-Eur |
Brady |
|
| CK-E99053 |
Rabbit soluble interleukin-1 receptor Ⅰ,IL-1sR Ⅰ ELISAkit |
|
----Eur |
Glory |
|
| 201-12-0650 |
Human soluble protein 185,sp185_HER-2 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| E06S0226 |
Goat anti-Soluble protein-100B |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| E11L0297 |
Bovine anti-soluble Liver Receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11P0110 |
Bovine anti-soluble P-selectin Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| E11R0361 |
Bovine anti-soluble Retinoid X Receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11S0226 |
Bovine anti-Soluble protein-100B |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| E11S0233 |
Bovine anti-soluble adhesion molecules |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| E11S0239 |
Bovine anti-soluble cluster of differentiation 86 |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| E11S0252 |
Bovine anti-soluble endothelium-selectin |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| E11S0260 |
Bovine anti-soluble interleukin 6 receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11S0261 |
Bovine anti-soluble interleukin 7 receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11S0262 |
Bovine anti-soluble interleukin 8 receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11S0266 |
Bovine anti-leptin soluble receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11S0281 |
Bovine anti-soluble platelet-selectin |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| E11S0293 |
Bovine anti-soluble toll-like receptor 2 |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11I0381 |
Bovine anti-Soluble Interleukin 2β receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11I0379 |
Bovine anti-Soluble Interleukin 2a receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E06S0233 |
Goat anti-soluble adhesion molecules |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| E06S0239 |
Goat anti-soluble cluster of differentiation 86 |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| E06S0252 |
Goat anti-soluble endothelium-selectin |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| E06S0260 |
Goat anti-soluble interleukin 6 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06S0261 |
Goat anti-soluble interleukin 7 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06S0262 |
Goat anti-soluble interleukin 8 receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06S0266 |
Goat anti-leptin soluble receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06S0281 |
Goat anti-soluble platelet-selectin |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| E06S0293 |
Goat anti-soluble toll-like receptor 2 |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E11F0265 |
Bovine anti-soluble Farnesoid Xreceptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11I0366 |
Bovine anti-soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11I0368 |
Bovine anti-soluble interleukin-1 receptor II |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11I0378 |
Bovine anti-soluble Interleukin 2 recepter |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13E0021 |
Anserine anti - soluble E-selectin ELISA Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| E13F0265 |
Anserine anti - soluble Farnesoid Xreceptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13I0366 |
Anserine anti - soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| CSB-E07381r |
Rat tumor necrosis factor soluble receptor |
96tests |
641-Eur |
Cusabio |
recombinant |
| CSB-E07438m |
Mouse soluble interleukin_2 receptor,sIL_2R |
96tests |
722-Eur |
Cusabio |
recombinant |
| CSB-E07440m |
Mouse soluble interleukin_2 receptor,sIL_2R |
96tests |
722-Eur |
Cusabio |
recombinant |
| CSB-E07994h |
Human soluble E_selectin,sE_selectin ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| CSB-E07995m |
Mouse soluble E_selectin,sE_selectin ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| CSB-E08065h |
Human Soluble protein_100B,S_100B ELISA Kit |
96tests |
837-Eur |
Cusabio |
elisa |
| CSB-E08067h |
Human Soluble protein_100,S_100 ELISA Kit |
96tests |
837-Eur |
Cusabio |
elisa |
| CSB-E08068m |
Mouse Soluble protein_100,S_100 ELISA Kit |
96tests |
837-Eur |
Cusabio |
elisa |
| CSB-E08074h |
Human soluble P_selectin,sP_selectin ELISA Kit |
96tests |
602-Eur |
Cusabio |
elisa |
| CSB-E08077m |
Mouse soluble P_selectin,sP_selectin ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| CSB-E08106p |
Porcine soluble P_selectin,sP_Selectin ELISA Kit |
96tests |
681-Eur |
Cusabio |
elisa |
| CSB-E08543r |
Rat soluble cluster of differentiation 86,sCD86 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E09092h |
Human soluble Phospholipase A2,sPL_A2 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E06941Rb |
Rabbit soluble E_selectin,sE_selectin ELISA Kit |
96tests |
681-Eur |
Cusabio |
elisa |
| CSB-E06895Rb |
Rabbit Soluble protein_100B,S_100B ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| E13I0368 |
Anserine anti - soluble interleukin-1 receptor II |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13I0378 |
Anserine anti - soluble Interleukin 2 recepter |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13I0379 |
Anserine anti - Soluble Interleukin 2a receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13I0381 |
Anserine anti - Soluble Interleukin 2β receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E08S0008 |
Canine Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0158 |
Canine Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E04629h |
Human soluble interleukin_2 receptor,IL_2sR |
96tests |
722-Eur |
Cusabio |
recombinant |
| CSB-E04630h |
Human soluble interleukin_2 receptor,IL_2sR |
96tests |
722-Eur |
Cusabio |
recombinant |
| 22643 |
Rat soluble cluster of differentiation 14(sCD14) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CSB-E04700r |
Rat platelet_derived growth factor soluble receptor |
96tests |
856-Eur |
Cusabio |
recombinant |
| CSB-E05191Rb |
Rabbit soluble adhesion molecules,Sam ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| CSB-E06861Rb |
Rabbit soluble P_selectin,sP_selectin ELISA Kit |
96tests |
681-Eur |
Cusabio |
elisa |
| CSB-E06894Rb |
Rabbit Soluble protein_100,S_100 ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| CSB-E09099h |
Human soluble tumor necrosis Factor |
96tests |
797-Eur |
Cusabio |
human |
| YSRTMPP004 |
Adenovirus Type 3 Soluble Antigen, ELISA |
1 ml. |
1045-Eur |
Accurate |
elisa |
| E07L0297 |
Porcine Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
608-Eur |
BGene |
|
| CK-E97408 |
Human soluble protein 185,sp185_HER-2 ELISAkit |
|
----Eur |
Glory |
|
| 201-09-0006 |
Rabbit soluble adhesion molecules,Sam ELISA Kit |
96T |
719-Eur |
SunBT |
|
| 201-09-0161 |
Rabbit soluble interleukin-1 receptor Ⅰ,IL-1sR Ⅰ ELISA kit |
96T |
719-Eur |
SunBT |
|
| 201-12-0305 |
Human Leptin Soluble Receptor,sLR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-1198 |
Human retinal soluble antigen,Sag ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0845 |
Human Soluble Adenylate Cyclase,sAC ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0217 |
Human soluble adhesion molecules,Sam ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0317 |
Human Soluble Endoglin,ENG_sCD105 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-1396 |
Human soluble Farnesoid X Receptor,FXR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0245 |
Human soluble Interleukin 2 recepter,IL-2sR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-1394 |
Human soluble Liver X Receptor,LXR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0650 |
Human soluble protein 185,sp185_HER-2 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E07I0378 |
Porcine Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
608-Eur |
BGene |
|
| E07I0368 |
Porcine Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
608-Eur |
BGene |
|
| YSRTMPP005 |
Adenovirus Type 11 Soluble Antigen, ELISA |
1 ml. |
1045-Eur |
Accurate |
elisa |
| CSB-E07448r |
Rat soluble interleukin_1 receptor Ⅰ,IL_1sRⅠ ELISA kit |
96T |
856-Eur |
Cusabio |
elisa |
| E06S0253 |
Goat Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
608-Eur |
BGene |
|
| CSB-E07446r |
Rat soluble interleukin_1 receptor Ⅱ,sIL_1RⅡ ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| CSB-E07439r |
Rat soluble interleukin_2 receptor,sIL_2Rα ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| E06S0260 |
Goat Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
608-Eur |
BGene |
|
| CSB-E07437r |
Rat soluble interleukin_2 receptor,sIL_2Rβ ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| E06S0266 |
Goat Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
608-Eur |
BGene |
|
| E06S0290 |
Goat Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07C0044 |
Porcine Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
608-Eur |
BGene |
|
| E07C0053 |
Porcine Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07F0265 |
Porcine Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
608-Eur |
BGene |
|
| E07I0366 |
Porcine Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
608-Eur |
BGene |
|
| 201-12-1395 |
Human soluble Retinoid X Receptor,RXR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0305 |
Human Leptin Soluble Receptor,sLR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-1198 |
Human retinal soluble antigen,Sag ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-11-0412 |
Rat soluble Toll-like receptor 6,sTLR-6 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0413 |
Rat soluble Interleukin 6 receptor,sIL-6R_CD126 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0414 |
Rat soluble Interleukin 7 receptor,sIL-7R_CD127 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| cyt-285 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha sIL 2R |
5 |
100-Eur |
Prospecbio |
|
| cyt-268 |
Recombinant Rabbit Prolactin Soluble Receptor raPrl R |
5 |
100-Eur |
Prospecbio |
|
| cyt-293 |
Recombinant Ovine Prolactin Soluble Receptor oPrl R |
5 |
100-Eur |
Prospecbio |
|
| cyt-294 |
Recombinant Bovine Prolactin Soluble Receptor bPrl R |
5 |
100-Eur |
Prospecbio |
|
| cyt-245 |
Recombinant Human soluble CD40 Ligand_TRAP sCD40L |
10 |
100-Eur |
Prospecbio |
|
| cyt-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag sCD40L His |
5 |
100-Eur |
Prospecbio |
|
| cyt-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP msCD40L |
5 |
100-Eur |
Prospecbio |
|
| cyt-334 |
Recombinant Human Soluble RANK Ligand sRANKL |
2 |
100-Eur |
Prospecbio |
|
| cyt-692 |
Recombinant Human Soluble RANK Ligand, His Tag sRANKL, His |
5 |
100-Eur |
Prospecbio |
|
| cyt-631 |
Recombinant Human Soluble RANK Ligand, GST Tag sRANKL GST |
2 |
100-Eur |
Prospecbio |
|
| 201-11-0411 |
Rat soluble Toll-like receptor 2,sTLR-2 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0408 |
Rat soluble Cluster of differentiation 86,sCD86 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-12-0845 |
Human Soluble Adenylate Cyclase,sAC ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-0217 |
Human soluble adhesion molecules,Sam ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-11-0413 |
Rat soluble Interleukin 6 receptor(sIL-6R_CD126)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-12-0317 |
Human Soluble Endoglin,ENG_sCD105 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-1396 |
Human soluble Farnesoid X Receptor,FXR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-0245 |
Human soluble Interleukin 2 recepter,IL-2sR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-1394 |
Human soluble Liver X Receptor,LXR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-1395 |
Human soluble Retinoid X Receptor,RXR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-11-0121 |
Rat soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0122 |
Rat soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0129 |
Rat soluble interleukin-2 receptor,IL-2sRα ELISA kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0130 |
Rat soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0405 |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| cyt-320 |
Recombinant Mouse Soluble RANK Ligand msRANKL |
2 |
100-Eur |
Prospecbio |
|
| OETCGF631 |
Soluble RANK Ligand Human Recombinant, GST tag |
10 |
171-Eur |
OET |
|
| E0966h |
Human soluble Triggering Receptor Expresses on Mye |
96T |
706-Eur |
EIAab |
recombinant |
| E05S0258 |
Guinea Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0254 |
Guinea soluble Factor-related Apoptosis |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0249 |
Guinea soluble endothelial protein C receptor |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0238 |
Guinea soluble cluster of differentiation 30 ligand |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05S0008 |
Guinea Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05F0103 |
Guinea soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05C0044 |
Guinea soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E0548Ch |
Chicken Soluble Intercellular Adhesion Molecule_1 |
96T |
839-Eur |
EIAab |
|
| E0022Ch |
Chicken soluble endothelial protein C receptor ELI |
96T |
839-Eur |
EIAab |
recombinant |
| E01S0290 |
Human Soluble IL-1 Receptor 4_ST2 (sIL-1R4_ST2) |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06R0361 |
Goat Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
608-Eur |
BGene |
|
| E06S0008 |
Goat Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
608-Eur |
BGene |
|
| E1160h |
Human soluble transferrin receptor ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| 1332-96-3 |
Ferric Pyrohphosphate, Soluble Iron(III) pyrophosphate, |
1g |
----Eur |
chemotra |
|
| OETCGF670 |
soluble CD40 Ligand_TRAP Human Recombinant, His Tag |
20 |
171-Eur |
OET |
|
| E0119h |
Human Soluble Cluster of differentiation 40 ligand |
96T |
706-Eur |
EIAab |
human |
| E1654h |
Human soluble cluster of differentiation 44 varian |
96T |
706-Eur |
EIAab |
human |
| E0824h |
Human soluble Cluster of differentiation 86 ELISA |
96T |
706-Eur |
EIAab |
elisa |
| E1154h |
Human soluble cytokine receptor ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E08S0258 |
Canine Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08S0254 |
Canine soluble Factor-related Apoptosis |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08S0249 |
Canine soluble endothelial protein C receptor |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08S0238 |
Canine soluble cluster of differentiation 30 ligand |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08S0008 |
Canine Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08F0103 |
Canine soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E06L0297 |
Goat Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
608-Eur |
BGene |
|
| E08C0044 |
Canine soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E01S0258 |
Human Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0254 |
Human soluble Factor-related Apoptosis |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0250 |
Human soluble Amyloid Precursor Protein β |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E1670c |
Canine soluble cluster of differentiation 146 ELIS |
96T |
839-Eur |
EIAab |
dog |
| E0548Mo |
Monkey Soluble Intercellular Adhesion Molecule_1 E |
96T |
839-Eur |
EIAab |
|
| SU4GC1 |
Guanylate cyclase (hsGC), soluble, Mab anti_ |
1 mg. |
1087-Eur |
Accurate |
monoclonal |
| SU8GSL1-01 |
Glycosylated Soluble LOX_1, Human, Recombinant |
0.1 mg. |
3467-Eur |
Accurate |
recombinant |
| E0219m |
Mouse Leptin Soluble Receptor ELISA Kit |
96T |
739-Eur |
EIAab |
elisa |
| E0548m |
Mouse Soluble Intercellular Adhesion Molecule 1 EL |
96T |
739-Eur |
EIAab |
mouse |
| YSRTMCA2756 |
CD154 (soluble), Mab anti_Human; Clone 2A3, WB,ELISA |
0.2 mg. |
425-Eur |
Accurate |
elisa |
| YSRTMCA2755 |
CD154 (soluble), Mab anti_Human; Clone 1H4, WB,ELISA |
0.2 mg. |
425-Eur |
Accurate |
elisa |
| E0824m |
Mouse soluble Cluster of differentiation 86 ELISA |
96T |
739-Eur |
EIAab |
elisa |
| E0119m |
Mouse Soluble Cluster of differentiation 40 ligand |
96T |
739-Eur |
EIAab |
mouse |
| E0118m |
Mouse Soluble Cluster of differentiation 30 ligand |
96T |
739-Eur |
EIAab |
mouse |
| E0678m |
Mouse soluble cluster of differentiation 30 ElISA |
96T |
739-Eur |
EIAab |
elisa |
| E06S0230 |
Goat Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
608-Eur |
BGene |
|
| E0824b |
Bovine soluble Cluster of differentiation 86 ELISA |
96T |
839-Eur |
EIAab |
elisa |
| E1348h |
Human Soluble Adenylate Cyclase ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E01S0249 |
Human soluble endothelial protein C receptor |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0238 |
Human soluble cluster of differentiation 30 ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06S0158 |
Goat Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
608-Eur |
BGene |
|
| E01S0008 |
Human Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01F0103 |
Human soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E2044h |
Human soluble Liver X Receptor ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E01C0044 |
Human soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| YD12580 |
Interferon gamma Soluble Receptor Chain 1 (IFN |
10 µg. |
1017-Eur |
Accurate |
recombinant |
| YD11580 |
Interferon gamma Soluble Receptor Chain 1 (IFN |
10 µg. |
1017-Eur |
Accurate |
recombinant |
| E2043h |
Human soluble Retinoid X Receptor ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E1859h |
Human Soluble Lectin_like oxidized low density lip |
96T |
706-Eur |
EIAab |
human |
| E1911h |
Human retinal soluble antigen ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| ACLY100-19-2UG |
Human Soluble Rank Ligand (H_RANK_L) |
2 µg. |
123-Eur |
Accurate |
human |
| E06S0233 |
Goat Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
608-Eur |
BGene |
|
| CK-E97629 |
Mouse Leptin Soluble Receptor,sLR ELISAkit |
|
----Eur |
Glory |
|
| CSB-E06895Rb |
Rabbit Soluble protein_100B,S_100B ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| 228-11456-2 |
Recombinant Mouse Soluble RANK Ligand |
10 |
290-Eur |
Ray Biotech |
recombinant |
| Z5010471 |
Recombinant Human Soluble RANK ligand |
10 µg |
304-Eur |
Biochain |
recombinant |
| Z5010466 |
Recombinant Human soluble CD40 Ligand_TRAP |
50 µg |
304-Eur |
Biochain |
recombinant |
| DS-MB-02832 |
Mouse Anti-Human CD154 (Soluble) |
200 |
604-Eur |
Ray Biotech |
human |
| E01E0021 |
Human Anti-soluble E-selectin ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E01F0265 |
Human Anti-soluble Farnesoid Xreceptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01I0366 |
Human Anti-soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01I0368 |
Human Anti-soluble interleukin-1 receptor II |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01I0378 |
Human Anti-soluble Interleukin 2 recepter |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01I0379 |
Human Anti-Soluble Interleukin 2a receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01I0381 |
Human Anti-Soluble Interleukin 2β receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01L0297 |
Human Anti-soluble Liver Receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01P0110 |
Human Anti-soluble P-selectin Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| 228-11456-1 |
Recombinant Mouse Soluble RANK Ligand |
2 |
201-Eur |
Ray Biotech |
recombinant |
| 228-11355-2 |
Recombinant Human Soluble RANK Ligand |
10 |
290-Eur |
Ray Biotech |
recombinant |
| CSB-E06894Rb |
Rabbit Soluble protein_100,S_100 ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| CSB-E06861Rb |
Rabbit soluble P_selectin,sP_selectin ELISA Kit |
96tests |
740-Eur |
Cusabio |
elisa |
| CSB-E05191Rb |
Rabbit soluble adhesion molecules,Sam ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| 228-11307-1 |
Recombinant Bovine Prolactin Soluble Receptor |
10 |
201-Eur |
Ray Biotech |
recombinant |
| 228-11307-2 |
Recombinant Bovine Prolactin Soluble Receptor |
50 |
290-Eur |
Ray Biotech |
recombinant |
| 228-11307-3 |
Recombinant Bovine Prolactin Soluble Receptor |
1 mg |
2068-Eur |
Ray Biotech |
recombinant |
| 228-11308-1 |
Recombinant Ovine Prolactin Soluble Receptor |
10 |
201-Eur |
Ray Biotech |
recombinant |
| 228-11308-2 |
Recombinant Ovine Prolactin Soluble Receptor |
50 |
290-Eur |
Ray Biotech |
recombinant |
| 228-11308-3 |
Recombinant Ovine Prolactin Soluble Receptor |
1 mg |
2068-Eur |
Ray Biotech |
recombinant |
| 228-11310-1 |
Recombinant Rabbit Prolactin Soluble Receptor |
10 |
201-Eur |
Ray Biotech |
recombinant |
| 228-11310-2 |
Recombinant Rabbit Prolactin Soluble Receptor |
50 |
290-Eur |
Ray Biotech |
recombinant |
| 228-11310-3 |
Recombinant Rabbit Prolactin Soluble Receptor |
1 mg |
2068-Eur |
Ray Biotech |
recombinant |
| 228-11355-1 |
Recombinant Human Soluble RANK Ligand |
2 |
201-Eur |
Ray Biotech |
recombinant |
| E01R0361 |
Human Anti-soluble Retinoid X Receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01S0226 |
Human Anti-Soluble protein-100B |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| E01S0233 |
Human Anti-soluble adhesion molecules |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| CSB-E10358r |
Rat soluble Toll_like receptor 2,sTLR_2 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| E05E0021 |
Guinea anti-soluble E-selectin ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E05F0265 |
Guinea anti-soluble Farnesoid Xreceptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05I0366 |
Guinea anti-soluble interleukin-1 receptor Ⅰ |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05I0368 |
Guinea anti-soluble interleukin-1 receptor II |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05I0378 |
Guinea anti-soluble Interleukin 2 recepter |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05I0379 |
Guinea anti-Soluble Interleukin 2a receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05I0381 |
Guinea anti-Soluble Interleukin 2β receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05L0297 |
Guinea anti-soluble Liver Receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05P0110 |
Guinea anti-soluble P-selectin Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E05R0361 |
Guinea anti-soluble Retinoid X Receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05S0226 |
Guinea anti-Soluble protein-100B |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| E05S0233 |
Guinea anti-soluble adhesion molecules |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| CSB-E10359r |
Rat soluble Toll_like receptor 6,sTLR_6 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E10644h |
Human soluble protein 185,sp185_HER_2 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| E01S0239 |
Human Anti-soluble cluster of differentiation 86 |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| E01S0252 |
Human Anti-soluble endothelium-selectin |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| E01S0260 |
Human Anti-soluble interleukin 6 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E07S0260 |
Porcine Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
608-Eur |
BGene |
|
| E01S0261 |
Human Anti-soluble interleukin 7 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01S0262 |
Human Anti-soluble interleukin 8 receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01S0266 |
Human Anti-leptin soluble receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01S0281 |
Human Anti-soluble platelet-selectin |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| E01S0293 |
Human Anti-soluble toll-like receptor 2 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E01S0294 |
Human Anti-soluble toll-like receptor 6 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CSB-E13340r |
Rat Soluble Interleukin_2 Receptor(SIL_2R) ELISA KIT |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E12752h |
Human soluble OX40L (sOX40L) ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E11178r |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| E05S0239 |
Guinea anti-soluble cluster of differentiation 86 |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| cyt-285 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha sIL 2R |
25 |
175-Eur |
Prospecbio |
|
| cyt-245 |
Recombinant Human soluble CD40 Ligand_TRAP sCD40L |
1mg |
1403-Eur |
Prospecbio |
|
| cyt-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag sCD40L His |
1mg |
2646-Eur |
Prospecbio |
|
| cyt-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP msCD40L |
1mg |
2646-Eur |
Prospecbio |
|
| cyt-334 |
Recombinant Human Soluble RANK Ligand sRANKL |
1mg |
4557-Eur |
Prospecbio |
|
| cyt-692 |
Recombinant Human Soluble RANK Ligand, His Tag sRANKL, His |
1mg |
2646-Eur |
Prospecbio |
|
| cyt-631 |
Recombinant Human Soluble RANK Ligand, GST Tag sRANKL GST |
0.1mg |
1103-Eur |
Prospecbio |
|
| cyt-320 |
Recombinant Mouse Soluble RANK Ligand msRANKL |
1mg |
4557-Eur |
Prospecbio |
|
| E07R0361 |
Porcine Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0008 |
Porcine Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0158 |
Porcine Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0230 |
Porcine Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0233 |
Porcine Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0253 |
Porcine Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
608-Eur |
BGene |
|
| cyt-294 |
Recombinant Bovine Prolactin Soluble Receptor bPrl R |
1mg |
3260-Eur |
Prospecbio |
|
| cyt-293 |
Recombinant Ovine Prolactin Soluble Receptor oPrl R |
1mg |
3260-Eur |
Prospecbio |
|
| cyt-268 |
Recombinant Rabbit Prolactin Soluble Receptor raPrl R |
20 |
175-Eur |
Prospecbio |
|
| cyt-293 |
Recombinant Ovine Prolactin Soluble Receptor oPrl R |
20 |
175-Eur |
Prospecbio |
|
| cyt-294 |
Recombinant Bovine Prolactin Soluble Receptor bPrl R |
20 |
175-Eur |
Prospecbio |
|
| cyt-245 |
Recombinant Human soluble CD40 Ligand_TRAP sCD40L |
50 |
175-Eur |
Prospecbio |
|
| cyt-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag sCD40L His |
20 |
175-Eur |
Prospecbio |
|
| cyt-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP msCD40L |
25 |
175-Eur |
Prospecbio |
|
| cyt-334 |
Recombinant Human Soluble RANK Ligand sRANKL |
10 |
175-Eur |
Prospecbio |
|
| cyt-692 |
Recombinant Human Soluble RANK Ligand, His Tag sRANKL, His |
20 |
175-Eur |
Prospecbio |
|
| cyt-631 |
Recombinant Human Soluble RANK Ligand, GST Tag sRANKL GST |
10 |
175-Eur |
Prospecbio |
|
| cyt-320 |
Recombinant Mouse Soluble RANK Ligand msRANKL |
10 |
175-Eur |
Prospecbio |
|
| CK-E97638 |
Mouse Soluble Endoglin,ENG_sCD105 ELISAkit |
|
----Eur |
Glory |
|
| cyt-285 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha sIL 2R |
1mg |
3601-Eur |
Prospecbio |
|
| cyt-268 |
Recombinant Rabbit Prolactin Soluble Receptor raPrl R |
1mg |
3260-Eur |
Prospecbio |
|
| CK-E98117 |
Rat soluble cluster of differentiation 14,sCD14 ELISAkit |
|
----Eur |
Glory |
|
| CK-E98130 |
Rat soluble Toll-like receptor 6,sTLR-6 ELISAkit |
|
----Eur |
Glory |
|
| CK-E98131 |
Rat soluble Toll-like receptor 2,sTLR-2 ELISAkit |
|
----Eur |
Glory |
|
| CSB-E09092h |
Human soluble Phospholipase A2,sPL_A2 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E08543r |
Rat soluble cluster of differentiation 86,sCD86 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E08106p |
Porcine soluble P_selectin,sP_Selectin ELISA Kit |
96tests |
740-Eur |
Cusabio |
elisa |
| CSB-E08077m |
Mouse soluble P_selectin,sP_selectin ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| CSB-E08074h |
Human soluble P_selectin,sP_selectin ELISA Kit |
96tests |
662-Eur |
Cusabio |
elisa |
| CSB-E08068m |
Mouse Soluble protein_100,S_100 ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| CSB-E08067h |
Human Soluble protein_100,S_100 ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| CSB-E08065h |
Human Soluble protein_100B,S_100B ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| CSB-E07995m |
Mouse soluble E_selectin,sE_selectin ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| CSB-E07994h |
Human soluble E_selectin,sE_selectin ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| CSB-E07439r |
Rat soluble interleukin_2 receptor,sIL_2Rá ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E07437r |
Rat soluble interleukin_2 receptor,sIL_2Râ ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E07381r |
Rat tumor necrosis factor soluble receptor |
96tests |
701-Eur |
Cusabio |
recombinant |
| CSB-E09349h |
Human Soluble Adenylate Cyclase,sAC ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E09578h |
Human soluble adhesion molecules,Sam ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| 228-10943-2 |
Recombinant Human Soluble IL-6 Receptor alpha |
20 |
290-Eur |
Ray Biotech |
recombinant |
| CK-E98305 |
Rat soluble Cluster of differentiation 86,sCD86 ELISAkit |
|
----Eur |
Glory |
|
| CSB-E13340r |
Rat Soluble Interleukin_2 Receptor(SIL_2R) ELISA KIT |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E12752h |
Human soluble OX40L (sOX40L) ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E11178r |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E10644h |
Human soluble protein 185,sp185_HER_2 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E10359r |
Rat soluble Toll_like receptor 6,sTLR_6 ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| CSB-E10358r |
Rat soluble Toll_like receptor 2,sTLR_2 ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| CSB-E10051m |
Mouse Leptin Soluble Receptor,sLR ELISA Kit |
96tests |
616-Eur |
Cusabio |
elisa |
| CSB-E10030h |
Human Soluble Endoglin,ENG_sCD105 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E09921m |
Mouse Soluble Endoglin,ENG_sCD105 ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| CSB-E09869Ch |
Chicken soluble E_selectin,sE_selectin ELISA Kit |
96tests |
662-Eur |
Cusabio |
elisa |
| CSB-E09823h |
Human Leptin Soluble Receptor,sLR ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| CSB-E06941Rb |
Rabbit soluble E_selectin,sE_selectin ELISA Kit |
96tests |
740-Eur |
Cusabio |
elisa |
| ARP54787_P050 |
IDH1(isocitrate dehydrogenase 1 (NADP+), soluble) |
50 µg |
513-Eur |
ACR |
rat |
| E0844Hu |
Human Soluble Adenylate Cyclase,sAC ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0649Hu |
Human soluble protein 185,sp185_HER-2 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| A32780 |
Aniline Yellow Alcohol Soluble C.I. No. 11000 |
500 G |
598-Eur |
pfalslandbauer. |
|
| A32780 |
Aniline Yellow Alcohol Soluble C.I. No. 11000 |
100 G |
297-Eur |
pfalslandbauer. |
|
| A32780 |
Aniline Yellow Alcohol Soluble C.I. No. 11000 |
25 G |
134-Eur |
pfalslandbauer. |
|
| Y059684 |
Anti_Human Soluble Guanylate Cyclase (hsGC) |
100ug |
443-Eur |
ABM Goods |
human |
| E0316Hu |
Human Soluble Endoglin,ENG_sCD105 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0304Hu |
Human Leptin Soluble Receptor,sLR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| Y061149 |
Anti_Interleukin_4 Soluble Receptor produced in goat |
100ug |
965-Eur |
ABM Goods |
recombinant |
| Y061155 |
Anti_Interleukin_2 Soluble Receptor γ produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| Y061157 |
Anti_Interleukin_2 Soluble Receptor β produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| Y061159 |
Anti_Interleukin_2 Soluble Receptor β produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| E1197Hu |
Human retinal soluble antigen,Sag ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| DEBMS653 |
TNF_ soluble Receptor I, Species monkey |
96 tests |
781-Eur |
Demeditec |
recombinant |
| E1393Hu |
Human soluble Liver X Receptor,LXR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0404Ra |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E0129Ra |
Rat soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
48T |
320-Eur |
Eastbio |
|
| E0128Ra |
Rat soluble interleukin-2 receptor,IL-2sRα ELISA kit |
48T |
320-Eur |
Eastbio |
|
| E0121Ra |
Rat soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
48T |
320-Eur |
Eastbio |
|
| E0120Ra |
Rat soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
48T |
320-Eur |
Eastbio |
|
| E14S0230 |
Sheep Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
622-Eur |
BGene |
|
| HI1M-721-5 |
Anti_human CD4 (soluble receptor) IgG fraction (monoclonal) |
100 µg |
350-Eur |
AustralBiologicals |
recombinant |
| A32580 |
Aniline Blue Water Soluble C.I. No. 42755 |
100 G |
258-Eur |
pfalslandbauer. |
|
| A32580 |
Aniline Blue Water Soluble C.I. No. 42755 |
25 G |
199-Eur |
pfalslandbauer. |
|
| A32578 |
Aniline Blue Alcohol Soluble C.I. No. 51004 |
100 G |
98-Eur |
pfalslandbauer. |
|
| E1395Hu |
Human soluble Farnesoid X Receptor,FXR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E1394Hu |
Human soluble Retinoid X Receptor,RXR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0244Hu |
Human soluble Interleukin 2 recepter,IL-2sR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0216Hu |
Human soluble adhesion molecules,Sam ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E14S0158 |
Sheep Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| Y030023 |
SOD1 aa 100-115 | superoxide dismutase 1, soluble Antibody |
50ul |
768-Eur |
ABM Goods |
|
| Y030022 |
SOD1 aa 80-96 | superoxide dismutase 1, soluble Antibody |
50ul |
768-Eur |
ABM Goods |
elisa |
| Y030021 |
SOD1 aa 58-72 | superoxide dismutase 1, soluble Antibody |
50ul |
768-Eur |
ABM Goods |
|
| E12S0266 |
Chicken Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
622-Eur |
BGene |
|
| HP241-R |
Recombinant (E. coli) HIV_1 p24 protein (soluble) |
100 ug |
262-Eur |
Alpha Diagnostics |
recombinant |
| Y030020 |
SOD1 aa 43-57 | superoxide dismutase 1, soluble Antibody |
50ul |
768-Eur |
ABM Goods |
|
| Y030019 |
SOD1 aa 24-39 | superoxide dismutase 1, soluble Antibody |
50ul |
768-Eur |
ABM Goods |
|
| Y030018 |
SOD1 aa 03-20 | superoxide dismutase 1, soluble Antibody |
100ul |
768-Eur |
ABM Goods |
|
| E12S0260 |
Chicken Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
622-Eur |
BGene |
|
| E0413Ra |
Rat soluble Interleukin 7 receptor,sIL-7R_CD127 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0412Ra |
Rat soluble Interleukin 6 receptor,sIL-6R_CD126 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0411Ra |
Rat soluble Toll-like receptor 6,sTLR-6 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E12S0290 |
Chicken Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
622-Eur |
BGene |
|
| Y030024 |
SOD1 aa 131-153 | superoxide dismutase 1, soluble Antibody |
50ul |
768-Eur |
ABM Goods |
|
| E14C0044 |
Sheep Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
622-Eur |
BGene |
|
| BB-EK0572 |
CD153 _ CD30L (Mouse, soluble form) |
1x96 Tests |
750-Eur |
ACR |
mouse |
| E14S0008 |
Sheep Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E14R0361 |
Sheep Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E14L0297 |
Sheep Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
622-Eur |
BGene |
|
| 27081 |
Human soluble interleukin-1 receptor Ⅰ(IL-1sR Ⅰ) ELISA Kit |
10ng/ml-0.156ng/ml <0.05ng/ml |
730-Eur |
TEFL |
|
| E0232Mo |
Mouse Soluble Endoglin,ENG_sCD105 ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E0203Mo |
Mouse Leptin Soluble Receptor,sLR ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E14I0378 |
Sheep Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
622-Eur |
BGene |
|
| E14I0368 |
Sheep Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
622-Eur |
BGene |
|
| E14I0366 |
Sheep Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
622-Eur |
BGene |
|
| E14F0265 |
Sheep Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E14C0053 |
Sheep Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
622-Eur |
BGene |
|
| E0410Ra |
Rat soluble Toll-like receptor 2,sTLR-2 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| 2081-1000 |
Digitonin, Water-Soluble Digitin |
1 g |
522-Eur |
Biovision |
|
| CK-E30483 |
Rat soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
96T |
454-Eur |
Eastbio |
|
| CK-E30481 |
Rat soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
454-Eur |
Eastbio |
|
| CK-E30270 |
Rat soluble Cluster of differentiation 86,sCD86 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E30096 |
Rat soluble Toll-like receptor 2,sTLR-2 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E30095 |
Rat soluble Toll-like receptor 6,sTLR-6 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CYT-55 |
CYT_55 Mouse soluble CD40 Ligand (mSCD40L) |
1 mg |
3037-Eur |
PLR |
mouse |
| CK-E30082 |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E20141 |
Mouse Soluble Endoglin,ENG_sCD105 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E20132 |
Mouse Leptin Soluble Receptor,sLR ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E11602 |
Human soluble protein 185,sp185_HER-2 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| CK-E11031 |
Human Soluble Adenylate Cyclase,sAC ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| RCYT-533A |
Recombinant Rat Prolactin Soluble Receptor |
10 µg |
117-Eur |
LeeBio |
recombinant |
| CK-E30487 |
Rat soluble interleukin-2 receptor,IL-2sRα ELISA kit |
96T |
454-Eur |
Eastbio |
|
| CK-E30488 |
Rat soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
96T |
454-Eur |
Eastbio |
|
| CK-E30566 |
Rat soluble endothelial protein C receptor,sER ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| 201-12-0245 |
Human soluble Interleukin 2 recepter(IL-2sR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-0217 |
Human soluble adhesion molecules(Sam)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| S-1011-010 |
Sulfo S-HyNic Crosslinker (Water Soluble) |
10 mg |
299-Eur |
Solulink |
|
| S-1011-105 |
Sulfo S-HyNic Crosslinker (Water Soluble) |
5 x 1.0 mg |
240-Eur |
Solulink |
|
| B-1001-105 |
ChromaLink™ Biotin Labeling Reagent (DMF Soluble) |
5 x 1.0 mg |
189-Eur |
Solulink |
|
| B-1001-010 |
ChromaLink™ Biotin Labeling Reagent (DMF Soluble) |
10 mg |
215-Eur |
Solulink |
|
| CK-E90501 |
Human Thymidine Kinase 1, Soluble(TK1)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E90431 |
Human soluble platelet-selectin(SP-S)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E90429 |
Human Soluble Endoglin(ENG_sCD105)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E90143 |
HUMAN SOLUBLE TRANSFERRİN RESEPTÖR-STFR |
96T |
454-Eur |
Eastbio |
|
| CK-E80193 |
Rabbit soluble adhesion molecules,Sam ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E80032 |
Rabbit soluble interleukin-1 receptor Ⅰ,IL-1sR Ⅰ ELISA kit |
96T |
454-Eur |
Eastbio |
|
| RCYT-533B |
Recombinant Rat Prolactin Soluble Receptor |
50 µg |
226-Eur |
LeeBio |
recombinant |
| RCYT-533C |
Recombinant Rat Prolactin Soluble Receptor |
1 mg |
1934-Eur |
LeeBio |
recombinant |
| CK-E10044 |
Human soluble adhesion molecules,Sam ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| E0203Mo |
Mouse Leptin Soluble Receptor,sLR ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| 201-09-0006 |
Rabbit soluble adhesion molecules(Sam)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| E14S0290 |
Sheep Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
622-Eur |
BGene |
|
| E14S0266 |
Sheep Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
622-Eur |
BGene |
|
| E14S0260 |
Sheep Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
622-Eur |
BGene |
|
| 31322 |
Porcine soluble interleukin-1 receptor Ⅰ(IL-1sR Ⅰ) ELISA Kit |
10ng/ml-0.156ng/ml <0.05ng/ml |
750-Eur |
TEFL |
|
| E14S0253 |
Sheep Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
622-Eur |
BGene |
|
| E14S0233 |
Sheep Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
622-Eur |
BGene |
|
| E0413Ra |
Rat soluble Interleukin 7 receptor,sIL-7R_CD127 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E0412Ra |
Rat soluble Interleukin 6 receptor,sIL-6R_CD126 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E0411Ra |
Rat soluble Toll-like receptor 6,sTLR-6 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E0410Ra |
Rat soluble Toll-like receptor 2,sTLR-2 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| 201-09-0161 |
Rabbit soluble interleukin-1 receptor Ⅰ(IL-1sR Ⅰ)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| E0232Mo |
Mouse Soluble Endoglin,ENG_sCD105 ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| 201-02-0204 |
Mouse Leptin Soluble Receptor(sLR)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| CK-E10029 |
Human Leptin Soluble Receptor,sLR ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| ISMUPAR-HIS |
Soluble Mouse Urokinase Receptor, His Tagged |
1mg |
5724-Eur |
Innovative Research INC |
|
| ISMUPAR-HIS |
Soluble Mouse Urokinase Receptor, His Tagged |
0.1mg |
810-Eur |
Innovative Research INC |
|
| 201-15-0073 |
Canine soluble Interleukin 2 recepter(IL-2sR)ELISA Kit |
96T |
704-Eur |
Sunred |
|
| ACLCYT472 |
Soluble CD40 Ligand_TRAP, Mouse, recombinant |
5 µg. |
----Eur |
Accurate |
recombinant |
| ACLCYT472B |
Soluble CD40 Ligand_TRAP, Mouse, recombinant |
25 µg. |
----Eur |
Accurate |
recombinant |
| AP03062PU-N |
Epoxide hydrolase 2 _ EPHX2 Soluble (Internal) |
50 µg |
462-Eur |
ACR |
rna |
| BB-EK0572 |
CD153 _ CD30L (Mouse, soluble form) |
1x96 Tests |
628-Eur |
ACR |
mouse |
| 201-02-0233 |
Mouse Soluble Endoglin(ENG_sCD105)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| BB-EK0573 |
CD154 _ CD40L (Human, soluble form) |
1x96 Tests |
664-Eur |
ACR |
human |
| AP15591PU-S |
Guanylate cyclase soluble GUCY1B3 (189_207) |
0.1 ml |
213-Eur |
ACR |
|
| AP15591PU-N |
Guanylate cyclase soluble GUCY1B3 (189_207) |
1.0 ml |
498-Eur |
ACR |
|
| E0407Ra |
Rat soluble Cluster of differentiation 86,sCD86 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E14S0266 |
Sheep Soluble Leptin Receptor ELISA, SLR |
|
715-Eur |
Blue Gene Biotech |
|
| E01I0378 |
Human Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
601-Eur |
BGene |
|
| E14S0260 |
Sheep Soluble interleukin 6 receptor ELISA, sIL-6R |
|
715-Eur |
Blue Gene Biotech |
|
| U0470r |
Rat soluble receptor activator of nuclear factor_k |
96T |
755-Eur |
EIAab |
recombinant |
| E01L0297 |
Human Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
601-Eur |
BGene |
|
| E14S0008 |
Sheep Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
715-Eur |
Blue Gene Biotech |
|
| S01-018 |
Human VEGFR_3_FLT_4, soluble Source Insect cells |
50 µg |
317-Eur |
Reliatech |
human |
| S01-017 |
Human VEGFR_3_FLT_4, soluble Source Insect cells |
10 µg |
169-Eur |
Reliatech |
human |
| E14I0378 |
Sheep Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
715-Eur |
Blue Gene Biotech |
|
| E14I0368 |
Sheep Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
715-Eur |
Blue Gene Biotech |
|
| E14I0366 |
Sheep Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
715-Eur |
Blue Gene Biotech |
|
| E14C0053 |
Sheep Soluble CD 44v9 ELISA , SCD44V9 |
|
715-Eur |
Blue Gene Biotech |
|
| E14C0044 |
Sheep Soluble CD44s ELISA , sCD44s |
|
715-Eur |
Blue Gene Biotech |
|
| E01I0368 |
Human Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
601-Eur |
BGene |
|
| E01I0366 |
Human Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
601-Eur |
BGene |
|
| E01F0265 |
Human Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
601-Eur |
BGene |
|
| U0547r |
Rat soluble Vascuolar cell adhesion molecule 1 CLI |
96T |
755-Eur |
EIAab |
rat |
| U1367r |
Rat soluble vascular endothelial growth factor rec |
96T |
755-Eur |
EIAab |
recombinant |
| E14S0253 |
Sheep Soluble Glucoprotein 130 ELISA , sGP130 |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0233 |
Sheep Soluble adhesion molecules ELISA, Sam |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0230 |
Sheep Soluble CD36 ELISA , sCD36 |
|
715-Eur |
Blue Gene Biotech |
|
| U0139r |
Rat soluble tumor necrosis factor_related apoptosi |
96T |
755-Eur |
EIAab |
rat |
| E14S0158 |
Sheep Soluble programmed death-1 ELISA, sPD-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E14R0361 |
Sheep Soluble Retinoid X Receptor ELISA, RXR |
|
715-Eur |
Blue Gene Biotech |
|
| E14L0297 |
Sheep Soluble Liver X Receptor ELISA, LXR |
|
715-Eur |
Blue Gene Biotech |
|
| E14F0265 |
Sheep Soluble Farnesoid X receptor ELISA, FXR |
|
715-Eur |
Blue Gene Biotech |
|
| E01C0044 |
Human Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
601-Eur |
BGene |
|
| E01C0053 |
Human Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
601-Eur |
BGene |
|
| E12S0290 |
Chicken Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0266 |
Chicken Soluble Leptin Receptor ELISA, SLR |
|
715-Eur |
Blue Gene Biotech |
|
| S01-002 |
Human VEGFR_2_KDR (D7), soluble Source Insect cells |
50 µg |
280-Eur |
Reliatech |
human |
| E12S0008 |
Chicken Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
715-Eur |
Blue Gene Biotech |
|
| SFC-034 |
Mouse TIE_2_Fc Chimera, soluble Source CHO cells |
100 µg |
272-Eur |
Reliatech |
mouse |
| SFC-033 |
Mouse TIE_2_Fc Chimera, soluble Source CHO cells |
20 µg |
124-Eur |
Reliatech |
mouse |
| E12I0378 |
Chicken Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
715-Eur |
Blue Gene Biotech |
|
| E12I0368 |
Chicken Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
715-Eur |
Blue Gene Biotech |
|
| E12I0366 |
Chicken Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
715-Eur |
Blue Gene Biotech |
|
| SFC-032 |
Mouse TIE_1_Fc Chimera, soluble Source CHO cells |
100 µg |
272-Eur |
Reliatech |
mouse |
| E12C0053 |
Chicken Soluble CD 44v9 ELISA , SCD44V9 |
|
715-Eur |
Blue Gene Biotech |
|
| E12C0044 |
Chicken Soluble CD44s ELISA , sCD44s |
|
715-Eur |
Blue Gene Biotech |
|
| SFC-031 |
Mouse TIE_1_Fc Chimera, soluble Source CHO cells |
20 µg |
124-Eur |
Reliatech |
mouse |
| E11S0290 |
Bovine Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
715-Eur |
Blue Gene Biotech |
|
| S01-027 |
Mouse Lyve_1, soluble Source Insect cells |
25 µg |
272-Eur |
Reliatech |
mouse |
| S01-015 |
Human VEGFR_1_Flt_1 (D3), soluble Source Insect cells |
5 µg |
139-Eur |
Reliatech |
human |
| S01-016 |
Human VEGFR_1_Flt_1 (D3), soluble Source Insect cells |
20 µg |
228-Eur |
Reliatech |
human |
| S01-013 |
Human VEGFR_1_Flt_1 (D4), soluble Source Insect cells |
5 µg |
139-Eur |
Reliatech |
human |
| E12S0253 |
Chicken Soluble Glucoprotein 130 ELISA , sGP130 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0233 |
Chicken Soluble adhesion molecules ELISA, Sam |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0230 |
Chicken Soluble CD36 ELISA , sCD36 |
|
715-Eur |
Blue Gene Biotech |
|
| S01-001 |
Human VEGFR_2_KDR (D7), soluble Source Insect cells |
5 µg |
80-Eur |
Reliatech |
human |
| E12S0158 |
Chicken Soluble programmed death-1 ELISA, sPD-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E12R0361 |
Chicken Soluble Retinoid X Receptor ELISA, RXR |
|
715-Eur |
Blue Gene Biotech |
|
| E12L0297 |
Chicken Soluble Liver X Receptor ELISA, LXR |
|
715-Eur |
Blue Gene Biotech |
|
| E12F0265 |
Chicken Soluble Farnesoid X receptor ELISA, FXR |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0260 |
Chicken Soluble interleukin 6 receptor ELISA, sIL-6R |
|
715-Eur |
Blue Gene Biotech |
|
| S01-012 |
Human VEGFR_1_Flt_1 (D5), soluble Source Insect cells |
20 µg |
206-Eur |
Reliatech |
human |
| S01-011 |
Human VEGFR_1_Flt_1 (D5), soluble Source Insect cells |
5 µg |
124-Eur |
Reliatech |
human |
| S01-014 |
Human VEGFR_1_Flt_1 (D4), soluble Source Insect cells |
20 µg |
228-Eur |
Reliatech |
human |
| E11S0266 |
Bovine Soluble Leptin Receptor ELISA, SLR |
|
715-Eur |
Blue Gene Biotech |
|
| HNS36-R |
Recombinant (E. coli) HCV NS3 Helicase, protein (soluble) |
100 ug |
335-Eur |
Alpha Diagnostics |
recombinant |
| E1394Hu |
Human soluble Retinoid X Receptor,RXR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E1393Hu |
Human soluble Liver X Receptor,LXR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E12I0378 |
Chicken Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
622-Eur |
BGene |
|
| E12I0368 |
Chicken Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
622-Eur |
BGene |
|
| E1197Hu |
Human retinal soluble antigen,Sag ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E12I0366 |
Chicken Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
622-Eur |
BGene |
|
| E0844Hu |
Human Soluble Adenylate Cyclase,sAC ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0649Hu |
Human soluble protein 185,sp185_HER-2 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E12F0265 |
Chicken Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E12C0053 |
Chicken Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12C0044 |
Chicken Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
622-Eur |
BGene |
|
| Y030024 |
SOD1 aa 131_153 | superoxide dismutase 1, soluble |
50ul |
870-Eur |
ABM Goods |
|
| E1395Hu |
Human soluble Farnesoid X Receptor,FXR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E12L0297 |
Chicken Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E12R0361 |
Chicken Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0253 |
Chicken Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
622-Eur |
BGene |
|
| E0407Ra |
Rat soluble Cluster of differentiation 86,sCD86 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0404Ra |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0129Ra |
Rat soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
96T |
490-Eur |
Eastbio |
|
| E0128Ra |
Rat soluble interleukin-2 receptor,IL-2sRα ELISA kit |
96T |
490-Eur |
Eastbio |
|
| E0121Ra |
Rat soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
96T |
490-Eur |
Eastbio |
|
| E0120Ra |
Rat soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
490-Eur |
Eastbio |
|
| HGP362-R |
Recombinant (E. coli) HIV gp36 protein (soluble) |
100 ug |
262-Eur |
Alpha Diagnostics |
recombinant |
| E12S0233 |
Chicken Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0230 |
Chicken Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0158 |
Chicken Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0008 |
Chicken Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E0316Hu |
Human Soluble Endoglin,ENG_sCD105 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| Y030023 |
SOD1 aa 100_115 | superoxide dismutase 1, soluble |
50ul |
870-Eur |
ABM Goods |
|
| E0304Hu |
Human Leptin Soluble Receptor,sLR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0216Hu |
Human soluble adhesion molecules,Sam ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E11L0297 |
Bovine Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E11I0378 |
Bovine Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
622-Eur |
BGene |
|
| E11I0368 |
Bovine Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
622-Eur |
BGene |
|
| E11I0366 |
Bovine Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
622-Eur |
BGene |
|
| E11F0265 |
Bovine Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E11C0053 |
Bovine Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11C0044 |
Bovine Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
622-Eur |
BGene |
|
| E9211h |
Human Adenylate Cyclase 10, Soluble ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E9447h |
Human Superoxide Dismutase 1, Soluble ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E12929h |
Human X_Prolyl Aminopeptidase 1, Soluble ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E14S0290 |
Sheep Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
715-Eur |
Blue Gene Biotech |
|
| E11R0361 |
Bovine Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0008 |
Bovine Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0158 |
Bovine Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| Y030022 |
SOD1 aa 80_96 | superoxide dismutase 1, soluble |
50ul |
870-Eur |
ABM Goods |
elisa |
| Y030021 |
SOD1 aa 58_72 | superoxide dismutase 1, soluble |
50ul |
870-Eur |
ABM Goods |
|
| E11S0290 |
Bovine Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
622-Eur |
BGene |
|
| Y030020 |
SOD1 aa 43_57 | superoxide dismutase 1, soluble |
50ul |
870-Eur |
ABM Goods |
|
| Y030019 |
SOD1 aa 24_39 | superoxide dismutase 1, soluble |
50ul |
870-Eur |
ABM Goods |
|
| E11S0266 |
Bovine Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
622-Eur |
BGene |
|
| Y030018 |
SOD1 aa 03_20 | superoxide dismutase 1, soluble |
100ul |
870-Eur |
ABM Goods |
|
| E11S0260 |
Bovine Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0253 |
Bovine Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
622-Eur |
BGene |
|
| E0244Hu |
Human soluble Interleukin 2 recepter,IL-2sR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E11S0233 |
Bovine Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0230 |
Bovine Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
622-Eur |
BGene |
|
| E13594h |
Human Isocitrate Dehydrogenase 1, Soluble ELISA Ki |
96T |
706-Eur |
EIAab |
elisa |
| 201-12-0305 |
Human Leptin Soluble Receptor(sLR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| cyt-304 |
Recombinant Human Soluble CD4 CYTOKINES AND GROWTH FACTORS |
10 |
167-Eur |
Prospecbio |
|
| 7-00893 |
Recombinant Human Soluble IL-6 Receptor alpha |
20 |
346-Eur |
CHI |
|
| 7-01436 |
Recombinant Rabbit Prolactin Soluble Receptor |
20 |
346-Eur |
CHI |
|
| 7-01439 |
Recombinant Ovine Prolactin Soluble Receptor |
20 |
346-Eur |
CHI |
|
| 7-01442 |
Recombinant Bovine Prolactin Soluble Receptor |
20 |
346-Eur |
CHI |
|
| 7-01469 |
Recombinant Human soluble CD40 Ligand_TRAP |
50 |
346-Eur |
CHI |
|
| 7-01472 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
20 |
346-Eur |
CHI |
|
| 7-01475 |
Recombinant Mouse soluble CD40 Ligand_TRAP |
25 |
346-Eur |
CHI |
|
| 7-01493 |
Recombinant Human Soluble RANK Ligand |
10 |
346-Eur |
CHI |
|
| 7-01496 |
Recombinant Human Soluble RANK Ligand, His Tag |
20 |
346-Eur |
CHI |
|
| 7-01499 |
Recombinant Human Soluble RANK Ligand, GST Tag |
10 |
346-Eur |
CHI |
|
| 7-01502 |
Recombinant Mouse Soluble RANK Ligand |
10 |
346-Eur |
CHI |
|
| 7-01500 |
Recombinant Human Soluble RANK Ligand, GST Tag |
0.1mg |
2365-Eur |
CHI |
|
| 7-01501 |
Recombinant Mouse Soluble RANK Ligand |
2 |
164-Eur |
CHI |
|
| 7-01498 |
Recombinant Human Soluble RANK Ligand, GST Tag |
2 |
164-Eur |
CHI |
|
| 7-01495 |
Recombinant Human Soluble RANK Ligand, His Tag |
5 |
164-Eur |
CHI |
|
| E-EL-Ch1765 |
Chicken sAC (Soluble Adenylate Cyclase) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-MK0300 |
Monkey sgp130 (Soluble Glucoprotein 130) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-MK0341 |
Monkey sAC (Soluble Adenylate Cyclase) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| cyt-304 |
Recombinant Human Soluble CD4 CYTOKINES AND GROWTH FACTORS |
2 |
96-Eur |
Prospecbio |
|
| 7-00892 |
Recombinant Human Soluble IL-6 Receptor alpha |
5 |
164-Eur |
CHI |
|
| 7-01435 |
Recombinant Rabbit Prolactin Soluble Receptor |
5 |
164-Eur |
CHI |
|
| 7-01438 |
Recombinant Ovine Prolactin Soluble Receptor |
5 |
164-Eur |
CHI |
|
| 7-01441 |
Recombinant Bovine Prolactin Soluble Receptor |
5 |
164-Eur |
CHI |
|
| 7-01468 |
Recombinant Human soluble CD40 Ligand_TRAP |
10 |
164-Eur |
CHI |
|
| 7-01471 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
5 |
164-Eur |
CHI |
|
| 7-01474 |
Recombinant Mouse soluble CD40 Ligand_TRAP |
5 |
164-Eur |
CHI |
|
| 7-01492 |
Recombinant Human Soluble RANK Ligand |
2 |
164-Eur |
CHI |
|
| 7-01470 |
Recombinant Human soluble CD40 Ligand_TRAP |
1mg |
2891-Eur |
CHI |
|
| 7-01473 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
1mg |
5733-Eur |
CHI |
|
| 7-01476 |
Recombinant Mouse soluble CD40 Ligand_TRAP |
1mg |
5733-Eur |
CHI |
|
| NBP1-35954 |
Guanylate cyclase soluble GUCY1B3 |
1.0 ml |
605-Eur |
ACR |
|
| NBP1-35953 |
Guanylate cyclase soluble GUCY1B3 |
0.1 ml |
486-Eur |
ACR |
|
| CSB-E15888h |
Human Soluble Toll-like Receptor 6(TLR-6) ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| CSB-E14261h |
Human Thymidine Kinase 1,Soluble(TK1) ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| TFR12-C |
CD71 _ TFRC (soluble form) (WB +ve control) |
0.1 ml |
332-Eur |
ACR |
|
| TFR11-M |
CD71 _ TFRC (bound and soluble form) |
0.1 mg |
486-Eur |
ACR |
|
| NBL1-15816 |
Soluble Liver_Pancreas Antigen Lysate |
0.1 mg |
593-Eur |
ACR |
|
| AP10315PU-N |
Guanylate cyclase soluble GUCY1B3 (189_207) |
0.1 mg |
427-Eur |
ACR |
|
| AP10312PU-N |
Guanylate cyclase soluble GUCY1A3 (C_term) |
0.1 mg |
427-Eur |
ACR |
|
| CSB-E07440m |
Mouse soluble interleukin-2 receptor,sIL-2Rα ELISA kit |
96T |
626-Eur |
Cusabio |
|
| AP08168PU-N |
Guanylate cyclase soluble GUCY1B3 (189_207) |
50 µg |
462-Eur |
ACR |
|
| 4Tr26-5B11 |
CD71 _ TFRC (soluble form) |
1 mg |
427-Eur |
ACR |
|
| NBP1-35955 |
Guanylate cyclase soluble GUCY1B3 |
7.0 ml |
486-Eur |
ACR |
|
| CSB-E14285h |
Human Soluble CD276,sCD276_sB7-H3 ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| Y103815 |
Transferrin receptor, Human Soluble Antibody |
1 mg |
957-Eur |
ABM Goods |
recombinant |
| 7-01497 |
Recombinant Human Soluble RANK Ligand, His Tag |
1mg |
5733-Eur |
CHI |
|
| CSB-E14264h |
Human soluble CD23(sCD23) ELISA Kit |
96T |
542-Eur |
Cusabio |
|
| 7-01437 |
Recombinant Rabbit Prolactin Soluble Receptor |
1mg |
7122-Eur |
CHI |
|
| 7-01440 |
Recombinant Ovine Prolactin Soluble Receptor |
1mg |
7122-Eur |
CHI |
|
| 7-01443 |
Recombinant Bovine Prolactin Soluble Receptor |
1mg |
7122-Eur |
CHI |
|
| 7-00894 |
Recombinant Human Soluble IL-6 Receptor alpha |
1mg |
7206-Eur |
CHI |
|
| CSB-E14050h |
Human soluble CD163(sCD163) ELISA Kit |
96T |
614-Eur |
Cusabio |
|
| 7-01494 |
Recombinant Human Soluble RANK Ligand |
1mg |
9900-Eur |
CHI |
|
| 7-01503 |
Recombinant Mouse Soluble RANK Ligand |
1mg |
9900-Eur |
CHI |
|
| Y080011 |
Guanylate Cyclase β1 subunit(soluble) Antibody |
100ul |
155-Eur |
ABM Goods |
|
| Y103813 |
Transferrin receptor, Human Soluble Antibody |
1 mg |
957-Eur |
ABM Goods |
recombinant |
| Y103814 |
Transferrin receptor, Human Soluble Antibody |
1 mg |
957-Eur |
ABM Goods |
recombinant |
| 4Tr26-23D10 |
CD71 _ TFRC (soluble form) |
1 mg |
427-Eur |
ACR |
|
| BB-EK0573 |
CD154 _ CD40L (Human, soluble form) |
1x96 Tests |
792-Eur |
ACR |
human |
| 4Tr26-5B11 |
CD71 _ TFRC (soluble form) |
1 mg |
513-Eur |
ACR |
|
| 4Tr26-23D10 |
CD71 _ TFRC (soluble form) |
1 mg |
513-Eur |
ACR |
|
| 4Tr26-13E4 |
CD71 _ TFRC (soluble form) |
1 mg |
513-Eur |
ACR |
|
| 4Tr26-11F5 |
CD71 _ TFRC (soluble form) |
1 mg |
513-Eur |
ACR |
|
| 4Tr26-10D2 |
CD71 _ TFRC (soluble form) |
1 mg |
513-Eur |
ACR |
|
| CG146-101 |
Recombinant Human Soluble RANK Ligand |
1mg |
7564-Eur |
GenDepot |
|
| CC049-101 |
Recombinant Human Soluble IL-6 Receptor alpha |
1mg |
5796-Eur |
GenDepot |
|
| CC038-101 |
Recombinant Human Soluble Iinterleukin-2 Receptor alp |
1mg |
5354-Eur |
GenDepot |
|
| CG111-101 |
Recombinant Ovine Prolactin Soluble Receptor |
1mg |
2171-Eur |
GenDepot |
|
| M-05962 |
METHYL RED INDICATOR AR (C.I.No. 13020) (Water Soluble) CAS: 493-52-7 |
100 gm |
114-Eur |
Oxford Lab |
|
| M-05962 |
METHYL RED INDICATOR AR (C.I.No. 13020) (Water Soluble) CAS: 493-52-7 |
25 gm |
104-Eur |
Oxford Lab |
|
| CG146-010 |
Recombinant Human Soluble RANK Ligand |
10ug |
282-Eur |
GenDepot |
|
| AP03062PU-N |
Soluble Epoxide Hydrolase (EPHX2) (Internal) |
50 µg |
555-Eur |
ACR |
rna |
| AP08168PU-N |
Guanylate cyclase soluble GUCY1B3 (aa 189_207) |
50 µg |
555-Eur |
ACR |
|
| AP10312PU-N |
Guanylate cyclase soluble GUCY1A3 (C_term) |
0.1 mg |
513-Eur |
ACR |
|
| ISMUPAR-HIS-0.1mg |
Soluble Mouse Urokinase Receptor, His Tagged 0.1mg |
|
746-Eur |
Innovative Research INC |
|
| BB-EK0573 |
CD154 _ CD40L (Human, soluble form) |
1x96 Tests |
792-Eur |
ACR |
human |
| BB-EK0572 |
CD153 _ CD30L (Mouse, soluble form) |
1x96 Tests |
750-Eur |
ACR |
mouse |
| S01-051 |
DLL-4, soluble Human Host: HEK 293 cells DLL4; hdelta2 |
25 |
232-Eur |
Reliatech |
|
| ARP54787_P050 |
IDH1(isocitrate dehydrogenase 1 (NADP+), soluble) |
50 µg |
513-Eur |
ACR |
rat |
| AP15591PU-S |
Guanylate cyclase soluble GUCY1B3 (aa 189_207) |
0.1 ml |
261-Eur |
ACR |
|
| AP15591PU-N |
Guanylate cyclase soluble GUCY1B3 (aa 189_207) |
1.0 ml |
597-Eur |
ACR |
|
| AP15186PU-N |
Guanylate cyclase soluble GUCY1B3 (Center) |
0.1 mg |
492-Eur |
ACR |
|
| AP15185PU-N |
Guanylate cyclase soluble GUCY1B3 (C_term) |
0.1 mg |
492-Eur |
ACR |
|
| AP13762PU-N |
Guanylate cyclase soluble GUCY1A3 (C_term) |
0.1 mg |
492-Eur |
ACR |
|
| AP13761PU-N |
Guanylate cyclase soluble GUCY1A3 (N_term) |
0.1 mg |
492-Eur |
ACR |
|
| AP10315PU-N |
Guanylate cyclase soluble GUCY1B3 (aa 189_207) |
0.1 mg |
513-Eur |
ACR |
|
| CG111-050 |
Recombinant Ovine Prolactin Soluble Receptor |
50ug |
282-Eur |
GenDepot |
|
| CC049-020 |
Recombinant Human Soluble IL-6 Receptor alpha |
20ug |
282-Eur |
GenDepot |
|
| CC038-025 |
Recombinant Human Soluble Iinterleukin-2 Receptor alp |
a 25ug |
282-Eur |
GenDepot |
|
| E-EL-R0888 |
Rat SCD14 (Soluble Cluster Of Differentiation 14) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R0897 |
Rat IL-1SRⅠ(Soluble Interleukin-1 Receptor Ⅰ) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R0898 |
Rat IL-1SRⅡ (Soluble Interleukin-1 Receptor Ⅱ) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R0899 |
Rat IL-2SRα (Soluble Interleukin-2 Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R0900 |
Rat IL-2SRβ (Soluble Interleukin-2 Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R1424 |
Rat SOD1( Superoxide Dismutase 1, Soluble) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-M1072 |
Mouse ENG_sCD105 (Soluble Endoglin) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| cyt-304 |
Recombinant Human Soluble CD4 CYTOKINES AND GROWTH FACTORS |
1mg |
5770-Eur |
Prospecbio |
|
| E-EL-P0430 |
Porcine sgp130 (Soluble Glucoprotein 130) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-P1036 |
Porcine IL-6R (Soluble Interleukin 6 Receptor) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-P1118 |
Porcine sAC (Soluble Adenylate Cyclase) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-Ch0230 |
Chicken sgp130 (Soluble Glucoprotein 130) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-H2444 |
Human TK1 (Thymidine Kinase 1, Soluble) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| ISMUPAR-HIS-1mg |
Soluble Mouse Urokinase Receptor, His Tagged 1mg |
|
5315-Eur |
Innovative Research INC |
|
| 228-11355-3 |
Recombinant Human Soluble RANKL Proteins |
1mg |
----Eur |
Ray Biotech |
|
| CG146-002 |
Recombinant Human Soluble RANK Ligand |
2ug |
199-Eur |
GenDepot |
|
| CG111-010 |
Recombinant Ovine Prolactin Soluble Receptor |
10ug |
199-Eur |
GenDepot |
|
| CC049-005 |
Recombinant Human Soluble IL-6 Receptor alpha |
5ug |
199-Eur |
GenDepot |
|
| 228-11355-1 |
Recombinant Human Soluble RANKL Proteins |
2 |
147-Eur |
Ray Biotech |
|
| CC038-005 |
Recombinant Human Soluble Iinterleukin-2 Receptor alp |
a 5ug |
199-Eur |
GenDepot |
|
| 228-11355-2 |
Recombinant Human Soluble RANKL Proteins |
10 |
205-Eur |
Ray Biotech |
|
| E-EL-H0082 |
Human sgp130 (Soluble Glucoprotein 130) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-H0192 |
Human IL-6R (Soluble Interleukin 6 Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| DS-MB-03380 |
Mouse Anti-Human LOX-1 (soluble) Antibodies |
0.2 mg |
411-Eur |
Ray Biotech |
|
| DS-01-0482 |
Recombinant Human CD54 (Soluble) Proteins |
50 |
568-Eur |
Ray Biotech |
|
| DS-01-0483 |
Recombinant Human CD95 (Soluble) Proteins |
25 |
568-Eur |
Ray Biotech |
|
| E-EL-H1638 |
Human sAC (Soluble Adenylate Cyclase) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-Ch0755 |
Chicken IL-6R (Soluble Interleukin 6 Receptor) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| CSB-E07994h |
Human soluble E_selectin,sE_selectin ELISA Kit |
96T |
683-Eur |
Cusabio |
elisa |
| CYT-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
50µg |
198-Eur |
Prospecbio |
recombinant |
| CYT-286 |
Recombinant Human Soluble IL_6 Receptor alpha |
20µg |
198-Eur |
Prospecbio |
recombinant |
| CYT-589 |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
5µg |
391-Eur |
Prospecbio |
recombinant |
| CYT-285 |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
25µg |
198-Eur |
Prospecbio |
recombinant |
| CYT-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
10µg |
113-Eur |
Prospecbio |
recombinant |
| CYT-286 |
Recombinant Human Soluble IL_6 Receptor alpha |
5µg |
113-Eur |
Prospecbio |
recombinant |
| CYT-589 |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
2µg |
275-Eur |
Prospecbio |
recombinant |
| CYT-285 |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
5µg |
113-Eur |
Prospecbio |
recombinant |
| KT-60524 |
Research Kits: Rat Soluble P-Selectin ELISA |
96 tests |
1342-Eur |
Kamiya Biomedical KB |
|
| QY-E11237 |
Rat soluble Cluster of differentiation 86(sCD86)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E11234 |
Rat soluble Toll-like receptor 2(sTLR-2)ELISA Kit |
96T |
537-Eur |
SQBIO |
|
| QY-E11233 |
Rat soluble Toll-like receptor 6(sTLR-6)ELISA Kit |
96T |
537-Eur |
SQBIO |
|
| CYT-285 |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
1mg |
4069-Eur |
Prospecbio |
recombinant |
| CYT-589 |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
10µg |
660-Eur |
Prospecbio |
recombinant |
| CYT-286 |
Recombinant Human Soluble IL_6 Receptor alpha |
1mg |
4686-Eur |
Prospecbio |
recombinant |
| CSB-E07439r |
Rat soluble interleukin_2 receptor,sIL_2Rá ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| CSB-E07437r |
Rat soluble interleukin_2 receptor,sIL_2Râ ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| CSB-E07381r |
Rat tumor necrosis factor soluble receptor |
96T |
701-Eur |
Cusabio |
recombinant |
| CSB-E07380r |
Rat tumor necrosis factor soluble receptor |
96T |
701-Eur |
Cusabio |
recombinant |
| CSB-E06941Rb |
Rabbit soluble E_selectin,sE_selectin ELISA Kit |
96T |
740-Eur |
Cusabio |
elisa |
| CSB-E06895Rb |
Rabbit Soluble protein_100B,S_100B ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| CSB-E06894Rb |
Rabbit Soluble protein_100,S_100 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| CSB-E06861Rb |
Rabbit soluble P_selectin,sP_selectin ELISA Kit |
96T |
740-Eur |
Cusabio |
elisa |
| CSB-E05191Rb |
Rabbit soluble adhesion molecules,Sam ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| 188-01473 |
RANK Ligand Soluble, Human, recombinant |
1 mg |
----Eur |
B-Bridge |
recombinant |
| FL-103 |
Biochemical: Fas Ligand, Soluble Human (no enhancer required) |
5 ug |
483-Eur |
Kamiya Biomedical KB |
|
| CYT-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
1mg |
1524-Eur |
Prospecbio |
recombinant |
| QY-E11232 |
Rat soluble Interleukin 6 receptor(sIL-6R_CD126)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E11231 |
Rat soluble Interleukin 7 receptor(sIL-7R_CD127)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E10088 |
Rat IsocitRate Dehydrogenase 1, Soluble(IDH1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 201-11-0405 |
Rat soluble cluster of differentiation 14(sCD14)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0130 |
Rat soluble interleukin-2 receptor(IL-2sRβ)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0129 |
Rat soluble interleukin-2 receptor(IL-2sRα)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0122 |
Rat soluble interleukin-1 receptor Ⅱ(IL-1sRⅡ)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0121 |
Rat soluble interleukin-1 receptor Ⅰ(IL-1sRⅠ)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 184-01671 |
RANK Receptor Soluble, Human, recombinant |
100 ug |
519-Eur |
B-Bridge |
recombinant |
| 201-12-1396 |
Human soluble Farnesoid X Receptor(FXR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-1395 |
Human soluble Retinoid X Receptor(RXR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-1394 |
Human soluble Liver X Receptor(LXR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-1198 |
Human retinal soluble antigen(Sag)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-0845 |
Human Soluble Adenylate Cyclase(sAC)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-0650 |
Human soluble protein 185(sp185_HER-2)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-11-0408 |
Rat soluble Cluster of differentiation 86(sCD86)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0411 |
Rat soluble Toll-like receptor 2(sTLR-2)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0412 |
Rat soluble Toll-like receptor 6(sTLR-6)ELISA Kit |
96T |
776-Eur |
SunBT |
|
| QY-E30111 |
Rabbit soluble adhesion molecules,Sam ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| QY-E30105 |
Rabbit soluble interleukin-1 receptor Ⅰ,IL-1sR Ⅰ ELISA kit |
96T |
646-Eur |
SQBIO |
|
| ACLCYT334B |
Soluble RANK ligand, Human, recombinant |
10 µg. |
----Eur |
Accurate |
recombinant |
| ACLCYT334 |
Soluble RANK ligand, Human, recombinant |
2 µg. |
----Eur |
Accurate |
recombinant |
| ACLCYT245B |
Soluble CD40 Ligand_TRAP, Human, recombinant |
50 µg. |
----Eur |
Accurate |
recombinant |
| ACLCYT245 |
Soluble CD40 Ligand_TRAP, Human, recombinant |
10 µg. |
----Eur |
Accurate |
recombinant |
| QY-E21372 |
Mouse soluble Interleukin 2 recepter(IL-2sR)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E20901 |
Mouse Leptin Soluble Receptor(sLR)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 201-11-1558 |
Rat IsocitRate Dehydrogenase 1, Soluble(IDH1)ELISA Kit |
96T |
776-Eur |
SunBT |
|
| 14410-42 |
Eosin Yellowish(water soluble) CAS: 17372-87-1 |
25G |
128-Eur |
Nacalai |
|
| 06880-42 |
Aniline Blue(water soluble) CAS: 28631-66-5 |
25G |
135-Eur |
Nacalai |
|
| 201-11-0414 |
Rat soluble Interleukin 7 receptor(sIL-7R_CD127)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-12-0317 |
Human Soluble Endoglin(ENG_sCD105)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 4Tr26-13E4 |
CD71 _ TFRC (soluble form) |
1 mg |
427-Eur |
ACR |
|
| 501CB501_H |
Cytochrome b5, soluble domain, rabbit, unlabelled |
|
----Eur |
ProtEra |
polyclonal |
| QY-E02446 |
Human soluble adhesion molecules(Sam)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| 301CUA01_H |
CuA, T.Thermophilus, soluble part of subunit 2 of CCO, unlabelled |
|
----Eur |
ProtEra |
|
| 301COX005_H |
Cox11, S.meliloti, soluble domain, unalabelled |
|
----Eur |
ProtEra |
|
| QY-E02455 |
Human Soluble Adenylate Cyclase(sAC)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E11523 |
Rat soluble interleukin-1 receptor Ⅱ(IL-1sRⅡ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E02458 |
Human soluble Retinoid X Receptor(RXR)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| 301COP002_H |
CopAb, B.subtilis, soluble domain B, unlabelled |
|
----Eur |
ProtEra |
polyclonal |
| QY-E02461 |
Human Leptin Soluble Receptor(sLR)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| 301COP003_H |
CopAab, B.subtilis, soluble domain AB, unlabelled |
|
----Eur |
ProtEra |
|
| QY-E02466 |
Human soluble Liver X Receptor(LXR)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E02467 |
Human soluble Farnesoid X Receptor(FXR)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| 301CC2A01 |
Ccc2a, S.cervisiae, recombinant, soluble domain A |
200ug |
266-Eur |
ProtEra |
recombinant |
| 501CB501 |
Cytochrome b5, soluble domain, rabbit, recombinant |
200ug |
166-Eur |
ProtEra |
recombinant |
| 8-sLOX1 |
Soluble lectin_like oxidized LDL receptor (LOX_1) |
50ug |
919-Eur |
Advenced Immuno Chemical |
recombinant |
| 4Tr26-11F5 |
CD71 _ TFRC (soluble form) |
1 mg |
427-Eur |
ACR |
|
| 4Tr26-10D2 |
CD71 _ TFRC (soluble form) |
1 mg |
427-Eur |
ACR |
|
| AP15185PU-N |
Guanylate cyclase soluble GUCY1B3 (C_term) |
0.1 mg |
409-Eur |
ACR |
|
| AP13761PU-N |
Guanylate cyclase soluble GUCY1A3 (N_term) |
0.1 mg |
409-Eur |
ACR |
|
| 501CB501 |
Cytochrome b5, soluble domain, rabbit, recombinant |
10mg |
2244-Eur |
ProtEra |
recombinant |
| CSB-EL022397RA |
Rat superoxide dismutase 1, soluble (SOD1) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| 301CC2A01 |
Ccc2a, S.cervisiae, recombinant, soluble domain A |
10mg |
3047-Eur |
ProtEra |
recombinant |
| 501CB501 |
Cytochrome b5, soluble domain, rabbit, recombinant |
1mg |
280-Eur |
ProtEra |
recombinant |
| 301CC2A01 |
Ccc2a, S.cervisiae, recombinant, soluble domain A |
1mg |
380-Eur |
ProtEra |
recombinant |
| QY-E11524 |
Rat soluble interleukin-1 receptor Ⅰ(IL-1sRⅠ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 8-sLOX1 |
Soluble lectin_like oxidized LDL receptor (LOX_1) |
100ug |
1440-Eur |
Advenced Immuno Chemical |
recombinant |
| QY-E01520 |
Human retinal soluble antigen(Sag)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E02470 |
Human soluble protein 185(sp185_HER-2)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| 301COP001_H |
CopAa, B.subtilis, soluble domain A, unlabelled |
|
----Eur |
ProtEra |
|
| 301CC2A01_H |
Ccc2a, S.cervisiae, soluble domain A, unlabelled |
|
----Eur |
ProtEra |
|
| CSB-E09869Ch |
Chicken soluble E_selectin,sE_selectin ELISA Kit |
96T |
662-Eur |
Cusabio |
elisa |
| CSB-E09823h |
Human Leptin Soluble Receptor,sLR ELISA Kit |
96T |
701-Eur |
Cusabio |
elisa |
| CSB-E09578h |
Human soluble adhesion molecules,Sam ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E09349h |
Human Soluble Adenylate Cyclase,sAC ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E09092h |
Human soluble Phospholipase A2,sPL_A2 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E08543r |
Rat soluble cluster of differentiation 86,sCD86 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E08106p |
Porcine soluble P_selectin,sP_Selectin ELISA Kit |
96T |
740-Eur |
Cusabio |
elisa |
| CSB-E08077m |
Mouse soluble P_selectin,sP_selectin ELISA Kit |
96T |
701-Eur |
Cusabio |
elisa |
| CSB-E08074h |
Human soluble P_selectin,sP_selectin ELISA Kit |
96T |
662-Eur |
Cusabio |
elisa |
| CSB-E08068m |
Mouse Soluble protein_100,S_100 ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| CSB-E08067h |
Human Soluble protein_100,S_100 ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| CSB-E08065h |
Human Soluble protein_100B,S_100B ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| CSB-E09921m |
Mouse Soluble Endoglin,ENG_sCD105 ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| QY-E11240 |
Rat soluble cluster of differentiation 14(sCD14)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E11515 |
Rat soluble interleukin-2 receptor(IL-2sRβ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E02478 |
Human Soluble Endoglin(ENG_sCD105)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CSB-E13772r |
Rat Soluble Cluster of Differentiation 80,sCD80 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E13340r |
Rat Soluble Interleukin_2 Receptor(SIL_2R) ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E12752h |
Human soluble OX40L (sOX40L) ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E11178r |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit |
96T |
626-Eur |
Cusabio |
elisa |
| CSB-E10644h |
Human soluble protein 185,sp185_HER_2 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| QY-E04279 |
Human soluble Interleukin 2 recepter(IL-2sR)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CSB-E10359r |
Rat soluble Toll_like receptor 6,sTLR_6 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| CSB-E10358r |
Rat soluble Toll_like receptor 2,sTLR_2 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| CSB-E10051m |
Mouse Leptin Soluble Receptor,sLR ELISA Kit |
96T |
486-Eur |
Cusabio |
elisa |
| CSB-E10030h |
Human Soluble Endoglin,sENG_sCD105 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| QY-E11516 |
Rat soluble interleukin-2 receptor(IL-2sRα)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| CSB-E07995m |
Mouse soluble E_selectin,sE_selectin ELISA Kit |
96T |
701-Eur |
Cusabio |
elisa |
| E03S0290 |
Mouse Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0293 |
Rat Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
601-Eur |
BGene |
|
| E02S0294 |
Rat Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0008 |
Mouse Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
689-Eur |
Blue Gene Biotech |
|
| U2043h |
Human soluble Retinoid X Receptor CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| U1956h |
Human soluble receptor for advanced glycation end |
96T |
706-Eur |
EIAab |
recombinant |
| E03I0378 |
Mouse Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
689-Eur |
Blue Gene Biotech |
|
| E03I0368 |
Mouse Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
689-Eur |
Blue Gene Biotech |
|
| E03I0366 |
Mouse Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
689-Eur |
Blue Gene Biotech |
|
| E03C0053 |
Mouse Soluble CD 44v9 ELISA , SCD44V9 |
|
689-Eur |
Blue Gene Biotech |
|
| E03C0044 |
Mouse Soluble CD44s ELISA , sCD44s |
|
689-Eur |
Blue Gene Biotech |
|
| CK-E95836 |
Human Leptin Soluble Receptor,sLR ELISAkit |
|
----Eur |
Glory |
|
| E03S0266 |
Mouse Soluble Leptin Receptor ELISA, SLR |
|
689-Eur |
Blue Gene Biotech |
|
| 'H00002983-P01-25 |
Guanylate cyclase soluble GUCY1B3 antigen |
25 |
700-Eur |
ACR |
|
| 'H00002983-P01-10 |
Guanylate cyclase soluble GUCY1B3 antigen |
10 |
495-Eur |
ACR |
|
| E03F0265 |
Mouse Soluble Farnesoid X receptor ELISA, FXR |
|
689-Eur |
Blue Gene Biotech |
|
| 'GTX102517 |
Guanylate cyclase soluble GUCY1A3 antibody |
0.1 ml |
304-Eur |
ACR |
|
| 'GTX104443 |
Guanylate cyclase soluble GUCY1B3 antibody |
0.1 ml |
304-Eur |
ACR |
|
| 'H00002982-P01-10 |
Guanylate cyclase soluble GUCY1A3 antigen |
10 |
495-Eur |
ACR |
|
| 'H00002982-P01-25 |
Guanylate cyclase soluble GUCY1A3 antigen |
25 |
700-Eur |
ACR |
|
| 'H00002982-Q01-10 |
Guanylate cyclase soluble GUCY1A3 antigen |
10 |
495-Eur |
ACR |
|
| E03S0253 |
Mouse Soluble Glucoprotein 130 ELISA , sGP130 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0233 |
Mouse Soluble adhesion molecules ELISA, Sam |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0230 |
Mouse Soluble CD36 ELISA , sCD36 |
|
689-Eur |
Blue Gene Biotech |
|
| 'H00002982-Q01-25 |
Guanylate cyclase soluble GUCY1A3 antigen |
25 |
700-Eur |
ACR |
|
| E03S0158 |
Mouse Soluble programmed death-1 ELISA, sPD-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E03R0361 |
Mouse Soluble Retinoid X Receptor ELISA, RXR |
|
689-Eur |
Blue Gene Biotech |
|
| E03L0297 |
Mouse Soluble Liver X Receptor ELISA, LXR |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0260 |
Mouse Soluble interleukin 6 receptor ELISA, sIL-6R |
|
689-Eur |
Blue Gene Biotech |
|
| CK-E95851 |
Human soluble adhesion molecules,Sam ELISAkit |
|
----Eur |
Glory |
|
| U0074h |
Human soluble interleukin_2 receptor CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| E03F0265 |
Mouse Soluble Farnesoid X receptor ELISA,FXR |
96 Tests/kit |
601-Eur |
BGene |
|
| E02I0381 |
Rat Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
689-Eur |
Blue Gene Biotech |
|
| E02I0379 |
Rat Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
689-Eur |
Blue Gene Biotech |
|
| E03I0366 |
Mouse Soluble interleukin-1 receptor ⅠELISA,IL-1sR Ⅰ |
96 Tests/kit |
601-Eur |
BGene |
|
| E03I0368 |
Mouse Soluble interleukin-1 receptor II ELISA,IL-1sR II |
96 Tests/kit |
601-Eur |
BGene |
|
| E03I0378 |
Mouse Soluble Interleukin 2 recepter ELISA,IL-2sR |
96 Tests/kit |
601-Eur |
BGene |
|
| U0065h |
Human soluble interleukin_1 receptorⅠ CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| U0066h |
Human soluble interleukin_1 receptor Ⅱ CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| U1815h |
Human soluble Interleukin 6 receptor,sIL_6R_CD126 |
96T |
706-Eur |
EIAab |
recombinant |
| U1837h |
Human soluble Interleukin 2 recepter CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| U0548h |
Human Soluble Intercellular Adhesion Molecule_1 CL |
96T |
706-Eur |
EIAab |
human |
| E02S0239 |
Rat Soluble cluster of differentiation 86 ELISA, SCD86 |
|
689-Eur |
Blue Gene Biotech |
|
| U0075h |
Human soluble interleukin_2 receptor CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| U1859h |
Human Soluble Lectin_like oxidized low density lip |
96T |
706-Eur |
EIAab |
human |
| E03C0044 |
Mouse Soluble CD44s ELISA ,sCD44s |
96 Tests/kit |
601-Eur |
BGene |
|
| E02S0224 |
Rat Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0213 |
Rat Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0291 |
Rat Soluble transferrin receptor ELISA
, sTfR |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0262 |
Rat Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0261 |
Rat Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0223 |
Rat Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
689-Eur |
Blue Gene Biotech |
|
| E03C0053 |
Mouse Soluble CD 44v9 ELISA ,SCD44V9 |
96 Tests/kit |
601-Eur |
BGene |
|
| U2044h |
Human soluble Liver X Receptor CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| E02S0294 |
Rat Soluble toll-like receptor 6 ELISA, STLR-6 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0293 |
Rat Soluble toll-like receptor 2 ELISA, STLR-2 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0263 |
Rat Anti-soluble liver antigen ELISA, SLA |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0290 |
Human Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
689-Eur |
Blue Gene Biotech |
|
| U1160h |
Human soluble transferrin receptor CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| E02S0239 |
Rat Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
601-Eur |
BGene |
|
| E05S0290 |
Guinea pig Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0266 |
Guinea pig Soluble Leptin Receptor ELISA, SLR |
|
689-Eur |
Blue Gene Biotech |
|
| U0548Mo |
Monkey Soluble Intercellular Adhesion Molecule_1 C |
96T |
839-Eur |
EIAab |
|
| E05S0253 |
Guinea pig Soluble Glucoprotein 130 ELISA , sGP130 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0233 |
Guinea pig Soluble adhesion molecules ELISA, Sam |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0230 |
Guinea pig Soluble CD36 ELISA , sCD36 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0158 |
Guinea pig Soluble programmed death-1 ELISA, sPD-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E05R0361 |
Guinea pig Soluble Retinoid X Receptor ELISA, RXR |
|
689-Eur |
Blue Gene Biotech |
|
| E05L0297 |
Guinea pig Soluble Liver X Receptor ELISA, LXR |
|
689-Eur |
Blue Gene Biotech |
|
| E05F0265 |
Guinea pig Soluble Farnesoid X receptor ELISA, FXR |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0261 |
Rat Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
601-Eur |
BGene |
|
| E02S0262 |
Rat Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
601-Eur |
BGene |
|
| E06C0044 |
Goat Soluble CD44s ELISA , sCD44s |
|
715-Eur |
Blue Gene Biotech |
|
| E06C0053 |
Goat Soluble CD 44v9 ELISA , SCD44V9 |
|
715-Eur |
Blue Gene Biotech |
|
| E06I0366 |
Goat Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
715-Eur |
Blue Gene Biotech |
|
| U0066m |
Mouse soluble interleukin_1 receptor Ⅱ CLIA KIT |
96T |
739-Eur |
EIAab |
recombinant |
| U0065m |
Mouse soluble interleukin_1 receptor Ⅰ CLIA KIT |
96T |
739-Eur |
EIAab |
recombinant |
| U0548m |
Mouse Soluble Intercellular Adhesion Molecule 1 CL |
96T |
739-Eur |
EIAab |
mouse |
| E06S0260 |
Goat Soluble interleukin 6 receptor ELISA, sIL-6R |
|
715-Eur |
Blue Gene Biotech |
|
| U0824m |
Mouse soluble Cluster of differentiation 86 CLIA K |
96T |
739-Eur |
EIAab |
mouse |
| U0119m |
Mouse Soluble Cluster of differentiation 40 ligand |
96T |
739-Eur |
EIAab |
mouse |
| U0118m |
Mouse Soluble Cluster of differentiation 30 ligand |
96T |
739-Eur |
EIAab |
mouse |
| U0678m |
Mouse soluble cluster of differentiation 30 CLIA K |
96T |
739-Eur |
EIAab |
mouse |
| E06S0008 |
Goat Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
715-Eur |
Blue Gene Biotech |
|
| U0219m |
Mouse Leptin Soluble Receptor CLIA KIT |
96T |
739-Eur |
EIAab |
recombinant |
| E06I0378 |
Goat Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
715-Eur |
Blue Gene Biotech |
|
| E06I0368 |
Goat Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
715-Eur |
Blue Gene Biotech |
|
| E05S0260 |
Guinea pig Soluble interleukin 6 receptor ELISA, sIL-6R |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0263 |
Rat Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
601-Eur |
BGene |
|
| E04R0361 |
Rabbit Soluble Retinoid X Receptor ELISA, RXR |
|
689-Eur |
Blue Gene Biotech |
|
| E04L0297 |
Rabbit Soluble Liver X Receptor ELISA, LXR |
|
689-Eur |
Blue Gene Biotech |
|
| E04F0265 |
Rabbit Soluble Farnesoid X receptor ELISA, FXR |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0260 |
Rabbit Soluble interleukin 6 receptor ELISA, sIL-6R |
|
689-Eur |
Blue Gene Biotech |
|
| E04R0361 |
Rabbit Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0008 |
Rabbit Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
689-Eur |
Blue Gene Biotech |
|
| E04I0378 |
Rabbit Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
689-Eur |
Blue Gene Biotech |
|
| E04I0368 |
Rabbit Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
689-Eur |
Blue Gene Biotech |
|
| E04I0366 |
Rabbit Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
689-Eur |
Blue Gene Biotech |
|
| E04C0053 |
Rabbit Soluble CD 44v9 ELISA , SCD44V9 |
|
689-Eur |
Blue Gene Biotech |
|
| E04C0044 |
Rabbit Soluble CD44s ELISA , sCD44s |
|
689-Eur |
Blue Gene Biotech |
|
| U0966h |
Human soluble Triggering Receptor Expresses on Mye |
96T |
706-Eur |
EIAab |
recombinant |
| E04S0158 |
Rabbit Soluble programmed death-1 ELISA, sPD-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0230 |
Rabbit Soluble CD36 ELISA , sCD36 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0233 |
Rabbit Soluble adhesion molecules ELISA, Sam |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0008 |
Guinea pig Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
689-Eur |
Blue Gene Biotech |
|
| RCYT-533C |
Recombinant Rat Prolactin Soluble Receptor |
1mg |
1905-Eur |
SeraLab |
recombinant |
| E05I0378 |
Guinea pig Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
689-Eur |
Blue Gene Biotech |
|
| E05I0368 |
Guinea pig Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
689-Eur |
Blue Gene Biotech |
|
| E05I0366 |
Guinea pig Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
689-Eur |
Blue Gene Biotech |
|
| RCYT-533B |
Recombinant Rat Prolactin Soluble Receptor |
50µg |
234-Eur |
SeraLab |
recombinant |
| RCYT-533A |
Recombinant Rat Prolactin Soluble Receptor |
10µg |
127-Eur |
SeraLab |
recombinant |
| E05C0053 |
Guinea pig Soluble CD 44v9 ELISA , SCD44V9 |
|
689-Eur |
Blue Gene Biotech |
|
| E05C0044 |
Guinea pig Soluble CD44s ELISA , sCD44s |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0290 |
Rabbit Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0266 |
Rabbit Soluble Leptin Receptor ELISA, SLR |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0253 |
Rabbit Soluble Glucoprotein 130 ELISA , sGP130 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0291 |
Rat Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0266 |
Human Soluble Leptin Receptor ELISA, SLR |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0290 |
Mouse Soluble IL-1 Receptor 4_ST2 ELISA ,ST2 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04L0297 |
Rabbit Soluble Liver X Receptor ELISA, LXR |
96 Tests/kit |
601-Eur |
BGene |
|
| E1815h |
Human soluble Interleukin 6 receptor,sIL_6R_CD126 |
96T |
706-Eur |
EIAab |
recombinant |
| PCLO |
PCK1 Gene phosphoenolpyruvate carboxykinase 1 (soluble) |
|
----Eur |
Transposagen |
|
| MDH2 |
MDH1 Gene malate dehydrogenase 1, NAD (soluble) |
|
----Eur |
Transposagen |
|
| MANEAL |
MANBB Gene mannosidase, beta B, soluble |
|
----Eur |
Transposagen |
|
| E04S0008 |
Rabbit Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0158 |
Rabbit Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E0065Rb |
Rabbit soluble interleukin_1 receptor ⅠELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E04S0230 |
Rabbit Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0233 |
Rabbit Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
601-Eur |
BGene |
|
| E0139r |
Rat soluble tumor necrosis factor_related apoptosi |
96T |
755-Eur |
EIAab |
rat |
| CSB-E04842r |
Rat Leptin Soluble Receptor,sLR ELISA Kit SpeciesRat |
96T |
688-Eur |
Cusabio |
|
| E0663b |
Bovine soluble Toll_like receptor 2 ELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E1155p |
Porcine soluble Factor_related Apoptosis ligand E |
96T |
839-Eur |
EIAab |
apoptosis |
| E04I0378 |
Rabbit Soluble Interleukin 2 recepter ELISA, IL-2sR |
96 Tests/kit |
601-Eur |
BGene |
|
| P3417Rb |
Rabbit anti_testicular soluble adenylyl cyclase po |
40ug/0.2ml |
592-Eur |
EIAab |
polyclonal |
| 05-52172 |
Antigens Soluble Transferrin Receptor , human |
10 |
237-Eur |
ARP |
|
| 14-20004 |
Antigens soluble RANK Ligand, Mouse |
20 |
215-Eur |
ARP |
|
| 14-10019 |
Antigens soluble RANK Ligand, Human |
2 |
215-Eur |
ARP |
|
| E1367r |
Rat soluble vascular endothelial growth factor rec |
96T |
755-Eur |
EIAab |
recombinant |
| E0906r |
Rat soluble platelet endothelial cell adhesion mol |
96T |
755-Eur |
EIAab |
rat |
| E0755r |
Rat soluble myosin heavy chain 2 ELISA Kit |
96T |
755-Eur |
EIAab |
elisa |
| E04C0044 |
Rabbit Soluble CD44s ELISA , sCD44s |
96 Tests/kit |
601-Eur |
BGene |
|
| E04C0053 |
Rabbit Soluble CD 44v9 ELISA , SCD44V9 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04F0265 |
Rabbit Soluble Farnesoid X receptor ELISA, FXR |
96 Tests/kit |
601-Eur |
BGene |
|
| E04I0366 |
Rabbit Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
96 Tests/kit |
601-Eur |
BGene |
|
| E04I0368 |
Rabbit Soluble interleukin-1 receptor II ELISA, IL-1sR II |
96 Tests/kit |
601-Eur |
BGene |
|
| CSB-E07437r |
Rat soluble interleukin-2 receptor,sIL-2Rβ ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-E07439r |
Rat soluble interleukin-2 receptor,sIL-2Rα ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| E04S0253 |
Rabbit Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
601-Eur |
BGene |
|
| E0022r |
Rat soluble endothelial protein C receptor ELISA K |
96T |
755-Eur |
EIAab |
elisa |
| E2173h |
Human Soluble Cluster of differentiation163 ELISA |
96T |
706-Eur |
EIAab |
elisa |
| 201-20-5506 |
SOD1{superoxide dismutase 1, soluble}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| 201-20-5302 |
SHMT1{serine hydroxymethyltransferase 1 (soluble)}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| 201-20-4076 |
PCK1{phosphoenolpyruvate carboxykinase 1 (soluble)}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| 201-20-3314 |
MDH1{malate dehydrogenase 1, NAD (soluble)}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| E04S0260 |
Rabbit Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
601-Eur |
BGene |
|
| E0219h |
Human Leptin Soluble Receptor ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E0470r |
Rat soluble receptor activator of nuclear factor_k |
96T |
755-Eur |
EIAab |
recombinant |
| E0547r |
Rat soluble Vascuolar cell adhesion molecule 1 ELI |
96T |
755-Eur |
EIAab |
rat |
| E0548h |
Human Soluble Intercellular Adhesion Molecule_1 EL |
96T |
706-Eur |
EIAab |
human |
| E0111r |
Rat Platelet_Derived Growth Factor Soluble Recepto |
96T |
755-Eur |
EIAab |
recombinant |
| orb80570 |
Rat Prolactin Soluble Receptor protein Proteins |
10 |
159-Eur |
Biorb |
|
| orb82245 |
Soluble Transferrin Receptor protein Proteins |
100 |
1072-Eur |
Biorb |
|
| CSB-E07446r |
Rat soluble interleukin-1 receptor Ⅱ,sIL-1RⅡ ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-E08067h |
Human Soluble protein-100,S-100 ELISA Kit SpeciesHuman |
96T |
959-Eur |
Cusabio |
|
| ADCY3 |
ADCY10 Gene adenylate cyclase 10 (soluble) |
|
----Eur |
Transposagen |
|
| ACP5 |
ACP1 Gene acid phosphatase 1, soluble |
|
----Eur |
Transposagen |
|
| E97839Ra |
ELISA Kit for Isocitrate Dehydrogenase 1, Soluble (IDH1) |
96T/Kit |
741-Eur |
USCNLife |
|
| E97839Hu |
ELISA Kit for Isocitrate Dehydrogenase 1, Soluble (IDH1) |
96T/Kit |
682-Eur |
USCNLife |
|
| E0119Rb |
Rabbit soluble cluster of differentiation 40 ligan |
96T |
839-Eur |
EIAab |
polyclonal |
| CSB-E08068m |
Mouse Soluble protein-100,S-100 ELISA Kit SpeciesMouse |
96T |
959-Eur |
Cusabio |
|
| E90936Hu |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) |
96T/Kit |
682-Eur |
USCNLife |
|
| E91960Mu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) |
96T/Kit |
702-Eur |
USCNLife |
|
| E91960Ra |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) |
96T/Kit |
741-Eur |
USCNLife |
|
| E91960Hu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) |
96T/Kit |
682-Eur |
USCNLife |
|
| E0548p |
Porcine Soluble Intercellular Adhesion Molecule_1 |
96T |
839-Eur |
EIAab |
porcine |
| E0312r |
Rat Soluble Mesothelin Related Peptide Kit ELISA K |
96T |
755-Eur |
EIAab |
elisa |
| U2042h |
Human soluble Farnesoid X Receptor CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| E01I0368 |
Human Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
689-Eur |
Blue Gene Biotech |
|
| E01I0366 |
Human Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
689-Eur |
Blue Gene Biotech |
|
| E01C0053 |
Human Soluble CD 44v9 ELISA , SCD44V9 |
|
689-Eur |
Blue Gene Biotech |
|
| E01C0044 |
Human Soluble CD44s ELISA , sCD44s |
|
689-Eur |
Blue Gene Biotech |
|
| E01I0378 |
Human Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
689-Eur |
Blue Gene Biotech |
|
| E03R0361 |
Mouse Soluble Retinoid X Receptor ELISA,RXR |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0008 |
Mouse Soluble Fms-like Tyrosine 1 ELISA ,sFLT1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0158 |
Mouse Soluble programmed death-1 ELISA,sPD-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| U0752h |
Human Soluble Cluster of differentiation 38 CLIA K |
96T |
706-Eur |
EIAab |
human |
| U0118h |
Human Soluble Cluster of differentiation 30 ligand |
96T |
706-Eur |
EIAab |
human |
| E01S0260 |
Human Soluble interleukin 6 receptor ELISA, sIL-6R |
|
689-Eur |
Blue Gene Biotech |
|
| U0652h |
human soluble cluster of differentiation 28 CLIA K |
96T |
706-Eur |
EIAab |
human |
| E03L0297 |
Mouse Soluble Liver X Receptor ELISA,LXR |
96 Tests/kit |
601-Eur |
BGene |
|
| U0119h |
Human Soluble Cluster of differentiation 40 ligand |
96T |
706-Eur |
EIAab |
human |
| CK-E96837 |
Human Soluble Adenylate Cyclase,sAC ELISAkit |
|
----Eur |
Glory |
|
| E01S0253 |
Human Soluble Glucoprotein 130 ELISA , sGP130 |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0233 |
Human Soluble adhesion molecules ELISA, Sam |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0230 |
Human Soluble CD36 ELISA , sCD36 |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0158 |
Human Soluble programmed death-1 ELISA, sPD-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E01R0361 |
Human Soluble Retinoid X Receptor ELISA, RXR |
|
689-Eur |
Blue Gene Biotech |
|
| E01L0297 |
Human Soluble Liver X Receptor ELISA, LXR |
|
689-Eur |
Blue Gene Biotech |
|
| E01F0265 |
Human Soluble Farnesoid X receptor ELISA, FXR |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0008 |
Human Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
689-Eur |
Blue Gene Biotech |
|
| U1154h |
Human soluble cytokine receptor CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| U2173h |
Human Soluble Cluster of differentiation163 CLIA K |
96T |
706-Eur |
EIAab |
human |
| U0824h |
Human soluble Cluster of differentiation 86 CLIA K |
96T |
706-Eur |
EIAab |
human |
| U1654h |
Human soluble cluster of differentiation 44 varian |
96T |
706-Eur |
EIAab |
human |
| E03S0230 |
Mouse Soluble CD36 ELISA ,sCD36 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0233 |
Mouse Soluble adhesion molecules ELISA,Sam |
96 Tests/kit |
601-Eur |
BGene |
|
| PC-Sac1 |
Soluble adenylate cyclase Mid Region, WB control |
100-150ul |
243-Eur |
FabGennix |
|
| PC-Sac1 |
Soluble adenylate cyclase 1 N-Terminal, WB control |
100-150ul |
243-Eur |
FabGennix |
|
| AS09536 |
SOD1 aa 43_57 | superoxide dismutase 1, soluble |
50 ul |
479-Eur |
Agrisera |
|
| AS09535 |
SOD1 aa 24_39 | superoxide dismutase 1, soluble |
50 ul |
479-Eur |
Agrisera |
|
| AS09534 |
SOD1 aa 03_20 | superoxide dismutase 1, soluble |
100 ul |
479-Eur |
Agrisera |
|
| U0219h |
Human Leptin Soluble Receptor CLIA KIT |
96T |
706-Eur |
EIAab |
recombinant |
| U0548Ch |
Chicken Soluble Intercellular Adhesion Molecule_1 |
96T |
839-Eur |
EIAab |
|
| E03S0260 |
Mouse Soluble interleukin 6 receptor ELISA,sIL-6R |
96 Tests/kit |
601-Eur |
BGene |
|
| U0022Ch |
Chicken soluble endothelial protein C receptor CLI |
96T |
839-Eur |
EIAab |
recombinant |
| U1670c |
Canine soluble cluster of differentiation 146 CLIA |
96T |
839-Eur |
EIAab |
dog |
| U0663b |
Bovine soluble Toll_like receptor 2 CLIA KIT |
96T |
839-Eur |
EIAab |
recombinant |
| E03S0266 |
Mouse Soluble Leptin Receptor ELISA,SLR |
96 Tests/kit |
601-Eur |
BGene |
|
| PC-Sac1 |
Soluble adenylate cyclase1 C-Epitope, WB control |
100-150ul |
243-Eur |
FabGennix |
|
| PC-sGCA1 |
Soluble Guanylate Cyclase alfa1, WB control |
100-150ul |
243-Eur |
FabGennix |
|
| PC-sGCA2 |
Soluble Guanylate Cyclase alfa2, WB control |
100-150ul |
243-Eur |
FabGennix |
|
| U0750h |
Human Soluble Cluster of differentiation 21 CLIA K |
96T |
706-Eur |
EIAab |
human |
| U0685h |
Human soluble cluster of differentiation 14 CLIA K |
96T |
706-Eur |
EIAab |
human |
| U0522h |
Human soluble adhesion molecules CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| U1348h |
Human Soluble Adenylate Cyclase CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| U1911h |
Human retinal soluble antigen CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| E03S0253 |
Mouse Soluble Glucoprotein 130 ELISA ,sGP130 |
96 Tests/kit |
601-Eur |
BGene |
|
| AS09578 |
A set of 7 antibodies against SOD1 | superoxide dismutase 1, soluble |
6x 50 ul + 1x 100 ul |
2693-Eur |
Agrisera |
Antibodies |
| AS09540 |
SOD1 aa 131_153 | superoxide dismutase 1, soluble |
50 ul |
479-Eur |
Agrisera |
|
| AS09539 |
SOD1 aa 100_115 | superoxide dismutase 1, soluble |
50 ul |
479-Eur |
Agrisera |
|
| AS09538 |
SOD1 aa 80_96 | superoxide dismutase 1, soluble |
50 ul |
479-Eur |
Agrisera |
elisa |
| AS09537 |
SOD1 aa 58_72 | superoxide dismutase 1, soluble |
50 ul |
479-Eur |
Agrisera |
|
| PC-sGCB |
Soluble Guanylate Cyclase beta , WB control |
100-150ul |
243-Eur |
FabGennix |
|
| U0824b |
Bovine soluble Cluster of differentiation 86 CLIA |
96T |
839-Eur |
EIAab |
bovine |
| E11F0265 |
Bovine Soluble Farnesoid X receptor ELISA, FXR |
|
715-Eur |
Blue Gene Biotech |
|
| E01S0158 |
Human Soluble programmed death-1 ELISA, sPD-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E07S0008 |
Porcine Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
715-Eur |
Blue Gene Biotech |
|
| U0548p |
Porcine Soluble Intercellular Adhesion Molecule_1 |
96T |
839-Eur |
EIAab |
porcine |
| E01S0253 |
Human Soluble Glucoprotein 130 ELISA , sGP130 |
96 Tests/kit |
601-Eur |
BGene |
|
| E09S0253 |
Monkey Soluble Glucoprotein 130 ELISA , sGP130 |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0260 |
Monkey Soluble interleukin 6 receptor ELISA, sIL-6R |
|
715-Eur |
Blue Gene Biotech |
|
| U1837p |
Porcine soluble Interleukin 2 recepter CLIA KIT |
96T |
839-Eur |
EIAab |
recombinant |
| U0548Rb |
Rabbit Soluble Intercellular Adhesion Molecule_1 C |
96T |
839-Eur |
EIAab |
polyclonal |
| U0312r |
Rat Soluble Mesothelin Related Peptide Kit CLIA KI |
96T |
755-Eur |
EIAab |
assays |
| E02S0224 |
Rat Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
601-Eur |
BGene |
|
| E02S0223 |
Rat Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
601-Eur |
BGene |
|
| E07S0260 |
Porcine Soluble interleukin 6 receptor ELISA, sIL-6R |
|
715-Eur |
Blue Gene Biotech |
|
| E01S0233 |
Human Soluble adhesion molecules ELISA, Sam |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0260 |
Human Soluble interleukin 6 receptor ELISA, sIL-6R |
96 Tests/kit |
601-Eur |
BGene |
|
| U0548r |
Rat Soluble Intercellular Adhesion Molecule 1 CLIA |
96T |
755-Eur |
EIAab |
rat |
| U0065Rb |
Rabbit soluble interleukin_1 receptor ⅠELISA Kit |
96T |
839-Eur |
EIAab |
elisa |
| E09S0290 |
Monkey Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
715-Eur |
Blue Gene Biotech |
|
| E01R0361 |
Human Soluble Retinoid X Receptor ELISA, RXR |
96 Tests/kit |
601-Eur |
BGene |
|
| E09S0266 |
Monkey Soluble Leptin Receptor ELISA, SLR |
|
715-Eur |
Blue Gene Biotech |
|
| U1155p |
Porcine soluble Factor_related Apoptosis ligand C |
96T |
839-Eur |
EIAab |
apoptosis |
| E09C0053 |
Monkey Soluble CD 44v9 ELISA , SCD44V9 |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0008 |
Monkey Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
715-Eur |
Blue Gene Biotech |
|
| E09I0366 |
Monkey Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
715-Eur |
Blue Gene Biotech |
|
| E09I0368 |
Monkey Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
715-Eur |
Blue Gene Biotech |
|
| E06F0265 |
Goat Soluble Farnesoid X receptor ELISA, FXR |
|
715-Eur |
Blue Gene Biotech |
|
| U0754r |
Rat soluble myosin heavy chain 1 CLIA KIT |
96T |
755-Eur |
EIAab |
assays |
| E08S0260 |
Canine Soluble interleukin 6 receptor ELISA, sIL-6R |
|
715-Eur |
Blue Gene Biotech |
|
| E01S0008 |
Human Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E09I0378 |
Monkey Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
715-Eur |
Blue Gene Biotech |
|
| E01S0230 |
Human Soluble CD36 ELISA , sCD36 |
96 Tests/kit |
601-Eur |
BGene |
|
| E08S0008 |
Canine Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
715-Eur |
Blue Gene Biotech |
|
| U0755r |
Rat soluble myosin heavy chain 2 CLIA KIT |
96T |
755-Eur |
EIAab |
assays |
| S01-024 |
Human CD105_Endoglin, soluble Source Insect cells |
5 µg |
102-Eur |
Reliatech |
human |
| E11S0260 |
Bovine Soluble interleukin 6 receptor ELISA, sIL-6R |
|
715-Eur |
Blue Gene Biotech |
|
| 102-P120G |
Anti_Human, pab FAS Ligand, soluble Source Goat |
100 µg |
332-Eur |
Reliatech |
polyclonal |
| E08C0053 |
Canine Soluble CD 44v9 ELISA , SCD44V9 |
|
715-Eur |
Blue Gene Biotech |
|
| E08C0044 |
Canine Soluble CD44s ELISA , sCD44s |
|
715-Eur |
Blue Gene Biotech |
|
| S01-025 |
Human CD105_Endoglin, soluble Source Insect cells |
25 µg |
272-Eur |
Reliatech |
human |
| E09S0230 |
Monkey Soluble CD36 ELISA , sCD36 |
|
715-Eur |
Blue Gene Biotech |
|
| 100-157 |
Human FAS Ligand, soluble, His_Tag Source CHO cells |
10 µg |
265-Eur |
Reliatech |
human |
| S01-040 |
Human EGFR, soluble Source Insect cells |
25 µg |
376-Eur |
Reliatech |
human |
| E07S0290 |
Porcine Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
715-Eur |
Blue Gene Biotech |
|
| S01-023 |
Mouse CD105_Endoglin, soluble Source Insect cells |
25 µg |
272-Eur |
Reliatech |
dog |
| S01-022 |
Mouse CD105_Endoglin, soluble Source Insect cells |
5 µg |
102-Eur |
Reliatech |
dog |
| U0119Rb |
Rabbit soluble cluster of differentiation 40 ligan |
96T |
839-Eur |
EIAab |
polyclonal |
| E08I0366 |
Canine Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
715-Eur |
Blue Gene Biotech |
|
| U0906r |
Rat soluble platelet endothelial cell adhesion mol |
96T |
755-Eur |
EIAab |
rat |
| E08I0368 |
Canine Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
715-Eur |
Blue Gene Biotech |
|
| E09F0265 |
Monkey Soluble Farnesoid X receptor ELISA, FXR |
|
715-Eur |
Blue Gene Biotech |
|
| E02I0379 |
Rat Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
601-Eur |
BGene |
|
| E09L0297 |
Monkey Soluble Liver X Receptor ELISA, LXR |
|
715-Eur |
Blue Gene Biotech |
|
| E02S0213 |
Rat Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
601-Eur |
BGene |
|
| E09R0361 |
Monkey Soluble Retinoid X Receptor ELISA, RXR |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0233 |
Monkey Soluble adhesion molecules ELISA, Sam |
|
715-Eur |
Blue Gene Biotech |
|
| E11I0378 |
Bovine Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0158 |
Monkey Soluble programmed death-1 ELISA, sPD-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E07F0265 |
Porcine Soluble Farnesoid X receptor ELISA, FXR |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0266 |
Porcine Soluble Leptin Receptor ELISA, SLR |
|
715-Eur |
Blue Gene Biotech |
|
| U1153Rb |
Rabbit soluble Factor_related Apoptosis CLIA KIT |
96T |
839-Eur |
EIAab |
polyclonal |
| E08I0378 |
Canine Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
715-Eur |
Blue Gene Biotech |
|
| E07L0297 |
Porcine Soluble Liver X Receptor ELISA, LXR |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0008 |
Bovine Soluble Fms-like Tyrosine 1 ELISA , sFLT1 |
|
715-Eur |
Blue Gene Biotech |
|
| S01-038 |
Human BAFF receptor, soluble Source E. coli |
50 µg |
265-Eur |
Reliatech |
recombinant |
| U0111r |
Rat Platelet_Derived Growth Factor Soluble Recepto |
96T |
755-Eur |
EIAab |
recombinant |
| E06S0253 |
Goat Soluble Glucoprotein 130 ELISA , sGP130 |
|
715-Eur |
Blue Gene Biotech |
|
| U0075m |
Mouse soluble interleukin_2 receptor CLIA KIT |
96T |
739-Eur |
EIAab |
recombinant |
| E11S0158 |
Bovine Soluble programmed death-1 ELISA, sPD-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E11R0361 |
Bovine Soluble Retinoid X Receptor ELISA, RXR |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0233 |
Porcine Soluble adhesion molecules ELISA, Sam |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0266 |
Goat Soluble Leptin Receptor ELISA, SLR |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0290 |
Goat Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
715-Eur |
Blue Gene Biotech |
|
| E11L0297 |
Bovine Soluble Liver X Receptor ELISA, LXR |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0230 |
Porcine Soluble CD36 ELISA , sCD36 |
|
715-Eur |
Blue Gene Biotech |
|
| E02I0381 |
Rat Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
601-Eur |
BGene |
|
| E11I0366 |
Bovine Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
715-Eur |
Blue Gene Biotech |
|
| S01-021 |
Human BMP receptor_1A, soluble Source Insect cells |
100 µg |
272-Eur |
Reliatech |
recombinant |
| E07S0158 |
Porcine Soluble programmed death-1 ELISA, sPD-1 |
|
715-Eur |
Blue Gene Biotech |
|
| U0022r |
Rat soluble endothelial protein C receptor CLIA KI |
96T |
755-Eur |
EIAab |
recombinant |
| E07C0044 |
Porcine Soluble CD44s ELISA , sCD44s |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0253 |
Porcine Soluble Glucoprotein 130 ELISA , sGP130 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0233 |
Goat Soluble adhesion molecules ELISA, Sam |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0230 |
Goat Soluble CD36 ELISA , sCD36 |
|
715-Eur |
Blue Gene Biotech |
|
| S01-026 |
Mouse Lyve_1, soluble Source Insect cells |
5 µg |
102-Eur |
Reliatech |
mouse |
| E08S0233 |
Canine Soluble adhesion molecules ELISA, Sam |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0253 |
Canine Soluble Glucoprotein 130 ELISA , sGP130 |
|
715-Eur |
Blue Gene Biotech |
|
| S01-029 |
Human Lyve_1, soluble Source Insect cells |
25 µg |
272-Eur |
Reliatech |
human |
| E06L0297 |
Goat Soluble Liver X Receptor ELISA, LXR |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0230 |
Canine Soluble CD36 ELISA , sCD36 |
|
715-Eur |
Blue Gene Biotech |
|
| S01-028 |
Human Lyve_1, soluble Source Insect cells |
5 µg |
102-Eur |
Reliatech |
human |
| E01S0266 |
Human Soluble Leptin Receptor ELISA, SLR |
96 Tests/kit |
601-Eur |
BGene |
|
| E08S0266 |
Canine Soluble Leptin Receptor ELISA, SLR |
|
715-Eur |
Blue Gene Biotech |
|
| E06R0361 |
Goat Soluble Retinoid X Receptor ELISA, RXR |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0253 |
Bovine Soluble Glucoprotein 130 ELISA , sGP130 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0158 |
Goat Soluble programmed death-1 ELISA, sPD-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0233 |
Bovine Soluble adhesion molecules ELISA, Sam |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0230 |
Bovine Soluble CD36 ELISA , sCD36 |
|
715-Eur |
Blue Gene Biotech |
|
| U0074m |
Mouse soluble interleukin_2 receptor CLIA KIT |
96T |
739-Eur |
EIAab |
recombinant |
| E08S0158 |
Canine Soluble programmed death-1 ELISA, sPD-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E01S0290 |
Human Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
96 Tests/kit |
601-Eur |
BGene |
|
| 27998 |
Human soluble alpha_Klotho ELISA Kit (Available only in USA and Canada) |
96well |
779-Eur |
Sceti K.K. |
elisa |
| S01-039 |
Human 4_1BB receptor, soluble Source E. coli |
20 µg |
265-Eur |
Reliatech |
recombinant |
| E08L0297 |
Canine Soluble Liver X Receptor ELISA, LXR |
|
715-Eur |
Blue Gene Biotech |
|
| E11I0368 |
Bovine Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
715-Eur |
Blue Gene Biotech |
|
| E08F0265 |
Canine Soluble Farnesoid X receptor ELISA, FXR |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0290 |
Canine Soluble IL-1 Receptor 4_ST2 ELISA , ST2 |
|
715-Eur |
Blue Gene Biotech |
|
| E09C0044 |
Monkey Soluble CD44s ELISA , sCD44s |
|
715-Eur |
Blue Gene Biotech |
|
| E07C0053 |
Porcine Soluble CD 44v9 ELISA , SCD44V9 |
|
715-Eur |
Blue Gene Biotech |
|
| E07R0361 |
Porcine Soluble Retinoid X Receptor ELISA, RXR |
|
715-Eur |
Blue Gene Biotech |
|
| E07I0368 |
Porcine Soluble interleukin-1 receptor II ELISA, IL-1sR II |
|
715-Eur |
Blue Gene Biotech |
|
| E07I0366 |
Porcine Soluble interleukin-1 receptor ⅠELISA, IL-1sR Ⅰ |
|
715-Eur |
Blue Gene Biotech |
|
| E11C0053 |
Bovine Soluble CD 44v9 ELISA , SCD44V9 |
|
715-Eur |
Blue Gene Biotech |
|
| E13594m |
Mouse Isocitrate Dehydrogenase 1, Soluble ELISA ki |
96T |
739-Eur |
EIAab |
elisa |
| E08R0361 |
Canine Soluble Retinoid X Receptor ELISA, RXR |
|
715-Eur |
Blue Gene Biotech |
|
| E07I0378 |
Porcine Soluble Interleukin 2 recepter ELISA, IL-2sR |
|
715-Eur |
Blue Gene Biotech |
|
| E11C0044 |
Bovine Soluble CD44s ELISA , sCD44s |
|
715-Eur |
Blue Gene Biotech |
|
| CSB-E04736h |
Human tumor necrosis factor soluble receptor |
96tests |
837-Eur |
Cusabio |
recombinant |
| 102-PA19 |
Anti_Human, pab VEGFR_2_KDR (Peptide), soluble Source Rabbit |
200 µg |
317-Eur |
Reliatech |
polyclonal |
| E13C0044 |
Anserine anti - soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| U0111h |
Human Platelet_Derived Growth Factor Soluble Recep |
96T |
706-Eur |
EIAab |
recombinant |
| 8-GsLOX |
Soluble lectin_like oxidized LDL receptor (LOX_1) glycosylated |
100ug |
1242-Eur |
Advenced Immuno Chemical |
recombinant |
| CSB-E07438m |
Mouse soluble interleukin_2 receptor,sIL_2Rβ ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| S01-017S |
Human VEGFR_3_FLT_4, soluble Source Insect cells |
5 µg |
124-Eur |
Reliatech |
human |
| SFC-009 |
Human VEGFR_3_FLT_4_Fc Chimera, soluble Source Insect cells |
10 µg |
124-Eur |
Reliatech |
human |
| CSB-E04738h |
Human tumor necrosis factor soluble receptor |
96tests |
797-Eur |
Cusabio |
recombinant |
| CSB-E04737m |
Mouse tumor necrosis factor soluble receptor |
96tests |
837-Eur |
Cusabio |
recombinant |
| CSB-RP130944h |
Recombinant human Soluble calcium-activated nucleotidase 1 |
500ug |
782-Eur |
Cusabio |
|
| SFC-010 |
Human VEGFR_3_FLT_4_Fc Chimera, soluble Source Insect cells |
50 µg |
287-Eur |
Reliatech |
human |
| 2-sLOX1 |
Soluble lectin_like oxidized LDL receptor (LOX_1) antibody |
500ug |
565-Eur |
Advenced Immuno Chemical |
recombinant |
| E13F0103 |
Anserine anti - soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| 301COX005 |
Cox11, S.meliloti, recombinant, soluble domain (aa 36_198) |
1mg |
285-Eur |
ProtEra |
recombinant |
| 21399 |
Rat Soluble Cluster of differentiation 40 ligand(sCD40L) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| 23846 |
Rat Soluble Cluster of differentiation 30 ligand(sCD30L) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E11S0254 |
Bovine anti-soluble Factor-related Apoptosis |
96 Tests/kit |
1128-Eur |
BlueGen |
apoptosis |
| 301COX005 |
Cox11, S.meliloti, recombinant, soluble domain (aa 36_198) |
10mg |
2285-Eur |
ProtEra |
recombinant |
| CSB-E07449m |
Mouse soluble interleukin_1 receptor Ⅰ,IL_1sRⅠ ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| 103-PA19S |
Anti_Mouse, pab VEGFR_2_Flk_1 (Peptide), soluble Source Rabbit |
100 µg |
206-Eur |
Reliatech |
polyclonal |
| CSB-E07440m |
Mouse soluble interleukin_2 receptor,sIL_2Rα ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| E11S0249 |
Bovine anti-soluble endothelial protein C receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E11S0238 |
Bovine anti-soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| E11S0008 |
Bovine anti-Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| 301COP002 |
CopAb, B.subtilis, recombinant, soluble domain B (aa 73_147) |
1mg |
229-Eur |
ProtEra |
recombinant |
| E11S0258 |
Bovine anti-Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| CSB-E04699m |
Mouse platelet_derived growth factor soluble receptor |
96tests |
837-Eur |
Cusabio |
recombinant |
| AP15185CP-N |
Guanylate cyclase soluble GUCY1B3 Control Peptide |
0.1 mg |
154-Eur |
ACR |
|
| E0022m |
Mouse soluble endothelial protein C receptor ELISA |
96T |
739-Eur |
EIAab |
elisa |
| CSB-RP130994h |
Recombinant human Soluble calcium-activated nucleotidase 1 |
500ug |
782-Eur |
Cusabio |
|
| SL10033E |
Human Interleukin-2 Soluble Receptor alpha (IL-2 sRa) ELISpot Kit |
96 wells |
544-Eur |
Anogen |
|
| 103-PA19 |
Anti_Mouse, pab VEGFR_2_Flk_1 (Peptide), soluble Source Rabbit |
200 µg |
317-Eur |
Reliatech |
polyclonal |
| AP13761CP-N |
Guanylate cyclase soluble GUCY1A3 Control Peptide |
0.1 mg |
154-Eur |
ACR |
|
| CSB-E07447m |
Mouse soluble interleukin_1 receptor Ⅱ,IL_1sRⅡ ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| 301COP002 |
CopAb, B.subtilis, recombinant, soluble domain B (aa 73_147) |
10mg |
1836-Eur |
ProtEra |
recombinant |
| 8-GsLOX |
Soluble lectin_like oxidized LDL receptor (LOX_1) glycosylated |
50ug |
1079-Eur |
Advenced Immuno Chemical |
recombinant |
| CSB-E07395r |
Rat soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E08544m |
Mouse soluble cluster of differentiation 86,sCD86 ELISA Kit |
96T |
626-Eur |
Cusabio |
elisa |
| E07S0258 |
Porcine anti-Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| 201-12-0257 |
Human soluble Cluster of differentiation 86,sCD86 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E02A0223 |
Rat anti-soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| CSB-E09093h |
Human soluble Factor_related Apoptosis,sFAS_Apo_1 ELISA Kit |
96T |
662-Eur |
Cusabio |
elisa |
| E02C0053 |
Rat anti-soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E02C0209 |
Rat anti-soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| CSB-E09096h |
Human soluble cytokine receptor,sCKR ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E09100h |
Human soluble transferrin receptor,sTfR ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E09296h |
Human soluble cluster of differentiation 28,sCD28 ELISA Kit |
96T |
542-Eur |
Cusabio |
elisa |
| 201-12-0302 |
Human Soluble Cluster of differentiation 38,sCD38 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0274 |
human soluble cluster of differentiation 28,sCD28 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0304 |
Human Soluble Cluster of differentiation 21,sCD21 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0283 |
Human soluble cytokine receptor,sCKR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| CSB-E08542h |
Human soluble cluster of differentiation 86,sCD86 ELISA Kit |
96T |
447-Eur |
Cusabio |
elisa |
| E13S0258 |
Anserine anti - Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| CSB-E07396r |
Rat soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E07438m |
Mouse soluble interleukin_2 receptor,sIL_2Râ ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| CSB-E07440m |
Mouse soluble interleukin_2 receptor,sIL_2Rá ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| CSB-E07993r |
Rat Soluble Intercellular Adhesion Molecule 1,sICAM_1 ELISA Kit |
96T |
701-Eur |
Cusabio |
elisa |
| 201-12-0209 |
Human soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
96T |
476-Eur |
SunBT |
|
| E13S0008 |
Anserine anti - Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| 201-12-0206 |
Human soluble interleukin-2 receptor,IL-2sRα ELISA kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0208 |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0207 |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
476-Eur |
SunBT |
|
| E13S0238 |
Anserine anti - soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| 201-12-0227 |
Human soluble Interleukin 6 receptor,sIL-6R_CD126 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E13S0249 |
Anserine anti - soluble endothelial protein C receptor |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E13S0254 |
Anserine anti - soluble Factor-related Apoptosis |
96 Tests/kit |
1128-Eur |
BlueGen |
apoptosis |
| 201-12-0318 |
Human soluble cluster of differentiation 14,sCD14 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| CSB-E09882h |
Human soluble cluster of differentiation 21,sCD21 ELISA Kit |
96T |
447-Eur |
Cusabio |
elisa |
| CSB-E09884h |
Human soluble cluster of differentiation 38,sCD38 ELISA Kit |
96T |
626-Eur |
Cusabio |
elisa |
| E1158h |
Human soluble Tumor Necrosis Factorαreceptor ELIS |
96T |
706-Eur |
EIAab |
recombinant |
| E06S0008 |
Goat anti-Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CSB-E04611h |
Human soluble interleukin_1 receptor Ⅰ,IL_1sRⅠ ELISA kit |
96T |
683-Eur |
Cusabio |
elisa |
| E06S0238 |
Goat anti-soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| CSB-E04612h |
Human soluble interleukin_1 receptor Ⅱ,IL_1sRⅡ ELISA kit |
96T |
683-Eur |
Cusabio |
elisa |
| E06S0249 |
Goat anti-soluble endothelial protein C receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06S0254 |
Goat anti-soluble Factor-related Apoptosis |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| E06S0258 |
Goat anti-Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| 301COP002 |
CopAb, B.subtilis, recombinant, soluble domain B (aa 73_147) |
200ug |
160-Eur |
ProtEra |
recombinant |
| 301COX005 |
Cox11, S.meliloti, recombinant, soluble domain (aa 36_198) |
200ug |
199-Eur |
ProtEra |
recombinant |
| CSB-E04629h |
Human soluble interleukin_2 receptor,IL_2sRα ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| CSB-E04630h |
Human soluble interleukin_2 receptor,IL_2sRβ ELISA kit |
96T |
772-Eur |
Cusabio |
elisa |
| 2-sLOX1 |
Soluble lectin_like oxidized LDL receptor (LOX_1) antibody |
200ug |
433-Eur |
Advenced Immuno Chemical |
recombinant |
| E0963h |
Human soluble tumor necrosis factor receptor 1 ELI |
96T |
706-Eur |
EIAab |
recombinant |
| 201-12-0539 |
Human anti-soluble liver antigen,SLA ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E06F0103 |
Goat anti-soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| QY-E11239 |
Rat Soluble Cluster of differentiation 30 ligand(sCD30L)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| U1156h |
Human soluble fibrin monomer complex CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| U1155h |
Human soluble Factor_related Apoptosis ligand CLIA |
96T |
706-Eur |
EIAab |
apoptosis |
| CSB-E10364Rb |
Rabbit soluble Factor_related Apoptosis,sFAS_Apo_1 ELISA Kit |
96T |
972-Eur |
Cusabio |
elisa |
| CSB-E11157m |
Mouse soluble cluster of differentiation 30,sCD30 ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| RCYT-294B |
Recombinant Bovine Prolactin Soluble Receptor |
50 |
208-Eur |
SeraLab |
|
| CSB-E11336h |
Human soluble cluster of differentiation 146,sCD146 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| RCYT-294A |
Recombinant Bovine Prolactin Soluble Receptor |
10 |
100-Eur |
SeraLab |
|
| CSB-E13199h |
Human soluble cluster of differentiation 14(SCD14) ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| U0022h |
Human soluble endothelial protein C receptor CLIA |
96T |
706-Eur |
EIAab |
recombinant |
| U0132r |
Rat Tumor necrosis factor soluble receptor Ⅱ CLIA |
96T |
755-Eur |
EIAab |
recombinant |
| E06C0044 |
Goat anti-soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| U0131r |
Rat Tumor necrosis factor soluble receptor Ⅰ CLIA |
96T |
755-Eur |
EIAab |
recombinant |
| E07C0044 |
Porcine anti-soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CSB-E04739m |
Mouse tumor necrosis factor soluble receptor |
96tests |
837-Eur |
Cusabio |
recombinant |
| E0131r |
Rat Tumor necrosis factor soluble receptor Ⅰ ELIS |
96T |
755-Eur |
EIAab |
recombinant |
| SFC-017 |
Human FGFR_2_Fc Chimera, soluble Source Insect cells |
10 µg |
102-Eur |
Reliatech |
human |
| E0547h |
Human soluble Vascuolar cell adhesion molecule 1 E |
96T |
706-Eur |
EIAab |
human |
| E-EL-H1113 |
Human SOD1 (Superoxide Dismutase 1, Soluble) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| SFC-016 |
Human FGFR_1_Fc Chimera, soluble Source Insect cells |
50 µg |
228-Eur |
Reliatech |
human |
| SFC-015 |
Human FGFR_1_Fc Chimera, soluble Source Insect cells |
10 µg |
102-Eur |
Reliatech |
human |
| E0470h |
Human soluble receptor activator of nuclear factor |
96T |
706-Eur |
EIAab |
recombinant |
| E-EL-H1637 |
Human sCKR (Soluble Cytokine Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| S01-009 |
Human VEGFR_1_Flt_1 (native), soluble Source Insect cells |
5 µg |
124-Eur |
Reliatech |
human |
| E1818h |
Soluble Vascular Endothelial Growth Factor Recepto |
96T |
706-Eur |
EIAab |
recombinant |
| E-EL-H0033 |
Human CD14 (Soluble Cluster of Differentiation14) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| CSB-E10030h |
Human Soluble Endoglin,sENG_sCD105 ELISA Kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| CSB-E09921m |
Mouse Soluble Endoglin,ENG_sCD105 ELISA Kit SpeciesMouse |
96T |
959-Eur |
Cusabio |
|
| SFC-021 |
Human FGFR_4_Fc Chimera, soluble Source Insect cells |
10 µg |
102-Eur |
Reliatech |
human |
| SFC-020 |
Human FGFR_3_Fc Chimera, soluble Source Insect cells |
50 µg |
228-Eur |
Reliatech |
human |
| E0132h |
Human Tumor necrosis factor soluble receptor Ⅱ EL |
96T |
706-Eur |
EIAab |
recombinant |
| SFC-019 |
Human FGFR_3_Fc Chimera, soluble Source Insect cells |
10 µg |
102-Eur |
Reliatech |
human |
| SFC-018 |
Human FGFR_2_Fc Chimera, soluble Source Insect cells |
50 µg |
228-Eur |
Reliatech |
human |
| E1893h |
Human soluble vascular endothelial growth factor r |
96T |
706-Eur |
EIAab |
human |
| E1367h |
Human soluble vascular endothelial growth factor r |
96T |
706-Eur |
EIAab |
human |
| E-EL-H1646 |
Human sTfR1 (Soluble Transferrin Receptor1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| 21618 |
Mouse soluble Cluster of differentiation 86(sCD86) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| S01-M09 |
Mouse VEGFR_1_Flt_1 (native), soluble Source Insect cells |
5 µg |
124-Eur |
Reliatech |
mouse |
| E-EL-R0889 |
Rat SCD30L (Soluble Cluster of Differentiation 30 Ligand) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| 22076 |
Mouse Soluble Interleukin-1 Receptor Ⅰ(IL-1sRⅠ) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E-EL-R0890 |
Rat SCD40L (Soluble Cluster of Differentiation 40 Ligand) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R0891 |
Rat SCD86 (Soluble Cluster of Differentiation 41 Ligand) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R0892 |
Rat SEPCR (Soluble Endothelial Protein C Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-R0894 |
Rat sFAS_sAPO-1 (Soluble Factor-Related Apoptosis) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| S01-010 |
Human VEGFR_1_Flt_1 (native), soluble Source Insect cells |
20 µg |
206-Eur |
Reliatech |
human |
| C-03066 |
COTTON BLUE (Water Soluble) (C.I.No.42755) CAS: 28983-56-4 |
25 gm |
104-Eur |
Oxford Lab |
|
| MCA2765 |
MOUSE ANTI HUMAN LOX-1 (SOLUBLE)-MONOCLONAL ANTIBODY |
0.2 mg |
485-Eur |
AbD Serotec |
monoclonal |
| CSB-E07440m |
Mouse soluble interleukin-2 receptor,sIL-2Rα ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| MCA2766 |
MOUSE ANTI HUMAN LOX-1 (SOLUBLE)-MONOCLONAL ANTIBODY |
0.2 mg |
485-Eur |
AbD Serotec |
monoclonal |
| E-03668 |
EOSINE YELLOW WATER SOLUBLE (For Microscopy) (C.I.No.45380) CAS: |
500 gm |
152-Eur |
Oxford Lab |
|
| E-03668 |
EOSINE YELLOW WATER SOLUBLE (For Microscopy) (C.I.No.45380) CAS: |
100 gm |
115-Eur |
Oxford Lab |
|
| 20713 |
Human soluble CD40 Ligand(sCD40L) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| E-03668 |
EOSINE YELLOW WATER SOLUBLE (For Microscopy) (C.I.No.45380) |
25 gm |
105-Eur |
Oxford Lab |
|
| C-03066 |
COTTON BLUE (Water Soluble) (C.I.No.42755) CAS: 28983-56-4 |
100 gm |
113-Eur |
Oxford Lab |
|
| CSB-E11178r |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-E12752h |
Human soluble OX40L (sOX40L) ELISA kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| CSB-E14020h |
Human Soluble Interleukin-7 Receptor,sIL-7R ELISA Kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| SFC-013 |
Human TIE_2_Fc Chimera, soluble Source Insect cells |
20 µg |
124-Eur |
Reliatech |
human |
| E0022Rb |
Rabbit soluble endothelial protein C receptor ELIS |
96T |
839-Eur |
EIAab |
recombinant |
| S01-M42 |
TIE-1, soluble Mouse Host: Insect cells Tie1; TIE; tie-1; D430008P04Rik |
50 |
251-Eur |
Reliatech |
|
| SFC-014 |
Human TIE_2_Fc Chimera, soluble Source Insect cells |
100 µg |
272-Eur |
Reliatech |
human |
| gen14250 |
SPCS_HUMAN Soluble liver antigen ELISA tesk kit |
1 |
787-Eur |
Other suppliers |
elisa |
| CSB-E08543r |
Rat soluble Cluster of differentiation 86,sCD86 ELISA Kit SpeciesRat |
96T |
913-Eur |
Cusabio |
|
| 10-663-45153 |
Soluble CD4 Human - T-cell surface antigen T4_Leu-3 N_A |
0.002 mg |
161-Eur |
GenWay |
human |
| 10-663-45153 |
Soluble CD4 Human - T-cell surface antigen T4_Leu-3 N_A |
0.01 mg |
352-Eur |
GenWay |
human |
| SFC-022 |
Human FGFR_4_Fc Chimera, soluble Source Insect cells |
50 µg |
228-Eur |
Reliatech |
human |
| S01-M41 |
TIE-1, soluble Mouse Host: Insect cells Tie1; TIE; tie-1; D430008P04Rik |
10 |
114-Eur |
Reliatech |
|
| Q-07490 |
QUINOLINE YELLOW (Spirit Soluble ) (C.I.No 47000) CAS: 8004-92-0 |
100 gm |
194-Eur |
Oxford Lab |
|
| Q-07495 |
QUINOLINE YELLOW (Water Soluble ) (C.I.No 47005) CAS: 8004-92-0 |
25 gm |
126-Eur |
Oxford Lab |
|
| Q-07495 |
QUINOLINE YELLOW (Water Soluble ) (C.I.No 47005) CAS: 8004-92-0 |
100 gm |
194-Eur |
Oxford Lab |
|
| Q-07490 |
QUINOLINE YELLOW (Spirit Soluble ) (C.I.No 47000) CAS: 8004-92-0 |
25 gm |
127-Eur |
Oxford Lab |
|
| E0547Rb |
Rabbit soluble Vascuolar cell adhesion molecule 1 |
96T |
839-Eur |
EIAab |
polyclonal |
| S01-060 |
DLL-1, soluble Human Host: HEK 293 cells DLL1; DL1; Delta; DELTA1 |
25 |
232-Eur |
Reliatech |
|
| SFC-011 |
Human TIE_1_Fc Chimera, soluble Source Insect cells |
20 µg |
124-Eur |
Reliatech |
human |
| SFC-012 |
Human TIE_1_Fc Chimera, soluble Source Insect cells |
100 µg |
272-Eur |
Reliatech |
human |
| CSB-EL022397RA |
Rat superoxide dismutase 1, soluble (SOD1) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| 10-663-45153 |
Soluble CD4 Human - T-cell surface antigen T4_Leu-3 N_A |
1 mg |
14466-Eur |
GenWay |
human |
| N002939 |
Huile soluble 250x26CARD-T1-P18 _ AC Signs;Pack-CARD; |
4 Pcs Per Pack |
11-Eur |
Brady |
|
| N002938 |
Huile soluble 250x26CARD-T1-P19 _ AC Signs;Pack-CARD; |
4 Pcs Per Pack |
11-Eur |
Brady |
|
| N-06305 |
NIGROSINE (C.I.No. 50415) (Spirit Soluble) (For Microscopy) CAS: 8005-02-5 |
25 gm |
104-Eur |
Oxford Lab |
|
| N003039 |
Huile soluble 355x37CARD-T1-P18 _ AC Signs;Pack-CARD; |
3 Pcs Per Pack |
11-Eur |
Brady |
|
| CSB-E14264h |
Human soluble CD23(sCD23) ELISA Kit SpeciesHuman |
96T |
714-Eur |
Cusabio |
|
| CSB-E14261h |
Human Thymidine Kinase 1,Soluble(TK1) ELISA Kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| N003139 |
Huile soluble 450x52CARD-T1-P18 _ AC Signs;Pack-CARD; |
2 Pcs Per Pack |
9-Eur |
Brady |
|
| CSB-E14050h |
Human soluble CD163(sCD163) ELISA Kit SpeciesHuman |
96T |
806-Eur |
Cusabio |
|
| N002840 |
Huile soluble 150x12CARD-T1-P18 _ AC Signs;Pack-CARD; |
5 Pcs Per Pack |
9-Eur |
Brady |
|
| N-06305 |
NIGROSINE (C.I.No. 50415) (Spirit Soluble) (For Microscopy) CAS: 8005-02-5 |
100 gm |
112-Eur |
Oxford Lab |
|
| CSB-EL022397PI |
Pig superoxide dismutase 1, soluble (SOD1) ELISA kit SpeciesPig |
96T |
913-Eur |
Cusabio |
|
| CSB-E15888h |
Human Soluble Toll-like Receptor 6(TLR-6) ELISA Kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-E14285h |
Human Soluble CD276,sCD276_sB7-H3 ELISA Kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| ELI-6229 |
soluble E-Selectin human direct ELISA without CE mark |
96 Wells |
1023-Eur |
Nal |
elisa |
| N-06307 |
NIGROSINE (Water Soluble) (C.I.No.50420) (For Microscopy) CAS: 8005-03-6 |
100 gm |
112-Eur |
Oxford Lab |
|
| ELI-6228 |
soluble L-Selectin human direct ELISA without CE mark |
96 Wells |
1023-Eur |
Nal |
elisa |
| ELI-6230 |
soluble P-Selectin human direct ELISA without CE mark |
96 Wells |
1023-Eur |
Nal |
elisa |
| N-06307 |
NIGROSINE (Water Soluble) (C.I.No.50420) (For Microscopy) CAS: 8005-03-6 |
25 gm |
104-Eur |
Oxford Lab |
|
| CSB-E07313r |
Rat soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| S01-M10 |
Mouse VEGFR_1_Flt_1 (native), soluble Source Insect cells |
20 µg |
206-Eur |
Reliatech |
mouse |
| 102-PA19S |
Anti_Human, pab VEGFR_2_KDR (Peptide), soluble Source Rabbit |
100 µg |
206-Eur |
Reliatech |
polyclonal |
| E0755m |
Mouse soluble myosin heavy chain 2 ELISA Kit |
96T |
739-Eur |
EIAab |
elisa |
| E0754h |
Human soluble myosin heavy chain 1 ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| 67763-24-0 |
Bromocresol green sodium salt Water soluble |
1g |
----Eur |
chemotra |
|
| E0754m |
Mouse soluble myosin heavy chain 1 ELISA Kit |
96T |
739-Eur |
EIAab |
elisa |
| S01-004 |
Human VEGFR_2_KDR (native), soluble Source Insect cells |
20 µg |
399-Eur |
Reliatech |
human |
| E0312h |
Human Soluble Mesothelin Related Peptide Kit ELISA |
96T |
706-Eur |
EIAab |
elisa |
| E0312m |
Mouse Soluble Mesothelin Related Peptide Kit ELIS |
96T |
739-Eur |
EIAab |
assays |
| A-00905 |
ANILINE BLUE (C.I.No 42775) (Water Soluble) CAS: 28983-56-4 |
100 gm |
121-Eur |
Oxford Lab |
|
| P4056Rb |
Rabbit anti_Tumor necrosis factor soluble receptor |
40ug/0.2ml |
592-Eur |
EIAab |
recombinant |
| CSB-E08542h |
Human soluble cluster of differentiation 86,sCD86 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E09296h |
Human soluble cluster of differentiation 28,sCD28 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E09100h |
Human soluble transferrin receptor,sTfR ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| E0906m |
Mouse soluble platelet endothelial cell adhesion m |
96T |
739-Eur |
EIAab |
mouse |
| CSB-E09096h |
Human soluble cytokine receptor,sCKR ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E09093h |
Human soluble Factor_related Apoptosis,sFAS_Apo_1 ELISA Kit |
96tests |
602-Eur |
Cusabio |
elisa |
| P3747Rb |
Rabbit anti_ Soluble protein_100 polyclonal Antibo |
40ug/0.2ml |
592-Eur |
EIAab |
polyclonal |
| CSB-E08544m |
Mouse soluble cluster of differentiation 86,sCD86 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| P3760Rb |
Rabbit anti_ soluble interleukin_2 receptor polyc |
40ug/0.2ml |
592-Eur |
EIAab |
recombinant |
| S01-M03 |
Mouse VEGFR_2_Flk_1 (native), soluble Source Insect cells |
5 µg |
176-Eur |
Reliatech |
mouse |
| A-00905 |
ANILINE BLUE (C.I.No 42775) (Water Soluble) CAS: 28983-56-4 |
25 gm |
106-Eur |
Oxford Lab |
|
| Y059685 |
Anti-Soluble Lectin-like Oxidized LDL Receptor (LOX-1) Antibody |
100ug |
495-Eur |
ABM Goods |
recombinant |
| C26225 |
m_Cresol Purple sodium salt (water soluble) |
100 G |
353-Eur |
pfalslandbauer. |
|
| Y059689 |
Anti-Human Soluble Transferrin Receptor Antibody |
100ug |
495-Eur |
ABM Goods |
recombinant |
| E0139h |
Human soluble tumor necrosis factor_related apopto |
96T |
706-Eur |
EIAab |
human |
| E0111h |
Human Platelet_Derived Growth Factor Soluble Recep |
96T |
706-Eur |
EIAab |
recombinant |
| SFC-008 |
Human VEGFR_2_KDR_Fc Chimera, soluble Source Insect cells |
50 µg |
228-Eur |
Reliatech |
human |
| CSB-E06859b |
Bovine soluble cluster of differentiation 86,sCD86 ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| E1818m |
Mouse Soluble Vascular Endothelial Growth Factor R |
96T |
739-Eur |
EIAab |
mouse |
| CSB-E07395r |
Rat soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E07396r |
Rat soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E07993r |
Rat Soluble Intercellular Adhesion Molecule 1,sICAM_1 ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| A-00904 |
ANILINE BLUE (C.I.No 42775) (Spirit Soluble) CAS: 28631-66-5 |
500 gm |
282-Eur |
Oxford Lab |
|
| A-00904 |
ANILINE BLUE (C.I.No 42775) (Spirit Soluble) CAS: 28631-66-5 |
100 gm |
160-Eur |
Oxford Lab |
|
| S01-M04 |
Mouse VEGFR_2_Flk_1 (native), soluble Source Insect cells |
20 µg |
399-Eur |
Reliatech |
mouse |
| A-00904 |
ANILINE BLUE (C.I.No 42775) (Spirit Soluble) CAS: 28631-66-5 |
25 gm |
121-Eur |
Oxford Lab |
|
| SFC-007 |
Human VEGFR_2_KDR_Fc Chimera, soluble Source Insect cells |
10 µg |
102-Eur |
Reliatech |
human |
| E1155h |
Human soluble Factor_related Apoptosis ligand ELIS |
96T |
706-Eur |
EIAab |
apoptosis |
| Y059630 |
Anti-soluble CD40 ligand (sCD40L) Antibody |
100ug |
495-Eur |
ABM Goods |
|
| E1367p |
Porcine soluble vascular endothelial growth factor |
96T |
839-Eur |
EIAab |
porcine |
| S01-003 |
Human VEGFR_2_KDR (native), soluble Source Insect cells |
5 µg |
176-Eur |
Reliatech |
human |
| E0964h |
Human soluble tumor necrosis factor receptor 2 ELI |
96T |
706-Eur |
EIAab |
recombinant |
| E-EL-P0386 |
Porcine sCKR (Soluble Cytokine Receptor) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| SFC-006 |
Human VEGFR_1_Flt_1(D7)_Fc Chimera, soluble Source Insect cells |
50 µg |
228-Eur |
Reliatech |
human |
| 102-PA21S |
Anti_Human, pab VEGFR_1_Flt_1 (Peptide), soluble Source Rabbit |
100 µg |
206-Eur |
Reliatech |
polyclonal |
| 102-PA21 |
Anti_Human, pab VEGFR_1_Flt_1 (Peptide), soluble Source Rabbit |
200 µg |
317-Eur |
Reliatech |
polyclonal |
| E-EL-P1130 |
Porcine CD14 (Soluble Cluster of Differentiation14) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-P2185 |
Porcine SOD1 (Superoxide Dismutase 1, Soluble) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-P2224 |
Porcine sTfR1 (Soluble Transferrin Receptor1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-Ch0866 |
Chicken sTfR1 (Soluble Transferrin Receptor1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-M1077 |
Mouse IL-2sRβ_CD122 (Soluble Interleukin-2 Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| B20038 |
Bromocresol purple sodium salt water soluble |
500 G |
415-Eur |
pfalslandbauer |
|
| SFC-005 |
Human VEGFR_1_Flt_1(D7)_Fc Chimera, soluble Source Insect cells |
10 µg |
102-Eur |
Reliatech |
human |
| B20038 |
Bromocresol purple sodium salt water soluble |
25 G |
129-Eur |
pfalslandbauer |
|
| E-EL-M1069 |
Mouse sCD30 (Soluble Cluster of Differentiation 30) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-M1071 |
Mouse sCD86 (Soluble Cluster of differentiation 86) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| B20038 |
Bromocresol purple sodium salt water soluble |
100 G |
173-Eur |
pfalslandbauer |
|
| E-EL-M1074 |
Mouse IL-1sRⅠ (Soluble Interleukin-1 Receptor Ⅰ) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-M1075 |
Mouse IL-1sRⅡ (Soluble Interleukin-1 Receptor Ⅱ) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-M1076 |
Mouse IL-2sRα_CD25 (Soluble Interleukin-2 Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E0022h |
Human soluble endothelial protein C receptor ELISA |
96T |
706-Eur |
EIAab |
elisa |
| E-EL-Ch1067 |
Chicken sCKR (Soluble Cytokine Receptor) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E0131m |
Mouse Tumor necrosis factor soluble receptor Ⅰ EL |
96T |
739-Eur |
EIAab |
recombinant |
| E0547m |
Mouse soluble Vascuolar cell adhesion molecule 1 E |
96T |
739-Eur |
EIAab |
mouse |
| E0139m |
Mouse soluble tumor necrosis factor_related apopto |
96T |
739-Eur |
EIAab |
mouse |
| E0470m |
Mouse soluble receptor activator of nuclear factor |
96T |
739-Eur |
EIAab |
recombinant |
| E0906h |
Human soluble platelet endothelial cell adhesion m |
96T |
706-Eur |
EIAab |
human |
| CSB-E09884h |
Human soluble cluster of differentiation 38,sCD38 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E09882h |
Human soluble cluster of differentiation 21,sCD21 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| E0111m |
Mouse Platelet_Derived Growth Factor Soluble Recep |
96T |
739-Eur |
EIAab |
recombinant |
| E0132m |
Mouse Tumor necrosis factor soluble receptor Ⅱ EL |
96T |
739-Eur |
EIAab |
recombinant |
| 22078 |
Mouse Soluble Interleukin-1 Receptor Ⅱ(IL-1sRⅡ) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E-EL-Ch1527 |
Chicken CD14 (Soluble Cluster of Differentiation14) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-Ch1589 |
Chicken SOD1 (Superoxide Dismutase 1, Soluble) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| 201-12-0206 |
Human soluble interleukin-2 receptor(IL-2sRα)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E-EL-MK1370 |
Monkey sTfR1 (Soluble Transferrin Receptor1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E0547Mo |
Monkey soluble Vascuolar cell adhesion molecule 1 |
96T |
839-Eur |
EIAab |
|
| E1156h |
Human soluble fibrin monomer complex ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E0547p |
Porcine soluble Vascuolar cell adhesion molecules |
96T |
839-Eur |
EIAab |
porcine |
| E1367m |
Mouse soluble vascular endothelial growth factor r |
96T |
739-Eur |
EIAab |
mouse |
| E0132r |
Rat Tumor necrosis factor soluble receptor Ⅱ ELIS |
96T |
755-Eur |
EIAab |
recombinant |
| E07S0254 |
Porcine anti-soluble Factor-related Apoptosis |
96 Tests/kit |
1101-Eur |
BlueGen |
apoptosis |
| cyt-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor tPrl R |
5 |
100-Eur |
Prospecbio |
|
| 228-11311-2 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
50 |
290-Eur |
Ray Biotech |
recombinant |
| 228-11311-1 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
10 |
201-Eur |
Ray Biotech |
recombinant |
| RCYT-670A |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
2 µg |
117-Eur |
LeeBio |
recombinant |
| RCYT-670B |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
10 µg |
226-Eur |
LeeBio |
recombinant |
| RCYT-670C |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
1 mg |
6721-Eur |
LeeBio |
recombinant |
| RCYT-334B |
Recombinant Human Soluble RANK Ligand |
10µg |
234-Eur |
SeraLab |
recombinant |
| CK-E10028 |
Human Soluble Cluster of differentiation 21,sCD21 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| CK-E10027 |
Human Soluble Cluster of differentiation 38,sCD38 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| 228-11311-3 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
1 mg |
2068-Eur |
Ray Biotech |
recombinant |
| RCYT-631C |
Recombinant Human Soluble RANK Ligand, GST Tag |
1 mg |
7992-Eur |
LeeBio |
recombinant |
| RCYT-320C |
Recombinant Mouse Soluble RANK Ligand |
1mg |
6235-Eur |
SeraLab |
recombinant |
| RCYT-334A |
Recombinant Human Soluble RANK Ligand |
2µg |
127-Eur |
SeraLab |
recombinant |
| RCYT-631A |
Recombinant Human Soluble RANK Ligand, GST Tag |
2 µg |
117-Eur |
LeeBio |
recombinant |
| CK-E10056 |
Human soluble cytokine receptor,sCKR ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| CK-E10050 |
human soluble cluster of differentiation 28,sCD28 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| 228-11356-2 |
Recombinant Human Soluble RANK Ligand, GST fusion |
10 |
290-Eur |
Ray Biotech |
recombinant |
| 228-11356-1 |
Recombinant Human Soluble RANK Ligand, GST fusion |
2 |
201-Eur |
Ray Biotech |
recombinant |
| RCYT-631B |
Recombinant Human Soluble RANK Ligand, GST Tag |
10 µg |
226-Eur |
LeeBio |
recombinant |
| RCYT-334C |
Recombinant Human Soluble RANK Ligand |
1mg |
6472-Eur |
SeraLab |
recombinant |
| RCYT-472A |
Recombinant Mouse soluble CD40 Ligand_TRAP |
5µg |
127-Eur |
SeraLab |
recombinant |
| CSB-E04739m |
Mouse tumor necrosis factor soluble receptor |
96tests |
896-Eur |
Cusabio |
recombinant |
| 201-02-0294 |
Mouse soluble Cluster of differentiation 86(sCD86)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| CSB-E06859b |
Bovine soluble cluster of differentiation 86,sCD86 ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| 201-02-0230 |
Mouse soluble interleukin-2 receptor(IL-2sRα)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| OETCGF589 |
Soluble Interleukin-2 Receptor alpha Human Recombinant, GST tag |
5 |
291-Eur |
OET |
|
| CSB-E07313r |
Rat soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| CSB-E07395r |
Rat soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E07396r |
Rat soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E04738h |
Human tumor necrosis factor soluble receptor |
96tests |
856-Eur |
Cusabio |
recombinant |
| CSB-E04737m |
Mouse tumor necrosis factor soluble receptor |
96tests |
896-Eur |
Cusabio |
recombinant |
| 201-02-0566 |
Mouse soluble interleukin-2 receptor(IL-2sRβ)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| 201-12-0257 |
Human soluble Cluster of differentiation 86,sCD86 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| RCYT-472B |
Recombinant Mouse soluble CD40 Ligand_TRAP |
25µg |
234-Eur |
SeraLab |
recombinant |
| RCYT-472C |
Recombinant Mouse soluble CD40 Ligand_TRAP |
1mg |
3751-Eur |
SeraLab |
recombinant |
| CSB-E04629h |
Human soluble interleukin_2 receptor,IL_2sRá ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E04630h |
Human soluble interleukin_2 receptor,IL_2sRâ ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E04698h |
rowth factor soluble receptor á,PDGFsR_á ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E04736h |
Human tumor necrosis factor soluble receptor |
96tests |
896-Eur |
Cusabio |
recombinant |
| RCYT-320B |
Recombinant Mouse Soluble RANK Ligand |
10µg |
234-Eur |
SeraLab |
recombinant |
| DS-MB-01418 |
Mouse Anti-Guanylate Cyclase alpha-1 (Soluble) |
200 |
516-Eur |
Ray Biotech |
mouse |
| RCYT-472C |
Recombinant Mouse soluble CD40 Ligand_TRAP |
1 mg |
3821-Eur |
LeeBio |
recombinant |
| E01S0249 |
Human Anti-soluble endothelial protein C receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| RCYT-245B |
Recombinant Human soluble CD40 Ligand_TRAP |
50 µg |
226-Eur |
LeeBio |
recombinant |
| E01S0238 |
Human Anti-soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| RCYT-245C |
Recombinant Human soluble CD40 Ligand_TRAP |
1 mg |
2014-Eur |
LeeBio |
recombinant |
| RCYT-268A |
Recombinant Rabbit Prolactin Soluble Receptor |
10 µg |
117-Eur |
LeeBio |
recombinant |
| RCYT-268B |
Recombinant Rabbit Prolactin Soluble Receptor |
50 µg |
226-Eur |
LeeBio |
recombinant |
| RCYT-268C |
Recombinant Rabbit Prolactin Soluble Receptor |
1 mg |
1934-Eur |
LeeBio |
recombinant |
| E01S0008 |
Human Anti-Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E01S0250 |
Human Anti-soluble Amyloid Precursor Protein β |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| RCYT-245A |
Recombinant Human soluble CD40 Ligand_TRAP |
10 µg |
117-Eur |
LeeBio |
recombinant |
| CK-E10286 |
Human soluble transferrin receptor,sTfR ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| CK-E10149 |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
728-Eur |
Eastbio |
|
| CK-E10148 |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
96T |
728-Eur |
Eastbio |
|
| CK-E10145 |
Human soluble interleukin-2 receptor,IL-2sRα ELISA kit |
96T |
728-Eur |
Eastbio |
|
| CK-E10075 |
Human soluble Cluster of differentiation 86,sCD86 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| E09S0291 |
Monkey Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
622-Eur |
BGene |
|
| E01S0258 |
Human Anti-Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| E01S0254 |
Human Anti-soluble Factor-related Apoptosis |
96 Tests/kit |
1087-Eur |
BlueGen |
apoptosis |
| RCYT-293A |
Recombinant Ovine Prolactin Soluble Receptor |
10 µg |
117-Eur |
LeeBio |
recombinant |
| RCYT-293B |
Recombinant Ovine Prolactin Soluble Receptor |
50 µg |
226-Eur |
LeeBio |
recombinant |
| E01C0044 |
Human Anti-soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| RCYT-334C |
Recombinant Human Soluble RANK Ligand |
1 mg |
6602-Eur |
LeeBio |
recombinant |
| RCYT-472A |
Recombinant Mouse soluble CD40 Ligand_TRAP |
5 µg |
117-Eur |
LeeBio |
recombinant |
| K24005R |
Fibrinogen, Oxidized (Soluble Fraction)Rabbit Neat |
20uL |
157-Eur |
Meridian Life Science |
|
| RCYT-472B |
Recombinant Mouse soluble CD40 Ligand_TRAP |
25 µg |
226-Eur |
LeeBio |
recombinant |
| RCYT-334B |
Recombinant Human Soluble RANK Ligand |
10 µg |
226-Eur |
LeeBio |
recombinant |
| E01F0103 |
Human Anti-soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| RCYT-293C |
Recombinant Ovine Prolactin Soluble Receptor |
1 mg |
1934-Eur |
LeeBio |
recombinant |
| RCYT-294A |
Recombinant Bovine Prolactin Soluble Receptor |
10 µg |
117-Eur |
LeeBio |
recombinant |
| RCYT-294B |
Recombinant Bovine Prolactin Soluble Receptor |
50 µg |
226-Eur |
LeeBio |
recombinant |
| RCYT-294C |
Recombinant Bovine Prolactin Soluble Receptor |
1 mg |
1934-Eur |
LeeBio |
recombinant |
| RCYT-320A |
Recombinant Mouse Soluble RANK Ligand |
2 µg |
117-Eur |
LeeBio |
recombinant |
| RCYT-320B |
Recombinant Mouse Soluble RANK Ligand |
10 µg |
226-Eur |
LeeBio |
recombinant |
| RCYT-320C |
Recombinant Mouse Soluble RANK Ligand |
1 mg |
6602-Eur |
LeeBio |
recombinant |
| RCYT-334A |
Recombinant Human Soluble RANK Ligand |
2 µg |
117-Eur |
LeeBio |
recombinant |
| E01S0290 |
Human Anti-Soluble IL-1 Receptor 4_ST2 (sIL-1R4_ST2) |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CSB-E07438m |
Mouse soluble interleukin_2 receptor,sIL_2Râ ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| cyt-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor tPrl R |
1mg |
3260-Eur |
Prospecbio |
|
| U1367m |
Mouse soluble vascular endothelial growth factor r |
96T |
739-Eur |
EIAab |
mouse |
| U0132h |
Human Tumor necrosis factor soluble receptor Ⅱ CL |
96T |
706-Eur |
EIAab |
recombinant |
| U1818m |
Mouse Soluble Vascular Endothelial Growth Factor R |
96T |
739-Eur |
EIAab |
mouse |
| U0139m |
Mouse soluble tumor necrosis factor_related apopto |
96T |
739-Eur |
EIAab |
mouse |
| cyt-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor tPrl R |
20 |
175-Eur |
Prospecbio |
|
| U0312m |
Mouse Soluble Mesothelin Related Peptide Kit CLIA |
96T |
739-Eur |
EIAab |
assays |
| U0470m |
Mouse soluble receptor activator of nuclear factor |
96T |
739-Eur |
EIAab |
recombinant |
| U0906m |
Mouse soluble platelet endothelial cell adhesion m |
96T |
739-Eur |
EIAab |
mouse |
| 228-10196-1 |
Recombinant Human soluble CD40 Ligand _ TRAP |
10 |
201-Eur |
Ray Biotech |
recombinant |
| 228-10196-2 |
Recombinant Human soluble CD40 Ligand _ TRAP |
50 |
290-Eur |
Ray Biotech |
recombinant |
| U0547m |
Mouse soluble Vascuolar cell adhesion molecule 1 C |
96T |
739-Eur |
EIAab |
mouse |
| U0547h |
Human soluble Vascuolar cell adhesion molecule 1 C |
96T |
706-Eur |
EIAab |
human |
| 228-10915-2 |
Recombinant Human Soluble Interleukin-2 Receptor alpha (IL-2R) |
25 |
290-Eur |
Ray Biotech |
recombinant |
| 228-10915-1 |
Recombinant Human Soluble Interleukin-2 Receptor alpha (IL-2R) |
5 |
201-Eur |
Ray Biotech |
recombinant |
| 228-10197-3 |
Recombinant Mouse soluble CD40 Ligand _ TRAP |
1 mg |
3681-Eur |
Ray Biotech |
recombinant |
| 228-10197-2 |
Recombinant Mouse soluble CD40 Ligand _ TRAP |
25 |
290-Eur |
Ray Biotech |
recombinant |
| 228-10197-1 |
Recombinant Mouse soluble CD40 Ligand _ TRAP |
5 |
201-Eur |
Ray Biotech |
recombinant |
| 228-10196-3 |
Recombinant Human soluble CD40 Ligand _ TRAP |
1 mg |
2068-Eur |
Ray Biotech |
recombinant |
| U0755m |
Mouse soluble myosin heavy chain 2 CLIA KIT |
96T |
739-Eur |
EIAab |
assays |
| U0754m |
Mouse soluble myosin heavy chain 1 CLIA KIT |
96T |
739-Eur |
EIAab |
assays |
| 27870 |
Mouse Soluble Cluster of differentiation 21(sCD21) ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
650-Eur |
TEFL |
|
| 27869 |
Mouse Soluble Cluster of differentiation 44 (sCD44)Elisa kit |
100ng/ml-1.56ng/ml <0.5ng/ml |
650-Eur |
TEFL |
|
| B20038 |
Bromocresol purple sodium salt (water soluble) |
25 G |
123-Eur |
pfalslandbauer. |
|
| B20038 |
Bromocresol purple sodium salt (water soluble) |
100 G |
167-Eur |
pfalslandbauer. |
|
| B20038 |
Bromocresol purple sodium salt (water soluble) |
500 G |
406-Eur |
pfalslandbauer. |
|
| E9377h |
Human Lectin Galactoside Binding, Soluble 3 Bindin |
96T |
706-Eur |
EIAab |
human |
| C26225 |
m_Cresol Purple sodium salt (water soluble) |
5 G |
124-Eur |
pfalslandbauer. |
|
| C26225 |
m_Cresol Purple sodium salt (water soluble) |
25 G |
173-Eur |
pfalslandbauer. |
|
| OETCGF285 |
Interleukin-2 alpha Soluble Receptor Human Recombinant |
25 |
171-Eur |
OET |
|
| RD194011100 |
ELISA Human , soluble Transferrin Receptor (sTfR) |
96 wells (1 kit) |
361-Eur |
Biovendor |
|
| U0111m |
Mouse Platelet_Derived Growth Factor Soluble Recep |
96T |
739-Eur |
EIAab |
recombinant |
| 62625-21-2 |
Thymol blue, sodium salt Water soluble |
1g |
----Eur |
chemotra |
|
| Y061148 |
Monoclonal Anti_Interleukin_4 Soluble Receptor produced in mouse |
100ug |
965-Eur |
ABM Goods |
recombinant |
| U0022m |
Mouse soluble endothelial protein C receptor CLIA |
96T |
739-Eur |
EIAab |
recombinant |
| Y061156 |
Monoclonal Anti_Interleukin_2 Soluble Receptor γ produced in mouse |
100ug |
965-Eur |
ABM Goods |
recombinant |
| Y061158 |
Monoclonal Anti_Interleukin_2 Soluble Receptor β produced in mouse |
100ug |
965-Eur |
ABM Goods |
recombinant |
| Y061160 |
Monoclonal Anti_Interleukin_2 Soluble Receptor β produced in mouse |
100ug |
965-Eur |
ABM Goods |
recombinant |
| 27871 |
Mouse soluble cluster of differentiation 28(sCD28)ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
650-Eur |
TEFL |
|
| U0131m |
Mouse Tumor necrosis factor soluble receptor Ⅰ CL |
96T |
739-Eur |
EIAab |
recombinant |
| CSB-E13199h |
Human soluble cluster of differentiation 14(SCD14) ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| U1893h |
Human soluble vascular endothelial growth factor r |
96T |
706-Eur |
EIAab |
human |
| RCYT-670A |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
2µg |
127-Eur |
SeraLab |
recombinant |
| 33382 |
Rabbit Soluble Cluster of differentiation 38(sCD38) ELISA KIT |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| 33380 |
Rabbit soluble cluster of differentiation 28(sCD28)ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
750-Eur |
TEFL |
|
| 33379 |
Rabbit Soluble Cluster of differentiation 21(sCD21) ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
750-Eur |
TEFL |
|
| 33378 |
Rabbit Soluble Cluster of differentiation 44 (sCD44)Elisa kit |
100ng/ml-1.56ng/ml <0.5ng/ml |
750-Eur |
TEFL |
|
| RCYT-670B |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
10µg |
234-Eur |
SeraLab |
recombinant |
| CSB-E08542h |
Human soluble cluster of differentiation 86,sCD86 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| RCYT-670C |
Recombinant Human soluble CD40 Ligand_TRAP His Tag |
1mg |
6589-Eur |
SeraLab |
recombinant |
| 33383 |
Rabbit soluble Cluster of differentiation 86(sCD86) ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
750-Eur |
TEFL |
|
| RCYT-631C |
Recombinant Human Soluble RANK Ligand, GST Tag |
1mg |
7833-Eur |
SeraLab |
recombinant |
| CSB-E07440m |
Mouse soluble interleukin_2 receptor,sIL_2Rá ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| 201-02-0108 |
Mouse soluble interleukin-1 receptor Ⅰ(IL-1sRⅠ)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| RCYT-631A |
Recombinant Human Soluble RANK Ligand, GST Tag |
2µg |
127-Eur |
SeraLab |
recombinant |
| RCYT-631B |
Recombinant Human Soluble RANK Ligand, GST Tag |
10µg |
234-Eur |
SeraLab |
recombinant |
| CSB-E07993r |
Rat Soluble Intercellular Adhesion Molecule 1,sICAM_1 ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| AGHIV-0245 |
rHIV p24, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
278-Eur |
Arista |
|
| AGHIV-0245 |
rHIV p24, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
252-Eur |
Arista |
|
| AGHIV-0245 |
rHIV p24, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
226-Eur |
Arista |
|
| CSB-E08544m |
Mouse soluble cluster of differentiation 86,sCD86 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| 31317 |
Porcine soluble Cluster of differentiation 86(sCD86) ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
750-Eur |
TEFL |
|
| 27873 |
Mouse soluble Cluster of differentiation 86(sCD86) ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
650-Eur |
TEFL |
|
| 27872 |
Mouse Soluble Cluster of differentiation 38(sCD38) ELISA KIT |
20ng/ml-0.312ng/ml <0.06ng/ml |
650-Eur |
TEFL |
|
| U1818h |
Human Soluble Vascular Endothelial Growth Factor R |
96T |
706-Eur |
EIAab |
human |
| U0132m |
Mouse Tumor necrosis factor soluble receptor Ⅱ CL |
96T |
739-Eur |
EIAab |
recombinant |
| CSB-E10364Rb |
Rabbit soluble Factor_related Apoptosis,sFAS_Apo_1 ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| U1367h |
Human soluble vascular endothelial growth factor r |
96T |
706-Eur |
EIAab |
human |
| CSB-E11157m |
Mouse soluble cluster of differentiation 30,sCD30 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E11336h |
Human soluble cluster of differentiation 146,sCD146 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| 31312 |
Porcine Soluble Cluster of differentiation CD 44 (sCD44)Elisa kit |
100ng/ml-1.56ng/ml <0.5ng/ml |
750-Eur |
TEFL |
|
| CSB-E09884h |
Human soluble cluster of differentiation 38,sCD38 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E09093h |
Human soluble Factor_related Apoptosis,sFAS_Apo_1 ELISA Kit |
96tests |
662-Eur |
Cusabio |
elisa |
| CSB-E09096h |
Human soluble cytokine receptor,sCKR ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E09100h |
Human soluble transferrin receptor,sTfR ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E09296h |
Human soluble cluster of differentiation 28,sCD28 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| 31316 |
Porcine Soluble Cluster of differentiation 38(sCD38) ELISA KIT |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| 31314 |
Porcine soluble cluster of differentiation 28(sCD28)ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
750-Eur |
TEFL |
|
| 31313 |
Porcine Soluble Cluster of differentiation 21(sCD21) ELISA KIT |
50ng/ml-0.78ng/ml <0.08ng/ml |
750-Eur |
TEFL |
|
| CSB-E09882h |
Human soluble cluster of differentiation 21,sCD21 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| 201-02-0143 |
Mouse soluble cluster of differentiation 30(sCD30)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| E04S0238 |
Rabbit anti-soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| QY-E21378 |
Mouse soluble interleukin-2 receptor(IL-2sRβ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21377 |
Mouse soluble interleukin-2 receptor(IL-2sRα)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21376 |
Mouse soluble interleukin-1 receptor Ⅱ(IL-1sRⅡ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21375 |
Mouse soluble interleukin-1 receptor Ⅰ(IL-1sRⅠ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21374 |
Mouse soluble Interleukin 7 receptor(sIL-7R_CD127)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21373 |
Mouse soluble Interleukin 6 receptor(sIL-6R_CD126)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E03F0103 |
Mouse anti-soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| AGHIV-0245 |
rHIV p24, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
236-Eur |
Arista Bio |
|
| QY-E21385 |
Mouse soluble Toll-like receptor 2(sTLR-2)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21386 |
Mouse soluble Toll-like receptor 6(sTLR-6)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 201-12-0208 |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
48T |
295-Eur |
SunBT |
|
| E03S0249 |
Mouse anti-soluble endothelial protein C receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| 201-12-0206 |
Human soluble interleukin-2 receptor,IL-2sRα ELISA kit |
48T |
295-Eur |
SunBT |
|
| E03S0238 |
Mouse anti-soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| 201-12-0209 |
Human soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
48T |
295-Eur |
SunBT |
|
| U0547Rb |
Rabbit soluble Vascuolar cell adhesion molecule 1 |
96T |
839-Eur |
EIAab |
polyclonal |
| E03S0008 |
Mouse anti-Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| QY-E21541 |
mor necrosis factor soluble receptor Ⅰ(TNFsR-Ⅰ)ELISA Kit |
96T |
620-Eur |
SQBIO |
|
| E03C0044 |
Mouse anti-soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E02T0527 |
Rat anti-Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| 201-11-0421 |
Rat soluble endothelial protein C receptor(sEPCR)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0419 |
Rat Soluble Intercellular Adhesion Molecule 1(sICAM-1)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-12-0282 |
Human soluble transferrin receptor,sTfR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| E04S0258 |
Rabbit anti-Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| E04S0254 |
Rabbit anti-soluble Factor-related Apoptosis |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| 201-11-0417 |
Rat soluble myosin heavy chain 1(sMHC-1)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| E04S0249 |
Rabbit anti-soluble endothelial protein C receptor |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| 201-11-0415 |
Rat soluble Factor-related Apoptosis(sFAS_Apo-1)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-1165 |
Rat soluble vascular adhesion protein-1(sVAP-1)ELISA Kit |
96T |
672-Eur |
SunBT |
|
| 20246 |
Rat Soluble Intercellular Adhesion Molecule 1(sICAM-1) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E02T0526 |
Rat anti-Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| QY-E21367 |
Mouse soluble Cluster of differentiation 86(sCD86)ELISA Kit |
96T |
519-Eur |
SQBIO |
|
| QY-E21364 |
Mouse soluble cluster of differentiation 14(sCD14)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 20183 |
Rat soluble Factor-related Apoptosis(sFAS_Apo-1) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| QY-E20874 |
Mouse IsocitMousee Dehydrogenase 1, Soluble(IDH1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E70028 |
Canine soluble cluster of differentiation 146,sCD146 ELISA Kit |
96T |
555-Eur |
SQBIO |
|
| 2520 |
Probenecid-water soluble , Buffers-loading agents |
10 x 15 mg |
73-Eur |
TEFL |
|
| 2522 |
Probenecid-water soluble , Buffers-loading agents |
150 mg |
68-Eur |
TEFL |
|
| E03S0254 |
Mouse anti-soluble Factor-related Apoptosis |
96 Tests/kit |
1087-Eur |
BlueGen |
apoptosis |
| E03S0258 |
Mouse anti-Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| 201-12-0207 |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
48T |
295-Eur |
SunBT |
|
| CSB-E04737m |
Mouse tumor necrosis factor soluble receptor |
96T |
896-Eur |
Cusabio |
recombinant |
| CSB-E04736h |
Human tumor necrosis factor soluble receptor |
96T |
896-Eur |
Cusabio |
recombinant |
| CSB-E04630h |
Human soluble interleukin_2 receptor,IL_2sRâ ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| CSB-E04629h |
Human soluble interleukin_2 receptor,IL_2sRá ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| 201-12-2045 |
Human soluble transferrin receptor1,sTfR1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E07S0008 |
Porcine anti-Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| 8Tr56 |
Human enzymes and proteins Transferrin Receptor, Soluble |
0,1mg |
782-Eur |
Hytest |
|
| U0906h |
Human soluble platelet endothelial cell adhesion m |
96T |
706-Eur |
EIAab |
human |
| 23848 |
Rat Soluble Endothelial Protein C Receptor(sEPCR) ELISA kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CSB-E04738h |
Human tumor necrosis factor soluble receptor |
96T |
856-Eur |
Cusabio |
recombinant |
| E07S0249 |
Porcine anti-soluble endothelial protein C receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| U0312h |
Human Soluble Mesothelin Related Peptide Kit CLIA |
96T |
706-Eur |
EIAab |
assays |
| E07S0238 |
Porcine anti-soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| U0754h |
Human soluble myosin heavy chain 1 CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| 201-12-0282 |
Human soluble transferrin receptor,sTfR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| CSB-E06859b |
Bovine soluble cluster of differentiation 86,sCD86 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| 18983 |
soluble α2,6-Sialyltransferase (rST6GalI-E41) Antigen peptide IgG poly |
100 |
417-Eur |
Demeditec |
|
| CSB-E04739m |
Mouse tumor necrosis factor soluble receptor |
96T |
896-Eur |
Cusabio |
recombinant |
| 201-12-0539 |
Human anti-soluble liver antigen,SLA ELISA Kit |
48T |
295-Eur |
SunBT |
|
| AGHIV-0245 |
rHIV p24, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
291-Eur |
Arista Bio |
|
| E07F0103 |
Porcine anti-soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| QY-E11230 |
Rat soluble Factor-related Apoptosis(sFAS_Apo-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E11228 |
Rat soluble myosin heavy chain 1(sMHC-1)ELISA Kit |
96T |
519-Eur |
SQBIO |
|
| U0547Mo |
Monkey soluble Vascuolar cell adhesion molecule 1 |
96T |
839-Eur |
EIAab |
|
| QY-E11226 |
Rat Soluble Intercellular Adhesion Molecule 1(sICAM-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E11224 |
Rat soluble endothelial protein C receptor(sEPCR)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E10480 |
Rat soluble vascular adhesion protein-1(sVAP-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 8Tr56 |
Human enzymes and proteins Transferrin Receptor, Soluble |
0,1 mg |
777-Eur |
Hytest |
recombinant |
| 201-12-0227 |
Human soluble Interleukin 6 receptor,sIL-6R_CD126 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| M0122 |
5(6)_Carboxyfluorescein, Water Soluble Fluorophore Standard, 100mg |
|
82-Eur |
MarkerGene |
|
| AGHIV-0245 |
rHIV p24, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
264-Eur |
Arista Bio |
|
| 201-12-0318 |
Human soluble cluster of differentiation 14,sCD14 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-0304 |
Human Soluble Cluster of differentiation 21,sCD21 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-0274 |
human soluble cluster of differentiation 28,sCD28 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-0302 |
Human Soluble Cluster of differentiation 38,sCD38 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| U0470h |
Human soluble receptor activator of nuclear factor |
96T |
706-Eur |
EIAab |
recombinant |
| QY-E11238 |
Rat Soluble Cluster of differentiation 40 ligand(sCD40L)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 201-12-0283 |
Human soluble cytokine receptor,sCKR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CSB-E07313r |
Rat soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| 201-12-2045 |
Human soluble transferrin receptor1,sTfR1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| OETCGF532 |
Prolactin Soluble Receptor Rainbow Trout Recombinant |
10 |
92-Eur |
OET |
|
| E05S0254 |
Guinea anti-soluble Factor-related Apoptosis |
96 Tests/kit |
1101-Eur |
BlueGen |
apoptosis |
| CK-E80035 |
Rabbit soluble endothelial protein C receptor,sER ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E05S0249 |
Guinea anti-soluble endothelial protein C receptor |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| RCYT-293B |
Recombinant Ovine Prolactin Soluble Receptor |
50µg |
234-Eur |
SeraLab |
recombinant |
| E05S0238 |
Guinea anti-soluble cluster of differentiation 30 ligand |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| CK-E60078 |
Chicken soluble endothelial protein C receptor,sER ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| RCYT-293C |
Recombinant Ovine Prolactin Soluble Receptor |
1mg |
1905-Eur |
SeraLab |
recombinant |
| CK-E30517 |
Rat Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E05S0258 |
Guinea anti-Soluble Intercellular Adhesion Molecule-1 |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| CK-E80036 |
Rabbit soluble endothelial protein C receptor,sER ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E04C0044 |
Rabbit anti-soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E08C0044 |
Canine anti-soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| RCYT-268A |
Recombinant Rabbit Prolactin Soluble Receptor |
10µg |
127-Eur |
SeraLab |
recombinant |
| RCYT-268B |
Recombinant Rabbit Prolactin Soluble Receptor |
50µg |
234-Eur |
SeraLab |
recombinant |
| RCYT-268C |
Recombinant Rabbit Prolactin Soluble Receptor |
1mg |
1905-Eur |
SeraLab |
recombinant |
| CK-E90428 |
Human soluble cluster of differentiation 14(sCD14)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| RCYT-293A |
Recombinant Ovine Prolactin Soluble Receptor |
10µg |
127-Eur |
SeraLab |
recombinant |
| 201-11-0421 |
Rat soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
490-Eur |
SunBT |
|
| E05S0008 |
Guinea anti-Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CK-E30516 |
Rat Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| OETCGF589 |
Soluble Interleukin-2 Receptor alpha Human Recombinant, GST tag |
2 |
199-Eur |
OET |
|
| CSB-E11157m |
Mouse soluble cluster of differentiation 30,sCD30 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E11336h |
Human soluble cluster of differentiation 146,sCD146 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CK-E20112 |
Mouse soluble endothelial protein C receptor,sER ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-E13199h |
Human soluble cluster of differentiation 14(SCD14) ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CK-E20091 |
Mouse soluble cluster of differentiation 30,sCD30 Elisa Kit |
96T |
454-Eur |
Eastbio |
|
| RCYT-320A |
Recombinant Mouse Soluble RANK Ligand |
2µg |
127-Eur |
SeraLab |
recombinant |
| CK-E11261 |
Human soluble endothelial protein C receptor,sER ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-E10364Rb |
Rabbit soluble Factor_related Apoptosis,sFAS_Apo_1 ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| CK-E20352 |
Mouse soluble Cluster of differentiation 86,sCD86 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| RCYT-294A |
Recombinant Bovine Prolactin Soluble Receptor |
10µg |
127-Eur |
SeraLab |
recombinant |
| RCYT-294B |
Recombinant Bovine Prolactin Soluble Receptor |
50µg |
234-Eur |
SeraLab |
recombinant |
| RCYT-294C |
Recombinant Bovine Prolactin Soluble Receptor |
1mg |
1906-Eur |
SeraLab |
recombinant |
| CK-E30438 |
Rat Soluble Intercellular Adhesion Molecule 1,sICAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| OETCGF532 |
Prolactin Soluble Receptor Rainbow Trout Recombinant |
50 |
171-Eur |
OET |
|
| E05F0103 |
Guinea anti-soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E05C0044 |
Guinea anti-soluble Cluster of Differentiation 44s Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CK-E30004 |
Rat soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| 8Tr56 |
Transferrin Receptor, Soluble, Human enzymes and proteins |
0,1mg |
745-Eur |
Hytest |
|
| E04F0103 |
Rabbit anti-soluble Fms.liketyrosinekinase Receptor 1 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| 201-11-0419 |
Rat Soluble Intercellular Adhesion Molecule 1,sICAM-1 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| U0964h |
Human soluble tumor necrosis factor receptor 2 CLI |
96T |
706-Eur |
EIAab |
recombinant |
| OETCGF285 |
Interleukin-2 alpha Soluble Receptor Human Recombinant |
5 |
92-Eur |
OET |
|
| U0547p |
Porcine soluble Vascuolar cell adhesion molecules |
96T |
839-Eur |
EIAab |
porcine |
| 201-12-0539 |
Human anti-soluble liver antigen(SLA)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-0318 |
Human soluble cluster of differentiation 14(sCD14)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| U0139h |
Human soluble tumor necrosis factor_related apopto |
96T |
706-Eur |
EIAab |
human |
| 201-12-0304 |
Human Soluble Cluster of differentiation 21(sCD21)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| B20038 |
Bromocresol purple sodium salt (water soluble) |
|
137-Eur |
pfalslandbauer |
|
| U0963h |
Human soluble tumor necrosis factor receptor 1 CLI |
96T |
706-Eur |
EIAab |
recombinant |
| 201-12-2045 |
Human soluble transferrin receptor1(sTfR1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-11-0407 |
Rat Soluble Cluster of differentiation 40 ligand(sCD40L)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0406 |
Rat Soluble Cluster of differentiation 30 ligand(sCD30L)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| U0022Rb |
Rabbit soluble endothelial protein C receptor CLIA |
96T |
839-Eur |
EIAab |
recombinant |
| 201-11-0406 |
Rat Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0407 |
Rat Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 182-01471 |
RANK Ligand Soluble, Human, recombinant (RANKL) |
10 ug |
722-Eur |
B-Bridge |
recombinant |
| 184-01791 |
RANK Ligand Soluble, Mouse, recombinant (RANKL) |
10 ug |
758-Eur |
B-Bridge |
recombinant |
| 186-01474 |
RANK Ligand Soluble, Human, recombinant (RANKL) |
50 ug |
2592-Eur |
B-Bridge |
recombinant |
| B20038 |
Bromocresol purple sodium salt (water soluble) |
|
183-Eur |
pfalslandbauer |
|
| B20038 |
Bromocresol purple sodium salt (water soluble) |
|
432-Eur |
pfalslandbauer |
|
| 201-12-0208 |
Human soluble interleukin-1 receptor Ⅱ(IL-1sRⅡ)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| RCYT-245A |
Recombinant Human soluble CD40 Ligand_TRAP |
10µg |
127-Eur |
SeraLab |
recombinant |
| RCYT-245B |
Recombinant Human soluble CD40 Ligand_TRAP |
50µg |
234-Eur |
SeraLab |
recombinant |
| U1367p |
Porcine soluble vascular endothelial growth factor |
96T |
839-Eur |
EIAab |
porcine |
| E91960Gu |
ELISA Kit for Guinea Pig Superoxide Dismutase 1,Soluble(SOD1) |
96T |
770-Eur |
USCNLife |
elisa |
| E91960Hu |
ELISA Kit for Human Superoxide Dismutase 1,Soluble(SOD1) |
96T |
689-Eur |
USCNLife |
elisa |
| RCYT-245C |
Recombinant Human soluble CD40 Ligand_TRAP |
1mg |
1983-Eur |
SeraLab |
recombinant |
| 201-12-0207 |
Human soluble interleukin-1 receptor Ⅰ(IL-1sRⅠ)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-0209 |
Human soluble interleukin-2 receptor(IL-2sRβ)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| U1158h |
Human soluble Tumor Necrosis Factorαreceptor CLIA |
96T |
706-Eur |
EIAab |
recombinant |
| 201-12-0302 |
Human Soluble Cluster of differentiation 38(sCD38)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-0283 |
Human soluble cytokine receptor(sCKR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-0282 |
Human soluble transferrin receptor(sTfR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-11-0415 |
Rat soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-12-0274 |
Human soluble cluster of differentiation 28(sCD28)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-0257 |
Human soluble Cluster of differentiation 86(sCD86)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-11-0417 |
Rat soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-12-0227 |
Human soluble Interleukin 6 receptor(sIL-6R_CD126)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E04S0008 |
Rabbit anti-Soluble Fms-like Tyrosine 1_Svegfr1 ELISA KIT |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E07S0224 |
Porcine Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0239 |
Porcine Soluble cluster of differentiation 86 ELISA, SCD86 |
|
715-Eur |
Blue Gene Biotech |
|
| 201-20-2446 |
GUCY1B3{guanylate cyclase 1, soluble, beta 3}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| E07I0381 |
Porcine Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
715-Eur |
Blue Gene Biotech |
|
| E0229Mo |
Mouse soluble interleukin-2 receptor,IL-2sRα ELISA kit |
48T |
386-Eur |
Eastbio |
|
| E01S0294 |
Human Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
601-Eur |
BGene |
|
| CSB-E13199h |
Human soluble cluster of differentiation 14,sCD14 ELISA Kit |
96T |
542-Eur |
Cusabio |
|
| E01S0293 |
Human Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0291 |
Human Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
601-Eur |
BGene |
|
| 201-20-2694 |
IDH1{isocitrate dehydrogenase 1 (NADP+), soluble}rabbit.pAb |
0.2ml |
487-Eur |
Shanghai Sunred |
|
| E0293Mo |
Mouse soluble Cluster of differentiation 86,sCD86 ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| E07I0379 |
Porcine Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
715-Eur |
Blue Gene Biotech |
|
| CSB-E04611h |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
542-Eur |
Cusabio |
|
| CSB-E04612h |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
96T |
542-Eur |
Cusabio |
|
| E01S0263 |
Human Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0262 |
Human Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
601-Eur |
BGene |
|
| E02C0209 |
Rat soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
601-Eur |
BGene |
|
| E02F0103 |
Rat Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| 201-20-2445 |
GUCY1A3{guanylate cyclase 1, soluble, alpha 3}rabbit.pAb |
0.2ml |
651-Eur |
Shanghai Sunred |
|
| E07S0213 |
Porcine Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0291 |
Porcine Soluble transferrin receptor ELISA
, sTfR |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0262 |
Porcine Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0261 |
Porcine Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0223 |
Porcine Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
715-Eur |
Blue Gene Biotech |
|
| 201-20-2343 |
GPD1{glycerol-3-phosphate dehydrogenase 1 (soluble)}rabbit.pAb |
0.2ml |
651-Eur |
Shanghai Sunred |
|
| RCYT-320B |
Recombinant Mouse Soluble RANK Ligand |
10 |
199-Eur |
SeraLab |
|
| E07S0294 |
Porcine Soluble toll-like receptor 6 ELISA, STLR-6 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0293 |
Porcine Soluble toll-like receptor 2 ELISA, STLR-2 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0263 |
Porcine Anti-soluble liver antigen ELISA, SLA |
|
715-Eur |
Blue Gene Biotech |
|
| E0565Mo |
Mouse soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
48T |
386-Eur |
Sunlog |
|
| RCYT-320A |
Recombinant Mouse Soluble RANK Ligand |
2 |
96-Eur |
SeraLab |
|
| RCYT-286B |
Recombinant Human Soluble IL-6 Receptor alpha |
20 |
199-Eur |
SeraLab |
|
| RCYT-286A |
Recombinant Human Soluble IL-6 Receptor alpha |
5 |
96-Eur |
SeraLab |
|
| E02L0229 |
Rat Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
601-Eur |
BGene |
|
| RD194011100 |
ELISA: soluble Transferrin Receptor (sTfR) , Human |
96 wells (1 kit) |
344-Eur |
Biovendor |
|
| E01S0261 |
Human Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
601-Eur |
BGene |
|
| CSB-E08153p |
Pig Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
557-Eur |
Cusabio |
|
| E06S0223 |
Goat Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
715-Eur |
Blue Gene Biotech |
|
| 201-20-3101 |
LGALS7B{lectin, galactoside-binding, soluble, 7B}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| E06S0294 |
Goat Soluble toll-like receptor 6 ELISA, STLR-6 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0293 |
Goat Soluble toll-like receptor 2 ELISA, STLR-2 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0263 |
Goat Anti-soluble liver antigen ELISA, SLA |
|
715-Eur |
Blue Gene Biotech |
|
| E08I0379 |
Canine Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
622-Eur |
BGene |
|
| E08I0381 |
Canine Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-20-3102 |
LGALS8{lectin, galactoside-binding, soluble, 8}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| E06S0239 |
Goat Soluble cluster of differentiation 86 ELISA, SCD86 |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0213 |
Canine Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0223 |
Canine Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
622-Eur |
BGene |
|
| E06I0381 |
Goat Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
715-Eur |
Blue Gene Biotech |
|
| E06I0379 |
Goat Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0224 |
Canine Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-20-3103 |
LGALS9{lectin, galactoside-binding, soluble, 9}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| E06S0261 |
Goat Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0262 |
Goat Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0291 |
Goat Soluble transferrin receptor ELISA
, sTfR |
|
715-Eur |
Blue Gene Biotech |
|
| 201-20-3095 |
LGALS1{lectin, galactoside-binding, soluble, 1}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| 201-20-3096 |
LGALS12{lectin, galactoside-binding, soluble, 12}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| 201-20-3097 |
LGALS2{lectin, galactoside-binding, soluble, 2}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| CSB-E15077B |
Bovine soluble cluster of differentiation 8(sCD8) ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| 201-20-3098 |
LGALS3{lectin, galactoside-binding, soluble, 3}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| E01S0239 |
Human Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
601-Eur |
BGene |
|
| CSB-E08987h |
Human anti-soluble liver antigen,SLA ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| E01S0224 |
Human Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0223 |
Human Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0213 |
Human Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
601-Eur |
BGene |
|
| E01I0381 |
Human Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
601-Eur |
BGene |
|
| E01I0379 |
Human Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
601-Eur |
BGene |
|
| 201-20-3100 |
LGALS4{lectin, galactoside-binding, soluble, 4}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| E06S0224 |
Goat Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0213 |
Goat Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
715-Eur |
Blue Gene Biotech |
|
| orb80099 |
Human soluble CD40 Ligand_TRAP protein Proteins |
10 |
159-Eur |
Biorb |
|
| E03S0213 |
Mouse Soluble Cluster Of Differentiation 27 ELISA,sCD27 |
96 Tests/kit |
601-Eur |
BGene |
|
| CK-E95882 |
Human soluble Cluster of differentiation 86,sCD86 ELISAkit |
|
----Eur |
Glory |
|
| HP241-R |
Recombinant (E. coli) HIV-1 p24 protein (soluble) Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
238-Eur |
ADI |
|
| CK-E97588 |
Mouse soluble cluster of differentiation 30,sCD30 ELISAkit |
|
----Eur |
Glory |
|
| CK-E95863 |
Human soluble cytokine receptor,sCKR ELISAkit |
|
----Eur |
Glory |
|
| CK-E95857 |
human soluble cluster of differentiation 28,sCD28 ELISAkit |
|
----Eur |
Glory |
|
| E08S0224 |
Canine Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0261 |
Sheep Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E95835 |
Human Soluble Cluster of differentiation 21,sCD21 ELISAkit |
|
----Eur |
Glory |
|
| CK-E95834 |
Human Soluble Cluster of differentiation 38,sCD38 ELISAkit |
|
----Eur |
Glory |
|
| E14S0262 |
Sheep Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E97849 |
Mouse soluble Cluster of differentiation 86,sCD86 ELISAkit |
|
----Eur |
Glory |
|
| E08S0213 |
Canine Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0213 |
Porcine Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0223 |
Porcine Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
608-Eur |
BGene |
|
| E08S0291 |
Canine Soluble transferrin receptor ELISA
, sTfR |
|
715-Eur |
Blue Gene Biotech |
|
| E03I0379 |
Mouse Soluble Interleukin 2a receptor ELISA,IL-2sRa |
96 Tests/kit |
601-Eur |
BGene |
|
| E03I0381 |
Mouse Soluble Interleukin 2β receptor ELISA,IL-2sRβ |
96 Tests/kit |
601-Eur |
BGene |
|
| E07I0381 |
Porcine Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
608-Eur |
BGene |
|
| E09S0293 |
Monkey Soluble toll-like receptor 2 ELISA, STLR-2 |
|
715-Eur |
Blue Gene Biotech |
|
| E11T0526 |
Bovine Tumor necrosis factor soluble receptor I |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E09S0263 |
Monkey Anti-soluble liver antigen ELISA, SLA |
|
715-Eur |
Blue Gene Biotech |
|
| E11T0527 |
Bovine Tumor necrosis factor soluble receptor II |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CK-E98473 |
Rat Soluble Intercellular Adhesion Molecule 1,sICAM-1 ELISAkit |
|
----Eur |
Glory |
|
| E13A0223 |
Anserine soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E09S0239 |
Monkey Soluble cluster of differentiation 86 ELISA, SCD86 |
|
715-Eur |
Blue Gene Biotech |
|
| E13C0053 |
Anserine soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CK-E96093 |
Human soluble transferrin receptor,sTfR ELISAkit |
|
----Eur |
Glory |
|
| CK-E95956 |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISAkit |
|
----Eur |
Glory |
|
| CK-E95955 |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISAkit |
|
----Eur |
Glory |
|
| CK-E95952 |
Human soluble interleukin-2 receptor,IL-2sRα ELISAkit |
|
----Eur |
Glory |
|
| E13C0209 |
Anserine soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E09I0381 |
Monkey Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
715-Eur |
Blue Gene Biotech |
|
| E09I0379 |
Monkey Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0262 |
Canine Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0261 |
Canine Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0224 |
Porcine Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
608-Eur |
BGene |
|
| E02S0250 |
Rat Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
601-Eur |
BGene |
|
| E02S0249 |
Rat soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
601-Eur |
BGene |
|
| E07S0263 |
Porcine Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0291 |
Porcine Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0293 |
Porcine Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0294 |
Porcine Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
608-Eur |
BGene |
|
| E0142Mo |
Mouse soluble cluster of differentiation 30,sCD30 Elisa Kit |
48T |
386-Eur |
Eastbio |
|
| E14S0291 |
Sheep Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
622-Eur |
BGene |
|
| E14S0293 |
Sheep Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
622-Eur |
BGene |
|
| E14S0294 |
Sheep Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0239 |
Canine Soluble cluster of differentiation 86 ELISA, SCD86 |
|
715-Eur |
Blue Gene Biotech |
|
| E02S0238 |
Rat Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
601-Eur |
BGene |
|
| E08I0381 |
Canine Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
715-Eur |
Blue Gene Biotech |
|
| E02S0238 |
Rat Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
689-Eur |
Blue Gene Biotech |
|
| E08I0379 |
Canine Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0263 |
Canine Anti-soluble liver antigen ELISA, SLA |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0293 |
Canine Soluble toll-like receptor 2 ELISA, STLR-2 |
|
715-Eur |
Blue Gene Biotech |
|
| E02S0254 |
Rat Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E14S0263 |
Sheep Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0223 |
Canine Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0239 |
Porcine Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
608-Eur |
BGene |
|
| B-1007-105 |
ChromaLink™ Biotin Labeling Reagent (Water Soluble) |
5 x 1.0 mg |
240-Eur |
Solulink |
|
| B-1007-110 |
ChromaLink™ Biotin Labeling Reagent (Water Soluble) |
10 mg |
261-Eur |
Solulink |
|
| E08S0294 |
Canine Soluble toll-like receptor 6 ELISA, STLR-6 |
|
715-Eur |
Blue Gene Biotech |
|
| E02S0258 |
Rat Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E02S0255 |
Rat Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
601-Eur |
BGene |
|
| CK-E98039 |
Rat soluble Factor-related Apoptosis,sFAS_Apo-1 ELISAkit |
|
----Eur |
Glory |
|
| E0107Mo |
Mouse soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
48T |
386-Eur |
Eastbio |
|
| GS-0021a |
aconitase 1, soluble primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| AGHIV-0245 |
rHIV p24, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
505-Eur |
Arista Bio |
|
| E07S0261 |
Porcine Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0262 |
Porcine Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
608-Eur |
BGene |
|
| cyt-533 |
Recombinant Rat Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| E05S0224 |
Guinea pig Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0261 |
Mouse Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0254 |
Rat Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E12S0224 |
Chicken Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0223 |
Chicken Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0213 |
Chicken Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
622-Eur |
BGene |
|
| QY-E02648 |
Human anti-soluble liver antigen(SLA)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| E02S0258 |
Rat Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0249 |
Rat soluble endothelial protein C receptor ELISA, SEPCR |
|
689-Eur |
Blue Gene Biotech |
|
| E12I0381 |
Chicken Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
622-Eur |
BGene |
|
| E02L0229 |
Rat Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
689-Eur |
Blue Gene Biotech |
|
| E12I0379 |
Chicken Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
622-Eur |
BGene |
|
| E02C0209 |
Rat soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0250 |
Rat Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
689-Eur |
Blue Gene Biotech |
|
| E02F0103 |
Rat Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
689-Eur |
Blue Gene Biotech |
|
| LGALS13 |
LGALS1 Gene lectin, galactoside-binding, soluble, 1 |
|
----Eur |
Transposagen |
|
| E01S0224 |
Human Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
689-Eur |
Blue Gene Biotech |
|
| QY-E02439 |
Human soluble transferrin receptor(sTfR)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E02438 |
Human soluble transferrin receptor1(sTfR1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E02S0255 |
Rat Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
689-Eur |
Blue Gene Biotech |
|
| HGP411-R |
Recombinant (E. coli) HIV_1 gp41, protein (soluble) |
100 ug |
262-Eur |
Alpha Diagnostics |
recombinant |
| E03S0223 |
Mouse Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0294 |
Mouse Soluble toll-like receptor 6 ELISA, STLR-6 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0293 |
Mouse Soluble toll-like receptor 2 ELISA, STLR-2 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0263 |
Mouse Anti-soluble liver antigen ELISA, SLA |
|
689-Eur |
Blue Gene Biotech |
|
| GUCY2C |
GUCY1A3 Gene guanylate cyclase 1, soluble, alpha 3 |
|
----Eur |
Transposagen |
|
| GUCY2D |
GUCY1B3 Gene guanylate cyclase 1, soluble, beta 3 |
|
----Eur |
Transposagen |
|
| HMGN1 |
HMGCS1 Gene 3-hydroxy-3-methylglutaryl-CoA synthase 1 (soluble) |
|
----Eur |
Transposagen |
|
| E03S0239 |
Mouse Soluble cluster of differentiation 86 ELISA, SCD86 |
|
689-Eur |
Blue Gene Biotech |
|
| E03I0381 |
Mouse Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
689-Eur |
Blue Gene Biotech |
|
| E03I0379 |
Mouse Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
689-Eur |
Blue Gene Biotech |
|
| E12S0239 |
Chicken Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-EL022397GO |
Goat superoxide dismutase 1, soluble (SOD1) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| CSB-EL022397GU |
Guinea pig superoxide dismutase 1, soluble (SOD1) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| IDH3A |
IDH1 Gene isocitrate dehydrogenase 1 (NADP+), soluble |
|
----Eur |
Transposagen |
|
| LGALS14 |
LGALS12 Gene lectin, galactoside-binding, soluble, 12 |
|
----Eur |
Transposagen |
|
| LGALS16 |
LGALS13 Gene lectin, galactoside-binding, soluble, 13 |
|
----Eur |
Transposagen |
|
| QY-E02456 |
Human soluble cytokine receptor(sCKR)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| LGALS9C |
LGALS9 Gene lectin, galactoside-binding, soluble, 9 |
|
----Eur |
Transposagen |
|
| QY-E02479 |
Human soluble Cluster of differentiation 86(sCD86)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E01S0261 |
Human Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
689-Eur |
Blue Gene Biotech |
|
| LGI1 |
LGALS9B Gene lectin, galactoside-binding, soluble, 9B |
|
----Eur |
Transposagen |
|
| S-1008-105 |
Reagents - 4FB Crosslinkers: Sulfo S-4FB Crosslinker (Water Soluble) |
5 x 1.0 mg |
177-Eur |
Solulink |
|
| S-1008-010 |
Reagents - 4FB Crosslinkers: Sulfo S-4FB Crosslinker (Water Soluble) |
10 mg |
261-Eur |
Solulink |
|
| LGI2 |
LGALS9C Gene lectin, galactoside-binding, soluble, 9C |
|
----Eur |
Transposagen |
|
| QY-E02487 |
Human soluble cluster of differentiation 14(sCD14)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CK200222 |
CYTOKINE ELISA KITS: Human IL 2 Soluble Receptor |
96tests |
687-Eur |
Antigenex |
|
| CK600222 |
CYTOKINE ELISA KITS: Human IL 6 Soluble Receptor |
96tests |
687-Eur |
Antigenex |
|
| ABS3121 |
MOUSE ANTI GUANYLATE CYCLASE ALPHA 1 (SOLUBLE) |
0.2 mg |
265-Eur |
AbD Serotec |
mouse |
| 50027 |
PROBENECID, SODIUM SALT *WATER SOLUBLE*, 77MG |
10MG |
226-Eur |
Biotium |
|
| QY-E02485 |
Human Soluble Cluster of differentiation 21(sCD21)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E02484 |
Human soluble cluster of differentiation 28(sCD28)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E08S0291 |
Canine Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
622-Eur |
BGene |
|
| QY-E02475 |
Human soluble Interleukin 6 receptor(sIL-6R_CD126)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| LGALS9B |
LGALS8 Gene lectin, galactoside-binding, soluble, 8 |
|
----Eur |
Transposagen |
|
| E01I0379 |
Human Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0213 |
Human Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0291 |
Human Soluble transferrin receptor ELISA
, sTfR |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0262 |
Human Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0223 |
Human Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
689-Eur |
Blue Gene Biotech |
|
| LGALS2 |
LGALS14 Gene lectin, galactoside-binding, soluble, 14 |
|
----Eur |
Transposagen |
|
| LGALS3BP |
LGALS2 Gene lectin, galactoside-binding, soluble, 2 |
|
----Eur |
Transposagen |
|
| LGALS4 |
LGALS3 Gene lectin, galactoside-binding, soluble, 3 |
|
----Eur |
Transposagen |
|
| LGALS7B |
LGALS4 Gene lectin, galactoside-binding, soluble, 4 |
|
----Eur |
Transposagen |
|
| LGALS8 |
LGALS7 Gene lectin, galactoside-binding, soluble, 7 |
|
----Eur |
Transposagen |
|
| E01S0263 |
Human Anti-soluble liver antigen ELISA, SLA |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0294 |
Human Soluble toll-like receptor 6 ELISA, STLR-6 |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0293 |
Human Soluble toll-like receptor 2 ELISA, STLR-2 |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0239 |
Human Soluble cluster of differentiation 86 ELISA, SCD86 |
|
689-Eur |
Blue Gene Biotech |
|
| LGALS9 |
LGALS7B Gene lectin, galactoside-binding, soluble, 7B |
|
----Eur |
Transposagen |
|
| E01I0381 |
Human Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
689-Eur |
Blue Gene Biotech |
|
| QY-E02482 |
Human Soluble Cluster of differentiation 38(sCD38)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E05S0213 |
Guinea pig Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
689-Eur |
Blue Gene Biotech |
|
| E11S0224 |
Bovine Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0261 |
Canine Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0261 |
Bovine Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0262 |
Bovine Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0263 |
Bovine Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
622-Eur |
BGene |
|
| E04S0224 |
Rabbit Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0213 |
Rabbit Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0291 |
Rabbit Soluble transferrin receptor ELISA
, sTfR |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0262 |
Rabbit Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0261 |
Rabbit Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0223 |
Rabbit Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
689-Eur |
Blue Gene Biotech |
|
| E08S0262 |
Canine Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0263 |
Canine Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E15792h |
Human soluble Cluster of differentiation 100(sCD100)ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E04S0294 |
Rabbit Soluble toll-like receptor 6 ELISA, STLR-6 |
|
689-Eur |
Blue Gene Biotech |
|
| E11S0223 |
Bovine Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0213 |
Bovine Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11I0381 |
Bovine Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
622-Eur |
BGene |
|
| E05S0291 |
Guinea pig Soluble transferrin receptor ELISA
, sTfR |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0262 |
Guinea pig Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0261 |
Guinea pig Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0223 |
Guinea pig Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0294 |
Guinea pig Soluble toll-like receptor 6 ELISA, STLR-6 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0293 |
Guinea pig Soluble toll-like receptor 2 ELISA, STLR-2 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0263 |
Guinea pig Anti-soluble liver antigen ELISA, SLA |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0239 |
Guinea pig Soluble cluster of differentiation 86 ELISA, SCD86 |
|
689-Eur |
Blue Gene Biotech |
|
| E05I0381 |
Guinea pig Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
689-Eur |
Blue Gene Biotech |
|
| E09S0293 |
Monkey Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
622-Eur |
BGene |
|
| E09S0294 |
Monkey Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
622-Eur |
BGene |
|
| RCYT-286C |
Recombinant Human Soluble IL-6 Receptor alpha |
1mg |
5671-Eur |
SeraLab |
|
| E05I0379 |
Guinea pig Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
689-Eur |
Blue Gene Biotech |
|
| E08S0239 |
Canine Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11I0379 |
Bovine Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
622-Eur |
BGene |
|
| E04S0293 |
Rabbit Soluble toll-like receptor 2 ELISA, STLR-2 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0263 |
Rabbit Anti-soluble liver antigen ELISA, SLA |
|
689-Eur |
Blue Gene Biotech |
|
| QY-E04308 |
Human soluble interleukin-1 receptor Ⅰ(IL-1sRⅠ)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| orb80577 |
Human soluble CD40 Ligand_TRAP His Tag protein Proteins |
2 |
159-Eur |
Biorb |
|
| orb80578 |
Mouse soluble CD40 Ligand_TRAP protein Proteins |
5 |
159-Eur |
Biorb |
|
| orb80583 |
Human Soluble RANK Ligand protein Proteins |
2 |
159-Eur |
Biorb |
|
| CSB-EL015447RA |
Rat Alpha-soluble NSF attachment protein(NAPA) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL015448RA |
Rat Beta-soluble NSF attachment protein(NAPB) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL002562RA |
Rat Brain acid soluble protein 1(BASP1) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E14S0213 |
Sheep Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
622-Eur |
BGene |
|
| orb80584 |
Human Soluble RANK Ligand GST tag protein Proteins |
2 |
159-Eur |
Biorb |
|
| orb80585 |
Mouse Soluble RANK Ligand protein Proteins |
2 |
159-Eur |
Biorb |
|
| E11S0294 |
Bovine Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-EL004484RA |
Rat Soluble calcium-activated nucleotidase 1(CANT1) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| QY-E04277 |
Human soluble interleukin-2 receptor(IL-2sRβ)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E07I0379 |
Porcine Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
608-Eur |
BGene |
|
| GPD2 |
GPD1 Gene glycerol-3-phosphate dehydrogenase 1 (soluble) |
|
----Eur |
Transposagen |
|
| GUCY1B3 |
GUCY1A2 Gene guanylate cyclase 1, soluble, alpha 2 |
|
----Eur |
Transposagen |
|
| CSB-E07447m |
Mouse soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E11S0293 |
Bovine Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E07449m |
Mouse soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
626-Eur |
Cusabio |
|
| QY-E04307 |
Human soluble interleukin-1 receptor Ⅱ(IL-1sRⅡ)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E04278 |
Human soluble interleukin-2 receptor(IL-2sRα)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CSB-E04629h |
Human soluble interleukin-2 receptor,IL-2sRα ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-E04630h |
Human soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
96T |
626-Eur |
Cusabio |
|
| orb80431 |
Human Soluble IL-6 Receptor alpha protein Proteins |
5 |
159-Eur |
Biorb |
|
| E04S0239 |
Rabbit Soluble cluster of differentiation 86 ELISA, SCD86 |
|
689-Eur |
Blue Gene Biotech |
|
| E04I0381 |
Rabbit Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
689-Eur |
Blue Gene Biotech |
|
| E04I0379 |
Rabbit Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
689-Eur |
Blue Gene Biotech |
|
| orb80566 |
Rabbit Prolactin Soluble Receptor protein Proteins |
10 |
159-Eur |
Biorb |
|
| E03S0224 |
Mouse Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0213 |
Mouse Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0291 |
Mouse Soluble transferrin receptor ELISA
, sTfR |
|
689-Eur |
Blue Gene Biotech |
|
| orb80567 |
Ovine Prolactin Soluble Receptor protein Proteins |
10 |
159-Eur |
Biorb |
|
| orb80568 |
Bovine Prolactin Soluble Receptor protein Proteins |
10 |
159-Eur |
Biorb |
|
| E11S0291 |
Bovine Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
622-Eur |
BGene |
|
| E03S0262 |
Mouse Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0223 |
Mouse Soluble Cluster of Differentiation 28 ELISA,sCD28 |
96 Tests/kit |
601-Eur |
BGene |
|
| E07T0527 |
Porcine Tumor necrosis factor soluble receptor II |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 228-10915-3 |
Recombinant Human Soluble IL-2R alpha _ IL2RA Proteins |
1mg |
----Eur |
Ray Biotech |
|
| E09I0381 |
Monkey Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
622-Eur |
BGene |
|
| E14S0294 |
Sheep Soluble toll-like receptor 6 ELISA, STLR-6 |
|
715-Eur |
Blue Gene Biotech |
|
| E09I0379 |
Monkey Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
622-Eur |
BGene |
|
| E06S0213 |
Goat Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
608-Eur |
BGene |
|
| E14S0293 |
Sheep Soluble toll-like receptor 2 ELISA, STLR-2 |
|
715-Eur |
Blue Gene Biotech |
|
| 7-00826 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha |
5 |
164-Eur |
CHI |
|
| E14S0263 |
Sheep Anti-soluble liver antigen ELISA, SLA |
|
715-Eur |
Blue Gene Biotech |
|
| ACLY100-19-100UG |
Human Soluble Rank Ligand (H_RANK_L) |
100 µg. |
497-Eur |
Accurate |
human |
| 7-01444 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
5 |
164-Eur |
CHI |
|
| 7-00827 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha |
25 |
346-Eur |
CHI |
|
| ACLY100-19-10UG |
Human Soluble Rank Ligand (H_RANK_L) |
10 µg. |
230-Eur |
Accurate |
human |
| E14S0223 |
Sheep Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0223 |
Goat Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
608-Eur |
BGene |
|
| E09S0223 |
Monkey Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
622-Eur |
BGene |
|
| AR1018 |
IHC related reagents: Water Soluble Sealing Reagent |
5 x 50ml |
186-Eur |
Bouster Immunoleader |
|
| E14S0224 |
Sheep Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0213 |
Sheep Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
715-Eur |
Blue Gene Biotech |
|
| 228-11356-3 |
Recombinant Human Soluble RANKL [GST-fusion] Proteins |
0.1mg |
1137-Eur |
Ray Biotech |
|
| E07T0526 |
Porcine Tumor necrosis factor soluble receptor I |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E0229Mo |
Mouse soluble interleukin-2 receptor,IL-2sRα ELISA kit |
96T |
656-Eur |
Eastbio |
|
| E0416Ra |
Rat soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E0418Ra |
Rat Soluble Intercellular Adhesion Molecule 1,sICAM-1 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E14S0291 |
Sheep Soluble transferrin receptor ELISA
, sTfR |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0262 |
Sheep Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0261 |
Sheep Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0224 |
Goat Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
608-Eur |
BGene |
|
| YCC410-414 |
Influenza Type A, Kumamoto_22_76 strain, soluble, CF Antigen |
1 ml. |
446-Eur |
Accurate |
Antibodies |
| 7-01445 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
20 |
346-Eur |
CHI |
|
| E14I0381 |
Sheep Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
715-Eur |
Blue Gene Biotech |
|
| E03T0527 |
Mouse Tumor necrosis factor soluble receptor II |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E14I0379 |
Sheep Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
715-Eur |
Blue Gene Biotech |
|
| E0538Hu |
Human anti-soluble liver antigen,SLA ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E03T0526 |
Mouse Tumor necrosis factor soluble receptor I |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06I0381 |
Goat Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
608-Eur |
BGene |
|
| E06I0379 |
Goat Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
608-Eur |
BGene |
|
| E12S0224 |
Chicken Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0213 |
Chicken Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0291 |
Chicken Soluble transferrin receptor ELISA
, sTfR |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0262 |
Chicken Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0261 |
Chicken Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
715-Eur |
Blue Gene Biotech |
|
| E02S0265 |
Rat Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| YCC410-416 |
Mumps Virus, Enders strain, soluble, CF Antigen |
1 ml. |
446-Eur |
Accurate |
Antibodies |
| E05T0527 |
Guinea Tumor necrosis factor soluble receptor II |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 7-00828 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha |
1mg |
5522-Eur |
CHI |
|
| YCC410-415 |
Influenza Type B, Kanagawa_3_76 strain, soluble, CF Antigen |
1 ml. |
446-Eur |
Accurate |
Antibodies |
| E08S0294 |
Canine Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
622-Eur |
BGene |
|
| E0420Ra |
Rat soluble endothelial protein C receptor,sEPCR ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| 7-01446 |
Recombinant Raibow Trout Prolactin Soluble Receptor |
1mg |
7122-Eur |
CHI |
|
| E08S0293 |
Canine Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
622-Eur |
BGene |
|
| E06S0261 |
Goat Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
608-Eur |
BGene |
|
| E06S0262 |
Goat Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
608-Eur |
BGene |
|
| YSRTMCA2766 |
LOX_1 soluble, Mab anti_; Clone LOX20_7, WB,ELISA |
0.2 mg. |
425-Eur |
Accurate |
elisa |
| E05T0526 |
Guinea Tumor necrosis factor soluble receptor I |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E14S0239 |
Sheep Soluble cluster of differentiation 86 ELISA, SCD86 |
|
715-Eur |
Blue Gene Biotech |
|
| E04A0223 |
Rabbit soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E12S0223 |
Chicken Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
715-Eur |
Blue Gene Biotech |
|
| YSRTMCA2765 |
LOX_1 soluble, Mab anti_Human; Clone LOX19_22, WB,ELISA |
0.2 mg. |
425-Eur |
Accurate |
elisa |
| E06S0239 |
Goat Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
608-Eur |
BGene |
|
| CK-E98601 |
Rat soluble endothelial protein C receptor,sEPCR ELISAkit |
|
----Eur |
Glory |
|
| E0538Hu |
Human anti-soluble liver antigen,SLA ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E12S0291 |
Chicken Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
622-Eur |
BGene |
|
| E0317Hu |
Human soluble cluster of differentiation 14,sCD14 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0303Hu |
Human Soluble Cluster of differentiation 21,sCD21 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0301Hu |
Human Soluble Cluster of differentiation 38,sCD38 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0282Hu |
Human soluble cytokine receptor,sCKR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0281Hu |
Human soluble transferrin receptor,sTfR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0273Hu |
human soluble cluster of differentiation 28,sCD28 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E04T0526 |
Rabbit Tumor necrosis factor soluble receptor I |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| CK-E98552 |
Rat Soluble Cluster of differentiation 40 ligand,sCD40L ELISAkit |
|
----Eur |
Glory |
|
| E02L0229 |
Rat lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01A0223 |
Human soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01C0053 |
Human soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0416Ra |
Rat soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0414Ra |
Rat soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0418Ra |
Rat Soluble Intercellular Adhesion Molecule 1,sICAM-1 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0406Ra |
Rat Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0405Ra |
Rat Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E01I0375 |
Human soluble TNF-related apoptosis inducing ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0420Ra |
Rat soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E12S0261 |
Chicken Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0262 |
Chicken Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
622-Eur |
BGene |
|
| E2044Hu |
Human soluble transferrin receptor1,sTfR1 ELISA Kit |
96T |
450-Eur |
Eastbio |
|
| E12S0263 |
Chicken Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
622-Eur |
BGene |
|
| E01C0209 |
Human soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0256Hu |
Human soluble Cluster of differentiation 86,sCD86 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| CK-E98551 |
Rat Soluble Cluster of differentiation 30 ligand,sCD30L ELISAkit |
|
----Eur |
Glory |
|
| E2044Hu |
Human soluble transferrin receptor1,sTfR1 ELISA Kit |
48T |
290-Eur |
Eastbio |
|
| E0205Hu |
Human soluble interleukin-2 receptor,IL-2sRα ELISA kit |
96T |
483-Eur |
Eastbio |
|
| E0107Mo |
Mouse soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
656-Eur |
Eastbio |
|
| DAG368 |
Recombinant Human Iocitrate Dehydrogenase 1 (NADP+), Soluble |
600 units |
462-Eur |
CDiagnostic |
|
| 228-10915-1 |
Recombinant Human Soluble IL-2R alpha _ IL2RA Proteins |
5 |
147-Eur |
Ray Biotech |
|
| 228-11356-1 |
Recombinant Human Soluble RANKL [GST-fusion] Proteins |
2 |
147-Eur |
Ray Biotech |
|
| E05C0053 |
Guinea soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E05C0209 |
Guinea soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 228-10915-2 |
Recombinant Human Soluble IL-2R alpha _ IL2RA Proteins |
25 |
205-Eur |
Ray Biotech |
|
| 228-11356-2 |
Recombinant Human Soluble RANKL [GST-fusion] Proteins |
10 |
205-Eur |
Ray Biotech |
|
| DS-MB-02832 |
Mouse Anti-Human CD154, soluble Antibodies |
0.2 mg |
411-Eur |
Ray Biotech |
|
| E0142Mo |
Mouse soluble cluster of differentiation 30,sCD30 Elisa Kit |
96T |
656-Eur |
Eastbio |
|
| E0206Hu |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
96T |
483-Eur |
Eastbio |
|
| E11S0239 |
Bovine Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
622-Eur |
BGene |
|
| E0208Hu |
Human soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
96T |
483-Eur |
Eastbio |
|
| E0405Ra |
Rat Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E0406Ra |
Rat Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E0226Hu |
Human soluble Interleukin 6 receptor,sIL-6R_CD126 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E09S0239 |
Monkey Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
622-Eur |
BGene |
|
| E01T0527 |
Human Tumor necrosis factor soluble receptor II |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0414Ra |
Rat soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E04T0527 |
Rabbit Tumor necrosis factor soluble receptor II |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E08C0053 |
Canine soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E01T0526 |
Human Tumor necrosis factor soluble receptor I |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E13T0527 |
Anserine Tumor necrosis factor soluble receptor II |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E13T0526 |
Anserine Tumor necrosis factor soluble receptor I |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E05A0223 |
Guinea soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E09S0224 |
Monkey Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0293 |
Chicken Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11I0381 |
Bovine Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
715-Eur |
Blue Gene Biotech |
|
| E04S0239 |
Rabbit Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
601-Eur |
BGene |
|
| E09S0262 |
Monkey Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
622-Eur |
BGene |
|
| E04S0224 |
Rabbit Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0223 |
Rabbit Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0213 |
Rabbit Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04I0381 |
Rabbit Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
601-Eur |
BGene |
|
| E04I0379 |
Rabbit Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
601-Eur |
BGene |
|
| E09S0263 |
Monkey Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
622-Eur |
BGene |
|
| E09S0224 |
Monkey Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0213 |
Monkey Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0291 |
Monkey Soluble transferrin receptor ELISA
, sTfR |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0262 |
Monkey Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0261 |
Monkey Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
622-Eur |
BGene |
|
| E04C0209 |
Rabbit soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E04S0293 |
Rabbit Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0291 |
Rabbit Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
601-Eur |
BGene |
|
| E11I0379 |
Bovine Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
715-Eur |
Blue Gene Biotech |
|
| E14I0381 |
Sheep Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
96 Tests/kit |
622-Eur |
BGene |
|
| E0301Hu |
Human Soluble Cluster of differentiation 38,sCD38 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E04S0263 |
Rabbit Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0262 |
Rabbit Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0261 |
Rabbit Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
96 Tests/kit |
601-Eur |
BGene |
|
| E0282Hu |
Human soluble cytokine receptor,sCKR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0281Hu |
Human soluble transferrin receptor,sTfR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0273Hu |
human soluble cluster of differentiation 28,sCD28 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E08T0526 |
Canine Tumor necrosis factor soluble receptor I |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E09S0261 |
Monkey Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
715-Eur |
Blue Gene Biotech |
|
| E06C0053 |
Goat soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E09S0223 |
Monkey Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
715-Eur |
Blue Gene Biotech |
|
| TFR11-M |
Monoclonal Anti_Human soluble Transferrin receptor 1 (TfR1) IgG 1 |
100 ug |
479-Eur |
Alpha Diagnostics |
recombinant |
| E03S0224 |
Mouse Soluble Cluster Of Differentiation 80 ELISA,sCD80 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0263 |
Mouse Anti-soluble liver antigen ELISA,SLA |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0262 |
Mouse Soluble interleukin 8 receptor ELISA,Sil-8R_cd128 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0261 |
Mouse Soluble interleukin 7 receptor ELISA,Sil-7R_cd127 |
96 Tests/kit |
601-Eur |
BGene |
|
| E07A0223 |
Porcine soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| cyt-533 |
Recombinant Rat Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
20 |
167-Eur |
Prospecbio |
|
| E07C0053 |
Porcine soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07C0209 |
Porcine soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E09S0294 |
Monkey Soluble toll-like receptor 6 ELISA, STLR-6 |
|
715-Eur |
Blue Gene Biotech |
|
| E0207Hu |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
96T |
483-Eur |
Eastbio |
|
| E14S0239 |
Sheep Soluble cluster of differentiation 86 ELISA, SCD86 |
96 Tests/kit |
622-Eur |
BGene |
|
| E0256Hu |
Human soluble Cluster of differentiation 86,sCD86 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E06T0527 |
Goat Tumor necrosis factor soluble receptor II |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06C0209 |
Goat soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E04C0053 |
Rabbit soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E03S0294 |
Mouse Soluble toll-like receptor 6 ELISA,STLR-6 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0293 |
Mouse Soluble toll-like receptor 2 ELISA,STLR-2 |
96 Tests/kit |
601-Eur |
BGene |
|
| E11C0209 |
Bovine soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11C0053 |
Bovine soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E03S0291 |
Mouse Soluble transferrin receptor ELISA
,sTfR |
96 Tests/kit |
601-Eur |
BGene |
|
| E14S0223 |
Sheep Soluble Cluster of Differentiation 28 ELISA, sCD28 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08T0527 |
Canine Tumor necrosis factor soluble receptor II |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E14S0224 |
Sheep Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11A0223 |
Bovine soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E06T0526 |
Goat Tumor necrosis factor soluble receptor I |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E03S0239 |
Mouse Soluble cluster of differentiation 86 ELISA,SCD86 |
96 Tests/kit |
601-Eur |
BGene |
|
| E11S0262 |
Bovine Soluble interleukin 8 receptor ELISA, Sil-8R_cd128 |
|
715-Eur |
Blue Gene Biotech |
|
| E03C0209 |
Mouse soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0206Hu |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit |
48T |
306-Eur |
Eastbio |
|
| cyt-533 |
Recombinant Rat Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
1mg |
3105-Eur |
Prospecbio |
|
| E09S0213 |
Monkey Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
96 Tests/kit |
622-Eur |
BGene |
|
| E0208Hu |
Human soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
48T |
306-Eur |
Eastbio |
|
| E03A0223 |
Mouse soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E0226Hu |
Human soluble Interleukin 6 receptor,sIL-6R_CD126 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E12I0379 |
Chicken Soluble Interleukin 2a receptor ELISA, IL-2sRa |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0291 |
Goat Soluble transferrin receptor ELISA
, sTfR |
96 Tests/kit |
608-Eur |
BGene |
|
| E0205Hu |
Human soluble interleukin-2 receptor,IL-2sRα ELISA kit |
48T |
306-Eur |
Eastbio |
|
| E03C0053 |
Mouse soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E11S0261 |
Bovine Soluble interleukin 7 receptor ELISA, Sil-7R_cd127 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0294 |
Chicken Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0291 |
Bovine Soluble transferrin receptor ELISA
, sTfR |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0293 |
Goat Soluble toll-like receptor 2 ELISA, STLR-2 |
96 Tests/kit |
608-Eur |
BGene |
|
| E06S0294 |
Goat Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
608-Eur |
BGene |
|
| E11S0224 |
Bovine Soluble Cluster Of Differentiation 80 ELISA, sCD80 |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0223 |
Bovine Soluble Cluster of Differentiation 28 ELISA, sCD28 |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0213 |
Bovine Soluble Cluster Of Differentiation 27 ELISA, sCD27 |
|
715-Eur |
Blue Gene Biotech |
|
| E08C0209 |
Canine soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E02V0005 |
Rat soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E12S0294 |
Chicken Soluble toll-like receptor 6 ELISA, STLR-6 |
|
715-Eur |
Blue Gene Biotech |
|
| E08A0223 |
Canine soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E02S0284 |
Rat soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E06A0223 |
Goat soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E0317Hu |
Human soluble cluster of differentiation 14,sCD14 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0207Hu |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit |
48T |
306-Eur |
Eastbio |
|
| E11S0239 |
Bovine Soluble cluster of differentiation 86 ELISA, SCD86 |
|
715-Eur |
Blue Gene Biotech |
|
| E0303Hu |
Human Soluble Cluster of differentiation 21,sCD21 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E14I0379 |
Sheep Soluble Interleukin 2a receptor ELISA, IL-2sRa |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0293 |
Chicken Soluble toll-like receptor 2 ELISA, STLR-2 |
|
715-Eur |
Blue Gene Biotech |
|
| E0293Mo |
Mouse soluble Cluster of differentiation 86,sCD86 ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E0565Mo |
Mouse soluble interleukin-2 receptor,IL-2sRβ ELISA kit |
96T |
656-Eur |
Eastbio |
|
| E12S0239 |
Chicken Soluble cluster of differentiation 86 ELISA, SCD86 |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0294 |
Bovine Soluble toll-like receptor 6 ELISA, STLR-6 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0263 |
Goat Anti-soluble liver antigen ELISA, SLA |
96 Tests/kit |
608-Eur |
BGene |
|
| E12I0381 |
Chicken Soluble Interleukin 2β receptor ELISA, IL-2sRβ |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0293 |
Bovine Soluble toll-like receptor 2 ELISA, STLR-2 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0263 |
Chicken Anti-soluble liver antigen ELISA, SLA |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0263 |
Bovine Anti-soluble liver antigen ELISA, SLA |
|
715-Eur |
Blue Gene Biotech |
|
| E04S0294 |
Rabbit Soluble toll-like receptor 6 ELISA, STLR-6 |
96 Tests/kit |
601-Eur |
BGene |
|
| 26444-72-4 |
tris[(dimethylamino)methyl]phenol tris[(dimethylamino)met |
1g |
----Eur |
chemotra |
|
| 2078-54-8 |
2,6_Di Iso Propyl Phenol 2,6_Di Iso Propyl Pheno |
1g |
----Eur |
chemotra |
|
| 5424-54-4 |
2,4_bis[(dimethylamino)methyl]phenol 2,4_bis[(dimethylamino) |
1g |
----Eur |
chemotra |
|
| 83804-01-7 |
tris[1-(methylphenyl)ethyl]phenol tris[1-(methylphenyl)eth |
1g |
----Eur |
chemotra |
|
| 25640-71-5 |
tris(1-phenylethyl)phenol tris(1-phenylethyl)phen |
1g |
----Eur |
chemotra |
|
| 84878-44-4 |
[[(6_Aminohexyl)amino]methyl]phenol [[(6_Aminohexyl)amino] |
1g |
----Eur |
chemotra |
|
| 53894-28-3 |
[[(2_aminoethyl)amino]methyl]phenol [[(2_aminoethyl)amino] |
1g |
----Eur |
chemotra |
|
| 63661-65-4 |
sodium 2-methoxy-4-(1-propenyl)phenol sodium 2-methoxy-4-(1 |
1g |
----Eur |
chemotra |
|
| E03C0053 |
Mouse anti-soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E01S0265 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| AGHIV-0225 |
rHIV gp41, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
212-Eur |
Arista |
|
| 201-02-0056 |
Mouse Soluble Cluster of differentiation 40 ligand(sCD40L)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| 201-12-2134 |
Human soluble vascular adhesion protein-1,sVAP-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-09-0142 |
Rabbit soluble cluster of differentiation 40 ligand(sCD40L)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| E05L0229 |
Guinea lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| AGHIV-0215 |
rHIV gp36, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
206-Eur |
Arista |
|
| 201-02-0280 |
Mouse Soluble Intercellular Adhesion Molecule 1(sICAM-1)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| 201-09-0155 |
Rabbit soluble Factor-related Apoptosis(sFAS_Apo-1)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| 201-12-0218 |
Human soluble Tumor Necrosis Factorαreceptor,sTNFαR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| E01S0284 |
Human soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| QY-E02481 |
Human Soluble Cluster of differentiation 40 ligand(sCD40L)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E03A0223 |
Mouse anti-soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| 201-09-0165 |
Rabbit soluble endothelial protein C receptor(sEPCR)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| AGHCV-0232 |
rHCV Cocktail, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
206-Eur |
Arista |
|
| E08L0229 |
Canine lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| 201-12-2047 |
Human soluble tumor necrosis factor 1,sTNF-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| QY-E02483 |
Human Soluble Cluster of differentiation 30 ligand(sCD30L)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CK-E98805 |
Porcine Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISAkit |
|
----Eur |
Glory |
|
| 201-09-0034 |
rabbit Soluble Intercellular Adhesion Molecule-1(sICAM-1)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| E08S0265 |
Canine Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| AGHIV-0225 |
rHIV gp41, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
238-Eur |
Arista |
|
| E05S0284 |
Guinea soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| 201-02-0007 |
Mouse soluble endothelial protein C receptor(sEPCR)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| E12S0258 |
Chicken Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-02-0166 |
Mouse soluble myosin heavy chain 1(sMHC-1)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| E03C0209 |
Mouse anti-soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| AGHIV-0255 |
rHIV gp13, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
304-Eur |
Arista |
|
| AGHIV-0215 |
rHIV gp36, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
258-Eur |
Arista |
|
| AGHIV-0255 |
rHIV gp13, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
278-Eur |
Arista |
|
| E05S0265 |
Guinea Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E04V0005 |
Rabbit soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| 201-02-0167 |
Mouse soluble myosin heavy chain 2(sMHC-2)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| CSB-E12742h |
Human soluble terminal complement complex SC5b9 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| E08S0284 |
Canine soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E08V0005 |
Canine soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CSB-E11155m |
Mouse soluble myosin heavy chain 1,sMHC_1 ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| CSB-E11156m |
Mouse soluble myosin heavy chain 2,sMHC_2 ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| AGHIV-0255 |
rHIV gp13, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
252-Eur |
Arista |
|
| 201-02-0058 |
Mouse Soluble Cluster of differentiation 30 ligand(sCD30L)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| E05V0005 |
Guinea soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| CSB-E11301h |
Human soluble cluster of differentiation 44 variant 9,sCD44_v9 ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| E02V0005 |
Rat anti-soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| AGHIV-0225 |
rHIV gp41, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
264-Eur |
Arista |
|
| SEH839Ra |
ELISA Kit for Isocitrate Dehydrogenase 1, Soluble (IDH1) Rattus norvegicus (Rat) |
96T |
738-Eur |
USCNLife |
|
| 201-12-2046 |
Human soluble cell adhesion molecule 26,sCD26 ELISA KIT |
96T |
476-Eur |
SunBT |
|
| CSB-E04700r |
Rat platelet_derived growth factor soluble receptor á,PDGFsR_á ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| 201-12-2046 |
Human soluble cell adhesion molecule 26,sCD26 ELISA KIT |
48T |
295-Eur |
SunBT |
|
| CSB-E09099h |
Human soluble tumor necrosis Factoráreceptor,sTNFáR ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E09097h |
Human soluble fibrin monomer complex,SFMC ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E09095h |
Human soluble Factor_related Apoptosis ligand,sFASL_Apo_1 ELISA Kit |
96T |
662-Eur |
Cusabio |
elisa |
| CSB-E08153p |
Porcine Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96T |
701-Eur |
Cusabio |
elisa |
| 201-12-1666 |
human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CSB-E04714h |
Human soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
542-Eur |
Cusabio |
elisa |
| CSB-E04715m |
Mouse soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
626-Eur |
Cusabio |
elisa |
| CSB-E04716h |
Human soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
634-Eur |
Cusabio |
elisa |
| CSB-E07992m |
Mouse Soluble Intercellular Adhesion Molecule 1,sICAM_1 ELISA Kit |
96T |
701-Eur |
Cusabio |
elisa |
| 201-12-0205 |
Human Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
476-Eur |
SunBT |
|
| CSB-E04530m |
Mouse soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| CSB-E04529Ch |
Chicken soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
710-Eur |
Cusabio |
elisa |
| SEC823Hu |
ELISA Kit for Thymidine Kinase 1, Soluble (TK1) Homo sapiens (Human) |
96T |
688-Eur |
USCNLife |
|
| SEA936Mu |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) Mus musculus (Mouse) |
96T |
644-Eur |
USCNLife |
|
| E01T0526 |
Human Anti-Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| SEB960Mu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Mus musculus (Mouse) |
96T |
675-Eur |
USCNLife |
|
| E13T0527 |
Anserine anti - Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| 201-09-0142 |
Rabbit soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
719-Eur |
SunBT |
|
| 201-09-0165 |
Rabbit soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
719-Eur |
SunBT |
|
| 201-09-0155 |
Rabbit soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
96T |
719-Eur |
SunBT |
|
| CSB-E09267Rb |
Rabbit soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
972-Eur |
Cusabio |
elisa |
| SEB960Ra |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Rattus norvegicus (Rat) |
96T |
706-Eur |
USCNLife |
|
| 201-09-0034 |
rabbit Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
719-Eur |
SunBT |
|
| E13T0526 |
Anserine anti - Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| 201-12-1666 |
human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| CSB-E07991h |
Human Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E04717m |
Mouse soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
626-Eur |
Cusabio |
elisa |
| CSB-E07990r |
Rat soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| E14S0258 |
Sheep Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
622-Eur |
BGene |
|
| AGHIV-0215 |
rHIV gp36, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
232-Eur |
Arista |
|
| 31321 |
Porcine Soluble InteFAellular Adhesion Molecule-2(sICAM-2) ELISA Kit |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| E14S0255 |
Sheep Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
622-Eur |
BGene |
|
| E14S0254 |
Sheep Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-12-0178 |
Human soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E14S0250 |
Sheep Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
622-Eur |
BGene |
|
| E14S0249 |
Sheep soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E06943Rb |
Rabbit Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96T |
740-Eur |
Cusabio |
elisa |
| 201-12-0264 |
Human Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 27877 |
Mouse Soluble InteFAellular Adhesion Molecule-2(sICAM-2) ELISA Kit |
20ng/ml-0.312ng/ml <0.06ng/ml |
650-Eur |
TEFL |
|
| E14S0238 |
Sheep Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
622-Eur |
BGene |
|
| E07T0526 |
Porcine anti-Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E07T0527 |
Porcine anti-Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| 201-12-0252 |
Human Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E14C0209 |
Sheep soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
622-Eur |
BGene |
|
| E14F0103 |
Sheep Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-12-0243 |
Human soluble cluster of differentiation 44 variant 9,sCD44-v9 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-2134 |
Human soluble vascular adhesion protein-1,sVAP-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| HGP362-R |
Recombinant (E. coli) HIV gp36 protein (soluble) Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
238-Eur |
ADI |
|
| 201-12-0218 |
Human soluble Tumor Necrosis Factorαreceptor,sTNFαR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 33386 |
Rabbit Soluble InteFAellular Adhesion Molecule-2(sICAM-2) ELISA Kit |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| E14L0229 |
Sheep Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-12-1246 |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-1823 |
Human soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-1168 |
Human soluble fibrin monomer complex,SFMC ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-2047 |
Human soluble tumor necrosis factor 1,sTNF-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| HGP411-R |
Recombinant (E. coli) HIV-1 gp41, protein (soluble) Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
238-Eur |
ADI |
|
| AGHCV-0231 |
rHCV Cocktail, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
206-Eur |
Arista |
|
| E09S0255 |
Monkey Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
622-Eur |
BGene |
|
| E09S0254 |
Monkey Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E09S0249 |
Monkey soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
622-Eur |
BGene |
|
| AGHCV-0231 |
rHCV Cocktail, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
167-Eur |
Arista |
|
| AGHCV-0217 |
rHCV Core, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
167-Eur |
Arista |
|
| 201-12-0178 |
Human soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| AGHIV-0241 |
rHIV gp41, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
160-Eur |
Arista |
|
| AGHIV-0238 |
rHIV gp41, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
160-Eur |
Arista |
|
| AGHIV-0237 |
rHIV gp41, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
160-Eur |
Arista |
|
| CSB-E10036Mo |
Monkey Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96T |
740-Eur |
Cusabio |
elisa |
| E03T0526 |
Mouse anti-Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E03T0527 |
Mouse anti-Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| RCYT-285C |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha |
1mg |
4919-Eur |
SeraLab |
|
| E09S0258 |
Monkey Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
622-Eur |
BGene |
|
| AGHCV-0232 |
rHCV Cocktail, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
167-Eur |
Arista |
|
| AGHCV-0217 |
rHCV Core, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
206-Eur |
Arista |
|
| CSB-E11154h |
Human soluble myosin heavy chain 1,sMHC_1 ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| AGHIV-0213 |
rHIV gp36, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
186-Eur |
Arista |
|
| AGHIV-0212 |
rHIV gp36, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
186-Eur |
Arista |
|
| AGHCV-0232 |
rHCV Cocktail, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
186-Eur |
Arista |
|
| CK-E98561 |
Rat Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISAkit |
|
----Eur |
Glory |
|
| AGHCV-0231 |
rHCV Cocktail, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
186-Eur |
Arista |
|
| AGHCV-0217 |
rHCV Core, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
186-Eur |
Arista |
|
| AGHIV-0241 |
rHIV gp41, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
179-Eur |
Arista |
|
| AGHIV-0238 |
rHIV gp41, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
179-Eur |
Arista |
|
| AGHIV-0237 |
rHIV gp41, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
179-Eur |
Arista |
|
| AGHIV-0222.2 |
rHIV gp41, soluble, Antigens - Infectious Disease |
1-99 mg/ml/ea price |
179-Eur |
Arista |
|
| CK-E98560 |
Rat Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISAkit |
|
----Eur |
Glory |
|
| E04A0223 |
Rabbit anti-soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| AGHIV-0222.2 |
rHIV gp41, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
160-Eur |
Arista |
|
| E09F0103 |
Monkey Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E09C0209 |
Monkey soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E09870Ch |
Chicken Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96T |
662-Eur |
Cusabio |
elisa |
| CGHIV-0640 |
rHIV p24, soluble CGC, Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
89-Eur |
Arista |
|
| CSB-E09835Rb |
Rabbit soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
972-Eur |
Cusabio |
elisa |
| E02L0229 |
Rat anti-lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| 201-12-0243 |
Human soluble cluster of differentiation 44 variant 9,sCD44-v9 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-0252 |
Human Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CGHIV-0640 |
rHIV p24, soluble CGC, Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
82-Eur |
Arista |
|
| SEB428Ra |
ELISA Kit for Adenylate Cyclase 10, Soluble (ADCY10) Rattus norvegicus (Rat) |
96T |
706-Eur |
USCNLife |
|
| SEB428Mu |
ELISA Kit for Adenylate Cyclase 10, Soluble (ADCY10) Mus musculus (Mouse) |
96T |
675-Eur |
USCNLife |
|
| 201-12-0205 |
Human Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
48T |
295-Eur |
SunBT |
|
| E01L0229 |
Human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E09L0229 |
Monkey Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-12-1823 |
Human soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| AGHIV-0213 |
rHIV gp36, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
160-Eur |
Arista |
|
| E09S0238 |
Monkey Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
622-Eur |
BGene |
|
| AGHIV-0212 |
rHIV gp36, soluble, Antigens - Infectious Disease |
100-999 mg/ml/ea price |
160-Eur |
Arista |
|
| AGHIV-0241 |
rHIV gp41, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
141-Eur |
Arista |
|
| AGHIV-0238 |
rHIV gp41, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
141-Eur |
Arista |
|
| AGHIV-0237 |
rHIV gp41, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
141-Eur |
Arista |
|
| AGHIV-0222.2 |
rHIV gp41, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
141-Eur |
Arista |
|
| 201-12-0264 |
Human Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| AGHIV-0213 |
rHIV gp36, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
134-Eur |
Arista |
|
| AGHIV-0212 |
rHIV gp36, soluble, Antigens - Infectious Disease |
>1000 mg/ml/ea price |
134-Eur |
Arista |
|
| 201-12-1168 |
Human soluble fibrin monomer complex,SFMC ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CGHIV-0640 |
rHIV p24, soluble CGC, Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
96-Eur |
Arista |
|
| CSB-E09901h |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| SEA936Ra |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) Rattus norvegicus (Rat) |
96T |
675-Eur |
USCNLife |
|
| C275 |
Recombinant Human α-Soluble NSF Attachment Protein_SNAP-α, Source: E. coli |
50μg |
450-Eur |
Novoprotein |
|
| E-EL-M1078 |
Mouse sMHC-1 (soluble myosin heavy chain 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-M1079 |
Mouse sMHC-2 (soluble myosin heavy chain 2) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| CSB-E04717m |
Mouse soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E04716h |
Human soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E04715m |
Mouse soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E04714h |
Human soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E04700r |
Rat platelet_derived growth factor soluble receptor á,PDGFsR_á ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| E-EL-P0191 |
Porcine sFMC (Soluble Fibrin Monomer Complex) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| cyt-294 |
Recombinant Bovine Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
1mg |
3105-Eur |
Prospecbio |
|
| cyt-293 |
Recombinant Ovine Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
1mg |
3105-Eur |
Prospecbio |
|
| cyt-268 |
Recombinant Rabbit Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
1mg |
3105-Eur |
Prospecbio |
|
| E-EL-P0773 |
Porcine SEPCR_PROCR (Soluble Endothelial Protein C Receptor) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| CSB-E04530m |
Mouse soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| CSB-E04529Ch |
Chicken soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| cyt-286 |
Recombinant Human Soluble IL-6 Receptor alpha CYTOKINES AND GROWTH FACTORS |
1mg |
3950-Eur |
Prospecbio |
|
| cyt-320 |
Recombinant Mouse Soluble RANK Ligand CYTOKINES AND GROWTH FACTORS |
10 |
167-Eur |
Prospecbio |
|
| E-EL-P1203 |
Porcine sICAM-1 (Soluble Intercellular Adhesion Molecule-1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| 201-12-1168 |
Human soluble fibrin monomer complex(SFMC)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| cyt-245 |
Recombinant Human soluble CD40 Ligand_TRAP CYTOKINES AND GROWTH FACTORS |
1mg |
1337-Eur |
Prospecbio |
|
| C275 |
Recombinant Human α-Soluble NSF Attachment Protein_SNAP-α, Source: E. coli |
500ug |
1451-Eur |
Novoprotein |
|
| C275 |
Recombinant Human α-Soluble NSF Attachment Protein_SNAP-α, Source: E. coli |
1mg |
2052-Eur |
Novoprotein |
|
| 201-12-1823 |
Human soluble Factor-related Apoptosis(sFAS_Apo-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-12-1246 |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit |
48T |
295-Eur |
SunBT |
|
| E-EL-R0910 |
Rat SVCAM-1 (Soluble Vascuolar Cell Adhesion Molecule 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| 201-12-1666 |
Human lectin-galactose binding-soluble 3(Lgals3)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| cyt-320 |
Recombinant Mouse Soluble RANK Ligand CYTOKINES AND GROWTH FACTORS |
1mg |
4340-Eur |
Prospecbio |
|
| CSB-E06943Rb |
Rabbit Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
740-Eur |
Cusabio |
elisa |
| cyt-631 |
Recombinant Human Soluble RANK Ligand GST Tag CYTOKINES AND GROWTH FACTORS |
0.1mg |
1051-Eur |
Prospecbio |
|
| E-EL-M1068 |
Mouse sCD30l (Soluble Cluster of differentiation 30 ligand) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| cyt-692 |
Recombinant Human Soluble RANK Ligand His Tag CYTOKINES AND GROWTH FACTORS |
1mg |
2520-Eur |
Prospecbio |
|
| E-EL-M1070 |
Mouse sCD40L (Soluble Cluster of differentiation 40 ligand) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| cyt-334 |
Recombinant Human Soluble RANK Ligand CYTOKINES AND GROWTH FACTORS |
1mg |
4340-Eur |
Prospecbio |
|
| E-EL-M1073 |
Mouse sEPCR (Soluble Endothelial Protein C Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| cyt-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP CYTOKINES AND GROWTH FACTORS |
1mg |
2520-Eur |
Prospecbio |
|
| cyt-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag CYTOKINES AND GROWTH FACTORS |
1mg |
2520-Eur |
Prospecbio |
|
| 201-12-1246 |
Human soluble endothelial protein C receptor(sEPCR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E-EL-P1621 |
Porcine sTNF-1 (Soluble Tumor Necrosis Factor 1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-P2030 |
Porcine LGALS3 (Lectin-Galactoside Binding Soluble 3) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| cyt-631 |
Recombinant Human Soluble RANK Ligand GST Tag CYTOKINES AND GROWTH FACTORS |
10 |
167-Eur |
Prospecbio |
|
| E-EL-MK0260 |
Monkey sFMC (Soluble Fibrin Monomer Complex) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| 201-12-0205 |
Human Soluble Cluster of differentiation 30 ligand(sCD30L)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| cyt-286 |
Recombinant Human Soluble IL-6 Receptor alpha CYTOKINES AND GROWTH FACTORS |
20 |
167-Eur |
Prospecbio |
|
| 201-12-0178 |
Human soluble myosin heavy chain 1(sMHC-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E-EL-MK0394 |
Monkey SEPCR_PROCR (Soluble Endothelial Protein C Receptor) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| cyt-320 |
Recombinant Mouse Soluble RANK Ligand CYTOKINES AND GROWTH FACTORS |
2 |
96-Eur |
Prospecbio |
|
| cyt-631 |
Recombinant Human Soluble RANK Ligand GST Tag CYTOKINES AND GROWTH FACTORS |
2 |
96-Eur |
Prospecbio |
|
| 65-024102 |
HIV1 gp160 IIIB soluble protein (HRP), Conjugated Proteins |
50 ug |
590-Eur |
Fitzgerald |
|
| E07L0229 |
Porcine Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
608-Eur |
BGene |
|
| CK-E97288 |
Human soluble fibrin monomer complex,SFMC ELISAkit |
|
----Eur |
Glory |
|
| CK-E97397 |
human lectin-galactose binding-soluble 3,Lgals3 ELISAkit |
|
----Eur |
Glory |
|
| DS-MB-03300 |
Mouse Anti-Human Guanylate Cyclase beta 1 (Soluble) |
200 |
516-Eur |
Ray Biotech |
human |
| CK-E97589 |
Mouse soluble myosin heavy chain 2,sMHC-2 ELISAkit |
|
----Eur |
Glory |
|
| CK-E97590 |
Mouse soluble myosin heavy chain 1,sMHC-1 ELISAkit |
|
----Eur |
Glory |
|
| CK-E97609 |
Mouse soluble endothelial protein C receptor,sEPCR ELISAkit |
|
----Eur |
Glory |
|
| CK-E97711 |
Mouse Soluble Cluster of differentiation 30 ligand,sCD30L ELISAkit |
|
----Eur |
Glory |
|
| E07S0238 |
Porcine Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
608-Eur |
BGene |
|
| cyt-268 |
Recombinant Rabbit Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
20 |
167-Eur |
Prospecbio |
|
| E-EL-MK0010 |
Monkey sICAM-1 (Soluble Intercellular Adhesion Molecule-1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| cyt-692 |
Recombinant Human Soluble RANK Ligand His Tag CYTOKINES AND GROWTH FACTORS |
20 |
167-Eur |
Prospecbio |
|
| cyt-334 |
Recombinant Human Soluble RANK Ligand CYTOKINES AND GROWTH FACTORS |
10 |
167-Eur |
Prospecbio |
|
| E-EL-Ch0320 |
Chicken sICAM-1 (Soluble Intercellular Adhesion Molecule-1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| 201-12-0264 |
Human Soluble Intercellular Adhesion Molecule-1(sICAM-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E-EL-Ch0417 |
Chicken LGALS3 (Lectin-Galactoside Binding Soluble 3) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-Ch0742 |
Chicken sTNF-1 (Soluble Tumor Necrosis Factor 1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| cyt-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP CYTOKINES AND GROWTH FACTORS |
25 |
167-Eur |
Prospecbio |
|
| 201-12-0252 |
Human Soluble Cluster of differentiation 40 ligand(sCD40L)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| cyt-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag CYTOKINES AND GROWTH FACTORS |
20 |
167-Eur |
Prospecbio |
|
| E-EL-Ch0901 |
Chicken sFMC (Soluble Fibrin Monomer Complex) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| cyt-245 |
Recombinant Human soluble CD40 Ligand_TRAP CYTOKINES AND GROWTH FACTORS |
50 |
167-Eur |
Prospecbio |
|
| 201-12-0243 |
Human soluble cluster of differentiation 44 variant 9(sCD44-v9)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E-EL-Ch1347 |
Chicken SEPCR_PROCR (Soluble Endothelial Protein C Receptor) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| 201-12-0218 |
Human soluble Tumor Necrosis Factorαreceptor(sTNFαR)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| cyt-294 |
Recombinant Bovine Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
20 |
167-Eur |
Prospecbio |
|
| cyt-293 |
Recombinant Ovine Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
20 |
167-Eur |
Prospecbio |
|
| E-EL-MK0003 |
Monkey sTNF-1 (Soluble Tumor Necrosis Factor 1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E07S0249 |
Porcine soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
608-Eur |
BGene |
|
| 201-12-2046 |
Human soluble cell adhesion molecule 26(sCD26)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| QY-E21388 |
Mouse soluble vascular adhesion protein-1(sVAP-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| PE130974h |
Recombinant human Soluble calcium-activated nucleotidase 1 protein |
1mg |
1438-Eur |
Biomatic |
|
| PE130944h |
Recombinant human Soluble calcium-activated nucleotidase 1 protein |
1mg |
1438-Eur |
Biomatic |
|
| PE130974h |
Recombinant human Soluble calcium-activated nucleotidase 1 protein |
5mg |
3162-Eur |
Biomatic |
|
| PE130944h |
Recombinant human Soluble calcium-activated nucleotidase 1 protein |
5mg |
3162-Eur |
Biomatic |
|
| 228-10198-1 |
Recombinant Human soluble CD40 Ligand _ TRAP, His-tagged |
2 |
201-Eur |
Ray Biotech |
recombinant |
| 228-10198-2 |
Recombinant Human soluble CD40 Ligand _ TRAP, His-tagged |
10 |
290-Eur |
Ray Biotech |
recombinant |
| 228-10916-1 |
Recombinant Human Soluble Interleukin-2 Receptor alpha (IL-2R), GST fusion |
2 |
422-Eur |
Ray Biotech |
recombinant |
| 228-10916-2 |
Recombinant Human Soluble interleukin-2 Receptor alpha (IL-2R), GST fusion |
5 |
566-Eur |
Ray Biotech |
recombinant |
| 228-10916-3 |
Recombinant Human Soluble Interleukin-2 Receptor alpha (IL-2R), GST fusion |
10 |
868-Eur |
Ray Biotech |
recombinant |
| C-02390 |
CASEIN SOLUBLE IN ALKALI (Nitrogen in dried material : 13.5-15.5%) CAS: 9000-71-9 |
500 gm |
126-Eur |
Oxford Lab |
|
| C-02390 |
CASEIN SOLUBLE IN ALKALI (Nitrogen in dried material : 13.5-15.5%) CAS: 9000-71-9 |
10x500 gm |
334-Eur |
Oxford Lab |
|
| 201-11-0768 |
Rat Tumor necrosis factor soluble receptor Ⅱ(TNFsR-Ⅱ)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0767 |
Rat Tumor necrosis factor soluble receptor Ⅰ(TNFsR-Ⅰ)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| E-03663 |
EOSINE YELLOW SPIRIT SOLUBLE (For Microscopy) (C.I.No.45386) CAS: 6359-05-3 |
25 gm |
108-Eur |
Oxford Lab |
|
| E-03663 |
EOSINE YELLOW SPIRIT SOLUBLE (For Microscopy) (C.I.No.45386) CAS: 6359-05-3 |
100 gm |
126-Eur |
Oxford Lab |
|
| CSB-E12742h |
Human soluble terminal complement complex SC5b9 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| 4GC1-GC10 |
Guanylate cyclase soluble GUCY1A3 (subunit alpha) |
1 mg |
666-Eur |
ACR |
|
| PE130944h |
Recombinant human Soluble calcium-activated nucleotidase 1 protein |
200ug |
510-Eur |
Biomatic |
|
| PE130974h |
Recombinant human Soluble calcium-activated nucleotidase 1 protein |
200ug |
510-Eur |
Biomatic |
|
| QY-E40088 |
Porcine soluble intercellular adhesion molecule-1 (sICAM-1) ELISA Kit |
96T |
519-Eur |
SQBIO |
|
| QY-E21371 |
Mouse Soluble Intercellular Adhesion Molecule 1(sICAM-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21370 |
Mouse soluble Factor-related Apoptosis(sFAS_Apo-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21368 |
Mouse soluble endothelial protein C receptor(sEPCR)ELISA Kit |
96T |
519-Eur |
SQBIO |
|
| QY-E21366 |
Mouse Soluble Cluster of differentiation 40 ligand(sCD40L)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21365 |
Mouse Soluble Cluster of differentiation 30 ligand(sCD30L)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E30106 |
rabbit Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| QY-E30107 |
Rabbit soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| QY-E30109 |
Rabbit soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| QY-E30110 |
Rabbit soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| QY-E10877 |
Rat Tumor necrosis factor soluble receptor Ⅱ(TNFsR-Ⅱ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E10878 |
Rat Tumor necrosis factor soluble receptor Ⅰ(TNFsR-Ⅰ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E11223 |
Rat soluble Vascuolar cell adhesion molecule 1(sVCAM-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E70110 |
Canine Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
555-Eur |
SQBIO |
|
| QY-E70108 |
Canine Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
555-Eur |
SQBIO |
|
| PE130974h |
Recombinant human Soluble calcium-activated nucleotidase 1 protein |
50ug |
280-Eur |
Biomatic |
|
| PE130944h |
Recombinant human Soluble calcium-activated nucleotidase 1 protein |
50ug |
280-Eur |
Biomatic |
|
| 4GC1-GC11 |
Guanylate cyclase soluble GUCY1B3 (subunit beta) |
1 mg |
666-Eur |
ACR |
|
| CSB-E11301h |
Human soluble cluster of differentiation 44 variant 9,sCD44_v9 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| 4GC1-GC25 |
Guanylate cyclase soluble GUCY1B3 (subunit beta) |
1 mg |
666-Eur |
ACR |
|
| S01-M44 |
TIE-2, soluble Mouse Host: Insect cells Tek; Hyk; Tie2; tie-2; Cd202b; AA517024 |
50 |
251-Eur |
Reliatech |
|
| CSB-E09099h |
Human soluble tumor necrosis Factoráreceptor,sTNFáR ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E09097h |
Human soluble fibrin monomer complex,SFMC ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E09095h |
Human soluble Factor_related Apoptosis ligand,sFASL_Apo_1 ELISA Kit |
96tests |
662-Eur |
Cusabio |
elisa |
| CSB-E08153p |
Porcine Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| DAG275 |
Recombinant Human Soluble Lectin-like Oxidized LDL Receptor-1 (sLOX) |
100ug |
2265-Eur |
CDiagnostic |
|
| E-EL-H1628 |
Human LGALS3 (Lectin-Galactoside Binding Soluble 3) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| 201-12-4145 |
Human Lectin, Galactoside-Binding Soluble 16(LGALS16)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E-EL-H1639 |
Human sFMC (Soluble Fibrin Monomer Complex) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-H1643 |
Human sTNF-1 (Soluble Tumor Necrosis Factor 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| CSB-E07992m |
Mouse Soluble Intercellular Adhesion Molecule 1,sICAM_1 ELISA Kit |
96tests |
701-Eur |
Cusabio |
elisa |
| CSB-E07991h |
Human Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E07990r |
Rat soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| E-EL-H2369 |
Human SEPCR_PROCR (Soluble Endothelial Protein C Receptor) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| WAK-AQ-250-50L |
AquaClean, Microbiocidal Additive for Water Soluble Heating Bath Fluids |
250 ml |
99-Eur |
WAK - Chemie Medical GmbH |
|
| C275 |
Recombinant Human α-Soluble NSF Attachment Protein_SNAP-α, Source: E. coli |
10μg |
186-Eur |
Novoprotein |
|
| 201-12-2134 |
Human soluble vascular adhesion protein-1(sVAP-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CSB-E09267Rb |
Rabbit soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| S01-M43 |
TIE-2, soluble Mouse Host: Insect cells Tek; Hyk; Tie2; tie-2; Cd202b; AA517024 |
10 |
114-Eur |
Reliatech |
|
| 4GC1-GC30 |
Guanylate cyclase soluble GUCY1B3 (subunit beta) |
1 mg |
666-Eur |
ACR |
|
| 201-11-0422 |
Rat soluble Vascuolar cell adhesion molecule 1(sVCAM-1)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 4GC1-GC44 |
Guanylate cyclase soluble GUCY1A3 (subunit alpha) |
1 mg |
666-Eur |
ACR |
|
| CSB-E11156m |
Mouse soluble myosin heavy chain 2,sMHC_2 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E11155m |
Mouse soluble myosin heavy chain 1,sMHC_1 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E11154h |
Human soluble myosin heavy chain 1,sMHC_1 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| AP10312CP-N |
Guanylate cyclase soluble GUCY1A3 (C_term) Control Peptide |
0.25 mg |
206-Eur |
ACR |
elisa |
| AP10315CP-N |
Guanylate cyclase soluble GUCY1B3 (aa 189_207) Control peptide |
0.25 mg |
206-Eur |
ACR |
elisa |
| CSB-E10036Mo |
Monkey Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
740-Eur |
Cusabio |
elisa |
| NB100-91798 |
Guanylate cyclase soluble GUCY1B3 (subunit beta_1_3) |
0.1 mg |
597-Eur |
ACR |
|
| CSB-E09901h |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E09870Ch |
Chicken Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
662-Eur |
Cusabio |
elisa |
| S01-034 |
IL-6 receptor alpha, soluble Human Host: HEK 293 cells Il6r; CD126; IL-6R |
20 |
232-Eur |
Reliatech |
|
| CSB-E09835Rb |
Rabbit soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| S01-R46 |
Podoplanin, soluble Rat Host: E. coli Pdpn; E11; Gp38; OTS-8; RTI40; T1-alpha |
5 |
88-Eur |
Reliatech |
|
| SFC-031 |
TIE-1_Fc Chimera, soluble Mouse Host: CHO cells Tie1; TIE; tie-1; D430008P04Rik |
20 |
108-Eur |
Reliatech |
|
| SFC-032 |
TIE-1_Fc Chimera, soluble Mouse Host: CHO cells Tie1; TIE; tie-1; D430008P04Rik |
100 |
251-Eur |
Reliatech |
|
| 201-12-2047 |
Human soluble tumor necrosis factor 1(sTNF-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| NB100-91798 |
Guanylate cyclase soluble GUCY1B3 (subunit beta_1_3) |
0.1 mg |
498-Eur |
ACR |
|
| 4GC1-GC10 |
Guanylate cyclase soluble GUCY1A3 (subunit alpha) |
1 mg |
557-Eur |
ACR |
|
| CK-E30439 |
Rat soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-EL015447BO |
Bovine Alpha-soluble NSF attachment protein(NAPA) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| E05T0526 |
Guinea anti-Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E05T0527 |
Guinea anti-Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| CSB-EL015448BO |
Bovine Beta-soluble NSF attachment protein(NAPB) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| E06A0223 |
Goat anti-soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E08A0223 |
Canine anti-soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| CSB-EL002562BO |
Bovine Brain acid soluble protein 1(BASP1) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| E08C0053 |
Canine anti-soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| E08C0209 |
Canine anti-soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| CSB-EL015450BO |
Bovine Gamma-soluble NSF attachment protein(NAPG) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| E04C0053 |
Rabbit anti-soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E04C0209 |
Rabbit anti-soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| CSB-EL002562CH |
Chicken Brain acid soluble protein 1(BASP1) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| CSB-EL010050DO |
Dog Guanylate cyclase soluble subunit alpha-3(GUCY1A3) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| CSB-EL010052DO |
Dog Guanylate cyclase soluble subunit beta-1(GUCY1B3) ELISA kit |
96T |
710-Eur |
Cusabio |
|
| 4GC1-GC11 |
Guanylate cyclase soluble GUCY1B3 (subunit beta) |
1 mg |
557-Eur |
ACR |
|
| 4GC1-GC25 |
Guanylate cyclase soluble GUCY1B3 (subunit beta) |
1 mg |
557-Eur |
ACR |
|
| CSB-EL004484MO |
Mouse Soluble calcium-activated nucleotidase 1(CANT1) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| AP10315CP-N |
Guanylate cyclase soluble GUCY1B3 (189_207) Control peptide |
0.25 mg |
166-Eur |
ACR |
|
| CK-E80147 |
rabbit Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| AP10312CP-N |
Guanylate cyclase soluble GUCY1A3 (C_term) Control Peptide |
0.25 mg |
166-Eur |
ACR |
|
| CSB-E11155m |
Mouse soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| CK-E80026 |
Rabbit soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-E11156m |
Mouse soluble myosin heavy chain 2,sMHC-2 ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| CK-E60035 |
Chicken Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E50056 |
Porcine Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-EL010049RA |
Rat Guanylate cyclase soluble subunit alpha-2(GUCY1A2) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL010050RA |
Rat Guanylate cyclase soluble subunit alpha-3(GUCY1A3) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL010052RA |
Rat Guanylate cyclase soluble subunit beta-1(GUCY1B3) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL010051RA |
Rat Guanylate cyclase soluble subunit beta-2(GUCY1B2) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| 4GC1-GC44 |
Guanylate cyclase soluble GUCY1A3 (subunit alpha) |
1 mg |
557-Eur |
ACR |
|
| CK-E30526 |
Rat Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
96T |
454-Eur |
Eastbio |
|
| CK-E30525 |
Rat Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT |
96T |
454-Eur |
Eastbio |
|
| 4GC1-GC30 |
Guanylate cyclase soluble GUCY1B3 (subunit beta) |
1 mg |
557-Eur |
ACR |
|
| CSB-E14255Ha |
Hamster Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
710-Eur |
Cusabio |
|
| RD172254100 |
Human, Galactosidase-binding soluble lectin 13, E.coli , Rec. Prot. |
0.1 mg |
352-Eur |
Biovendor |
|
| CK-E20214 |
Mouse Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| QY-E02473 |
Human Lectin, Galactoside-Binding Soluble 16(LGALS16)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| CK-E10055 |
Human soluble Tumor Necrosis Factorαreceptor,sTNFαR ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| 201-11-0768 |
Rat Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
96T |
490-Eur |
SunBT |
|
| 186-01474 |
RANK Ligand Soluble, Human, recombinant (RANKL) Proteins |
50 ug |
2355-Eur |
B-Bridge |
|
| 184-01791 |
RANK Ligand Soluble, Mouse, recombinant (RANKL) Proteins |
10 ug |
676-Eur |
B-Bridge |
|
| 201-16-0086 |
Chicken soluble endothelial protein C receptor(sEPCR)ELISA Kit |
96T |
734-Eur |
Sunred |
|
| 201-11-0767 |
Rat Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT |
96T |
490-Eur |
SunBT |
|
| 201-16-0045 |
Chicken Soluble Intercellular Adhesion Molecule-1(sICAM-1)ELISA Kit |
96T |
734-Eur |
Sunred |
|
| 201-15-0136 |
Canine soluble Factor-related Apoptosis(sFAS_Apo-1)ELISA Kit |
96T |
704-Eur |
Sunred |
|
| 201-11-0422 |
Rat soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-15-0089 |
Canine soluble cluster of differentiation 44 variant 9(sCD44-v9)ELISA Kit |
96T |
646-Eur |
Sunred |
|
| 182-01471 |
RANK Ligand Soluble, Human, recombinant (RANKL) Proteins |
10 ug |
643-Eur |
B-Bridge |
|
| MCA2776 |
MOUSE ANTI HUMAN CD71 (SOLUBLE)-MONOCLONAL ANTIBODY |
0.2 mg |
384-Eur |
AbD Serotec |
monoclonal |
| MCA2775 |
MOUSE ANTI HUMAN CD71 (SOLUBLE)-MONOCLONAL ANTIBODY |
0.2 mg |
384-Eur |
AbD Serotec |
monoclonal |
| MCA2756 |
MOUSE ANTI HUMAN CD154 (SOLUBLE)-MONOCLONAL ANTIBODY |
0.2 mg |
485-Eur |
AbD Serotec |
monoclonal |
| MCA2755 |
MOUSE ANTI HUMAN CD154 (SOLUBLE)-MONOCLONAL ANTIBODY |
0.2 mg |
485-Eur |
AbD Serotec |
monoclonal |
| QY-E02480 |
Human soluble cluster of differentiation 44 variant 9(sCD44-v9)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CK-E10088 |
Human Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| QY-E02472 |
Human lectin-galactose binding-soluble 3(Lgals3)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| CK-E20093 |
Mouse soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E20092 |
Mouse soluble myosin heavy chain 2,sMHC-2 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| QY-E02443 |
Human soluble Tumor Necrosis Factorαreceptor(sTNFαR)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| E01C0209 |
Human Anti-soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| CK-E11591 |
human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| CK-E11482 |
Human soluble fibrin monomer complex,SFMC ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| QY-E02444 |
Human soluble tumor necrosis factor 1(sTNF-1)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| QY-E02445 |
Human soluble cell adhesion molecule 26(sCD26)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| QY-E02448 |
Human soluble fibrin monomer complex(SFMC)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| CK-E11165 |
Human soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| QY-E02450 |
Human soluble vascular adhesion protein-1(sVAP-1)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| QY-E02451 |
Human soluble endothelial protein C receptor(sEPCR)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E02457 |
Human Soluble Intercellular Adhesion Molecule-1(sICAM-1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CK-E10119 |
Human Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| QY-E02464 |
Human soluble myosin heavy chain 1(sMHC-1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CK-E10118 |
Human Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| QY-E02469 |
Human soluble Factor-related Apoptosis(sFAS_Apo-1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CSB-E13725h |
Human Soluble Mesothelin Related Peptide(SMRP)ELISA KIT |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-EQ027952MO |
Mouse soluble amyloid precursor protein β (sAPPβ) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E07S0250 |
Porcine Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
608-Eur |
BGene |
|
| CSB-E09870Ch |
Chicken Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
524-Eur |
Cusabio |
|
| CSB-E11301h |
Human soluble cluster of differentiation 44 variant 9,sCD44-v9 ELISA Kit |
96T |
542-Eur |
Cusabio |
|
| CSB-E07381r |
Rat Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT |
96T |
557-Eur |
Cusabio |
|
| CSB-E07380r |
Rat Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
96T |
557-Eur |
Cusabio |
|
| CSB-E10036Mo |
Monkey Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
594-Eur |
Cusabio |
|
| CSB-EL015447HU |
Human Alpha-soluble NSF attachment protein(NAPA) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL015448HU |
Human Beta-soluble NSF attachment protein(NAPB) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL002562HU |
Human Brain acid soluble protein 1(BASP1) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL015450HU |
Human Gamma-soluble NSF attachment protein(NAPG) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| 23863 |
Rat Tumor necrosis factor soluble receptor Ⅱ(TNFsR-Ⅱ) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| 23862 |
Rat Tumor Necrosis Factor Soluble Receptor Ⅰ(TNFsR-Ⅰ) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| 20837 |
Rat Soluble Vascuolar Cell Adhesion Molecule 1(sVCAM-1) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CK-E98474 |
Rat soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISAkit |
|
----Eur |
Glory |
|
| E08C0209 |
Canine soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
622-Eur |
BGene |
|
| E08F0103 |
Canine Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08L0229 |
Canine Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
622-Eur |
BGene |
|
| 101-M165 |
IL-2 receptor, soluble, Host: Mouse, Species: Anti-Human |
500 ug |
290-Eur |
Reliatech |
|
| RCYT-285A |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha |
5 |
96-Eur |
SeraLab |
|
| RCYT-285B |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha |
25 |
199-Eur |
SeraLab |
|
| AP02138SU-S |
Fibrinogen (Oxidized), (Soluble Fraction) Rabbit antibody Ab Serum |
20 |
147-Eur |
ACR |
|
| AP02138SU-N |
Fibrinogen (Oxidized), (Soluble Fraction) Rabbit antibody Ab Serum |
0.1 ml |
309-Eur |
ACR |
|
| E07S0254 |
Porcine Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0255 |
Porcine Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
608-Eur |
BGene |
|
| E07S0258 |
Porcine Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
608-Eur |
BGene |
|
| cyt-692 |
Recombinant Human Soluble RANK Ligand His Tag CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| cyt-334 |
Recombinant Human Soluble RANK Ligand CYTOKINES AND GROWTH FACTORS |
2 |
96-Eur |
Prospecbio |
|
| E01A0223 |
Human Anti-soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| cyt-472 |
Recombinant Mouse soluble CD40 Ligand_TRAP CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| E01C0053 |
Human Anti-soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| cyt-670 |
Recombinant Human soluble CD40 Ligand_TRAP His Tag CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| cyt-245 |
Recombinant Human soluble CD40 Ligand_TRAP CYTOKINES AND GROWTH FACTORS |
10 |
96-Eur |
Prospecbio |
|
| cyt-294 |
Recombinant Bovine Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| E01I0375 |
Human Anti-soluble TNF-related apoptosis inducing ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
apoptosis |
| cyt-293 |
Recombinant Ovine Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| cyt-268 |
Recombinant Rabbit Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| cyt-286 |
Recombinant Human Soluble IL-6 Receptor alpha CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| E08S0238 |
Canine Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
622-Eur |
BGene |
|
| Y059684 |
Anti-Human Soluble Guanylate Cyclase (hsGC) Antibody |
100ug |
495-Eur |
ABM Goods |
human |
| Y061149 |
Anti-Interleukin-4 Soluble Receptor produced in goat Antibody |
100ug |
857-Eur |
ABM Goods |
recombinant |
| E08S0255 |
Canine Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
622-Eur |
BGene |
|
| E08S0258 |
Canine Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E12742h |
Human soluble terminal complement complex SC5b9 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| 20067 |
Human soluble Intercellular Adhesion Molecule 1(sICAM-1) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| CSB-E11301h |
Human soluble cluster of differentiation 44 variant 9,sCD44_v9 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| 23648 |
Human soluble Endothelial Protein C Receptor(sEPCR) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| CSB-E11156m |
Mouse soluble myosin heavy chain 2,sMHC_2 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E11155m |
Mouse soluble myosin heavy chain 1,sMHC_1 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E11154h |
Human soluble myosin heavy chain 1,sMHC_1 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E11154h |
Human soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL015447MO |
Mouse Alpha-soluble NSF attachment protein(NAPA) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL015448MO |
Mouse Beta-soluble NSF attachment protein(NAPB) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL002562MO |
Mouse Brain acid soluble protein 1(BASP1) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E05C0053 |
Guinea anti-soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E05C0209 |
Guinea anti-soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CSB-EL015450MO |
Mouse Gamma-soluble NSF attachment protein(NAPG) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CK-E90430 |
Human soluble endothelial protein C receptor(SEPCR)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| 21082 |
Mouse Soluble Cluster of differentiation 30 ligand(sCD30L) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E08S0254 |
Canine Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| Y061155 |
Anti-Interleukin-2 Soluble Receptor γ produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| Y061157 |
Anti-Interleukin-2 Soluble Receptor β produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| Y061159 |
Anti-Interleukin-2 Soluble Receptor β produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| 20184 |
Rat Soluble Factor-Related Apoptosis Ligand(sFASL_Apo-1) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CSB-E11807h |
human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EQ027464HU |
Human soluble amyloid precursor protein α (sAPPα) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| S01-051 |
DLL-4, soluble, Host: HEK 293 cells, Species: Human, Synonyms: DLL4; hdelta2 |
25 ug |
232-Eur |
Reliatech |
|
| CSB-EL004484HU |
Human Soluble calcium-activated nucleotidase 1(CANT1) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E04T0526 |
Rabbit anti-Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04T0527 |
Rabbit anti-Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| 22344 |
Mouse Soluble Myosin Heavy Chain 2(sMHC-2) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| 22342 |
Mouse Soluble Myosin Heavy Chain 1(sMHC-1) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E08S0249 |
Canine soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
622-Eur |
BGene |
|
| QY-E21379 |
Mouse soluble myosin heavy chain 1(sMHC-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E05A0223 |
Guinea anti-soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E08S0250 |
Canine Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
622-Eur |
BGene |
|
| 23735 |
Mouse Soluble Endothelial Protein C Receptor(sEPCR) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CSB-EQ027464MO |
Mouse soluble amyloid precursor protein α (sAPPα) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| RCYT-286C |
Recombinant Human Soluble IL_6 Receptor alpha |
1mg |
5671-Eur |
SeraLab |
recombinant |
| RCYT-589C |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
10µg |
817-Eur |
SeraLab |
recombinant |
| E05L0229 |
Guinea pig Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0238 |
Guinea pig Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0249 |
Guinea pig soluble endothelial protein C receptor ELISA, SEPCR |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0250 |
Guinea pig Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0258 |
Guinea pig Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
689-Eur |
Blue Gene Biotech |
|
| E07C0209 |
Porcine soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
608-Eur |
BGene |
|
| E05S0254 |
Guinea pig Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E05S0255 |
Guinea pig Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
689-Eur |
Blue Gene Biotech |
|
| E06C0209 |
Goat soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
715-Eur |
Blue Gene Biotech |
|
| E06F0103 |
Goat Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E06L0229 |
Goat Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0238 |
Goat Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0249 |
Goat soluble endothelial protein C receptor ELISA, SEPCR |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0250 |
Goat Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
715-Eur |
Blue Gene Biotech |
|
| RCYT-589B |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
5µg |
477-Eur |
SeraLab |
recombinant |
| RCYT-589A |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
2µg |
331-Eur |
SeraLab |
recombinant |
| E11C0209 |
Bovine soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
622-Eur |
BGene |
|
| E04S0254 |
Rabbit Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E11S0258 |
Bovine Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0255 |
Bovine Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0254 |
Bovine Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E04S0255 |
Rabbit Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
689-Eur |
Blue Gene Biotech |
|
| RCYT-532A |
Recombinant Raibow Trout Prolactin Soluble Receptor |
10µg |
127-Eur |
SeraLab |
recombinant |
| RCYT-532B |
Recombinant Raibow Trout Prolactin Soluble Receptor |
50µg |
234-Eur |
SeraLab |
recombinant |
| RCYT-532C |
Recombinant Raibow Trout Prolactin Soluble Receptor |
1mg |
1905-Eur |
SeraLab |
recombinant |
| E05C0209 |
Guinea pig soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
689-Eur |
Blue Gene Biotech |
|
| E11S0250 |
Bovine Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0249 |
Bovine soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
622-Eur |
BGene |
|
| E05F0103 |
Guinea pig Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E11S0238 |
Bovine Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
622-Eur |
BGene |
|
| E11L0229 |
Bovine Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
622-Eur |
BGene |
|
| E11F0103 |
Bovine Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E06S0258 |
Goat Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0254 |
Goat Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0255 |
Goat Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0250 |
Porcine Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0254 |
Porcine Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0255 |
Porcine Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
715-Eur |
Blue Gene Biotech |
|
| E0166Mo |
Mouse soluble myosin heavy chain 2,sMHC-2 ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| E08C0209 |
Canine soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
715-Eur |
Blue Gene Biotech |
|
| E08F0103 |
Canine Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E11261 |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
728-Eur |
Glory |
|
| CK-E94718 |
Human Soluble intercellular adhesion molecule-1(SICAM-1) ELISA Kit |
96T |
728-Eur |
Glory |
|
| E08L0229 |
Canine Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0238 |
Canine Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0249 |
Canine soluble endothelial protein C receptor ELISA, SEPCR |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0250 |
Canine Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
715-Eur |
Blue Gene Biotech |
|
| E0165Mo |
Mouse soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| E08S0258 |
Canine Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E95065 |
Human Soluble intercellular adhesion molecule-1(SICAM-1) ELISA Kit |
96T |
728-Eur |
Glory |
|
| E0280Mo |
Mouse soluble Vascular cell adhesion molecule 1,sVCAM-1 |
48T |
386-Eur |
Sunlog |
|
| E0280Mo |
Mouse soluble Vascular cell adhesion molecule 1,sVCAM-1 |
96T |
656-Eur |
Sunlog |
|
| E07S0249 |
Porcine soluble endothelial protein C receptor ELISA, SEPCR |
|
715-Eur |
Blue Gene Biotech |
|
| E01C0209 |
Human soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
601-Eur |
BGene |
|
| E01L0229 |
Human Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0238 |
Human Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0249 |
Human soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0250 |
Human Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
601-Eur |
BGene |
|
| E07S0258 |
Porcine Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
715-Eur |
Blue Gene Biotech |
|
| E01S0254 |
Human Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0255 |
Human Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0258 |
Human Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E07C0209 |
Porcine soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
715-Eur |
Blue Gene Biotech |
|
| E07F0103 |
Porcine Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E0280Mo |
Mouse soluble Vascuolar cell adhesion molecule 1,sVCAM-1 |
48T |
320-Eur |
Eastbio |
|
| E0279Mo |
Mouse Soluble Intercellular Adhesion Molecule 1,sICAM-1 ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| E07L0229 |
Porcine Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0238 |
Porcine Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E95082 |
Human soluble endothelial protein C receptor (sEPCR) ELISA Kit |
96T |
728-Eur |
Glory |
|
| RCYT-286B |
Recombinant Human Soluble IL_6 Receptor alpha |
20µg |
234-Eur |
SeraLab |
recombinant |
| CSB-E04529Ch |
Chicken soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| E03S0249 |
Mouse soluble endothelial protein C receptor ELISA, SEPCR |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0250 |
Mouse Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E07990r |
Rat soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CSB-E07991h |
Human Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E07992m |
Mouse Soluble Intercellular Adhesion Molecule 1,sICAM_1 ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| E03S0254 |
Mouse Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
689-Eur |
Blue Gene Biotech |
|
| 'H00002982-D01 |
Guanylate cyclase soluble GUCY1A3 antibody Host Rabbit |
0.1 ml |
509-Eur |
ACR |
|
| E07F0103 |
Porcine Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
608-Eur |
BGene |
|
| 'H00002982-B01 |
Guanylate cyclase soluble GUCY1A3 antibody Host Mouse |
50 |
481-Eur |
ACR |
|
| 'AP15185CP-N |
Guanylate cyclase soluble GUCY1B3 Control Peptide antibody _CP |
0.1 mg |
195-Eur |
ACR |
|
| 'AP13761CP-N |
Guanylate cyclase soluble GUCY1A3 Control Peptide antibody _CP |
0.1 mg |
195-Eur |
ACR |
|
| 'AP10315CP-N |
Guanylate cyclase soluble GUCY1B3 control peptide antibody _CP |
0.25 mg |
208-Eur |
ACR |
|
| CSB-E08153p |
Porcine Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
641-Eur |
Cusabio |
elisa |
| 'AP10312CP-N |
Guanylate cyclase soluble GUCY1A3 control peptide antibody _CP |
0.25 mg |
208-Eur |
ACR |
|
| 'GTX114458 |
Guanylate cyclase soluble GUCY1A3 antibody Host Rabbit |
0.1 ml |
441-Eur |
ACR |
|
| E03S0238 |
Mouse Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
689-Eur |
Blue Gene Biotech |
|
| E03F0103 |
Mouse Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E03L0229 |
Mouse Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E04530m |
Mouse soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
837-Eur |
Cusabio |
elisa |
| E01F0103 |
Human Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0249 |
Human soluble endothelial protein C receptor ELISA, SEPCR |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0254 |
Human Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E04714h |
Human soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E04715m |
Mouse soluble cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E04716h |
Human soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CSB-E04717m |
Mouse soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| E01S0255 |
Human Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
689-Eur |
Blue Gene Biotech |
|
| E02T0526 |
Rat Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
689-Eur |
Blue Gene Biotech |
|
| E02T0527 |
Rat Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
689-Eur |
Blue Gene Biotech |
|
| E02V0005 |
Rat Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E06943Rb |
Rabbit Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
681-Eur |
Cusabio |
elisa |
| E03S0258 |
Mouse Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
689-Eur |
Blue Gene Biotech |
|
| E03C0209 |
Mouse soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
689-Eur |
Blue Gene Biotech |
|
| 'C0219-2 |
Guanylate cyclase soluble GUCY1B3 antibody Host rabbit |
0.1 mg |
427-Eur |
ACR |
|
| 'C0219-1 |
Guanylate cyclase soluble GUCY1B3 antibody Host rabbit |
50 |
298-Eur |
ACR |
|
| CSB-E09095h |
Human soluble Factor_related Apoptosis ligand,sFASL_Apo_1 ELISA Kit |
96tests |
602-Eur |
Cusabio |
elisa |
| CSB-E10036Mo |
Monkey Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
681-Eur |
Cusabio |
elisa |
| 'AP06153PU-N |
Guanylate cyclase soluble GUCY1B3 antibody Host Rabbit |
100 |
468-Eur |
ACR |
|
| 'AP02138SU-S |
Fibrinogen (Oxidized), (Soluble Fraction) antibody Host Rabbit |
20 |
208-Eur |
ACR |
|
| 'AP02138SU-N |
Fibrinogen (Oxidized), (Soluble Fraction) antibody Host Rabbit |
100 |
454-Eur |
ACR |
|
| E04S0258 |
Rabbit Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
689-Eur |
Blue Gene Biotech |
|
| E04C0209 |
Rabbit soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
689-Eur |
Blue Gene Biotech |
|
| E04F0103 |
Rabbit Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E04L0229 |
Rabbit Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0238 |
Rabbit Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0249 |
Rabbit soluble endothelial protein C receptor ELISA, SEPCR |
|
689-Eur |
Blue Gene Biotech |
|
| E01T0527 |
Human Anti-Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04S0250 |
Rabbit Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
689-Eur |
Blue Gene Biotech |
|
| RCYT-285A |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
5µg |
127-Eur |
SeraLab |
recombinant |
| RCYT-285B |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
25µg |
234-Eur |
SeraLab |
recombinant |
| RCYT-285C |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
1mg |
4919-Eur |
SeraLab |
recombinant |
| Y050217 |
Anti_Human Tumor Necrosis Factor soluble p55 Receptor (sTNFRp55) |
100ul |
447-Eur |
ABM Goods |
recombinant |
| Y050218 |
Anti_Human Tumor Necrosis Factor soluble p55 Receptor (sTNFRp55) |
100ug |
447-Eur |
ABM Goods |
recombinant |
| CSB-E09901h |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| 'BP2227 |
Fibrinogen (Oxidized), (Soluble Fraction) antibody Host rabbit |
20 |
522-Eur |
ACR |
|
| CSB-E09097h |
Human soluble fibrin monomer complex,SFMC ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| 'ARP46012_P050 |
Guanylate cyclase soluble GUCY1B3 antibody Host rabbit |
50 |
481-Eur |
ACR |
|
| 'AP22710PU-N |
Guanylate cyclase soluble GUCY1B3 (189-207) antibody Host Rabbit |
50 |
550-Eur |
ACR |
|
| CSB-E09267Rb |
Rabbit soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| 'AP20764PU-N |
Guanylate cyclase soluble GUCY1A3 antibody Host Rabbit |
100 |
468-Eur |
ACR |
|
| 'AP15591PU-S |
Guanylate cyclase soluble GUCY1B3 (189-207) antibody Host Rabbit |
0.1 ml |
236-Eur |
ACR |
|
| 'AP15591PU-N |
Guanylate cyclase soluble GUCY1B3 (189-207) antibody Host Rabbit |
1.0 ml |
563-Eur |
ACR |
|
| 'AP15591PU-M |
Guanylate cyclase soluble GUCY1B3 (189-207) antibody Host Rabbit |
0.5 ml |
427-Eur |
ACR |
|
| 'AP15185CP-N |
Guanylate cyclase soluble GUCY1B3 Control Peptide antibody /CP |
0.1 mg |
195-Eur |
ACR |
|
| 'AP13761CP-N |
Guanylate cyclase soluble GUCY1A3 Control Peptide antibody /CP |
0.1 mg |
195-Eur |
ACR |
|
| CSB-E09835Rb |
Rabbit soluble endothelial protein C receptor,sEPCR ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| CSB-E09870Ch |
Chicken Soluble Intercellular Adhesion Molecule_1,sICAM_1 ELISA Kit |
96tests |
602-Eur |
Cusabio |
elisa |
| 'AP10315CP-N |
Guanylate cyclase soluble GUCY1B3 control peptide antibody /CP |
0.25 mg |
208-Eur |
ACR |
|
| 'AP10312CP-N |
Guanylate cyclase soluble GUCY1A3 control peptide antibody /CP |
0.25 mg |
208-Eur |
ACR |
|
| RCYT-286A |
Recombinant Human Soluble IL_6 Receptor alpha |
5µg |
127-Eur |
SeraLab |
recombinant |
| CK-E95192 |
Human Soluble endothelial protein C receptor(sEPCR) ELISA Kit |
96T |
728-Eur |
Glory |
|
| E14F0103 |
Sheep Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E0217Hu |
Human soluble Tumor Necrosis Factorαreceptor,sTNFαR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0242Hu |
Human soluble cluster of differentiation 44 variant 9,sCD44-v9 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E2133Hu |
Human soluble vascular adhesion protein-1,sVAP-1 ELISA Kit |
48T |
290-Eur |
Eastbio |
|
| E0263Hu |
Human Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E1167Hu |
Human soluble fibrin monomer complex,SFMC ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E1245Hu |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E1665Hu |
human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E1822Hu |
Human soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E2045Hu |
Human soluble cell adhesion molecule 26,sCD26 ELISA KIT |
96T |
450-Eur |
Eastbio |
|
| E2046Hu |
Human soluble tumor necrosis factor 1,sTNF-1 ELISA Kit |
96T |
450-Eur |
Eastbio |
|
| E2133Hu |
Human soluble vascular adhesion protein-1,sVAP-1 ELISA Kit |
96T |
450-Eur |
Eastbio |
|
| E0421Ra |
Rat soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E0766Ra |
Rat Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT |
96T |
490-Eur |
Eastbio |
|
| E0767Ra |
Rat Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
96T |
490-Eur |
Eastbio |
|
| E0218Po |
Porcine Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
96T |
560-Eur |
Eastbio |
|
| E06S0238 |
Goat Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
608-Eur |
BGene |
|
| E0204Hu |
Human Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0177Hu |
Human soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| YCC410-503 |
Mumps Virus, Enders strain, soluble, Guinea pig anti_, CF |
1 ml. |
832-Eur |
Accurate |
Antibodies |
| YCC410-429 |
Mumps Virus, Enders strain, soluble, CF Control Antigen |
0.5 ml. |
202-Eur |
Accurate |
Antibodies |
| E14L0229 |
Sheep Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0238 |
Sheep Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
715-Eur |
Blue Gene Biotech |
|
| E0131h |
Human Tumor necrosis factor soluble receptor ⅠELI |
96T |
706-Eur |
EIAab |
recombinant |
| E0421Ra |
Rat soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E14S0249 |
Sheep soluble endothelial protein C receptor ELISA, SEPCR |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0250 |
Sheep Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0258 |
Sheep Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
715-Eur |
Blue Gene Biotech |
|
| YCC410-427 |
Influenza Type A, Kumamoto_22_76 strain, soluble, CF Control Antigen |
0.5 ml. |
202-Eur |
Accurate |
Antibodies |
| YIAT1005.2 |
Fibrinogen (soluble fraction), oxidized, Rabbit anti_Human; ELISA |
100 µl. |
708-Eur |
Accurate |
elisa |
| YIAT1005.1 |
Fibrinogen (soluble fraction), oxidized, Rabbit anti_Human; ELISA |
20 µl. |
207-Eur |
Accurate |
elisa |
| CK-E97067 |
Human soluble endothelial protein C receptor,sEPCR ELISAkit |
|
----Eur |
Glory |
|
| E14S0254 |
Sheep Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0255 |
Sheep Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
715-Eur |
Blue Gene Biotech |
|
| E0006Mo |
Mouse soluble endothelial protein C receptor,sEPCR ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E0055Mo |
Mouse Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E0057Mo |
Mouse Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| CSB-E04700r |
Rat Platelet_Derived Growth Factor Soluble Receptor α,PDGFsR_α ELISA kit |
96T |
915-Eur |
Cusabio |
elisa |
| ABS5105 |
MOUSE ANTI HUMAN GUANYLATE CYCLASE BETA 1 (SOLUBLE) |
0.2 mg |
265-Eur |
AbD Serotec |
human |
| E0280Mo |
Mouse soluble Vascuolar cell adhesion molecule 1,sVCAM-1 |
96T |
490-Eur |
Eastbio |
|
| E0177Hu |
Human soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0204Hu |
Human Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0217Hu |
Human soluble Tumor Necrosis Factorαreceptor,sTNFαR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0242Hu |
Human soluble cluster of differentiation 44 variant 9,sCD44-v9 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0263Hu |
Human Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| Y061164 |
Monoclonal Anti_Interleukin_1 Soluble Receptor Type I produced in mouse |
100ug |
965-Eur |
ABM Goods |
recombinant |
| Y061539 |
Anti_Tumor Necrosis Factor Soluble Receptor II produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| Y061540 |
Anti_Tumor Necrosis Factor Soluble Receptor I produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| Y061541 |
Anti_Tumor Necrosis Factor Soluble Receptor I produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| Y061795 |
Anti_Transforming Growth Factor_β Soluble Receptor III produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| Y061796 |
Anti_Transforming Growth Factor_β Soluble Receptor II produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| Y062056 |
Anti_Platelet_Derived Growth Factor Soluble Receptor β produced in goat |
100ug |
1120-Eur |
ABM Goods |
recombinant |
| CSB-E04736h |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR_ⅠELISA KIT |
96T |
896-Eur |
Cusabio |
elisa |
| E1167Hu |
Human soluble fibrin monomer complex,SFMC ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E1245Hu |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E2046Hu |
Human soluble tumor necrosis factor 1,sTNF-1 ELISA Kit |
48T |
290-Eur |
Eastbio |
|
| E2045Hu |
Human soluble cell adhesion molecule 26,sCD26 ELISA KIT |
48T |
290-Eur |
Eastbio |
|
| E0165Mo |
Mouse soluble myosin heavy chain 1,sMHC-1 ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E0166Mo |
Mouse soluble myosin heavy chain 2,sMHC-2 ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| CSB-E07990r |
Rat soluble Vascuolar cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| E06S0249 |
Goat soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
608-Eur |
BGene |
|
| E06S0250 |
Goat Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
608-Eur |
BGene |
|
| E0279Mo |
Mouse Soluble Intercellular Adhesion Molecule 1,sICAM-1 ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E06S0254 |
Goat Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
608-Eur |
BGene |
|
| E06S0255 |
Goat Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
608-Eur |
BGene |
|
| E1822Hu |
Human soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E06S0258 |
Goat Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
608-Eur |
BGene |
|
| CSB-E07381r |
Rat Tumor necrosis factor soluble receptor Ⅰ,TNFsR_Ⅰ ELISA KIT |
96T |
701-Eur |
Cusabio |
elisa |
| CSB-E07380r |
Rat Tumor necrosis factor soluble receptor Ⅱ,TNFsR_Ⅱ ELISA KIT |
96T |
701-Eur |
Cusabio |
elisa |
| E1665Hu |
human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0251Hu |
Human Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E14C0209 |
Sheep soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E95420 |
Human Soluble endothelial protein C receptor(sEPCR) ELISA Kit |
96T |
728-Eur |
Glory |
|
| CK-E95895 |
Human Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISAkit |
|
----Eur |
Glory |
|
| E09C0209 |
Monkey soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
715-Eur |
Blue Gene Biotech |
|
| E09F0103 |
Monkey Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E95925 |
Human Soluble Cluster of differentiation 40 ligand,sCD40L ELISAkit |
|
----Eur |
Glory |
|
| CK-E95926 |
Human Soluble Cluster of differentiation 30 ligand,sCD30L ELISAkit |
|
----Eur |
Glory |
|
| E09L0229 |
Monkey Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0238 |
Monkey Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0249 |
Monkey soluble endothelial protein C receptor ELISA, SEPCR |
|
715-Eur |
Blue Gene Biotech |
|
| E0767Ra |
Rat Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
48T |
320-Eur |
Eastbio |
|
| E09S0250 |
Monkey Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E96971 |
Human soluble myosin heavy chain 1,sMHC-1 ELISAkit |
|
----Eur |
Glory |
|
| E03S0238 |
Mouse Soluble cluster of differentiation 30 ligand ELISA,SCD30L |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0249 |
Mouse soluble endothelial protein C receptor ELISA,SEPCR |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0250 |
Mouse Soluble Amyloid Precursor Protein β ELISA,sAPPβ |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0254 |
Mouse Soluble Factor-related Apoptosis ELISA,SFAS_Apo-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03L0229 |
Mouse Lectin-galactose binding-soluble 3 ELISA ,Lgals3 |
96 Tests/kit |
601-Eur |
BGene |
|
| E0218Po |
Porcine Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit |
48T |
380-Eur |
Eastbio |
|
| E09S0258 |
Monkey Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
715-Eur |
Blue Gene Biotech |
|
| E0057Mo |
Mouse Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| E0055Mo |
Mouse Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| E0006Mo |
Mouse soluble endothelial protein C receptor,sEPCR ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| U0131h |
Human Tumor necrosis factor soluble receptor ⅠELI |
96T |
706-Eur |
EIAab |
recombinant |
| E08S0254 |
Canine Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
715-Eur |
Blue Gene Biotech |
|
| GS-1297a |
malate dehydrogenase 1, NAD (soluble) primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| GS-1568a |
phosphoenolpyruvate carboxykinase 1 (soluble) primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| GS-2096a |
superoxide dismutase 1, soluble primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| E02T0526 |
Rat Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
601-Eur |
BGene |
|
| E02T0527 |
Rat Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
601-Eur |
BGene |
|
| E02V0005 |
Rat Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| CK-E95862 |
Human soluble Tumor Necrosis Factorαreceptor,sTNFαR ELISAkit |
|
----Eur |
Glory |
|
| E08S0255 |
Canine Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
715-Eur |
Blue Gene Biotech |
|
| E03C0209 |
Mouse soluble Cluster of differentiation 40 ligand ELISA ,Scd40l |
96 Tests/kit |
601-Eur |
BGene |
|
| E03F0103 |
Mouse Soluble Fms-like tyrosine kinase Receptor 1 ELISA ,sFLt-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0255 |
Mouse Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA,sCTLA4 |
96 Tests/kit |
601-Eur |
BGene |
|
| E03S0258 |
Mouse Soluble Intercellular Adhesion Molecule-1 ELISA,SICAM1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E0766Ra |
Rat Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT |
48T |
320-Eur |
Eastbio |
|
| E11S0258 |
Bovine Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
715-Eur |
Blue Gene Biotech |
|
| E06C0209 |
Goat soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
608-Eur |
BGene |
|
| E06F0103 |
Goat Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
608-Eur |
BGene |
|
| E01F0103 |
Human Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E11S0254 |
Bovine Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0255 |
Bovine Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
715-Eur |
Blue Gene Biotech |
|
| E12C0209 |
Chicken soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
715-Eur |
Blue Gene Biotech |
|
| E12F0103 |
Chicken Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E12L0229 |
Chicken Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0238 |
Chicken Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0249 |
Chicken soluble endothelial protein C receptor ELISA, SEPCR |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0250 |
Chicken Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0258 |
Chicken Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0254 |
Chicken Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0255 |
Chicken Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0250 |
Bovine Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0249 |
Bovine soluble endothelial protein C receptor ELISA, SEPCR |
|
715-Eur |
Blue Gene Biotech |
|
| E11S0238 |
Bovine Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
715-Eur |
Blue Gene Biotech |
|
| E03S0255 |
Mouse Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
689-Eur |
Blue Gene Biotech |
|
| E09S0254 |
Monkey Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E04C0209 |
Rabbit soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
601-Eur |
BGene |
|
| E04F0103 |
Rabbit Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04L0229 |
Rabbit Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0238 |
Rabbit Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0249 |
Rabbit soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0250 |
Rabbit Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
601-Eur |
BGene |
|
| E09S0255 |
Monkey Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
|
715-Eur |
Blue Gene Biotech |
|
| E04S0254 |
Rabbit Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0255 |
Rabbit Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0258 |
Rabbit Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E11C0209 |
Bovine soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
715-Eur |
Blue Gene Biotech |
|
| E11F0103 |
Bovine Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E11L0229 |
Bovine Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
715-Eur |
Blue Gene Biotech |
|
| E06L0229 |
Goat Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
608-Eur |
BGene |
|
| AGHIV-0212 |
rHIV gp36, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
323-Eur |
Arista Bio |
|
| E07A0223 |
Porcine anti-soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CGHIV-0640 |
rHIV p24, soluble CGC Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
93-Eur |
Arista Bio |
|
| AGHCV-0217 |
rHCV Core, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
175-Eur |
Arista Bio |
|
| AGHCV-0231 |
rHCV Cocktail, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
175-Eur |
Arista Bio |
|
| AGHCV-0232 |
rHCV Cocktail, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
175-Eur |
Arista Bio |
|
| AGHIV-0212 |
rHIV gp36, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
141-Eur |
Arista Bio |
|
| E06T0527 |
Goat anti-Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06T0526 |
Goat anti-Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| AGHIV-0213 |
rHIV gp36, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
141-Eur |
Arista Bio |
|
| AGHIV-0215 |
rHIV gp36, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
216-Eur |
Arista Bio |
|
| CSB-EL015447RA |
Rat Alpha-soluble NSF attachment protein(NAPA) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-EL015448RA |
Rat Beta-soluble NSF attachment protein(NAPB) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| E07C0053 |
Porcine anti-soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| 201-20-2567 |
HMGCS1{3-hydroxy-3-methylglutaryl-Coenzyme A synthase 1 (soluble)}rabbit.pAb |
0.2ml |
623-Eur |
Shanghai Sunred |
|
| AGHIV-0241 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
307-Eur |
Arista Bio |
|
| AGHIV-0238 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
307-Eur |
Arista Bio |
|
| AGHIV-0237 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
307-Eur |
Arista Bio |
|
| AGHIV-0222.2 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
307-Eur |
Arista Bio |
|
| CGHIV-0640 |
rHIV p24, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price x 2 |
141-Eur |
Arista Bio |
|
| CSB-E06859b |
Bovine soluble Cluster of differentiation 86,sCD86 ELISA Kit SpeciesBovine |
96T |
981-Eur |
Cusabio |
|
| CSB-EL004484RA |
Rat Soluble calcium-activated nucleotidase 1(CANT1) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-EL002562RA |
Rat Brain acid soluble protein 1(BASP1) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| AGHIV-0222.2 |
rHIV gp41, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
148-Eur |
Arista Bio |
|
| E13L0229 |
Anserine lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| AGHIV-0225 |
rHIV gp41, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
223-Eur |
Arista Bio |
|
| CSB-E13199h |
Human soluble cluster of differentiation 14,sCD14 ELISA Kit SpeciesHuman |
96T |
714-Eur |
Cusabio |
|
| AGHIV-0238 |
rHIV gp41, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
148-Eur |
Arista Bio |
|
| AGHIV-0241 |
rHIV gp41, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
148-Eur |
Arista Bio |
|
| AGHIV-0255 |
rHIV gp13, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
264-Eur |
Arista Bio |
|
| CK-E99057 |
Rabbit soluble endothelial protein C receptor,sEPCR ELISAkit |
|
----Eur |
Glory |
|
| CK-E99056 |
Rabbit soluble endothelial protein C receptor,sEPCR ELISAkit |
|
----Eur |
Glory |
|
| CSB-E09884h |
Human Soluble Cluster of differentiation 38,sCD38 ELISA Kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| E12S0250 |
Chicken Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E09882h |
Human Soluble Cluster of differentiation 21,sCD21 ELISA Kit SpeciesHuman |
96T |
583-Eur |
Cusabio |
|
| CSB-E09865m |
Mouse Soluble Toll-like Receptor 9,sTLR9_sCD289 ELISA Kit SpeciesMouse |
96T |
959-Eur |
Cusabio |
|
| AGHIV-0237 |
rHIV gp41, soluble Antigens - Infectious Disease |
>1000 mg/ml/ea price |
148-Eur |
Arista Bio |
|
| orb80569 |
Raibow Trout Prolactin Soluble Receptor protein Proteins |
10 |
159-Eur |
Biorb |
|
| orb80417 |
Human Soluble IIL2 Receptor alpha protein Proteins |
5 |
159-Eur |
Biorb |
|
| CSB-EL022397RB |
Rabbit superoxide dismutase 1, soluble (SOD1) ELISA kit SpeciesRabbit |
96T |
913-Eur |
Cusabio |
|
| orb80418 |
Human Soluble IIL2 Receptor alpha GST tag protein Proteins |
2 |
287-Eur |
Biorb |
|
| CSB-EL022397RH |
Monkey superoxide dismutase 1, soluble (SOD1) ELISA kit SpeciesMonkey |
96T |
913-Eur |
Cusabio |
|
| CSB-EL022397GU |
Guinea pig superoxide dismutase 1, soluble (SOD1) ELISA kit SpeciesGuinea pig |
96T |
913-Eur |
Cusabio |
|
| CSB-E15792h |
Human soluble Cluster of differentiation 100(sCD100)ELISA kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| CSB-E15768h |
Human Soluble Cluster of Differentiation 80 (sCD80) ELISA Kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| CSB-E15077B |
Bovine soluble cluster of differentiation 8(sCD8) ELISA Kit SpeciesBovine |
96T |
816-Eur |
Cusabio |
|
| CSB-E14275m |
Mouse Soluble Toll-like Receptor 4,sTLR4 ELISA Kit SpeciesMouse |
96T |
913-Eur |
Cusabio |
|
| CSB-E14274m |
Mouse Soluble Toll-like Receptor 2,sTLR2 ELISA Kit SpeciesMouse |
96T |
913-Eur |
Cusabio |
|
| CSB-E09296h |
human soluble cluster of differentiation 28,sCD28 ELISA Kit SpeciesHuman |
96T |
714-Eur |
Cusabio |
|
| AGHIV-0213 |
rHIV gp36, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
323-Eur |
Arista Bio |
|
| AGHIV-0255 |
rHIV gp13, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
318-Eur |
Arista Bio |
|
| CGHIV-0640 |
rHIV p24, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
100-Eur |
Arista Bio |
|
| E06L0229 |
Goat lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06S0265 |
Goat Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06S0284 |
Goat soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06V0005 |
Goat soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E11L0229 |
Bovine lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11S0265 |
Bovine Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11S0284 |
Bovine soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11V0005 |
Bovine soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E11T0526 |
Bovine anti-Tumor necrosis factor soluble receptor I |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| AGHCV-0217 |
rHCV Core, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
216-Eur |
Arista Bio |
|
| AGHCV-0231 |
rHCV Cocktail, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
216-Eur |
Arista Bio |
|
| AGHIV-0241 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
187-Eur |
Arista Bio |
|
| AGHIV-0238 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
187-Eur |
Arista Bio |
|
| AGHIV-0237 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
187-Eur |
Arista Bio |
|
| AGHIV-0225 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
277-Eur |
Arista Bio |
|
| AGHIV-0222.2 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
187-Eur |
Arista Bio |
|
| AGHIV-0215 |
rHIV gp36, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
270-Eur |
Arista Bio |
|
| AGHIV-0213 |
rHIV gp36, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
195-Eur |
Arista Bio |
|
| AGHIV-0212 |
rHIV gp36, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
195-Eur |
Arista Bio |
|
| E0251Hu |
Human Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| AGHCV-0232 |
rHCV Cocktail, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price |
216-Eur |
Arista Bio |
|
| E11T0527 |
Bovine anti-Tumor necrosis factor soluble receptor II |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| AGHCV-0217 |
rHCV Core, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
195-Eur |
Arista Bio |
|
| AGHCV-0231 |
rHCV Cocktail, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
195-Eur |
Arista Bio |
|
| AGHIV-0238 |
rHIV gp41, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
168-Eur |
Arista Bio |
|
| AGHIV-0241 |
rHIV gp41, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
168-Eur |
Arista Bio |
|
| AGHIV-0255 |
rHIV gp13, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
557-Eur |
Arista Bio |
|
| AGHIV-0255 |
rHIV gp13, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
291-Eur |
Arista Bio |
|
| AGHIV-0225 |
rHIV gp41, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
479-Eur |
Arista Bio |
|
| AGHIV-0215 |
rHIV gp36, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
466-Eur |
Arista Bio |
|
| AGHCV-0232 |
rHCV Cocktail, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
362-Eur |
Arista Bio |
|
| AGHCV-0231 |
rHCV Cocktail, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
362-Eur |
Arista Bio |
|
| AGHCV-0217 |
rHCV Core, soluble Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
362-Eur |
Arista Bio |
|
| AGHIV-0237 |
rHIV gp41, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
168-Eur |
Arista Bio |
|
| AGHIV-0225 |
rHIV gp41, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
250-Eur |
Arista Bio |
|
| E13A0223 |
Anserine anti - soluble intercellular Adhesion Molecular 1 ELISA KIT |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| CK-E99168 |
rabbit Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISAkit |
|
----Eur |
Glory |
|
| E13C0053 |
Anserine anti - soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| AGHCV-0232 |
rHCV Cocktail, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
195-Eur |
Arista Bio |
|
| AGHIV-0212 |
rHIV gp36, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
168-Eur |
Arista Bio |
|
| HNS55-R |
Recombinant (E. coli) HCV NS5 protein, fragments of the NS5 immunodominant regions, (soluble) |
100 ug |
262-Eur |
Alpha Diagnostics |
recombinant |
| AGHIV-0213 |
rHIV gp36, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
168-Eur |
Arista Bio |
|
| E13C0209 |
Anserine anti - soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| AGHIV-0215 |
rHIV gp36, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
243-Eur |
Arista Bio |
|
| AGHIV-0222.2 |
rHIV gp41, soluble Antigens - Infectious Disease |
100-999 mg/ml/ea price |
168-Eur |
Arista Bio |
|
| E07C0209 |
Porcine anti-soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CSB-E08544m |
Mouse soluble Cluster of differentiation 86,sCD86 ELISA Kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| CSB-E04630h |
Human soluble interleukin-2 receptor,IL-2sRβ ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| E07S0265 |
Porcine Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E07L0229 |
Porcine lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E06C0209 |
Goat anti-soluble Cluster of differentiation 40 ligand ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E06C0053 |
Goat anti-soluble Cluster of Differentiation 44v9 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E03V0005 |
Mouse soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| P-sGCB |
Soluble Guanylate Cyclase beta , Antigen blocking peptide |
100ul |
196-Eur |
FabGennix |
|
| E03S0284 |
Mouse soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E02S0284 |
Rat anti-soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| RCYT-285B |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
25 µg |
226-Eur |
LeeBio |
recombinant |
| P-sGCA2 |
Soluble Guanylate Cyclase alfa2, Antigen blocking peptide |
100ul |
196-Eur |
FabGennix |
|
| P-sGCA1 |
Soluble Guanylate Cyclase alfa1, Antigen blocking peptide |
100ul |
196-Eur |
FabGennix |
|
| P-Sac121 |
Soluble adenylate cyclase1 C-Epitope, Antigen blocking peptide |
100ul |
196-Eur |
FabGennix |
|
| CSB-E04629h |
Human soluble interleukin-2 receptor,IL-2sRα ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-E04612h |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit SpeciesHuman |
96T |
714-Eur |
Cusabio |
|
| CSB-E04611h |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit SpeciesHuman |
96T |
714-Eur |
Cusabio |
|
| 05-50172 |
Monoclonal antibody Anti-soluble Transferrin Receptor, human |
50 |
215-Eur |
ARP |
|
| 05-50172A |
Monoclonal antibody Anti-soluble Transferrin Receptor, human |
50 |
215-Eur |
ARP |
|
| RCYT-285A |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
5 µg |
117-Eur |
LeeBio |
recombinant |
| P-Sac100 |
Soluble adenylate cyclase 1 N-Terminal, Antigen blocking peptide |
100ul |
196-Eur |
FabGennix |
|
| P-Sac110 |
Soluble adenylate cyclase Mid Region, Antigen blocking peptide |
100ul |
196-Eur |
FabGennix |
|
| E07S0284 |
Porcine soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| RCYT-285C |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha |
1 mg |
5212-Eur |
LeeBio |
recombinant |
| RCYT-286A |
Recombinant Human Soluble IL_6 Receptor alpha |
5 µg |
117-Eur |
LeeBio |
recombinant |
| RCYT-589A |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
2 µg |
325-Eur |
LeeBio |
recombinant |
| E01S0250 |
Human Soluble Amyloid Precursor Protein β ELISA, sAPPβ |
|
689-Eur |
Blue Gene Biotech |
|
| RCYT-589B |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
5 µg |
474-Eur |
LeeBio |
recombinant |
| RCYT-589C |
Recombinant Human Soluble Iinterleukin_2 Receptor alpha, GST tag |
10 µg |
822-Eur |
LeeBio |
recombinant |
| E01S0258 |
Human Soluble Intercellular Adhesion Molecule-1 ELISA, SICAM1 |
|
689-Eur |
Blue Gene Biotech |
|
| E12S0254 |
Chicken Soluble Factor-related Apoptosis ELISA, SFAS_Apo-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0255 |
Chicken Soluble Cytotoxic T-Lymphocyte Associated Antigen 4 ELISA, sCTLA4 |
96 Tests/kit |
622-Eur |
BGene |
|
| E01L0229 |
Human Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
|
689-Eur |
Blue Gene Biotech |
|
| E01C0209 |
Human soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
|
689-Eur |
Blue Gene Biotech |
|
| E04L0229 |
Rabbit lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E04S0265 |
Rabbit Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| RCYT-532C |
Recombinant Raibow Trout Prolactin Soluble Receptor |
1 mg |
1934-Eur |
LeeBio |
recombinant |
| RCYT-286B |
Recombinant Human Soluble IL_6 Receptor alpha |
20 µg |
226-Eur |
LeeBio |
recombinant |
| E03S0265 |
Mouse Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| RCYT-286C |
Recombinant Human Soluble IL_6 Receptor alpha |
1 mg |
6006-Eur |
LeeBio |
recombinant |
| E03L0229 |
Mouse lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| RCYT-532A |
Recombinant Raibow Trout Prolactin Soluble Receptor |
10 µg |
117-Eur |
LeeBio |
recombinant |
| E02S0265 |
Rat anti-Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CK-E98922 |
Chicken Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISAkit |
|
----Eur |
Glory |
|
| RCYT-532B |
Recombinant Raibow Trout Prolactin Soluble Receptor |
50 µg |
226-Eur |
LeeBio |
recombinant |
| E04S0284 |
Rabbit soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E01S0238 |
Human Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
|
689-Eur |
Blue Gene Biotech |
|
| E07V0005 |
Porcine soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E13S0284 |
Anserine soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| CSB-E07447m |
Mouse soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| E01V0005 |
Human soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E12S0249 |
Chicken soluble endothelial protein C receptor ELISA, SEPCR |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E99047 |
Rabbit soluble Factor-related Apoptosis,sFAS_Apo-1 ELISAkit |
|
----Eur |
Glory |
|
| E12F0103 |
Chicken Soluble Fms-like tyrosine kinase Receptor 1 ELISA , sFLt-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E12L0229 |
Chicken Lectin-galactose binding-soluble 3 ELISA , Lgals3 |
96 Tests/kit |
622-Eur |
BGene |
|
| E13V0005 |
Anserine soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| E12S0238 |
Chicken Soluble cluster of differentiation 30 ligand ELISA, SCD30L |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E98965 |
Chicken soluble endothelial protein C receptor,sEPCR ELISAkit |
|
----Eur |
Glory |
|
| CSB-E07395r |
Rat Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit SpeciesRat |
96T |
913-Eur |
Cusabio |
|
| CSB-E07313r |
Rat soluble endothelial protein C receptor,sEPCR ELISA Kit SpeciesRat |
96T |
981-Eur |
Cusabio |
|
| CSB-E08542h |
Human soluble Cluster of differentiation 86,sCD86 ELISA Kit SpeciesHuman |
96T |
583-Eur |
Cusabio |
|
| CGHIV-0640 |
rHIV p24, soluble CGC Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
86-Eur |
Arista Bio |
|
| E13S0265 |
Anserine Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
789-Eur |
Other suppliers |
|
| HGP13-R |
Recombinant (E. coli) HIV gp13 protein (HIV_gp13 Subtype O), soluble |
100 ug |
262-Eur |
Alpha Diagnostics |
recombinant |
| E12C0209 |
Chicken soluble Cluster of differentiation 40 ligand ELISA , Scd40l |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E07449m |
Mouse soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| 828-27-3 |
4_(Trifluoromethoxy)phenol 4_(Trifluoromethoxy)ph |
1g |
----Eur |
chemotra |
|
| 461-84-7 |
4_(Trifluoromethylthio)phenol 4_(Trifluoromethylthio)p |
1g |
----Eur |
chemotra |
|
| 636-93-1 |
2_Methoxy_5_Nitro Phenol 2_Methoxy_5_Nitro Phe |
1g |
----Eur |
chemotra |
|
| 103-18-4 |
4_[(4_aminophenyl)azo]phenol 4_[(4_aminophenyl)azo] |
1g |
----Eur |
chemotra |
|
| 496-96-5 |
2_BROMO_4_FLUORO PHENOL 2_BROMO_4_FLUORO |
1g |
----Eur |
chemotra |
|
| 461-84-1 |
4_(Trifluoromethylthio)phenol 4_(Trifluoromethylthio)p |
1g |
----Eur |
chemotra |
|
| 695-96-5 |
2_Bromo_4_Chloro Phenol 2_Bromo_4_Chloro Phe |
1g |
----Eur |
chemotra |
|
| 829-99-6 |
3_(Trifluoromethoxy)phenol 3_(Trifluoromethoxy)ph |
1g |
----Eur |
chemotra |
|
| 120-32-1 |
2_Benzyl_4_Chloro Phenol 2_Benzyl_4_Chloro Phe |
1g |
----Eur |
chemotra |
|
| 637-33-2 |
3_(hydrazinomethyl)phenol 3_(hydrazinomethyl)phe |
1g |
----Eur |
chemotra |
|
| 827-99-6 |
3_(Trifluoromethoxy)phenol 3_(Trifluoromethoxy)ph |
1g |
----Eur |
chemotra |
|
| CGHIV-0633 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
77-Eur |
Arista Bio |
|
| AGHIV-0233 |
rHIV gp120_41 fusion, soluble (63 KDa) Antigens - Infectious Disease |
100-999 mg/ml/ea price |
175-Eur |
Arista Bio |
|
| E0694Ra |
Rat Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
96T |
490-Eur |
Eastbio |
|
| QY-E10950 |
Rat Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E0249Hu |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISA KIT |
48T |
306-Eur |
Eastbio |
|
| QY-E21541 |
Mouse Tumor necrosis factor soluble receptor Ⅰ(TNFsR-Ⅰ)ELISA Kit |
96T |
464-Eur |
Qayee |
|
| E-EL-M0077 |
Mouse sICAM-1_CD54 (Soluble Intercellular Adhesion Molecule 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| 201-09-0072 |
Rabbit soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
719-Eur |
SunBT |
|
| CGHIV-0620 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
79-Eur |
Arista Bio |
|
| E-EL-M0647 |
Mouse sVCAM-1 (soluble vasccular cell adhesion molecule 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E0264Hu |
Human soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
48T |
290-Eur |
Eastbio |
|
| E0243Hu |
Human soluble tumor necrosis factor receptor 1,sTNF-R1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E12V0005 |
Chicken Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
715-Eur |
Blue Gene Biotech |
|
| E12T0527 |
Chicken Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
715-Eur |
Blue Gene Biotech |
|
| E12T0526 |
Chicken Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E98675 |
Rat Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISAkit |
|
----Eur |
Glory |
|
| Y061538 |
Anti_Tumor Necrosis Factor Soluble Receptor Type II produced in goat |
100ug |
965-Eur |
ABM Goods |
recombinant |
| CSB-E04698h |
Human platelet_derived growth factor soluble receptor á,PDGFsR_á ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| E11T0526 |
Bovine Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
715-Eur |
Blue Gene Biotech |
|
| CGHIV-0633 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
90-Eur |
Arista Bio |
|
| GPD1-1942H |
Protein Recombinant Human Glycerol-3-phosphate dehydrogenase 1 (soluble) |
0.1mg |
497-Eur |
CBio |
|
| CGHIV-0613 |
rHIV gp36, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
90-Eur |
Arista Bio |
|
| QY-E21542 |
Mouse Tumor necrosis factor soluble receptor Ⅱ(TNFsR-Ⅱ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21390 |
Mouse soluble Vascuolar cell adhesion molecule 1(sVCAM-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| CGHIV-0613 |
rHIV gp36, soluble CGC Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
77-Eur |
Arista Bio |
|
| CGHIV-0610 |
rHIV gp36, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
93-Eur |
Arista Bio |
|
| E0115Mo |
Mouse Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT |
96T |
656-Eur |
Eastbio |
|
| E0694Ra |
Rat Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
48T |
320-Eur |
Eastbio |
|
| CGHCV-0632 |
rHCV Cocktail, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
107-Eur |
Arista Bio |
|
| CGHIV-0638 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
90-Eur |
Arista Bio |
|
| CK-E98848 |
Porcine soluble Vascuolar cell adhesion molecules 1,sVCAM-1 ELISAkit |
|
----Eur |
Glory |
|
| QY-E30101 |
Rabbit soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| E11T0527 |
Bovine Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
715-Eur |
Blue Gene Biotech |
|
| E0116Mo |
Mouse Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
96T |
656-Eur |
Eastbio |
|
| QY-E40126 |
Porcine soluble vascular cell adhesion molecule-1 (sVCAM-1) ELISA Kit |
96T |
519-Eur |
SQBIO |
|
| E0220Po |
Porcine soluble Vascuolar cell adhesion molecules 1,sVCAM-1 ELISA Kit |
96T |
560-Eur |
Eastbio |
|
| LGALS4-1802H |
Protein Recombinant Human Lectin, Galactoside-binding, Soluble, 4 |
0.5mg |
934-Eur |
CBio |
|
| CGHCV-0632 |
rHCV Cocktail, soluble CGC Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
93-Eur |
Arista Bio |
|
| CGHIV-0610 |
rHIV gp36, soluble CGC Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
79-Eur |
Arista Bio |
|
| CSB-E04699m |
Mouse platelet_derived growth factor soluble receptor á,PDGFsR_á ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| E90936Mu |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) Organism: Mus musculus (Mouse) |
96T |
591-Eur |
USCNLife |
|
| ELI-6041 |
Leptin Soluble Receptor ELISA without CE mark; incub. time 3h_10 min |
96 Wells |
994-Eur |
Nal |
elisa |
| cyt-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
1mg |
3105-Eur |
Prospecbio |
|
| SFC-011 |
TIE-1_Fc Chimera, soluble Human Host: Insect cells TIE1; TIE; JTK14 |
20 |
108-Eur |
Reliatech |
|
| 184-01791 |
RANK Ligand Soluble, Mouse, recombinant (RANKL) Proteins Bone_Cartilage |
10 ug |
722-Eur |
B-Bridge |
|
| E0264Hu |
Human soluble Vascular cell adhesion molecule 1,sVCAM-1 ELISA Kit |
48T |
306-Eur |
Btlab |
|
| E0027Hu |
human soluble receptor for advanced glycation end products,sRAGE ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E-EL-H0135 |
Human sICAM-1_CD54 (Soluble Intercellular Adhesion Molecule 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| DS-MB-01418 |
Mouse Anti-Human Guanylate Cyclase alpha-1 (soluble) Antibodies |
0.2 mg |
361-Eur |
Ray Biotech |
|
| DS-MB-03300 |
Mouse Anti-Human Guanylate Cyclase beta 1 (soluble) Antibodies |
0.2 mg |
361-Eur |
Ray Biotech |
|
| 182-01471 |
RANK Ligand Soluble, Human, recombinant (RANKL) Proteins Bone_Cartilage |
10 ug |
688-Eur |
B-Bridge |
|
| CSB-RP130994h |
Recombinant human Soluble calcium-activated nucleotidase 1 Source: E.coli |
1mg |
1189-Eur |
Cusabio |
|
| E1915Hu |
Human Tumor necrosis factor soluble receptorⅡ,TNFsR-ⅡELISA KIT |
96T |
483-Eur |
Eastbio |
|
| E91960Ra |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Organism: Rattus norvegicus (Rat) |
96T |
647-Eur |
USCNLife |
|
| CGHIV-0638 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
83-Eur |
Arista Bio |
|
| E0415Ra |
Rat soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| CGHIV-0633 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
83-Eur |
Arista Bio |
|
| E0264Hu |
Human soluble Vascular cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
483-Eur |
Btlab |
|
| 186-01474 |
RANK Ligand Soluble, Human, recombinant (RANKL) Proteins Bone_Cartilage |
50 ug |
2469-Eur |
B-Bridge |
|
| SFC-012 |
TIE-1_Fc Chimera, soluble Human Host: Insect cells TIE1; TIE; JTK14 |
100 |
251-Eur |
Reliatech |
|
| E0389Hu |
Human soluble tumor necrosis factor receptor 2,sTNF-R2 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0264Hu |
Human soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
450-Eur |
Eastbio |
|
| CGHIV-0620 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
93-Eur |
Arista Bio |
|
| E0249Hu |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISA KIT |
96T |
483-Eur |
Eastbio |
|
| E0243Hu |
Human soluble tumor necrosis factor receptor 1,sTNF-R1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| SFC-033 |
TIE-2_Fc Chimera, soluble Mouse Host: CHO cells Tek; Hyk; Tie2; tie-2; Cd202b; AA517024 |
20 |
108-Eur |
Reliatech |
|
| E1821Hu |
Human soluble Factor-related Apoptosis ligand,sFASL_Apo-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| SFC-034 |
TIE-2_Fc Chimera, soluble Mouse Host: CHO cells Tek; Hyk; Tie2; tie-2; Cd202b; AA517024 |
100 |
251-Eur |
Reliatech |
|
| 100-301 |
TRAIL_Apo2L, soluble Human Host: E. coli TNFSF10; TL2; APO2L; CD253; TRAIL; Apo-2L |
50 |
232-Eur |
Reliatech |
|
| E97839Ra |
ELISA Kit for Isocitrate Dehydrogenase 1, Soluble (IDH1) Organism: Rattus norvegicus (Rat) |
96T |
676-Eur |
USCNLife |
|
| CABT-47137MH |
Mouse Anti Human Cd154 (Soluble) Monoclonal Antibody |
0.2 mg*0.75 |
671-Eur |
CDiagnostic |
|
| CABT-47139MH |
Mouse Anti Human Cd154 (Soluble) Monoclonal Antibody |
0.2 mg*0.75 |
671-Eur |
CDiagnostic |
|
| E14V0005 |
Sheep Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
715-Eur |
Blue Gene Biotech |
|
| CSB-RP130944h |
Recombinant human Soluble calcium-activated nucleotidase 1 Source: E.coli |
1mg |
1189-Eur |
Cusabio |
|
| CK-E99167 |
Rabbit soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISAkit |
|
----Eur |
Glory |
|
| CGHIV-0620 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
86-Eur |
Arista Bio |
|
| QY-E11229 |
Rat soluble receptor activator of nuclear factor-kB ligand(sRANKL)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E0027Hu |
human soluble receptor for advanced glycation end products,sRAGE ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| CGHIV-0638 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
77-Eur |
Arista Bio |
|
| CGHIV-0613 |
rHIV gp36, soluble CGC Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
83-Eur |
Arista Bio |
|
| CGHIV-0610 |
rHIV gp36, soluble CGC Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
86-Eur |
Arista Bio |
|
| CGHCV-0632 |
rHCV Cocktail, soluble CGC Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
100-Eur |
Arista Bio |
|
| E1915Hu |
Human Tumor necrosis factor soluble receptorⅡ,TNFsR-ⅡELISA KIT |
48T |
306-Eur |
Eastbio |
|
| SEH839Hu |
ELISA Kit for Isocitrate Dehydrogenase 1, Soluble (IDH1) Homo sapiens (Human) |
96T |
688-Eur |
USCNLife |
|
| SEB960Hu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Homo sapiens (Human) |
96T |
659-Eur |
USCNLife |
|
| E-EL-R0902 |
Rat SPECAM-1 (Soluble Platelet Endothelial Cell Adhesion Molecule 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E0415Ra |
Rat soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| AGHIV-0233 |
rHIV gp120_41 fusion, soluble (63 KDa) Antigens - Infectious Disease |
>1000 mg/ml/ea price |
154-Eur |
Arista Bio |
|
| E-EL-R0757 |
Rat PDGFsR-α (Platelet-Derived Growth Factor Soluble Receptor α) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E1821Hu |
Human soluble Factor-related Apoptosis ligand,sFASL_Apo-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E14T0527 |
Sheep Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
715-Eur |
Blue Gene Biotech |
|
| E08V0005 |
Canine Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E14T0526 |
Sheep Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
715-Eur |
Blue Gene Biotech |
|
| E92823Hu |
ELISA Kit for Thymidine Kinase 1, Soluble (TK1) Organism: Homo sapiens (Human) |
96T |
630-Eur |
USCNLife |
|
| CK-E98640 |
Rat soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISAkit |
|
----Eur |
Glory |
|
| E91428Mu |
ELISA Kit for Adenylate Cyclase 10, Soluble (ADCY10) Organism: Mus musculus (Mouse) |
96T |
618-Eur |
USCNLife |
|
| E90936Ra |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) Organism: Rattus norvegicus (Rat) |
96T |
618-Eur |
USCNLife |
|
| E08T0527 |
Canine Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
622-Eur |
BGene |
|
| E08T0526 |
Canine Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
622-Eur |
BGene |
|
| MD-14-0376 |
Mouse Anti-Human Soluble Guanylate Cyclase (hsGC) Proteins |
1 mg |
601-Eur |
Ray Biotech |
|
| E91960Mu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Organism: Mus musculus (Mouse) |
96T |
618-Eur |
USCNLife |
|
| E0389Hu |
Human soluble tumor necrosis factor receptor 2,sTNF-R2 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| SEA936Hu |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) Homo sapiens (Human) |
96T |
629-Eur |
USCNLife |
|
| CSB-E04716h |
Human Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit SpeciesHuman |
96T |
826-Eur |
Cusabio |
|
| GOT2 |
GOT1 Gene glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) |
|
----Eur |
Transposagen |
|
| CSB-E09901h |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| CSB-E10036Mo |
Monkey Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit SpeciesMonkey |
96T |
779-Eur |
Cusabio |
|
| E04T0526 |
Rabbit Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
689-Eur |
Blue Gene Biotech |
|
| E04T0527 |
Rabbit Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
689-Eur |
Blue Gene Biotech |
|
| E04V0005 |
Rabbit Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E11154h |
Human soluble myosin heavy chain 1,sMHC-1 ELISA Kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-E11155m |
Mouse soluble myosin heavy chain 1,sMHC-1 ELISA Kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| 201-12-0244 |
Human soluble tumor necrosis factor receptor 1,sTNF-R1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CSB-EL010050MO |
Mouse Guanylate cyclase soluble subunit alpha-3(GUCY1A3) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| 201-12-0390 |
Human soluble tumor necrosis factor receptor 2,sTNF-R2 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CGHIV-0613 |
rHIV gp36, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price x 2 |
122-Eur |
Arista Bio |
|
| CGHIV-0633 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price x 2 |
122-Eur |
Arista Bio |
|
| CSB-E04717m |
Mouse Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| 'AP10315PU-N |
Guanylate cyclase soluble GUCY1B3 (189-207) antibody Isotype IgG Host Rabbit |
0.1 mg |
509-Eur |
ACR |
|
| CSB-E11266h |
Human soluble tumor necrosis factor receptor 2,sTNF_R2 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E11265h |
Human soluble tumor necrosis factor receptor 1,sTNF_R1 ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| 'AP08168PU-N |
Guanylate cyclase soluble GUCY1B3 (189-207) antibody Isotype IgG Host Rabbit |
50 |
550-Eur |
ACR |
|
| CSB-EL010052MO |
Mouse Guanylate cyclase soluble subunit beta-1(GUCY1B3) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| 20056 |
Human Soluble Factor-related Apoptosis Ligand (sFasL) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| CSB-E11156m |
Mouse soluble myosin heavy chain 2,sMHC-2 ELISA Kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| CSB-EL002562CH |
Chicken Brain acid soluble protein 1(BASP1) ELISA kit SpeciesChicken |
96T |
913-Eur |
Cusabio |
|
| Y061160 |
Monoclonal Anti-Interleukin-2 Soluble Receptor β produced in mouse Antibody |
100ug |
857-Eur |
ABM Goods |
recombinant |
| CSB-EL010050DO |
Dog Guanylate cyclase soluble subunit alpha-3(GUCY1A3) ELISA kit SpeciesDog |
96T |
913-Eur |
Cusabio |
|
| Y061158 |
Monoclonal Anti-Interleukin-2 Soluble Receptor β produced in mouse Antibody |
100ug |
857-Eur |
ABM Goods |
recombinant |
| E05T0526 |
Guinea pig Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
689-Eur |
Blue Gene Biotech |
|
| Y061156 |
Monoclonal Anti-Interleukin-2 Soluble Receptor γ produced in mouse Antibody |
100ug |
857-Eur |
ABM Goods |
recombinant |
| CSB-E10037Mo |
Monkey soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
972-Eur |
Cusabio |
elisa |
| E05T0527 |
Guinea pig Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-EL010051HU |
Human Guanylate cyclase soluble subunit beta-2(GUCY1B2) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL015450BO |
Bovine Gamma-soluble NSF attachment protein(NAPG) ELISA kit SpeciesBovine |
96T |
913-Eur |
Cusabio |
|
| CSB-EL002562BO |
Bovine Brain acid soluble protein 1(BASP1) ELISA kit SpeciesBovine |
96T |
913-Eur |
Cusabio |
|
| CSB-E11807h |
human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-E13725h |
Human Soluble Mesothelin Related Peptide(SMRP)ELISA Kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| 20922 |
Human Soluble Vascular Cell Adhesion Molecule 1 (sVCAM-1) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| 201-12-0028 |
human soluble receptor for advanced glycation end products,sRAGE ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 23747 |
Mouse Tumor Necrosis Factor Soluble Receptor Ⅰ(TNFsR-Ⅰ) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| 23748 |
Mouse Tumor Necrosis Factor Soluble Receptor Ⅱ(TNFsR-Ⅱ) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CSB-EL015447BO |
Bovine Alpha-soluble NSF attachment protein(NAPA) ELISA kit SpeciesBovine |
96T |
913-Eur |
Cusabio |
|
| CSB-EL015448BO |
Bovine Beta-soluble NSF attachment protein(NAPB) ELISA kit SpeciesBovine |
96T |
913-Eur |
Cusabio |
|
| Y061148 |
Monoclonal Anti-Interleukin-4 Soluble Receptor produced in mouse Antibody |
100ug |
857-Eur |
ABM Goods |
recombinant |
| QY-E02468 |
Human soluble Factor-related Apoptosis ligand(sFASL_Apo-1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E02S0284 |
Rat Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
689-Eur |
Blue Gene Biotech |
|
| QY-E00178 |
Human Tumor necrosis factor soluble receptor Ⅰ(TNFsR-Ⅰ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E00177 |
Human Tumor necrosis factor soluble receptorⅡ(TNFsR-Ⅱ)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| CSB-E14253Ha |
Hamster soluble Vascular cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
710-Eur |
Cusabio |
|
| E03V0005 |
Mouse Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
689-Eur |
Blue Gene Biotech |
|
| 301COP001 |
CopAa, B.subtilis, recombinant, soluble domain A (aa 1_71), S46V mutant |
1mg |
229-Eur |
ProtEra |
recombinant |
| 301COP003 |
CopAab, B.subtilis, recombinant, soluble domain AB (aa 1_147), S46V mutant |
1mg |
261-Eur |
ProtEra |
recombinant |
| E03T0526 |
Mouse Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0265 |
Rat Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
689-Eur |
Blue Gene Biotech |
|
| QY-E02441 |
Human soluble tumor necrosis factor receptor 2(sTNF-R2)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E02442 |
Human soluble tumor necrosis factor receptor 1(sTNF-R1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| QY-E02459 |
Human soluble receptor for advanced glycation end products(sRAGE)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E01T0527 |
Human Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
689-Eur |
Blue Gene Biotech |
|
| E01T0526 |
Human Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
689-Eur |
Blue Gene Biotech |
|
| E01V0005 |
Human Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
689-Eur |
Blue Gene Biotech |
|
| QY-E02449 |
Human soluble Vascuolar cell adhesion molecule 1(sVCAM-1)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| 301COP001 |
CopAa, B.subtilis, recombinant, soluble domain A (aa 1_71), S46V mutant |
200ug |
160-Eur |
ProtEra |
recombinant |
| 301COP003 |
CopAab, B.subtilis, recombinant, soluble domain AB (aa 1_147), S46V mutant |
200ug |
183-Eur |
ProtEra |
recombinant |
| 201-11-0695 |
Rat Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
96T |
490-Eur |
SunBT |
|
| E03T0527 |
Mouse Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
689-Eur |
Blue Gene Biotech |
|
| PC-SNAP1 |
Alfa soluble N-ethymaleimide sensitive factor attachment protein, WB control |
100-150ul |
243-Eur |
FabGennix |
|
| CSB-E05126r |
Rat soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| CSB-E15845r |
Rat Soluble Lectin-like Oxidized Low Density Lipoprotein Receptor-1(sLOX-1)ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| 14-2RANKL |
Polyclonal antibody Anti-soluble Receptor Activator of NF-κB Ligand, Mouse |
200 |
170-Eur |
ARP |
|
| CSB-E04530m |
Mouse soluble endothelial protein C receptor,sEPCR ELISA Kit SpeciesMouse |
96T |
959-Eur |
Cusabio |
|
| CSB-E04714h |
Human Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit SpeciesHuman |
96T |
714-Eur |
Cusabio |
|
| 201-12-1916 |
Human Tumor necrosis factor soluble receptorⅡ,TNFsR-ⅡELISA KIT |
48T |
295-Eur |
SunBT |
|
| 201-12-0250 |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISA KIT |
48T |
295-Eur |
SunBT |
|
| 201-12-0265 |
Human soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CSB-E14331r |
Rat soluble triggering receptor expresses on myeloid cells-2,sTREM-2 ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| CSB-E13539h |
Human Soluble Receptor Activator Of Nuclear Factor_kB(SRANK) ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| 'H00002982-B01P |
Guanylate cyclase soluble GUCY1A3 antibody Host Mouse |
50 |
481-Eur |
ACR |
|
| 301COP001 |
CopAa, B.subtilis, recombinant, soluble domain A (aa 1_71), S46V mutant |
10mg |
1836-Eur |
ProtEra |
recombinant |
| 301COP003 |
CopAab, B.subtilis, recombinant, soluble domain AB (aa 1_147), S46V mutant |
10mg |
2023-Eur |
ProtEra |
recombinant |
| 201-11-0416 |
Rat soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
490-Eur |
SunBT |
|
| MCA2623 |
MOUSE ANTI GUANYLATE CYCLASE ALPHA 1 (SOLUBLE)-MONOCLONAL ANTIBODY |
0.2 mg |
370-Eur |
AbD Serotec |
monoclonal |
| 'H00002982-D01P |
Guanylate cyclase soluble GUCY1A3 antibody Host Rabbit |
100 |
509-Eur |
ACR |
|
| 30R-2214 |
Soluble CD40 Ligand protein (Mouse), Native & Recombinant Proteins |
5 ug |
328-Eur |
Fitzgerald |
|
| 30R-2214 |
Soluble CD40 Ligand protein (Mouse), Native & Recombinant Proteins |
25 ug |
660-Eur |
Fitzgerald |
|
| CSB-E13847r |
Rat soluble Triggering Receptor Expresses on Myeloid Cells_1,sTREM_1 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E04715m |
Mouse Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| CSB-EL010052HU |
Human Guanylate cyclase soluble subunit beta-1(GUCY1B3) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E08T0526 |
Canine Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
715-Eur |
Blue Gene Biotech |
|
| 201-12-0244 |
Human soluble tumor necrosis factor receptor 1,sTNF-R1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E08T0527 |
Canine Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
715-Eur |
Blue Gene Biotech |
|
| E08V0005 |
Canine Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
715-Eur |
Blue Gene Biotech |
|
| AVARP13049 |
Anti-Alpha-soluble NSF attachment protein (NAPA) Species_Reactivity: Human |
|
230-Eur |
Aviva |
|
| E91960Gu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Organism Cavia (Guinea pig ) |
96T |
715-Eur |
USCNLife |
elisa |
| E90936Mu |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) Organism Mus musculus (Mouse) |
96T |
654-Eur |
USCNLife |
elisa |
| E91960Po |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Organism Sus scrofa (Porcine; Pig) |
96T |
745-Eur |
USCNLife |
elisa |
| E0220Po |
Porcine soluble Vascuolar cell adhesion molecules 1,sVCAM-1 ELISA Kit |
48T |
380-Eur |
Eastbio |
|
| 201-12-0390 |
Human soluble tumor necrosis factor receptor 2,sTNF-R2 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| LGALS4-1802H |
Protein: Recombinant Human Lectin, Galactoside-binding, Soluble, 4 |
0.5mg |
934-Eur |
C.bio |
|
| E0116Mo |
Mouse Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
48T |
386-Eur |
Eastbio |
|
| E0115Mo |
Mouse Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT |
48T |
386-Eur |
Eastbio |
|
| 201-12-1916 |
Human Tumor necrosis factor soluble receptorⅡ,TNFsR-ⅡELISA KIT |
96T |
476-Eur |
SunBT |
|
| 201-12-0250 |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISA KIT |
96T |
476-Eur |
SunBT |
|
| M0257 |
Carboxyumbelliferyl beta_D_galactopyranoside (CUG), Water soluble, Fluorescent lacZ beta_Galactosidase Reagent, 5mg |
|
192-Eur |
MarkerGene |
|
| 201-12-0265 |
Human soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| GPD1-1942H |
Protein: Recombinant Human Glycerol-3-phosphate dehydrogenase 1 (soluble) |
0.1mg |
497-Eur |
C.bio |
|
| CK-E98432 |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISAkit |
|
----Eur |
Glory |
|
| CK-E97716 |
Mouse Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISAkit |
|
----Eur |
Glory |
|
| CK-E97715 |
Mouse Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISAkit |
|
----Eur |
Glory |
|
| E09T0526 |
Monkey Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
715-Eur |
Blue Gene Biotech |
|
| cyt-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
20 |
167-Eur |
Prospecbio |
|
| E09T0527 |
Monkey Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
715-Eur |
Blue Gene Biotech |
|
| CSB-E05126r |
Rat soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96T |
772-Eur |
Cusabio |
elisa |
| 201-12-1822 |
Human soluble Factor-related Apoptosis ligand,sFASL_Apo-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E09V0005 |
Monkey Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
715-Eur |
Blue Gene Biotech |
|
| AGHIV-0233 |
rHIV gp120_41 fusion, soluble (63 KDa) Antigens - Infectious Disease |
1-99 mg/ml/ea price |
195-Eur |
Arista Bio |
|
| E05V0005 |
Guinea pig Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
689-Eur |
Blue Gene Biotech |
|
| E02S0295 |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| cyt-285 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha CYTOKINES AND GROWTH FACTORS |
25 |
167-Eur |
Prospecbio |
|
| CSB-E06802p |
Porcine soluble vascular cell adhesion molecules 1,sVCAM_1 ELISA Kit |
96T |
972-Eur |
Cusabio |
elisa |
| CSB-E07989m |
Mouse soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| CSB-E07988h |
Human soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| E91960Ra |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Organism Rattus norvegicus (Rat) |
96T |
684-Eur |
USCNLife |
elisa |
| E91960Mu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Organism Mus musculus (Mouse) |
96T |
654-Eur |
USCNLife |
elisa |
| 201-12-0028 |
human soluble receptor for advanced glycation end products,sRAGE ELISA Kit |
96T |
476-Eur |
SunBT |
|
| ACLCYT309 |
Tumor Necrosis Factor Receptor Inhibitor, Human Soluble, recombinant |
10 µg. |
----Eur |
Accurate |
recombinant |
| CSB-E06944Rb |
Rabbit soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
972-Eur |
Cusabio |
elisa |
| ACLCYT309B |
Tumor Necrosis Factor Receptor Inhibitor, Human Soluble, recombinant |
50 µg. |
----Eur |
Accurate |
recombinant |
| cyt-285 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha CYTOKINES AND GROWTH FACTORS |
1mg |
3430-Eur |
Prospecbio |
|
| CSB-EL010050HU |
Human Guanylate cyclase soluble subunit alpha-3(GUCY1A3) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| E06T0526 |
Goat Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
715-Eur |
Blue Gene Biotech |
|
| E06T0527 |
Goat Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
715-Eur |
Blue Gene Biotech |
|
| E07V0005 |
Porcine Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
608-Eur |
BGene |
|
| 22053 |
Rat Soluble Platelet Endothelial Cell Adhesion Molecule 1(sPECAM-1) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E07T0527 |
Porcine Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
608-Eur |
BGene |
|
| 20812 |
Rat Soluble Receptor Activator Of Nuclear Factor-kB Ligand(sRANKL) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E07T0526 |
Porcine Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
608-Eur |
BGene |
|
| E06V0005 |
Goat Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
715-Eur |
Blue Gene Biotech |
|
| CSB-EL015448MO |
Mouse Beta-soluble NSF attachment protein(NAPB) ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| CSB-EL015447MO |
Mouse Alpha-soluble NSF attachment protein(NAPA) ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| CSB-EL004484HU |
Human Soluble calcium-activated nucleotidase 1(CANT1) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-EL010052DO |
Dog Guanylate cyclase soluble subunit beta-1(GUCY1B3) ELISA kit SpeciesDog |
96T |
913-Eur |
Cusabio |
|
| CSB-EL010049HU |
Human Guanylate cyclase soluble subunit alpha-2(GUCY1A2) ELISA kit |
96T |
626-Eur |
Cusabio |
|
| CSB-EL015447HU |
Human Alpha-soluble NSF attachment protein(NAPA) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| 22290 |
Rat Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α) ELISA kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CSB-EL015448HU |
Human Beta-soluble NSF attachment protein(NAPB) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-EL002562HU |
Human Brain acid soluble protein 1(BASP1) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-EL015450HU |
Human Gamma-soluble NSF attachment protein(NAPG) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CGHIV-0638 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price x 2 |
122-Eur |
Arista Bio |
|
| CSB-EL002562MO |
Mouse Brain acid soluble protein 1(BASP1) ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| RD172254100 |
Galactosidase-binding soluble lectin 13, E.coli, Human Recombinant protein |
0.1 mg |
336-Eur |
Biovendor |
|
| CGHCV-0632 |
rHCV Cocktail, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price x 2 |
154-Eur |
Arista Bio |
|
| E07T0526 |
Porcine Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
|
715-Eur |
Blue Gene Biotech |
|
| cyt-285 |
Recombinant Human Soluble Iinterleukin-2 Receptor alpha CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| E07T0527 |
Porcine Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
|
715-Eur |
Blue Gene Biotech |
|
| E07V0005 |
Porcine Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
715-Eur |
Blue Gene Biotech |
|
| 201-20-2333 |
GOT1{glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1)}rabbit.pAb |
0.2ml |
623-Eur |
Shanghai Sunred |
|
| cyt-532 |
Recombinant Raibow Trout Prolactin Soluble Receptor CYTOKINES AND GROWTH FACTORS |
5 |
96-Eur |
Prospecbio |
|
| AGHIV-0233 |
rHIV gp120_41 fusion, soluble (63 KDa) Antigens - Infectious Disease |
1-99 mg/ml/ea price x 2 |
323-Eur |
Arista Bio |
|
| CGHIV-0620 |
rHIV gp41, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price x 2 |
128-Eur |
Arista Bio |
|
| 201-12-1822 |
Human soluble Factor-related Apoptosis ligand,sFASL_Apo-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CSB-EL010051RA |
Rat Guanylate cyclase soluble subunit beta-2(GUCY1B2) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-EL015450MO |
Mouse Gamma-soluble NSF attachment protein(NAPG) ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| PR-680 |
CD40L, soluble CD40 Ligand_CD154_TRAP TNF-related Activation Proteinhuman, recombinant, E. coli |
50 |
241-Eur |
Jena Bioscience |
recombinant |
| CSB-EL004484MO |
Mouse Soluble calcium-activated nucleotidase 1(CANT1) ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| E11V0005 |
Bovine Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
|
715-Eur |
Blue Gene Biotech |
|
| CGHIV-0610 |
rHIV gp36, soluble CGC Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price x 2 |
128-Eur |
Arista Bio |
|
| CSB-EL010049RA |
Rat Guanylate cyclase soluble subunit alpha-2(GUCY1A2) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-EL010050RA |
Rat Guanylate cyclase soluble subunit alpha-3(GUCY1A3) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-EL010052RA |
Rat Guanylate cyclase soluble subunit beta-1(GUCY1B3) ELISA kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-E08134r |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| JP27998 |
soluble α-Klotho human ELISA Standard range: 93.75 - 6000 pg_ml |
96 tests |
720-Eur |
Gentaur |
|
| CGHIV-0620 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
82-Eur |
Arista |
|
| 201-12-0265 |
Human soluble Vascuolar cell adhesion molecule 1(sVCAM-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CK-E94825 |
Human soluble Tumor Necrosis Factor αreceptor （STNFΑR）ELISA |
96T |
728-Eur |
Glory |
|
| CK-E95063 |
Human Soluble tumor necrosis factor α receptor 2(sTNF-α) ELISA Kit |
96T |
728-Eur |
Glory |
|
| 201-12-0250 |
Human Tumor necrosis factor soluble receptor Ⅰ(TNFsR-Ⅰ)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| GS-0894a |
glycerol-3-phosphate dehydrogenase 1 (soluble) primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| CGHIV-0610 |
rHIV gp36, soluble CGC, Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
82-Eur |
Arista |
|
| GS-1044a |
isocitrate dehydrogenase 1 (NADP+), soluble primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| GS-1207a |
lectin, galactoside-binding, soluble, 1 primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| CSB-E10037Mo |
Monkey soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| 201-12-0244 |
Human soluble tumor necrosis factor receptor 1(sTNF-R1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| GS-1208a |
lectin, galactoside-binding, soluble, 12 primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| CSB-E11266h |
Human soluble tumor necrosis factor receptor 2,sTNF_R2 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| E01V0005 |
Human Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| CGHIV-0633 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
86-Eur |
Arista |
|
| AP10312CP-N |
Guanylate cyclase soluble GUCY1A3 control peptide antibody Ab_CP |
0.25 mg |
147-Eur |
ACR |
|
| AP10315CP-N |
Guanylate cyclase soluble GUCY1B3 control peptide antibody Ab_CP |
0.25 mg |
147-Eur |
ACR |
|
| CSB-E05126r |
Rat soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CGHIV-0613 |
rHIV gp36, soluble CGC, Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
86-Eur |
Arista |
|
| CSB-E04699m |
Mouse platelet_derived growth factor soluble receptor á,PDGFsR_á ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| CSB-E08069r |
Rat Soluble protein-100,S-100 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| CSB-E11265h |
Human soluble tumor necrosis factor receptor 1,sTNF_R1 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| Z5010472 |
Recombinant Human Soluble Tumor Necrosis Factor Receptor Inhibitor |
50 µg |
435-Eur |
Biochain |
recombinant |
| 201-12-0390 |
Human soluble tumor necrosis factor receptor 2(sTNF-R2)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E01T0526 |
Human Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
601-Eur |
BGene |
|
| E01T0527 |
Human Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
601-Eur |
BGene |
|
| GS-1209a |
lectin, galactoside-binding, soluble, 3 primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| CGHIV-0638 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
80-Eur |
Arista |
|
| CGHIV-0638 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
73-Eur |
Arista |
|
| E04V0005 |
Rabbit anti-soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| 201-11-0695 |
Rat Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| CGHIV-0633 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
73-Eur |
Arista |
|
| Z5010472 |
Recombinant Human Soluble Tumor Necrosis Factor Receptor Inhibitor |
50 µg |
447-Eur |
Biochain |
recombinant |
| S01-060 |
DLL-1, soluble, Host: HEK 293 cells, Species: Human, Synonyms: DLL1; DL1; Delta; DELTA1 |
25 ug |
232-Eur |
Reliatech |
|
| CK-E20219 |
Mouse Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
96T |
454-Eur |
Eastbio |
|
| E03T0526 |
Mouse Tumor necrosis factor soluble receptor I ELISA,TNFsR-I |
96 Tests/kit |
601-Eur |
BGene |
|
| CGHIV-0613 |
rHIV gp36, soluble CGC, Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
73-Eur |
Arista |
|
| E13L0229 |
Anserine anti - lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| E03T0527 |
Mouse Tumor necrosis factor soluble receptor II ELISA,TNFsR-II |
96 Tests/kit |
601-Eur |
BGene |
|
| CK-E20218 |
Mouse Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT |
96T |
454-Eur |
Eastbio |
|
| CK-E95919 |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISAkit |
|
----Eur |
Glory |
|
| CK-E95918 |
Human Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISAkit |
|
----Eur |
Glory |
|
| GS-1211a |
lectin, galactoside-binding, soluble, 7B primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| GS-1212a |
lectin, galactoside-binding, soluble, 9 primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| E02S0265 |
Rat Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
601-Eur |
BGene |
|
| CGHIV-0633 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
80-Eur |
Arista |
|
| CSB-E11265h |
Human soluble tumor necrosis factor receptor 1,sTNF_R1 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CSB-E11266h |
Human soluble tumor necrosis factor receptor 2,sTNF_R2 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| CGHIV-0613 |
rHIV gp36, soluble CGC, Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
80-Eur |
Arista |
|
| CSB-E08134r |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96tests |
915-Eur |
Cusabio |
elisa |
| 201-12-0028 |
Human soluble receptor for advanced glycation end products(sRAGE)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CK-E95864 |
Human soluble Factor-related Apoptosis ligand,sFASL_Apo-1 ELISAkit |
|
----Eur |
Glory |
|
| CGHIV-0620 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
76-Eur |
Arista |
|
| CGHIV-0610 |
rHIV gp36, soluble CGC, Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
76-Eur |
Arista |
|
| E01S0284 |
Human Anti-soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E04S0265 |
Rabbit anti-Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CK-E30605 |
Rat soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-E06802p |
Porcine soluble vascular cell adhesion molecules 1,sVCAM_1 ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| CK-E90317 |
Human soluble Vascuolar cell adhesion molecule 1(SVCAM-1)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-E06944Rb |
Rabbit soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| E03S0284 |
Mouse anti-soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CSB-E07988h |
Human soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E07989m |
Mouse soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
837-Eur |
Cusabio |
elisa |
| 201-11-0416 |
Rat soluble receptor activator of nuclear factor-kB ligand(sRANKL)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| E11V0005 |
Bovine Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-09-0072 |
Rabbit soluble Vascuolar cell adhesion molecule 1(sVCAM-1)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| E04S0284 |
Rabbit anti-soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CSB-E08134r |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| E05S0265 |
Guinea anti-Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| AGHIV-0233 |
rHIV gp120_41 fusion, soluble (63 KDa), Antigens - Infectious Disease |
100-999 mg/ml/ea price |
167-Eur |
Arista |
|
| CSB-E05126r |
Rat soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| E11T0526 |
Bovine Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E30640 |
Rat Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
96T |
454-Eur |
Eastbio |
|
| E14T0527 |
Sheep Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
622-Eur |
BGene |
|
| E14V0005 |
Sheep Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E14T0526 |
Sheep Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
622-Eur |
BGene |
|
| E03L0229 |
Mouse anti-lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| CK-E50099 |
Porcine soluble Vascuolar cell adhesion molecules 1,sVCAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E11T0527 |
Bovine Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E80146 |
Rabbit soluble Vascuolar cell adhesion molecule 1,sVCAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| AGHIV-0233 |
rHIV gp120_41 fusion, soluble (63 KDa), Antigens - Infectious Disease |
1-99 mg/ml/ea price |
186-Eur |
Arista |
|
| E05L0229 |
Guinea anti-lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E03S0265 |
Mouse anti-Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| CK-E90432 |
Human soluble receptor for advanced glycation end products(sRAGE)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E05S0284 |
Guinea anti-soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| CGHIV-0620 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
89-Eur |
Arista |
|
| 365039 |
Protein,Murine soluble Receptor Activator of NF_kappa_B Ligand (M_sRANK_Ligand) |
0.002 mg |
190-Eur |
GenWay |
recombinant |
| 365022 |
Protein,Human soluble Receptor Activator of NF_kappa_B Ligand (H_sRANK_Ligand) |
0.002 mg |
190-Eur |
GenWay |
recombinant |
| CSB-E06944Rb |
Rabbit soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| CGHIV-0610 |
rHIV gp36, soluble CGC, Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
89-Eur |
Arista |
|
| E09V0005 |
Monkey Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E09T0527 |
Monkey Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
622-Eur |
BGene |
|
| E09T0526 |
Monkey Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E30397 |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CGHIV-0638 |
rHIV gp41, soluble CGC, Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
86-Eur |
Arista |
|
| CSB-E06802p |
Porcine soluble vascular cell adhesion molecules 1,sVCAM_1 ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| JP27782 |
soluble (Pro)renin Receptor human ELISA Standard range: 125 - 8.000 pg_ml |
96 tests |
720-Eur |
Gentaur |
|
| 201-02-0117 |
Mouse Tumor necrosis factor soluble receptor Ⅱ(TNFsR-Ⅱ)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| 201-12-1822 |
Human soluble Factor-related Apoptosis ligand(sFASL_Apo-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CSB-E07989m |
Mouse soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| E05V0005 |
Guinea anti-soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CSB-E07988h |
Human soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| 188-01473 |
RANK Ligand Soluble, Human, recombinant (RANKL)*price on request |
1 mg |
----Eur |
B-Bridge |
recombinant |
| E03V0005 |
Mouse anti-soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| 201-12-1916 |
Human Tumor necrosis factor soluble receptorⅡ(TNFsR-Ⅱ)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E07L0229 |
Porcine anti-lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CSB-E10037Mo |
Monkey soluble vascular cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| 201-02-0116 |
Mouse Tumor necrosis factor soluble receptor Ⅰ(TNFsR-Ⅰ)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| CGHCV-0632 |
rHCV Cocktail, soluble CGC, Gold Conjugates - Infectious Disease |
1-99 mg/ml/ea price |
102-Eur |
Arista |
|
| CGHCV-0632 |
rHCV Cocktail, soluble CGC, Gold Conjugates - Infectious Disease |
100-999 mg/ml/ea price |
96-Eur |
Arista |
|
| CGHCV-0632 |
rHCV Cocktail, soluble CGC, Gold Conjugates - Infectious Disease |
>1000 mg/ml/ea price |
89-Eur |
Arista |
|
| 201-02-0281 |
Mouse soluble Vascuolar cell adhesion molecule 1(sVCAM-1)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| E01L0229 |
Human Anti-lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| CSB-E04737m |
Mouse Tumor necrosis factor soluble receptor Ⅰ,TNFsR_Ⅰ ELISA KIT |
96T |
896-Eur |
Cusabio |
elisa |
| E02S0284 |
Rat Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
601-Eur |
BGene |
|
| CSB-E04699m |
Mouse Platelet_Derived Growth Factor Soluble Receptor α,PDGFsR_α ELISA kit |
96T |
896-Eur |
Cusabio |
elisa |
| 33384 |
Rabbit Soluble Factor-related Apoptosis Ligand (sFasL) ELISA KIT |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| E06S0284 |
Goat anti-soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E06V0005 |
Goat anti-soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| CSB-E04698h |
Human Platelet_Derived Growth Factor Soluble Receptor α,PDGFsR_α ELISA kit |
96T |
683-Eur |
Cusabio |
elisa |
| E04L0229 |
Rabbit anti-lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E12T0526 |
Chicken Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
622-Eur |
BGene |
|
| E12T0527 |
Chicken Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0265 |
Bovine anti-Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| 201-15-0090 |
Canine soluble tumor necrosis factor receptor 1(sTNF-R1)ELISA Kit |
96T |
704-Eur |
Sunred |
|
| E12V0005 |
Chicken Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
622-Eur |
BGene |
|
| E01S0265 |
Human Anti-Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1087-Eur |
BlueGen |
recombinant |
| E11V0005 |
Bovine anti-soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| E06S0265 |
Goat anti-Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| CSB-E04738h |
Human Tumor necrosis factor soluble receptor Ⅱ,TNFsR_Ⅱ ELISA KIT |
96T |
570-Eur |
Cusabio |
elisa |
| 27874 |
Mouse Soluble Factor-related Apoptosis Ligand (sFasL) ELISA KIT |
20ng/ml-0.312ng/ml <0.06ng/ml |
650-Eur |
TEFL |
|
| E01V0005 |
Human Anti-soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1087-Eur |
BlueGen |
elisa |
| E07S0265 |
Porcine anti-Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| E13V0005 |
Anserine anti - soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| E07S0284 |
Porcine anti-soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1101-Eur |
BlueGen |
recombinant |
| CSB-E07989m |
Mouse soluble Vascuolar cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| CSB-E07988h |
Human soluble Vascuolar cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| E13S0284 |
Anserine anti - soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| 31328 |
Porcine Soluble Vascuolar Cell Adhesion Molecule 1(sVCAM-1) ELISA KIT |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| CSB-E06944Rb |
Rabbit soluble Vascuolar cell adhesion molecule 1,sVCAM_1 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| CSB-E06802p |
Porcine soluble Vascuolar cell adhesion molecules 1,sVCAM_1 ELISA Kit |
96T |
915-Eur |
Cusabio |
elisa |
| CSB-E04739m |
Mouse Tumor necrosis factor soluble receptor Ⅱ,TNFsR_Ⅱ ELISA KIT |
96T |
896-Eur |
Cusabio |
elisa |
| 31318 |
Porcine Soluble Factor-related Apoptosis Ligand (sFasL) ELISA KIT |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| AP15185CP-N |
Guanylate cyclase soluble GUCY1B3 Control Peptide antibody Ab_CP |
0.1 mg |
138-Eur |
ACR |
|
| E13S0265 |
Anserine anti - Soluble Lectin-like oxidized low density lipoprotein receptor-1 |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| 27096 |
Human Tumor Necrosis Factor Soluble Receptor Ⅱ(TNFsR-Ⅱ) ELISA Kit |
20ng/ml-0.312ng/ml <0.06ng/ml |
730-Eur |
TEFL |
|
| E06L0229 |
Goat anti-lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E11L0229 |
Bovine anti-lectin-galactose binding-soluble 3,Lgals3 ELISA Kit |
96 Tests/kit |
1128-Eur |
BlueGen |
elisa |
| S01-M41 |
TIE-1, soluble, Host: Insect cells, Species: Mouse, Synonyms: Tie1; TIE; tie-1; D430008P04Rik |
10 ug |
114-Eur |
Reliatech |
|
| AGHIV-0233 |
rHIV gp120_41 fusion, soluble (63 KDa), Antigens - Infectious Disease |
>1000 mg/ml/ea price |
148-Eur |
Arista |
|
| CK-E10112 |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISA KIT |
96T |
454-Eur |
Eastbio |
|
| AP13761CP-N |
Guanylate cyclase soluble GUCY1A3 Control Peptide antibody Ab_CP |
0.1 mg |
138-Eur |
ACR |
|
| 27080 |
Human Soluble Factor-Related Apoptosis Ligand(sFASL_Apo-1) ELISA Kit |
2000pg/ml-31.2pg/ml <12pg/ml |
730-Eur |
TEFL |
|
| E06T0526 |
Goat Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
608-Eur |
BGene |
|
| 27095 |
Human Tumor Necrosis Factor Soluble Receptor Ⅰ(TNFsR-Ⅰ) ELISA Kit |
20ng/ml-0.312ng/ml <0.06ng/ml |
730-Eur |
TEFL |
|
| CK-E10111 |
Human Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT |
96T |
454-Eur |
Eastbio |
|
| E07V0005 |
Porcine anti-soluble Vascular cellular adhesion molecule 1 Elisa Kit |
96 Tests/kit |
1101-Eur |
BlueGen |
elisa |
| E06V0005 |
Goat Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
608-Eur |
BGene |
|
| 33392 |
Rabbit Soluble Vascuolar Cell Adhesion Molecule 1(sVCAM-1) ELISA KIT |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| E03V0005 |
Mouse Soluble Vascular cellular adhesion molecule 1 ELISA ,Svcam-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E06T0527 |
Goat Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
608-Eur |
BGene |
|
| E04T0526 |
Rabbit Tumor necrosis factor soluble receptor I ELISA, TNFsR-I |
96 Tests/kit |
601-Eur |
BGene |
|
| 27082 |
Human Soluble Vascuolar Cell Adhesion Molecule 1(sVCAM-1) ELISA KIT |
10ng/ml-0.156ng/ml <0.05ng/ml |
730-Eur |
TEFL |
|
| S01-M42 |
TIE-1, soluble, Host: Insect cells, Species: Mouse, Synonyms: Tie1; TIE; tie-1; D430008P04Rik |
50 ug |
251-Eur |
Reliatech |
|
| CK-E10057 |
Human soluble Factor-related Apoptosis ligand,sFASL_Apo-1 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| E11S0284 |
Bovine anti-soluble receptor activator of nuclear factor-kB ligand |
96 Tests/kit |
1128-Eur |
BlueGen |
recombinant |
| E04V0005 |
Rabbit Soluble Vascular cellular adhesion molecule 1 ELISA , Svcam-1 |
96 Tests/kit |
601-Eur |
BGene |
|
| E04T0527 |
Rabbit Tumor necrosis factor soluble receptor II ELISA, TNFsR-II |
96 Tests/kit |
601-Eur |
BGene |
|
| EIAAB45210 |
GNT1,Homo sapiens,Human,Phenol-metabolizing UDP-glucuronosyltransferase,UDP-glucuronosyltransferase 1-6,UDP-glucuronosyltransferase 1A6,UDP-glucuronosyltransferase 1-F,UDPGT 1-6,UGT1,UGT1*6,UGT1.6,UGT |
|
1109-Eur |
EIAab |
|
| SFC-031 |
TIE-1_Fc Chimera, soluble, Host: CHO cells, Species: Mouse, Synonyms: Tie1; TIE; tie-1; D430008P04Rik |
20 ug |
108-Eur |
Reliatech |
|
| E-EL-H2166 |
Human sVCAM-1_CD106 (soluble Vascuolar Cell Adhesion Molecule 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| Sac-101AP |
Soluble adenylate cyclase 1 N-Terminal, Host species: Rabbit, Polyclonal antibody |
200ul |
337-Eur |
FabGennix |
|
| 201-12-1425 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1,sLOX-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| 201-12-0647 |
Human soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
476-Eur |
SunBT |
|
| CSB-E13340r |
Rat soluble interleukin-2 receptor(sIL-2R) ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 201-12-0201 |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
96T |
476-Eur |
SunBT |
|
| CSB-E08134r |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit SpeciesRat |
96T |
981-Eur |
Cusabio |
|
| CSB-E07370r |
Rat soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| 201-12-1425 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1(sLOX-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CSB-E13567h |
Human soluble lectin-like oxidized low density lipoprotein receptor-1(sLOX-1)ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| SFC-032 |
TIE-1_Fc Chimera, soluble, Host: CHO cells, Species: Mouse, Synonyms: Tie1; TIE; tie-1; D430008P04Rik |
100 ug |
238-Eur |
Reliatech |
|
| CSB-E07370r |
Rat soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| E-EL-M0929 |
Mouse PDGFsR-α (Platelet-Derived Growth Factor Soluble Receptor α) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| 201-12-0261 |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| S01-037 |
TWEAK receptor, soluble Human Host: E. coli TNFRSF12A; FN14; CD266; TWEAKR |
25 |
232-Eur |
Reliatech |
|
| 201-12-0311 |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1(sTREM-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 27069 |
Human Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α) ELISA Kit |
20ng/ml-0.312ng/ml <0.06ng/ml |
650-Eur |
TEFL |
|
| CSB-EL023577RA |
Rat thymidine kinase 1, soluble (TK1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E05127m |
Mouse soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| Sac-112AP |
Soluble adenylate cyclase Mid Region, Host species: Rabbit, Polyclonal antibody |
200ul |
337-Eur |
FabGennix |
|
| Sac-121AP |
Soluble adenylate cyclase1 C-Epitope, Host species: Rabbit, Polyclonal antibody |
200ul |
337-Eur |
FabGennix |
|
| CSB-E04698h |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
96T |
542-Eur |
Cusabio |
|
| CSB-E08133h |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| 201-12-0261 |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| 201-12-0201 |
Human Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CSB-E08135m |
Mouse soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| CSB-EL010052HU |
Human Guanylate cyclase soluble subunit beta-1(GUCY1B3) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CABT-52850MG |
Mouse Anti Guanylate Cyclase Alpha 1 (Soluble) Monoclonal Antibody |
0.2 mg*0.75 |
591-Eur |
CDiagnostic |
|
| CSB-E08133h |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit |
96T |
542-Eur |
Cusabio |
|
| CSB-E05127m |
Mouse soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96T |
772-Eur |
Cusabio |
elisa |
| S01-M44 |
TIE-2, soluble, Host: Insect cells, Species: Mouse, Synonyms: Tek; Hyk; Tie2; tie-2; Cd202b; AA517024 |
50 ug |
251-Eur |
Reliatech |
|
| CSB-E05126r |
Rat soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CK-E90434 |
Human Soluble Vascular Endothelial Growth Factor Receptor 1(SFLT-1)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-E04739m |
Mouse Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT SpeciesMouse |
96T |
959-Eur |
Cusabio |
|
| CSB-E04737m |
Mouse Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT SpeciesMouse |
96T |
959-Eur |
Cusabio |
|
| CK-E90433 |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1(STREM1)ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CSB-E15846m |
Mouse soluble Lectin-like Oxidized Low Density Lipoprotein Receptor-1(sLOX-1)ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| S01-M43 |
TIE-2, soluble, Host: Insect cells, Species: Mouse, Synonyms: Tek; Hyk; Tie2; tie-2; Cd202b; AA517024 |
10 ug |
114-Eur |
Reliatech |
|
| CSB-E05125h |
Human soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E04736h |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISA KIT SpeciesHuman |
96T |
959-Eur |
Cusabio |
|
| 201-12-0647 |
Human soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
48T |
295-Eur |
SunBT |
|
| MBLAC1 |
MBL2 Gene mannose-binding lectin (protein C) 2, soluble (opsonic defect) |
|
----Eur |
Transposagen |
|
| 201-12-1425 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1,sLOX-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| Y061796 |
Anti-Transforming Growth Factor-β Soluble Receptor II produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| CSB-EL010049HU |
Human Guanylate cyclase soluble subunit alpha-2(GUCY1A2) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-E08135m |
Mouse soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| ISMUPAR-HIS |
Proteins and Antibodies Human and Animal Soluble Mouse Urokinase Receptor, His Tagged |
1mg |
6877-Eur |
Innovative Research INC |
|
| E-EL-MK0320 |
Monkey VCAM-1_CD106 (soluble Vascuolar Cell Adhesion Molecule 1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| 20804 |
Mouse Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| 201-12-0201 |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
48T |
295-Eur |
SunBT |
|
| E91428Hu |
ELISA Kit for Adenylate Cyclase 10, Soluble (ADCY10) Organism Homo sapiens (Human) |
96T |
639-Eur |
USCNLife |
elisa |
| E90936Hu |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) Organism Homo sapiens (Human) |
96T |
639-Eur |
USCNLife |
elisa |
| PR-680 |
Proteins: CD40L, soluble CD40 Ligand_CD154_TRAP TNF-related Activation Proteinhuman, recombinant, E. coli |
50 |
230-Eur |
Jena Bioscience |
|
| CSB-EL012871RA |
Rat Leptin Soluble Receptor,sLR ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
688-Eur |
Cusabio |
elisa |
| PR-680 |
CD40L, soluble CD40 Ligand_CD154_TRAP TNF_related Activation Protein human, recombinant, E. coli |
50µg |
296-Eur |
Jena Bioscience |
recombinant |
| DS-MB-03380 |
Mouse Anti-Human Lectin-type Oxidized LDL Receptor (LOX-1) _ OLR1 (Soluble) |
200 |
604-Eur |
Ray Biotech |
recombinant |
| Y061795 |
Anti-Transforming Growth Factor-β Soluble Receptor III produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| CK-E97707 |
Mouse Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISAkit |
|
----Eur |
Glory |
|
| CSB-E15820r |
Rat soluble CD23(sCD23) ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| 33389 |
Rabbit soluble triggering receptor expressed on myeloid cells-1 (sTREM-1) Elisa Kit |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| E09S0265 |
Monkey Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-EL010050HU |
Human Guanylate cyclase soluble subunit alpha-3(GUCY1A3) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-E08133h |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96T |
683-Eur |
Cusabio |
elisa |
| Y061541 |
Anti-Tumor Necrosis Factor Soluble Receptor I produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| Y061540 |
Anti-Tumor Necrosis Factor Soluble Receptor I produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| IDH1-1284H |
Protein: Recombinant Human Isocitrate Dehydrogenase 1 (NADP+), Soluble, His-tagged |
0.5mg |
1059-Eur |
C.bio |
|
| LGALS9-1937H |
Protein: Recombinant Human Lectin, Galactoside-Binding, Soluble, 9, His-tagged
|
50ug |
539-Eur |
C.bio |
|
| Y061539 |
Anti-Tumor Necrosis Factor Soluble Receptor II produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| 1909-1 |
KN-93, Water-Soluble N-[2-[[[3-(4-Chlorophenyl)-2-propenyl]methylamino]methyl]phenyl]-N-(2-hydroxyethyl)-4-methoxybenzenesulphonamide |
1 mg |
162-Eur |
Biovision |
|
| 1909-5 |
KN-93, Water-Soluble N-[2-[[[3-(4-Chlorophenyl)-2-propenyl]methylamino]methyl]phenyl]-N-(2-hydroxyethyl)-4-methoxybenzenesulphonamide |
5 mg |
432-Eur |
Biovision |
|
| Y061164 |
Monoclonal Anti-Interleukin-1 Soluble Receptor Type I produced in mouse Antibody |
100ug |
857-Eur |
ABM Goods |
recombinant |
| 21969 |
Mouse Soluble Receptor Activator Of Nuclear Factor-kB Ligand(sRANKL) ELISA kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CSB-EL001161RA |
Rat aconitase 1, soluble (ACO1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| E14S0284 |
Sheep Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
622-Eur |
BGene |
|
| 21615 |
Mouse Soluble Platelet Endothelial Cell Adhesion Molecule 1(sPECAM-1) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CSB-EL010052MO |
Mouse Guanylate cyclase soluble subunit beta-1(GUCY1B3) ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| CSB-EL010050MO |
Mouse Guanylate cyclase soluble subunit alpha-3(GUCY1A3) ELISA kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| E91960Hu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Organism Homo sapiens (Human) |
96T |
639-Eur |
USCNLife |
elisa |
| ISMUPAR-HIS |
Proteins and Antibodies Human and Animal Soluble Mouse Urokinase Receptor, His Tagged |
0.1mg |
898-Eur |
Innovative Research INC |
|
| CSB-EL010051HU |
Human Guanylate cyclase soluble subunit beta-2(GUCY1B2) ELISA kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-EL022397PL |
Human superoxide dismutase 1, soluble (SOD1) ELISA kit, Species , Sample Type |
96T |
816-Eur |
Cusabio |
elisa |
| HNS45-R |
Recombinant (E. coli) HCV NS4 protein, fragments of the NS4 immunodominant region derived from 11 HCV genotypes, (soluble) |
100 |
291-Eur |
Alpha Diagnostics |
recombinant |
| E-EL-Ch0831 |
Chicken VCAM-1_CD106 (soluble Vascuolar Cell Adhesion Molecule 1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-M1083 |
Mouse sRANKL (Soluble Receptor Activator of Nuclear Factor-kB Ligand) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-M1081 |
Mouse sPECAM-1 (Soluble Platelet Endothelial Cell Adhesion Molecule 1) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| 201-12-0311 |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| CSB-E05125h |
Human soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96tests |
856-Eur |
Cusabio |
elisa |
| E05S0295 |
Guinea soluble tumor necrosis factor-related apoptosis inducing ligand |
96 Tests/kit |
770-Eur |
Other suppliers |
|
| E01S0295 |
Human soluble tumor necrosis factor-related apoptosis inducing ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| E12S0265 |
Chicken Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-E05127m |
Mouse soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| HP1201-R |
Recombinant (E. coli) HIV_1 p120 protein (C_terminus of gp120 and most of gp41) (soluble) |
100 ug |
262-Eur |
Alpha Diagnostics |
recombinant |
| E12S0284 |
Chicken Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
622-Eur |
BGene |
|
| Y050217 |
Anti-Human Tumor Necrosis Factor soluble p55 Receptor (sTNFRp55) Antibody |
100ul |
396-Eur |
ABM Goods |
recombinant |
| E07S0265 |
Porcine Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
608-Eur |
BGene |
|
| Y050218 |
Anti-Human Tumor Necrosis Factor soluble p55 Receptor (sTNFRp55) Antibody |
100ug |
396-Eur |
ABM Goods |
recombinant |
| E07S0284 |
Porcine Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
608-Eur |
BGene |
|
| CSB-E09375p |
Porcine soluble vascular endothelial growth factor receptor_2,VEGFR_2_sFLK_1 ELISA Kit |
96T |
972-Eur |
Cusabio |
elisa |
| S01-R46 |
Podoplanin, soluble, Host: E. coli, Species: Rat, Synonyms: Pdpn; E11; Gp38; OTS-8; RTI40; T1-alpha |
5 ug |
88-Eur |
Reliatech |
|
| 31325 |
Porcine soluble triggering receptor expressed on myeloid cells-1 (sTREM-1) Elisa Kit |
20ng/ml-0.312ng/ml <0.06ng/ml |
750-Eur |
TEFL |
|
| E03S0295 |
Mouse soluble tumor necrosis factor-related apoptosis inducing ligand |
96 Tests/kit |
761-Eur |
Other suppliers |
|
| CSB-E11266h |
Human soluble tumor necrosis factor receptor 2,sTNF-R2 ELISA Kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| 201-12-0261 |
Human soluble platelet endothelial cell adhesion molecule 1(sPECAM-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CSB-E15845r |
Rat Soluble Lectin-like Oxidized Low Density Lipoprotein Receptor-1(sLOX-1)ELISA Kit SpeciesRat |
96T |
816-Eur |
Cusabio |
|
| CSB-E11317h |
Human soluble Triggering Receptor Expresses on Myeloid Cells_1,sTREM_1 ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| CK-E97874 |
Mouse soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISAkit |
|
----Eur |
Glory |
|
| CSB-E13482r |
Rat Soluble Glycoprotein VI (SGPVI) ELISA KIT, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL011622RA |
Rat soluble interleukin-1 receptor Ⅱ,sIL-1RⅡ ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| E-EL-P1121 |
Porcine VCAM-1_CD106 (soluble Vascuolar Cell Adhesion Molecule 1) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| CSB-EL011649RA |
Rat soluble interleukin-2 receptor,sIL-2Rα ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-E13539h |
Human Soluble Receptor Activator of Nuclear Factor-kB,sRANK ELISA Kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| S01-034 |
IL-6 receptor alpha, soluble, Host: HEK 293 cells, Species: Human, Synonyms: Il6r; CD126; IL-6R |
20 ug |
232-Eur |
Reliatech |
|
| CK-E98011 |
Mouse soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISAkit |
|
----Eur |
Glory |
|
| CSB-EL011650RA |
Rat soluble interleukin-2 receptor,sIL-2Rβ ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| E14S0265 |
Sheep Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
622-Eur |
BGene |
|
| E02S0295 |
Rat anti-soluble tumor necrosis factor-related apoptosis inducing ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
apoptosis |
| CSB-E09374h |
Human soluble vascular endothelial growth factor receptor_2,VEGFR_2_sFLK_1 ELISA Kit |
96T |
896-Eur |
Cusabio |
elisa |
| E08S0265 |
Canine Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-12-0647 |
Human soluble receptor activator of nuclear factor-kB ligand(sRANKL)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| G-R1910-0A |
*Treponema Pallidum ( Antigen) ultra-pure soluble protein, Host_SourceRabbit tissue |
200ug |
296-Eur |
GBI |
polyclonal |
| E06S0265 |
Goat Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
715-Eur |
Blue Gene Biotech |
|
| E04S0265 |
Rabbit Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
601-Eur |
BGene |
|
| CK-E20377 |
Mouse soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E96683 |
Human soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISAkit |
|
----Eur |
Glory |
|
| CK-E96571 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1,sLOX-1 ELISAkit |
|
----Eur |
Glory |
|
| CK-E95930 |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISAkit |
|
----Eur |
Glory |
|
| E90936Hu |
ELISA Kit for Phosphoenolpyruvate Carboxykinase 1, Soluble (PCK1) Organism: Homo sapiens (Human) |
96T |
577-Eur |
USCNLife |
|
| E0419Ra |
Rat soluble vascular endothelial growth factor receptor-2,sVEGFR-2_sFLK-1 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E91960Hu |
ELISA Kit for Superoxide Dismutase 1, Soluble (SOD1) Organism: Homo sapiens (Human) |
96T |
604-Eur |
USCNLife |
|
| QY-E00585 |
Human Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| MCA2624 |
MOUSE ANTI HUMAN GUANYLATE CYCLASE BETA 1 (SOLUBLE)-MONOCLONAL ANTIBODY |
0.2 mg |
370-Eur |
AbD Serotec |
monoclonal |
| E09S0284 |
Monkey Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
715-Eur |
Blue Gene Biotech |
|
| E09S0265 |
Monkey Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
715-Eur |
Blue Gene Biotech |
|
| E0422Ra |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM-1_sCD31 ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| 201-02-0639 |
Mouse Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| LGALS9-1937H |
Protein Recombinant Human Lectin, Galactoside-Binding, Soluble, 9, His-tagged
|
50ug |
539-Eur |
CBio |
|
| E03S0284 |
Mouse Soluble receptor activator of nuclear factor-kB ligand ELISA,SRANKL |
96 Tests/kit |
601-Eur |
BGene |
|
| IDH1-1284H |
Protein Recombinant Human Isocitrate Dehydrogenase 1 (NADP+), Soluble, His-tagged |
0.5mg |
1059-Eur |
CBio |
|
| E03S0265 |
Mouse Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA,SlOX-1 ELI |
96 Tests/kit |
601-Eur |
BGene |
|
| 201-11-0423 |
Rat soluble platelet endothelial cell adhesion molecule 1(sPECAM-1_sCD31)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| CSB-E11317h |
Human soluble Triggering Receptor Expresses on Myeloid Cells_1,sTREM_1 ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| CK-E10111 |
Human Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT =sTNFR2 |
96T |
728-Eur |
Glory |
|
| E07S0284 |
Porcine Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0265 |
Porcine Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E20514 |
Mouse soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E0638Mo |
Mouse Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α)ELISA Kit |
48T |
386-Eur |
Sunlog |
|
| E01S0284 |
Human Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
601-Eur |
BGene |
|
| E01S0265 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
601-Eur |
BGene |
|
| E06S0284 |
Goat Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E10112 |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISA KIT =sTNFR1 |
96T |
728-Eur |
Glory |
|
| CK-E94824 |
Human Soluble receptor activator of nuclear factor-kB ligand(sRANKL) ELISA |
96T |
728-Eur |
Glory |
|
| E08S0284 |
Canine Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
715-Eur |
Blue Gene Biotech |
|
| 201-11-0420 |
Rat soluble vascular endothelial growth factor receptor-2(sVEGFR-2_sFLK-1)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| E08S0265 |
Canine Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
715-Eur |
Blue Gene Biotech |
|
| CSB-E13848m |
Mouse soluble Triggering Receptor Expresses on Myeloid Cells_1,sTREM_1 ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| E97839Hu |
ELISA Kit for Isocitrate Dehydrogenase 1, Soluble (IDH1) Organism: Homo sapiens (Human) |
96T |
630-Eur |
USCNLife |
|
| GS-0986a |
3-hydroxy-3-methylglutaryl-Coenzyme A synthase 1 (soluble) primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| E0069Mo |
Mouse soluble receptor activator of nuclear factor-kB ligand(sRANKL)ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| CK-E95003 |
Human Soluble receptor activator of nuclear factor-kB ligand(sRANKL) ELISA |
96T |
728-Eur |
Glory |
|
| CK-E20210 |
Mouse Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
96T |
454-Eur |
Eastbio |
|
| E04S0284 |
Rabbit Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
601-Eur |
BGene |
|
| E11S0265 |
Bovine Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
715-Eur |
Blue Gene Biotech |
|
| QY-E02460 |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1(sTREM-1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CK-E10123 |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
96T |
728-Eur |
Eastbio |
|
| E0069Mo |
Mouse soluble receptor activator of nuclear factor-kB ligand(sRANKL)ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| QY-E11222 |
Rat soluble platelet endothelial cell adhesion molecule 1(sPECAM-1_sCD31)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E0419Ra |
Rat soluble vascular endothelial growth factor receptor-2,sVEGFR-2_sFLK-1 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| QY-E11225 |
Rat soluble vascular endothelial growth factor receptor-2(sVEGFR-2_sFLK-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| CK-E10765 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1,sLOX-1 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| E1424Hu |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1,sLOX-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E1424Hu |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1,sLOX-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| QY-E21209 |
Mouse Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E21384 |
Mouse soluble receptor activator of nuclear factor-kB ligand(sRANKL)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E0310Hu |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0200Hu |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
48T |
306-Eur |
Eastbio |
|
| E06S0284 |
Goat Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
608-Eur |
BGene |
|
| QY-E02462 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1(sLOX-1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E0638Mo |
Mouse Platelet-Derived Growth Factor Soluble Receptor α(PDGFsR-α)ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| E06S0265 |
Goat Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
608-Eur |
BGene |
|
| E0646Hu |
Human soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0646Hu |
Human soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0310Hu |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| QY-E02447 |
Human soluble platelet endothelial cell adhesion molecule 1(sPECAM-1)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| 201-11-0423 |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM-1_sCD31 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 201-11-0420 |
Rat soluble vascular endothelial growth factor receptor-2,sVEGFR-2_sFLK-1 ELISA Kit |
96T |
490-Eur |
SunBT |
|
| E08S0284 |
Canine Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
622-Eur |
BGene |
|
| YSGAAP470C |
TRAIL (TNF Related_Apoptosis Ligand), membrane & soluble forms, ~32 & 24kD (respectively), Rabbit anti_Human; WB |
25 µg. |
476-Eur |
Accurate |
polyclonal |
| YSGAAP470E |
TRAIL (TNF Related_Apoptosis Ligand), membrane & soluble forms, ~32 & 24kD (respectively), Rabbit anti_Human; WB |
100 µg. |
920-Eur |
Accurate |
polyclonal |
| CK-E97046 |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISAkit |
|
----Eur |
Glory |
|
| E11S0284 |
Bovine Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E11240 |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| E12S0265 |
Chicken Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
715-Eur |
Blue Gene Biotech |
|
| E0260Hu |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E09S0284 |
Monkey Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
622-Eur |
BGene |
|
| E0260Hu |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0200Hu |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit |
96T |
483-Eur |
Eastbio |
|
| E14S0284 |
Sheep Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0265 |
Sheep Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
715-Eur |
Blue Gene Biotech |
|
| CK-E10877 |
Human soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| E12S0284 |
Chicken Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
715-Eur |
Blue Gene Biotech |
|
| QY-E02465 |
Human soluble receptor activator of nuclear factor-kB ligand(sRANKL)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E05S0284 |
Guinea pig Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E05125h |
Human soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| S01-041 |
CD27 ligand, soluble Human Host: CHO cells CD70; CD27L; CD27LG; TNFSF7 |
50 |
232-Eur |
Reliatech |
|
| CSB-E09374h |
Human soluble vascular endothelial growth factor receptor_2,VEGFR_2_sFLK_1 ELISA Kit |
96tests |
837-Eur |
Cusabio |
elisa |
| E11S0284 |
Bovine Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
96 Tests/kit |
622-Eur |
BGene |
|
| E03S0284 |
Mouse Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E11317h |
Human soluble Triggering Receptor Expresses on Myeloid Cells_1,sTREM_1 ELISA Kit |
96T |
781-Eur |
Cusabio |
elisa |
| S01-M46 |
Podoplanin, soluble Mouse Host: E. coli Pdpn; T1a; Gp38; OTS-8; T1alpha; RANDAM-2; T1-alpha |
5 |
88-Eur |
Reliatech |
|
| CSB-E07370r |
Rat soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| E11S0265 |
Bovine Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-02-0070 |
Mouse soluble receptor activator of nuclear factor-kB ligand(sRANKL)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| E04S0265 |
Rabbit Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E16495r |
Rat soluble tumor necrosis factor-like weak inducer of apoptosis (sTWEAK)ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| HCV36-R |
Recombiant (E. coli) HCV Antigens_GST fusion protein (mosaic of several antigenic epitopes) (soluble) |
100 ug |
335-Eur |
Alpha Diagnostics |
recombinant |
| 'AP15185PU-N |
Guanylate cyclase soluble GUCY1B3 (C-term) antibody Isotype Ig Host Rabbit |
0.1 mg |
481-Eur |
ACR |
|
| CSB-E09375p |
Porcine soluble vascular endothelial growth factor receptor_2,VEGFR_2_sFLK_1 ELISA Kit |
96tests |
972-Eur |
Cusabio |
elisa |
| 'AP13761PU-N |
Guanylate cyclase soluble GUCY1A3 (N-term) antibody Isotype Ig Host Rabbit |
0.1 mg |
481-Eur |
ACR |
|
| S01-023 |
CD105_Endoglin, soluble Mouse Host: Insect cells Eng; CD105; AI528660; AI662476; S-endoglin |
25 |
238-Eur |
Reliatech |
|
| CSB-E09375p |
Porcine soluble vascular endothelial growth factor receptor_2,VEGFR_2_sFLK_1 ELISA Kit |
96tests |
913-Eur |
Cusabio |
elisa |
| CSB-E09374h |
Human soluble vascular endothelial growth factor receptor_2,VEGFR_2_sFLK_1 ELISA Kit |
96tests |
896-Eur |
Cusabio |
elisa |
| S01-025 |
CD105_Endoglin, soluble Human Host: Insect cells Endoglin; END; ORW; HHT1; ORW1; CD105 |
25 |
238-Eur |
Reliatech |
|
| S01-024 |
CD105_Endoglin, soluble Human Host: Insect cells Endoglin; END; ORW; HHT1; ORW1; CD105 |
5 |
88-Eur |
Reliatech |
|
| 'AP10312PU-N |
Guanylate cyclase soluble GUCY1A3 (C-term) antibody Isotype IgG Host Rabbit |
0.1 mg |
509-Eur |
ACR |
|
| CSB-E05127m |
Mouse soluble receptor activator of nuclear factor_kB ligand,sRANKL ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| E01S0284 |
Human Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0284 |
Rabbit Soluble receptor activator of nuclear factor-kB ligand ELISA, SRANKL |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-E08135m |
Mouse soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96tests |
837-Eur |
Cusabio |
elisa |
| CSB-E08133h |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM_1 ELISA Kit |
96tests |
797-Eur |
Cusabio |
elisa |
| E05S0265 |
Guinea pig Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
689-Eur |
Blue Gene Biotech |
|
| S01-022 |
CD105_Endoglin, soluble Mouse Host: Insect cells Eng; CD105; AI528660; AI662476; S-endoglin |
5 |
88-Eur |
Reliatech |
|
| E01S0265 |
Human Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0265 |
Mouse Soluble Lectin-like oxidized low density lipoprotein receptor-1 ELISA, SlOX-1 ELI |
|
689-Eur |
Blue Gene Biotech |
|
| E0422Ra |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM-1_sCD31 ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| 201-12-0311 |
Human soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| sGCA-112AP |
Soluble Guanylate Cyclase alfa2, Host species: Rabbit, Polyclonal antibody |
200ul |
337-Eur |
FabGennix |
|
| E0230Hu |
Human soluble vascular endothelial growth factor receptor-3,sVEGFR-3_sFLT-4 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E0271Hu |
Human soluble vascular endothelial growth factor receptor-2,sVEGFR-2_sFLK-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| 201-12-0272 |
Human soluble vascular endothelial growth factor receptor-2,sVEGFR-2_sFLK-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E03S0295 |
Mouse anti-soluble tumor necrosis factor-related apoptosis inducing ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
apoptosis |
| CK-E98785 |
Porcine soluble vascular endothelial growth factor receptor-2,VEGFR-2_sFLK-1 ELISAkit |
|
----Eur |
Glory |
|
| CSB-EL013621CA |
Cat malate dehydrogenase 1, NAD (soluble) (MDH1) ELISA kit, Species Cat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| EIAAB05277 |
Apyrase homolog,Cant1,Mouse,Mus musculus,SCAN-1,Soluble calcium-activated nucleotidase 1 |
|
1164-Eur |
EIAab |
|
| S01-062 |
Thrombomodulin, soluble Human Host: HEK 293 cells THBD; TM; THRM; AHUS6; BDCA3; CD141; THPH12 |
10 |
232-Eur |
Reliatech |
|
| CK-E98567 |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISAkit |
|
----Eur |
Glory |
|
| sGCA-201AP |
Soluble Guanylate Cyclase beta , Host species: Rabbit, Polyclonal antibody |
200ul |
337-Eur |
FabGennix |
|
| YM9067 |
TNF alpha, Free Soluble (17kD), Membrane (26kD), Receptor_bound, Clone T3, Mab anti_Human; IP_IA_flow_WB_Inhibits |
100 µg. |
937-Eur |
Accurate |
recombinant |
| E02S0295 |
Rat Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
689-Eur |
Blue Gene Biotech |
|
| CABT-52295MH |
Mouse Anti Human Guanylate Cyclase Beta 1 (Soluble) Monoclonal Antibody |
0.2 mg*0.75 |
591-Eur |
CDiagnostic |
|
| CK-E10046 |
Human soluble vascular endothelial growth factor receptor-2,VEGFR-2_sFLK-1 ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| OBT0977 |
Dog Heartworm, Dirofiliaria immitis, soluble & structural antigens, Goat anti_adult worm; ELISA |
1 ml. |
478-Eur |
Accurate |
elisa |
| YSGVAPSV013C |
SNAP_23A (Soluble N_Ethylmaleimide_Sensitive_Factor_Attachment Proteins), ~28kD, Rabbit anti_Human, Mouse, Rat, Bovine, Dog, Hamster; WB |
25 µg. |
548-Eur |
Accurate |
polyclonal |
| YSGVAPSV013E |
SNAP_23A (Soluble N_Ethylmaleimide_Sensitive_Factor_Attachment Proteins), ~28kD, Rabbit anti_Human, Mouse, Rat, Bovine, Dog, Hamster; WB |
100 µg. |
1102-Eur |
Accurate |
polyclonal |
| HNS37-R |
Recombinant (E. coli) HCV NS31a helicase protein (full lengthc33c) immunodomnant regions (soluble) |
100 ug |
262-Eur |
Alpha Diagnostics |
recombinant |
| YSGVAPSV002A |
SNAP_25 (Soluble N_Ethylmaleimide_Sensitive_Factor_Attachment Proteins), ~27kD, Rabbit anti_Mouse, Rat, Bovine, Xenopus; WB_IP_IHC |
12.5 µg. |
500-Eur |
Accurate |
polyclonal |
| YSGVAPSV002D |
SNAP_25 (Soluble N_Ethylmaleimide_Sensitive_Factor_Attachment Proteins), ~27kD, Rabbit anti_Mouse, Rat, Bovine, Xenopus; WB_IP_IHC |
50 µg. |
1052-Eur |
Accurate |
polyclonal |
| P-SNAP1 |
Alfa soluble N-ethymaleimide sensitive factor attachment protein, Antigen blocking peptide |
100ul |
196-Eur |
FabGennix |
|
| 201-11-0424 |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
490-Eur |
SunBT |
|
| 'H00002982-M01 |
Guanylate cyclase soluble GUCY1A3 Clone '2H1 antibody Isotype IgG2b Host Mouse |
100 |
481-Eur |
ACR |
|
| 33391 |
Rabbit soluble vascular endothelial growth factor receptor-2(VEGFR-2_sFLK-1) ELISA Kit |
10ng/ml-0.156ng/ml <0.05ng/ml |
750-Eur |
TEFL |
|
| CSB-E07371m |
Mouse soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| WAKAQ25050L |
AquaClean, Microbiocidal Additive for water soluble heating bath fluids (a WAK_Chemie product) |
250 ml. |
401-Eur |
Accurate |
|
| 201-12-0228 |
Human Soluble Vascular Endothelial Growth Factor Receptor 1,sFlt-1_sVEGFR-1 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E0227Hu |
Human Soluble Vascular Endothelial Growth Factor Receptor 1,sFlt-1_sVEGFR-1 ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| 201-12-0228 |
Human Soluble Vascular Endothelial Growth Factor Receptor 1,sFlt-1_sVEGFR-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| S01-035 |
TRAIL R-1_DR4, soluble Human Host: E. coli TNFRSF10A; DR4; APO2; CD261; TRAILR1; TRAILR-1 |
50 |
232-Eur |
Reliatech |
|
| E0669Mo |
Mouse soluble platelet endothelial cell adhesion molecule 1(sPECAM-1_sCD31)ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| CSB-E04750h |
Human soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96T |
683-Eur |
Cusabio |
elisa |
| QY-E40068 |
Porcine soluble vascular endothelial growth factor receptor 2
(VEGFR-2_sFLK-1) ELISA Kit |
96T |
698-Eur |
SQBIO |
|
| SFC-014 |
TIE-2_Fc Chimera, soluble Human Host: Insect cells TEK; TIE2; VMCM; TIE-2; VMCM1; CD202B |
100 |
251-Eur |
Reliatech |
|
| E0611Mo |
Mouse Soluble Vascular Endothelial Growth Factor Receptor 1(sFlt-1_sVEGFR-1)ELISA kjt |
96T |
656-Eur |
Eastbio |
|
| E0603Mo |
Mouse Soluble Vascular Endothelial Growth Factor Receptor 2(VEGFR-2_sFLK-1)ELISA kit |
96T |
656-Eur |
Eastbio |
|
| SFC-013 |
TIE-2_Fc Chimera, soluble Human Host: Insect cells TEK; TIE2; VMCM; TIE-2; VMCM1; CD202B |
20 |
108-Eur |
Reliatech |
|
| CSB-EL022397DO |
Dog superoxide dismutase 1, soluble (SOD1) ELISA kit, Species Dog, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| SFC-034 |
TIE-2_Fc Chimera, soluble, Host: CHO cells, Species: Mouse, Synonyms: Tek; Hyk; Tie2; tie-2; Cd202b; AA517024 |
100 ug |
238-Eur |
Reliatech |
|
| SFC-033 |
TIE-2_Fc Chimera, soluble, Host: CHO cells, Species: Mouse, Synonyms: Tek; Hyk; Tie2; tie-2; Cd202b; AA517024 |
20 ug |
108-Eur |
Reliatech |
|
| CK-E50036 |
Porcine soluble vascular endothelial growth factor receptor-2,VEGFR-2_sFLK-1 ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| QY-E21380 |
Mouse soluble platelet endothelial cell adhesion molecule 1(sPECAM-1_sCD31)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| E0271Hu |
Human soluble vascular endothelial growth factor receptor-2,sVEGFR-2_sFLK-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| SFC-012 |
TIE-1_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: TIE1; TIE; JTK14 |
100 ug |
238-Eur |
Reliatech |
|
| SFC-011 |
TIE-1_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: TIE1; TIE; JTK14 |
20 ug |
108-Eur |
Reliatech |
|
| CK-E30532 |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
454-Eur |
Eastbio |
|
| E0230Hu |
Human soluble vascular endothelial growth factor receptor-3,sVEGFR-3_sFLT-4 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0227Hu |
Human Soluble Vascular Endothelial Growth Factor Receptor 1,sFlt-1_sVEGFR-1 ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| QY-E21389 |
Mouse soluble vascular endothelial growth factor receptor-2(sVEGFR-2_sFLK-1)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E40068 |
Porcine soluble vascular endothelial growth factor receptor 2 (VEGFR-2_sFLK-1) ELISA Kit |
96T |
519-Eur |
Qayee |
|
| E0219Po |
Porcine soluble vascular endothelial growth factor receptor-2,VEGFR-2_sFLK-1 ELISA Kit |
96T |
560-Eur |
Eastbio |
|
| E0423Ra |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
490-Eur |
Eastbio |
|
| S01-011 |
VEGFR-1_Flt-1 (D5), soluble, Host: Insect cells, Species: Human, Synonyms: FLT1; FLT; VEGFR1 |
5 ug |
108-Eur |
Reliatech |
|
| S01-012 |
VEGFR-1_Flt-1 (D5), soluble, Host: Insect cells, Species: Human, Synonyms: FLT1; FLT; VEGFR1 |
20 ug |
180-Eur |
Reliatech |
|
| CSB-E07371m |
Mouse soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96T |
772-Eur |
Cusabio |
elisa |
| 22943 |
Rat Soluble Tumor Necrosis Factor-Related Apoptosis Inducing Ligand(sTRAIL) ELISA KIT |
96T |
878-Eur |
Bio-Medical |
elisa |
| QY-E02454 |
Human Soluble Vascular Endothelial Growth Factor Receptor 1(sFlt-1_sVEGFR-1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| HP1201-R |
Recombinant (E. coli) HIV-1 p120 protein (C-terminus of gp120 and most of gp41) (soluble ~16 kda) Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
238-Eur |
ADI |
|
| QY-E02453 |
Human soluble vascular endothelial growth factor receptor-2(sVEGFR-2_sFLK-1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| 31327 |
Porcine soluble vascular endothelial growth factor receptor-2(VEGFR-2_sFLK-1) ELISA Kit |
10ng/ml-0.156ng/ml <0.05ng/ml |
750-Eur |
TEFL |
|
| CSB-E04750h |
Human soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96tests |
722-Eur |
Cusabio |
elisa |
| S01-014 |
VEGFR-1_Flt-1 (D4), soluble, Host: Insect cells, Species: Human, Synonyms: FLT1; FLT; VEGFR1 |
20 ug |
199-Eur |
Reliatech |
|
| S01-013 |
VEGFR-1_Flt-1 (D4), soluble, Host: Insect cells, Species: Human, Synonyms: FLT1; FLT; VEGFR1 |
5 ug |
121-Eur |
Reliatech |
|
| QY-E11221 |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand(sTRAIL)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 100-301 |
TRAIL_Apo2L, soluble, Host: E. coli, Species: Human, Synonyms: TNFSF10; TL2; APO2L; CD253; TRAIL; Apo-2L |
50 ug |
232-Eur |
Reliatech |
|
| S01-044 |
TIE-2, soluble Human Host: Insect cells EGFR; ERBB; HER1; mENA; ERBB1; PIG61 |
50 |
251-Eur |
Reliatech |
|
| sGCA-101AP |
Soluble Guanylate Cyclase alfa1, Host species: Rabbit, Polyclonal antibody |
200ul |
337-Eur |
FabGennix |
|
| S01-043 |
TIE-2, soluble Human Host: Insect cells EGFR; ERBB; HER1; mENA; ERBB1; PIG61 |
10 |
114-Eur |
Reliatech |
|
| 28-647 |
Pycard is a cytosolic soluble protein that forms insoluble aggregates and enhances etoposide-induced apoptosis. |
0.1 mg |
496-Eur |
Prosci |
apoptosis |
| S01-015 |
VEGFR-1_Flt-1 (D3), soluble, Host: Insect cells, Species: Human, Synonyms: FLT1; FLT; VEGFR1 |
5 ug |
121-Eur |
Reliatech |
|
| S01-016 |
VEGFR-1_Flt-1 (D3), soluble, Host: Insect cells, Species: Human, Synonyms: FLT1; FLT; VEGFR1 |
20 ug |
199-Eur |
Reliatech |
|
| QY-E02452 |
Human soluble vascular endothelial growth factor receptor-3(sVEGFR-3_sFLT-4)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| E01S0295 |
Human Anti-soluble tumor necrosis factor-related apoptosis inducing ligand |
96 Tests/kit |
1087-Eur |
BlueGen |
apoptosis |
| S01-030 |
FAS receptor, soluble Human Host: E. coli FAS; APT1; CD95; FAS1; APO-1; FASTM; ALPS1A; TNFRSF6 |
20 |
232-Eur |
Reliatech |
|
| HCV21-R |
Recombinant (E. coli, his_tag) HCV core protein Mosaic (nucleocapsid immunodominant regions) (soluble) |
100 ug |
335-Eur |
Alpha Diagnostics |
recombinant |
| E0219Po |
Porcine soluble vascular endothelial growth factor receptor-2,VEGFR-2_sFLK-1 ELISA Kit |
48T |
380-Eur |
Eastbio |
|
| CSB-EL004879RA |
Rat soluble cluster of differentiation 14,sCD14 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| 201-12-0228 |
Human Soluble Vascular Endothelial Growth Factor Receptor 1(sFlt-1_sVEGFR-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CSB-E11885h |
Human soluble vascular endothelial cell growth factor receptor 1,VEGFR_1 ELISA Kit |
96tests |
602-Eur |
Cusabio |
elisa |
| 4Tr26-7-1 |
CD71 _ TFRC (soluble form) Clone 7-1 antibody Isotype IgG2b Host Mouse |
1 mg |
489-Eur |
ACR |
|
| GS-0887a |
glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| CSB-E15846m |
Mouse soluble Lectin-like Oxidized Low Density Lipoprotein Receptor-1(sLOX-1)ELISA Kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| CSB-EL013621RA |
Rat malate dehydrogenase 1, NAD (soluble) (MDH1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E16492h |
Human soluble tumor necrosis factor-like weak inducer of apoptosis (sTWEAK)ELISA Kit |
96T |
626-Eur |
Cusabio |
|
| P91960Mu01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Mus musculus (Mouse) Source: Escherichia coli |
100ug |
656-Eur |
USCNLife |
|
| P91960Ra01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Rattus norvegicus (Rat) Source: Escherichia coli |
100ug |
685-Eur |
USCNLife |
|
| CSB-E05127m |
Mouse soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| 201-02-0612 |
Mouse Soluble Vascular Endothelial Growth Factor Receptor 1(sFlt-1_sVEGFR-1)ELISA kjt |
96T |
548-Eur |
Sunred |
|
| CSB-E11885h |
Human soluble vascular endothelial cell growth factor receptor 1,VEGFR_1 ELISA Kit |
96tests |
662-Eur |
Cusabio |
elisa |
| CK-E95853 |
Human soluble vascular endothelial growth factor receptor-2,VEGFR-2_sFLK-1 ELISAkit |
|
----Eur |
Glory |
|
| E02S0295 |
Rat Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
601-Eur |
BGene |
|
| CSB-E08135m |
Mouse soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit SpeciesMouse |
96T |
959-Eur |
Cusabio |
|
| CSB-E11885h |
Human soluble vascular endothelial cell growth factor receptor 1,VEGFR_1 ELISA Kit |
96T |
662-Eur |
Cusabio |
elisa |
| 201-12-0272 |
Human soluble vascular endothelial growth factor receptor-2(sVEGFR-2_sFLK-1)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CSB-E13772r |
Rat Soluble Cluster of Differentiation 80,sCD80 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| Sac-121AP |
Polyclonal Antibody Soluble adenylate cyclase1 C-Epitope Immunogen: peptide Host: Rabbit |
200ul |
304-Eur |
FGen |
|
| 10321 |
Antibody directed against: sAPPb (soluble β Amyloid Precursor Protein -Swedish ) Monoclonal IgG3 |
100 |
397-Eur |
Gentaur |
|
| CSB-E07371m |
Mouse soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| Sac-121AP |
PC-Sac1 (WB control) Soluble adenylate cyclase1 C-Epitope Immunogen: peptide Host: Rabbit |
100-150ul |
221-Eur |
FGen |
|
| Sac-112AP |
PC-Sac1 (WB control) Soluble adenylate cyclase Mid Region Immunogen: peptide Host: Rabbit |
100-150ul |
221-Eur |
FGen |
|
| Sac-101AP |
PC-Sac1 (WB control) Soluble adenylate cyclase 1 N-Terminal Immunogen: peptide Host: Rabbit |
100-150ul |
221-Eur |
FGen |
|
| CSB-E10358r |
Rat soluble Toll-like receptor 2,sTLR-2 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| CSB-E10359r |
Rat soluble Toll-like receptor 6,sTLR-6 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| 201-02-0604 |
Mouse Soluble Vascular Endothelial Growth Factor Receptor 2(VEGFR-2_sFLK-1)ELISA kit |
96T |
548-Eur |
Sunred |
|
| CSB-E13848m |
Mouse soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISA Kit SpeciesMouse |
96T |
913-Eur |
Cusabio |
|
| CSB-E08543r |
Rat soluble Cluster of differentiation 86,sCD86 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022397RA |
Rat superoxide dismutase 1, soluble (SOD1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 4Tr26-2B6 |
CD71 _ TFRC (soluble form) Clone 2B6 antibody Isotype IgG2a Host Mouse |
1 mg |
481-Eur |
ACR |
|
| Sac-101AP |
Polyclonal Antibody Soluble adenylate cyclase 1 N-Terminal Immunogen: peptide Host: Rabbit |
200ul |
304-Eur |
FGen |
|
| E0669Mo |
Mouse soluble platelet endothelial cell adhesion molecule 1(sPECAM-1_sCD31)ELISA Kit |
48T |
386-Eur |
Sunlog |
|
| Sac-112AP |
Polyclonal Antibody Soluble adenylate cyclase Mid Region Immunogen: peptide Host: Rabbit |
200ul |
304-Eur |
FGen |
|
| E0611Mo |
Mouse Soluble Vascular Endothelial Growth Factor Receptor 1(sFlt-1_sVEGFR-1)ELISA kjt |
48T |
386-Eur |
Sunlog |
|
| E0603Mo |
Mouse Soluble Vascular Endothelial Growth Factor Receptor 2(VEGFR-2_sFLK-1)ELISA kit |
48T |
386-Eur |
Sunlog |
|
| CSB-E04750h |
Human soluble tumor necrosis factor_related apoptosis inducing ligand,sTRAIL ELISA Kit |
96tests |
781-Eur |
Cusabio |
elisa |
| 201-12-0231 |
Human soluble vascular endothelial growth factor receptor-3,sVEGFR-3_sFLT-4 ELISA Kit |
96T |
476-Eur |
SunBT |
|
| CSB-EL001176PI |
Pig acid phosphatase 1, soluble (ACP1) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 201-12-0272 |
Human soluble vascular endothelial growth factor receptor-2,sVEGFR-2_sFLK-1 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| P91960Mu01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Mus musculus (Mouse) Source: Escherichia coli |
50ug |
470-Eur |
USCNLife |
|
| 201-12-0231 |
Human soluble vascular endothelial growth factor receptor-3,sVEGFR-3_sFLT-4 ELISA Kit |
48T |
295-Eur |
SunBT |
|
| Y062056 |
Anti-Platelet-Derived Growth Factor Soluble Receptor β produced in goat Antibody |
100ug |
994-Eur |
ABM Goods |
recombinant |
| CSB-EL013621PI |
Pig malate dehydrogenase 1, NAD (soluble) (MDH1) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| P91960Ra01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Rattus norvegicus (Rat) Source: Escherichia coli |
50ug |
490-Eur |
USCNLife |
|
| E0423Ra |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
48T |
320-Eur |
Eastbio |
|
| SFC-021 |
FGFR-4_Fc Chimera, soluble Human Host: Insect cells FGFR4; TKF; JTK2; CD334 |
10 |
88-Eur |
Reliatech |
|
| CSB-E04699m |
Mouse Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit SpeciesMouse |
96T |
959-Eur |
Cusabio |
|
| SFC-022 |
FGFR-4_Fc Chimera, soluble Human Host: Insect cells FGFR4; TKF; JTK2; CD334 |
50 |
199-Eur |
Reliatech |
|
| CSB-E04698h |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit SpeciesHuman |
96T |
714-Eur |
Cusabio |
|
| 201-11-0424 |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand(sTRAIL)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-02-0670 |
Mouse soluble platelet endothelial cell adhesion molecule 1(sPECAM-1_sCD31)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| P91960Mu01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Mus musculus (Mouse) Source: Escherichia coli |
10ug |
285-Eur |
USCNLife |
|
| EK0573 |
Human soluble CD40L ELISA Kit , Sensitivity: < 15pg_ml, Assay Range: 62.5pg_ml-4000pg_ml |
96T |
441-Eur |
Bouster Immunoleader |
|
| EK0530 |
Human Soluble TNFRⅡ ELISA Kit , Sensitivity: < 2 pg_ml, Assay Range: 7.8pg_ml-500pg_ml |
96T |
368-Eur |
Bouster Immunoleader |
|
| P91960Ra01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Rattus norvegicus (Rat) Source: Escherichia coli |
10ug |
295-Eur |
USCNLife |
|
| Y061538 |
Anti-Tumor Necrosis Factor Soluble Receptor Type II produced in goat Antibody |
100ug |
857-Eur |
ABM Goods |
recombinant |
| CSB-EL022397PI |
Pig superoxide dismutase 1, soluble (SOD1) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E05125h |
Human soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit SpeciesHuman |
96T |
913-Eur |
Cusabio |
|
| 201-12-0231 |
Human soluble vascular endothelial growth factor receptor-3(sVEGFR-3_sFLT-4)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| CSB-EL001337RA |
Rat adenylate cyclase 10 (soluble) (ADCY10) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL001176RA |
Rat acid phosphatase 1, soluble (ACP1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| E05S0295 |
Guinea anti-soluble tumor necrosis factor-related apoptosis inducing ligand |
96 Tests/kit |
1101-Eur |
BlueGen |
apoptosis |
| 82774-61-6 |
4_amino_3_(isopropyl)phenol 4_amino_3_(isopropyl)p |
1g |
----Eur |
chemotra |
|
| 80826-86-4 |
4_Iodo_3,5_dimethyl phenol 4_Iodo_3,5_dimethyl phe |
1g |
----Eur |
chemotra |
|
| 642-71-7 |
3,4,5_Tri Methoxy Phenol 3,4,5_Tri Methoxy Phen |
1g |
----Eur |
chemotra |
|
| 36215-85-7 |
2,4,6_tris(1_methyloctyl)phenol 2,4,6_tris(1_methyloctyl) |
1g |
----Eur |
chemotra |
|
| 18254-13-2 |
2,4,6_tris(1_phenylethyl)phenol 2,4,6_tris(1_phenylethyl) |
1g |
----Eur |
chemotra |
|
| 91339-74-1 |
2_Amino_4_(tert_pentyl)phenol 2_Amino_4_(tert_pentyl) |
1g |
----Eur |
chemotra |
|
| 213690-27-8 |
4_Bromo_2_(5_Isoxazoly)Phenol 4_Bromo_2_(5_Isoxazoly |
1g |
----Eur |
chemotra |
|
| 71750-46-4 |
dichloro(methylthio)phenol dichloro(methylthio)phe |
1g |
----Eur |
chemotra |
|
| 288401-62-7 |
4_Fluoro_2_(5_isoxazolyl)phenol 4_Fluoro_2_(5_isoxazolyl |
1g |
----Eur |
chemotra |
|
| 2769-94-0 |
2,4_bis(1_phenylethyl)phenol 2,4_bis(1_phenylethyl)p |
1g |
----Eur |
chemotra |
|
| 4526-42-5 |
2,6_Bis(methyltiomethyl)phenol 2,6_Bis(methyltiomethyl |
1g |
----Eur |
chemotra |
|
| 1570-65-6 |
2,4_Di Chloro_6_Methyl Phenol 2,4_Di Chloro_6_Methyl |
1g |
----Eur |
chemotra |
|
| 84962-64-1 |
4_phenyl(phenylmethyl)phenol 4_phenyl(phenylmethyl) |
1g |
----Eur |
chemotra |
|
| EIAAB40115 |
Aryl sulfotransferase,Aryl sulfotransferase IV,ASTIV,Minoxidil sulfotransferase,Mx-ST,Phenol sulfotransferase,PST-1,Rat,Rattus norvegicus,ST1A1,St1a1,Sulfokinase,Sulfotransferase 1A1,Sult1a1,Tyrosine- |
|
1191-Eur |
EIAab |
|
| CSB-E07371m |
Mouse soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
626-Eur |
Cusabio |
|
| E07S0295 |
Porcine Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
608-Eur |
BGene |
|
| CK-E10105 |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
728-Eur |
Eastbio |
|
| AS09 539 |
Antibody: SOD1 aa 100-115 | superoxide dismutase 1, soluble , Host: rabbit, polyclonal, Comfirmed reactivity: human |
50 |
337-Eur |
Gentaur |
|
| AS09 540 |
Antibody: SOD1 aa 131-153 | superoxide dismutase 1, soluble , Host: rabbit, polyclonal, Comfirmed reactivity: human |
50 |
337-Eur |
Gentaur |
|
| S01-025 |
CD105_Endoglin, soluble, Host: Insect cells, Species: Human, Synonyms: Endoglin; END; ORW; HHT1; ORW1; CD105 |
25 ug |
238-Eur |
Reliatech |
|
| AS09 538 |
Antibody: SOD1 aa 80-96 | superoxide dismutase 1, soluble , Host: rabbit, polyclonal, Comfirmed reactivity: human |
50 |
337-Eur |
Gentaur |
|
| S01-024 |
CD105_Endoglin, soluble, Host: Insect cells, Species: Human, Synonyms: Endoglin; END; ORW; HHT1; ORW1; CD105 |
5 ug |
88-Eur |
Reliatech |
|
| 201-02-0680 |
Mouse soluble tumor necrosis factor-related apoptosis inducing ligand(sTRAIL)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| 22944 |
Mouse Soluble Tumor Necrosis Factor-Related Apoptosis Inducing Ligand(sTRAIL) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| S01-041 |
CD27 ligand, soluble, Host: CHO cells, Species: Human, Synonyms: CD70; CD27L; CD27LG; TNFSF7 |
50 ug |
232-Eur |
Reliatech |
|
| AS09 537 |
Antibody: SOD1 aa 58-72 | superoxide dismutase 1, soluble , Host: rabbit, polyclonal, Comfirmed reactivity: human |
50 |
337-Eur |
Gentaur |
|
| 22942 |
Human soluble tumor necrosis factor-related apoptosis inducing ligand(sTRAIL) ELISA KIT |
96T |
650-Eur |
Bio-Medical |
elisa |
| 201-12-1825 |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
476-Eur |
SunBT |
|
| QY-E02440 |
Human soluble tumor necrosis factor-related apoptosis inducing ligand(sTRAIL)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| S01-022 |
CD105_Endoglin, soluble, Host: Insect cells, Species: Mouse, Synonyms: Eng; CD105; AI528660; AI662476; S-endoglin |
5 ug |
88-Eur |
Reliatech |
|
| AS09 534 |
Antibody: SOD1 aa 03-20 | superoxide dismutase 1, soluble , Host: rabbit, polyclonal, Comfirmed reactivity: human |
100 |
337-Eur |
Gentaur |
|
| AS09 535 |
Antibody: SOD1 aa 24-39 | superoxide dismutase 1, soluble , Host: rabbit, polyclonal, Comfirmed reactivity: human |
50 |
337-Eur |
Gentaur |
|
| E14S0295 |
Sheep Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
622-Eur |
BGene |
|
| S01-M46 |
Podoplanin, soluble, Host: E. coli, Species: Mouse, Synonyms: Pdpn; T1a; Gp38; OTS-8; T1alpha; RANDAM-2; T1-alpha |
5 ug |
88-Eur |
Reliatech |
|
| HNS55-R |
Recombinant (E. coli) Hepatitis C Virus (HCV) NS5 protein, fragments of the NS5 immunodominant regions, (soluble) Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
303-Eur |
ADI |
|
| S01-023 |
CD105_Endoglin, soluble, Host: Insect cells, Species: Mouse, Synonyms: Eng; CD105; AI528660; AI662476; S-endoglin |
25 ug |
238-Eur |
Reliatech |
|
| 201-12-1825 |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
48T |
295-Eur |
SunBT |
|
| AS09 536 |
Antibody: SOD1 aa 43-57 | superoxide dismutase 1, soluble , Host: rabbit, polyclonal, Comfirmed reactivity: human |
50 |
337-Eur |
Gentaur |
|
| E05S0295 |
Guinea pig Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-EL012889PI |
Pig lectin, galactoside-binding, soluble, 4 (LGALS4) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 100-157 |
FAS Ligand, soluble Human Host: CHO cells FASLG; FASL; CD178; CD95L; CD95-L; TNFSF6; APT1LG1 |
10 |
232-Eur |
Reliatech |
|
| CSB-E08153p |
Pig Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit, Species Pig, Sample Type serum, plasma |
96T |
735-Eur |
Cusabio |
elisa |
| S01-032 |
IL-2 receptor alpha, soluble Human Host: Insect cells IL2RA; CD25; IL2R; TCGFR; IDDM10 |
25 |
232-Eur |
Reliatech |
|
| E03S0295 |
Mouse Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
689-Eur |
Blue Gene Biotech |
|
| S01-046 |
Podoplanin, soluble Human Host: E. coli PDPN; T1A; GP36; GP40; Gp38; OTS8; T1A-2; AGGRUS; HT1A-1; PA2.26 |
5 |
88-Eur |
Reliatech |
|
| CSB-EL009709RA |
Rat glycerol-3-phosphate dehydrogenase 1 (soluble) (GPD1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010049RA |
Rat guanylate cyclase 1, soluble, alpha 2 (GUCY1A2) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012886PI |
Pig lectin, galactoside-binding, soluble, 2 (LGALS2) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012882PI |
Pig lectin, galactoside-binding, soluble, 1 (LGALS1) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010989PI |
Pig isocitrate dehydrogenase 1 (NADP+), soluble (IDH1) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| EIAAB05275 |
Apyrase homolog,Cant1,Rat,Rattus norvegicus,SCAN-1,Soluble calcium-activated nucleotidase 1,Srapy |
|
1191-Eur |
EIAab |
|
| sGCA-201AP |
Polyclonal Antibody Soluble Guanylate Cyclase beta Immunogen: peptide Host: Rabbit |
200ul |
304-Eur |
FGen |
|
| sGCA-112AP |
Polyclonal Antibody Soluble Guanylate Cyclase alfa2 Immunogen: peptide Host: Rabbit |
200ul |
304-Eur |
FGen |
|
| sGCA-101AP |
Polyclonal Antibody Soluble Guanylate Cyclase alfa1 Immunogen: peptide Host: Rabbit |
200ul |
304-Eur |
FGen |
|
| E09S0295 |
Monkey Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
622-Eur |
BGene |
|
| E04S0295 |
Rabbit Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
689-Eur |
Blue Gene Biotech |
|
| AM05610PU-N |
Guanylate cyclase soluble GUCY1A3 Clone GC10 antibody Isotype IgG1 Host Mouse |
0.2 mg |
468-Eur |
ACR |
|
| AM05611PU-N |
Guanylate cyclase soluble GUCY1B3 Clone GC11 antibody Isotype IgG2b Host Mouse |
0.2 mg |
468-Eur |
ACR |
|
| CSB-EL010050RA |
Rat guanylate cyclase 1, soluble, alpha 3 (GUCY1A3) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010051RA |
Rat guanylate cyclase 1, soluble, beta 2 (GUCY1B2) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010052RA |
Rat guanylate cyclase 1, soluble, beta 3 (GUCY1B3) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E07396r |
Rat Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL004937RA |
Rat Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E16492h |
Human soluble tumor necrosis factor-like weak inducer of apoptosis (sTWEAK)ELISA Kit SpeciesHuman |
96T |
816-Eur |
Cusabio |
|
| CSB-EL018743RA |
Rat soluble endothelial protein C receptor,sEPCR ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| CSB-E16270r |
Rat soluble fibrin monomer complex(SFMC)ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| E04S0295 |
Rabbit Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
601-Eur |
BGene |
|
| E-EL-P0426 |
Porcine VEGFR-2_sFLK-1_KDR (Soluble Vascular Endothelial Growth Factor Receptor-2) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E-EL-H1603 |
Human VEGFR-2_sFLK-1_KDR (Soluble Vascular Endothelial Growth Factor Receptor-2) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E-EL-Ch2217 |
Chicken VEGFR-2_sFLK-1_KDR (Soluble Vascular Endothelial Growth Factor Receptor-2) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E01S0295 |
Human Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
689-Eur |
Blue Gene Biotech |
|
| CSB-EL012895RA |
Rat lectin, galactoside-binding, soluble, 9 (LGALS9) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012882RA |
Rat lectin, galactoside-binding, soluble, 1 (LGALS1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012886RA |
Rat lectin, galactoside-binding, soluble, 2 (LGALS2) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012887RA |
Rat lectin, galactoside-binding, soluble, 3 (LGALS3) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012889RA |
Rat lectin, galactoside-binding, soluble, 4 (LGALS4) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| E11S0295 |
Bovine Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
622-Eur |
BGene |
|
| CSB-EL012892RA |
Rat lectin, galactoside-binding, soluble, 7 (LGALS7) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012894RA |
Rat lectin, galactoside-binding, soluble, 8 (LGALS8) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| E-EL-MK0188 |
Monkey VEGFR-2_sFLK-1_KDR (Soluble Vascular Endothelial Growth Factor Receptor-2) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| 201-12-1825 |
Human soluble tumor necrosis factor-related apoptosis inducing ligand(sTRAIL)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| sGCA-101AP |
PC-sGCA1 (WB control) Soluble Guanylate Cyclase alfa1 Immunogen: peptide Host: Rabbit |
100-150ul |
221-Eur |
FGen |
|
| YM9068 |
TNF alpha, Free Soluble (17kD), Membrane (26kD), No X w_receptor_bound TNFa, Clone T1, Mab anti_Human; IP_IA_flow_WB_Inhibits |
100 µg. |
937-Eur |
Accurate |
recombinant |
| E11S0295 |
Bovine Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
715-Eur |
Blue Gene Biotech |
|
| E08S0295 |
Canine Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
622-Eur |
BGene |
|
| S01-009 |
VEGFR-1_Flt-1 (native), soluble, Host: Insect cells, Species: Human, Synonyms: FLT1; FLT; VEGFR1 |
5 ug |
108-Eur |
Reliatech |
|
| S01-010 |
VEGFR-1_Flt-1 (native), soluble, Host: Insect cells, Species: Human, Synonyms: FLT1; FLT; VEGFR1 |
20 ug |
180-Eur |
Reliatech |
|
| P91960Hu01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Homo sapiens (Human) Source: Escherichia coli |
10ug |
271-Eur |
USCNLife |
|
| P91960Rb01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Oryctolagus cuniculus (Rabbit) Source: Escherichia coli |
10ug |
305-Eur |
USCNLife |
|
| P91960Hu01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Homo sapiens (Human) Source: Escherichia coli |
50ug |
441-Eur |
USCNLife |
|
| SFC-005 |
VEGFR-1_Flt-1(D7)-Fc Chimera, soluble, Host: Insect cells, Species: Human , Synonyms: FLT1; FLT; VEGFR1 |
10 ug |
88-Eur |
Reliatech |
|
| SFC-006 |
VEGFR-1_Flt-1(D7)-Fc Chimera, soluble, Host: Insect cells, Species: Human , Synonyms: FLT1; FLT; VEGFR1 |
50 ug |
199-Eur |
Reliatech |
|
| S01-037 |
TWEAK receptor, soluble, Host: E. coli, Species: Human, Synonyms: TNFRSF12A; FN14; CD266; TWEAKR |
25 ug |
232-Eur |
Reliatech |
|
| YM9068B |
TNF alpha, Free Soluble (17kD), Membrane (26kD), No X w_receptor_bound TNFa, Clone T1, Mab anti_Human, Biotin |
50 µg. |
738-Eur |
Accurate |
recombinant |
| QY-E21387 |
Mouse soluble tumor necrosis factor-related apoptosis inducing ligand(sTRAIL)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| CSB-E04750h |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
542-Eur |
Cusabio |
|
| E06S0295 |
Goat Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
608-Eur |
BGene |
|
| E0679Mo |
Mouse soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
656-Eur |
Eastbio |
|
| E1824Hu |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
48T |
306-Eur |
Eastbio |
|
| E12S0295 |
Chicken Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
622-Eur |
BGene |
|
| E1824Hu |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
96T |
483-Eur |
Eastbio |
|
| E14S0295 |
Sheep Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
715-Eur |
Blue Gene Biotech |
|
| CLBM1926 |
Interleukin 6 Receptor (IL_6R), soluble, Human, ELISA Compact Kit (includes 3 coating Ab, 3 plts.,conj., std., dil. buf.) |
kit |
731-Eur |
Accurate |
elisa |
| E12S0295 |
Chicken Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
715-Eur |
Blue Gene Biotech |
|
| P91960Rb01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Oryctolagus cuniculus (Rabbit) Source: Escherichia coli |
50ug |
510-Eur |
USCNLife |
|
| P91960Bo01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Bos taurus; Bovine (Cattle) Source: Escherichia coli |
50ug |
568-Eur |
USCNLife |
|
| P91960Rb01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Oryctolagus cuniculus (Rabbit) Source: Escherichia coli |
100ug |
714-Eur |
USCNLife |
|
| P91960Bo01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Bos taurus; Bovine (Cattle) Source: Escherichia coli |
100ug |
802-Eur |
USCNLife |
|
| sGCA-201AP |
PC-sGCB (WB control) Soluble Guanylate Cyclase beta Immunogen: peptide Host: Rabbit |
100-150ul |
221-Eur |
FGen |
|
| CK-E95912 |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISAkit |
|
----Eur |
Glory |
|
| E08S0295 |
Canine Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
715-Eur |
Blue Gene Biotech |
|
| E0679Mo |
Mouse soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT |
48T |
386-Eur |
Sunlog |
|
| E07S0295 |
Porcine Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
715-Eur |
Blue Gene Biotech |
|
| E01S0295 |
Human Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
96 Tests/kit |
601-Eur |
BGene |
|
| E06S0295 |
Goat Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
715-Eur |
Blue Gene Biotech |
|
| ELI-6146 |
anti-SLA (soluble Liver antigen) ELISA with CE; incub. time 30_15_15 min; Sample Serum, Plasma |
96 Wells |
----Eur |
Nal |
elisa |
| E09S0295 |
Monkey Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA, Strail |
|
715-Eur |
Blue Gene Biotech |
|
| CSB-EL012887DO |
Dog lectin, galactoside-binding, soluble, 3 (LGALS3) ELISA kit, Species Dog, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| P91960Bo01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Bos taurus; Bovine (Cattle) Source: Escherichia coli |
10ug |
334-Eur |
USCNLife |
|
| CSB-EL010050DO |
Dog guanylate cyclase 1, soluble, alpha 3 (GUCY1A3) ELISA kit, Species Dog, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| E03S0295 |
Mouse Soluble tumor necrosis factor-related apoptosis inducing ligand ELISA,Strail |
96 Tests/kit |
601-Eur |
BGene |
|
| P91960Hu01 |
Superoxide Dismutase 1, Soluble (SOD1) Organism: Homo sapiens (Human) Source: Escherichia coli |
100ug |
612-Eur |
USCNLife |
|
| sGCA-112AP |
PC-sGCA2 (WB control) Soluble Guanylate Cyclase alfa2 Immunogen: peptide Host: Rabbit |
100-150ul |
221-Eur |
FGen |
|
| CSB-EL010052DO |
Dog guanylate cyclase 1, soluble, beta 3 (GUCY1B3) ELISA kit, Species Dog, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| EIAAB45208 |
Mouse,Mus musculus,Phenol UDP-glucuronosyltransferase,UDP-glucuronosyltransferase 1-6,UDPGT 1-6,UGP1A1,Ugt1,UGT1*6,UGT1.6,UGT1-06,UGT1A6,Ugt1a6,Ugt1a6a |
|
1164-Eur |
EIAab |
|
| CSB-E04750h |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT SpeciesHuman |
96T |
714-Eur |
Cusabio |
|
| CSB-E07371m |
Mouse soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT SpeciesMouse |
96T |
816-Eur |
Cusabio |
|
| A91960Ra01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Rattus norvegicus (Rat) Type: Polyclonal Source: Rabbit |
50ug |
341-Eur |
USCNLife |
|
| CSB-E07380r |
Rat Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT, Species Rat, Sample Type serum, plasma |
96T |
735-Eur |
Cusabio |
elisa |
| A91960Ra01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Rattus norvegicus (Rat) Type: Polyclonal Source: Rabbit |
100ug |
445-Eur |
USCNLife |
|
| A91960Mu01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Mus musculus (Mouse) Type: Polyclonal Source: Rabbit |
100ug |
425-Eur |
USCNLife |
|
| AS09 578 |
Antibody: A set of 7 antibodies against SOD1 | superoxide dismutase 1, soluble , Host: rabbit, polyclonal, Comfirmed reactivity: human |
6x 50 |
1950-Eur |
Gentaur |
|
| A91960Mu01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Mus musculus (Mouse) Type: Polyclonal Source: Rabbit |
50ug |
328-Eur |
USCNLife |
|
| SFC-019 |
FGFR-3_Fc Chimera, soluble Human Host: Insect cells FGFR3; ACH; CEK2; JTK4; CD333; HSFGFR3EX |
10 |
88-Eur |
Reliatech |
|
| SFC-020 |
FGFR-3_Fc Chimera, soluble Human Host: Insect cells FGFR3; ACH; CEK2; JTK4; CD333; HSFGFR3EX |
50 |
199-Eur |
Reliatech |
|
| S01-052 |
OX40 ligand, soluble Human Host: Insect cells TNFSF4; GP34; CD252; OX4OL; TXGP1; CD134L; OX-40L |
10 |
232-Eur |
Reliatech |
|
| 100-118 |
TNF receptor type I, soluble Human Host: E. coli TNFRSF1A; FPF; p55; p60; TBP1; TNF-R; TNFAR; TNFR1; p55-R; CD120a; TNFR55; TNFR60; TNF-R-I; TNF-R55 |
20 |
232-Eur |
Reliatech |
|
| CSB-E07381r |
Rat Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT, Species Rat, Sample Type serum, plasma |
96T |
735-Eur |
Cusabio |
elisa |
| S01-044 |
TIE-2, soluble, Host: Insect cells, Species: Human, Synonyms: EGFR; ERBB; HER1; mENA; ERBB1; PIG61 |
50 ug |
251-Eur |
Reliatech |
|
| CSB-EL012890RA |
Rat lectin, galactoside-binding, soluble, 5 (galectin 5) (LGALS5) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E06802p |
Pig soluble Vascular cell adhesion molecules 1,sVCAM-1 ELISA Kit, Species Pig, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| S01-030 |
FAS receptor, soluble, Host: E. coli, Species: Human, Synonyms: FAS; APT1; CD95; FAS1; APO-1; FASTM; ALPS1A; TNFRSF6 |
20 ug |
232-Eur |
Reliatech |
|
| S01-018 |
VEGFR-3_FLT-4, soluble, Host: Insect cells, Species: Human, Synonyms: FLT4; PCL; FLT41; LMPH1A; VEGFR3 |
50 ug |
277-Eur |
Reliatech |
|
| S01-017 |
VEGFR-3_FLT-4, soluble, Host: Insect cells, Species: Human, Synonyms: FLT4; PCL; FLT41; LMPH1A; VEGFR3 |
10 ug |
147-Eur |
Reliatech |
|
| S01-043 |
TIE-2, soluble, Host: Insect cells, Species: Human, Synonyms: EGFR; ERBB; HER1; mENA; ERBB1; PIG61 |
10 ug |
114-Eur |
Reliatech |
|
| SFC-021 |
FGFR-4_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FGFR4; TKF; JTK2; CD334 |
10 ug |
88-Eur |
Reliatech |
|
| SFC-022 |
FGFR-4_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FGFR4; TKF; JTK2; CD334 |
50 ug |
199-Eur |
Reliatech |
|
| S01-062 |
Thrombomodulin, soluble, Host: HEK 293 cells, Species: Human, Synonyms: THBD; TM; THRM; AHUS6; BDCA3; CD141; THPH12 |
20 ug |
232-Eur |
Reliatech |
|
| SFC-013 |
TIE-2_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: TEK; TIE2; VMCM; TIE-2; VMCM1; CD202B |
20 ug |
108-Eur |
Reliatech |
|
| 102-PA21 |
VEGFR-1_Flt-1 (Peptide), soluble, Host: Rabbit, Species: Anti-Human, Synonyms: FLT1; FLT; VEGFR1 |
200 ug |
270-Eur |
Reliatech |
|
| 102-PA21S |
VEGFR-1_Flt-1 (Peptide), soluble, Host: Rabbit, Species: Anti-Human, Synonyms: FLT1; FLT; VEGFR1 |
100 ug |
180-Eur |
Reliatech |
|
| SFC-014 |
TIE-2_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: TEK; TIE2; VMCM; TIE-2; VMCM1; CD202B |
100 ug |
238-Eur |
Reliatech |
|
| S01-035 |
TRAIL R-1_DR4, soluble, Host: E. coli, Species: Human, Synonyms: TNFRSF10A; DR4; APO2; CD261; TRAILR1; TRAILR-1 |
50 ug |
232-Eur |
Reliatech |
|
| S01-061 |
IL-1 receptor antagonist, soluble Human Host: E. coli IL1RN; DIRA; IRAP; IL1F3; IL1RA; MVCD4; IL-1RN; IL-1ra; IL-1ra3; ICIL-1RA |
100 |
232-Eur |
Reliatech |
|
| 102-P95 |
TNF receptor type I, soluble Anti-Human Host: Rabbit TNFRSF1A; FPF; p55; p60; TBP1; TNF-R; TNFAR; TNFR1; p55-R; CD120a; TNFR55; TNFR60; TNF-R-I; TNF-R55 |
100 |
290-Eur |
Reliatech |
|
| S01-032 |
IL-2 receptor alpha, soluble, Host: Insect cells, Species: Human, Synonyms: IL2RA; CD25; IL2R; TCGFR; IDDM10 |
25 ug |
232-Eur |
Reliatech |
|
| 100-119 |
TNF receptor type II, soluble Human Host: E. coli TNFRSF1B;p75; TBPII; TNFBR; TNFR2; CD120b; TNFR1B; TNFR80; TNF-R75; p75TNFR; TNF-R-II |
20 |
232-Eur |
Reliatech |
|
| 100-157 |
FAS Ligand, soluble, His-Tag, Host: CHO cells, Species: Human, Synonyms: FASLG; FASL; CD178; CD95L; CD95-L; TNFSF6; APT1LG1 |
10 ug |
232-Eur |
Reliatech |
|
| 102-P120G |
FAS Ligand, soluble Anti-Human Host: Goat FASLG; FASL; CD178; CD95L; CD95-L; TNFSF6; APT1LG1 |
100 |
290-Eur |
Reliatech |
|
| CSB-EL009679PI |
Pig glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) (GOT1) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| WAK-AQ-250-50L |
AquaClean(Water soluble additive for fluids in heating baths concentrate and circulating thermostats to prevent microbial contamination. Sufficient for 50 l. |
250 ml concentrate |
99-Eur |
WAK - Chemie Medical GmbH |
|
| S01-017S |
VEGFR-3_FLT-4, soluble, Host: Insect cells, Species: Human, Synonyms: FLT4; PCL; FLT41; LMPH1A; VEGFR3 |
5 ug |
108-Eur |
Reliatech |
|
| HNS37-R |
Recombinant (E. coli) Hepatitis C Virus (HCV) NS3 1a helicase protein (full lengthc33c) immunodomnant regions (soluble) Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
238-Eur |
ADI |
|
| S01-046 |
Podoplanin, soluble, Host: E. coli, Species: Human, Synonyms: PDPN; T1A; GP36; GP40; Gp38; OTS8; T1A-2; AGGRUS; HT1A-1; PA2.26 |
5 ug |
88-Eur |
Reliatech |
|
| A91960Hu01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Homo sapiens (Human) Type: Polyclonal Source: Rabbit |
50ug |
322-Eur |
USCNLife |
|
| A91960Rb01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Oryctolagus cuniculus (Rabbit) Type: Polyclonal Source: Guinea pig |
50ug |
354-Eur |
USCNLife |
|
| Sac-112AP |
Soluble adenylate cyclase Mid Region Polyclonal Antibody Host Species: Rabbit Immunogen: peptide Epitope Location: |
200ul |
320-Eur |
FGen |
|
| A91960Rb01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Oryctolagus cuniculus (Rabbit) Type: Polyclonal Source: Guinea pig |
100ug |
462-Eur |
USCNLife |
|
| A91960Hu01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Homo sapiens (Human) Type: Polyclonal Source: Rabbit |
100ug |
418-Eur |
USCNLife |
|
| CSB-E04700r |
Rat Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| Sac-101AP |
Soluble adenylate cyclase 1 N-Terminal Polyclonal Antibody Host Species: Rabbit Immunogen: peptide Epitope Location: |
200ul |
320-Eur |
FGen |
|
| A91960Bo01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Bos taurus; Bovine (Cattle) Type: Polyclonal Source: Rabbit |
100ug |
500-Eur |
USCNLife |
|
| CSB-E14331r |
Rat soluble triggering receptor expresses on myeloid cells-2,sTREM-2 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL017767RA |
Rat soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| A91960Bo01 |
Antibody to Superoxide Dismutase 1, Soluble (SOD1) Organism: Bos taurus; Bovine (Cattle) Type: Polyclonal Source: Rabbit |
50ug |
379-Eur |
USCNLife |
|
| SNAP1-101AP |
Alfa soluble N-ethymaleimide sensitive factor attachment protein, Host species: Rabbit, Polyclonal antibody |
200ul |
337-Eur |
FabGennix |
|
| CSB-E13847r |
Rat soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL023986RA |
Rat soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL016331RA |
Rat Soluble Lectin-like Oxidized Low Density Lipoprotein Receptor-1(sLOX-1)ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| PPP012 |
PURIFIED PIG IgG, Product Type Purified Protein, Specificity IgG, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
409-Eur |
AbD Serotec |
cat |
| SCH-OBT2270 |
PURIFIED DOG IgG, Product Type Purified Protein, Specificity IgG, Target Species Dog, Host N_A, Format Purified, Isotypes IgG, Applications E, Clone N_A |
10 mg |
350-Eur |
Serotech |
dog |
| SCH-PFP001 |
PURIFIED CAT IgG, Product Type Purified Protein, Specificity IgG, Target Species Cat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
231-Eur |
Serotech |
cat |
| OBT2270 |
PURIFIED DOG IgG, Product Type Purified Protein, Specificity IgG, Target Species Dog, Host N_A, Format Purified, Isotypes IgG, Applications E, Clone N_A |
10 mg |
350-Eur |
AbD Serotec |
dog |
| PFP001 |
PURIFIED CAT IgG, Product Type Purified Protein, Specificity IgG, Target Species Cat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
231-Eur |
AbD Serotec |
cat |
| SCH-PPP012 |
PURIFIED PIG IgG, Product Type Purified Protein, Specificity IgG, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
409-Eur |
Serotech |
cat |
| sGCA-112AP |
Soluble Guanylate Cyclase alfa2 Polyclonal Antibody Host Species: Rabbit Immunogen: peptide Epitope Location: |
200ul |
320-Eur |
FGen |
|
| sGCA-101AP |
Soluble Guanylate Cyclase alfa1 Polyclonal Antibody Host Species: Rabbit Immunogen: peptide Epitope Location: |
200ul |
320-Eur |
FGen |
|
| A91960Ra01-B |
Biotin-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1); Reactivity: Rattus norvegicus (Rat) Clonality: Polyclonal Source: Rabbit |
50ug |
414-Eur |
USCNLife |
|
| 553-841 |
Aqua Clean, Waterbath additives and Disinfectant spray, Microbiocidal Additive for water soluble heating bath not for aluminium and acryl glass |
1 x 500 ml |
144-Eur |
Biozidat |
|
| 553-842 |
Aqua Clean, Waterbath additives and Disinfectant spray, Microbiocidal Additive for water soluble heating bath not for aluminium and acryl glass |
1 x 1000 ml |
221-Eur |
Biozidat |
|
| CSB-E16495r |
Rat soluble tumor necrosis factor-like weak inducer of apoptosis (sTWEAK)ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| SFC-019 |
FGFR-3_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FGFR3; ACH; CEK2; JTK4; CD333; HSFGFR3EX |
10 ug |
88-Eur |
Reliatech |
|
| HYB111-05 |
Acetylcholinesterase (AChE), native detergent soluble, brain (G4) or rbc (G2), No X w_BtChE, Clone 111_05, Mab anti_Human, NO X w_Torpedo marmorata or Flounder; ELISA_Blotting |
200 µg. |
993-Eur |
Accurate |
elisa |
| WAK-AQA-250-50L |
Acryl AquaClean(Water soluble additive for fluids in heating baths concentrate and circulating thermostats to prevent microbial contamination.Sufficient for 50 l.) |
250 ml concentrate |
151-Eur |
WAK - Chemie Medical GmbH |
|
| 26-233 |
SAC belongs to a distinct class of mammalian adenylyl cyclase that is soluble and insensitive to G protein or forskolin regulation. It is localized in the cytoplasm and is thought to function as a gen |
0.05 mg |
632-Eur |
Prosci |
|
| CSB-EL013540RA |
Rat mannose-binding lectin (protein C) 2, soluble (opsonic defect) (MBL2) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| SFC-009 |
VEGFR-3_FLT-4_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FLT4; PCL; FLT41; LMPH1A; VEGFR3 |
10 ug |
108-Eur |
Reliatech |
|
| SFC-020 |
FGFR-3_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FGFR3; ACH; CEK2; JTK4; CD333; HSFGFR3EX |
50 ug |
199-Eur |
Reliatech |
|
| sGCA-201AP |
Soluble Guanylate Cyclase beta Polyclonal Antibody Host Species: Rabbit Immunogen: peptide Epitope Location: |
200ul |
320-Eur |
FGen |
|
| S01-066 |
ESL-1, soluble Human Host: E. coli Golgi apparatus protein-1, E-selectin ligand-1, Cysteine-rich fibroblast growth factor receptor |
20 |
348-Eur |
Reliatech |
|
| 100-115 |
CD40 Ligand_TRAP, soluble Human Host: E. coli CD40LG; IGM; IMD3; TRAP; gp39; CD154; CD40L; HIGM1; T-BAM; TNFSF5; hCD40L |
50 |
232-Eur |
Reliatech |
|
| CSB-EL013540PI |
Pig mannose-binding lectin (protein C) 2, soluble (opsonic defect) (MBL2) ELISA kit, Species Pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| YSGVAMSV012C |
SNAP_25A (Soluble N_Ethylmaleimide_Sensitive_Factor_Attachment Proteins), ~27kD, Clone SP12, Mab anti_Human, Mouse, Rat, Bovine, Cat, Hamster, Swine, Xenopus; WB_IHC |
25 µg. |
529-Eur |
Accurate |
monoclonal |
| A91960Mu01-B |
Biotin-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1); Reactivity: Mus musculus (Mouse) Clonality: Polyclonal Source: Rabbit |
50ug |
397-Eur |
USCNLife |
|
| 100-118 |
TNF receptor type I, soluble, Host: E. coli, Species: Human, Synonyms: TNFRSF1A; FPF; p55; p60; TBP1; TNF-R; TNFAR; TNFR1; p55-R; CD120a; TNFR55; TNFR60; TNF-R-I; TNF-R55 |
20 ug |
232-Eur |
Reliatech |
|
| YSGVAMSV012E |
SNAP_25A (Soluble N_Ethylmaleimide_Sensitive_Factor_Attachment Proteins), ~27kD, Clone SP12, Mab anti_Human, Mouse, Rat, Bovine, Cat, Hamster, Swine, Xenopus; WB_IHC |
100 µg. |
1022-Eur |
Accurate |
monoclonal |
| 553-840 |
Aqua Clean, Waterbath additives and Disinfectant spray, Microbiocidal Additive for water soluble heating bath not for aluminium and acryl glass |
1 x 250 ml |
98-Eur |
Biozidat |
|
| SFC-010 |
VEGFR-3_FLT-4_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FLT4; PCL; FLT41; LMPH1A; VEGFR3 |
50 ug |
251-Eur |
Reliatech |
|
| S01-052 |
OX40 ligand, soluble, Host: Insect cells, Species: Human, Synonyms: TNFSF4; GP34; CD252; OX4OL; TXGP1; CD134L; OX-40L |
10 ug |
232-Eur |
Reliatech |
|
| PHP150 |
PURIFIED hCG, Product Type Purified Protein, Specificity hCG, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
409-Eur |
AbD Serotec |
human |
| PRP12 |
PURIFIED RAT IgG (POLYCLONAL), Product Type Purified Protein, Specificity IgG, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
20 mg |
385-Eur |
AbD Serotec |
polyclonal |
| SCH-PHP150 |
PURIFIED hCG, Product Type Purified Protein, Specificity hCG, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
409-Eur |
Serotech |
human |
| SCH-PRP12 |
PURIFIED RAT IgG (POLYCLONAL), Product Type Purified Protein, Specificity IgG, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
20 mg |
385-Eur |
Serotech |
polyclonal |
| PHP145 |
PURIFIED hCG ALPHA, Product Type Purified Protein, Specificity hCG, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
0.1 mg |
1245-Eur |
AbD Serotec |
human |
| SCH-PHP145 |
PURIFIED hCG ALPHA, Product Type Purified Protein, Specificity hCG, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
0.1 mg |
1245-Eur |
Serotech |
human |
| A91960Bo01-B |
Biotin-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1); Reactivity: Bos taurus; Bovine (Cattle) Clonality: Polyclonal Source: Rabbit |
50ug |
372-Eur |
USCNLife |
|
| 102-P95 |
TNF receptor type I, soluble, Host: Rabbit, Species: Anti-Human, Synonyms: TNFRSF1A; FPF; p55; p60; TBP1; TNF-R; TNFAR; TNFR1; p55-R; CD120a; TNFR55; TNFR60; TNF-R-I; TNF-R55 |
100 ug |
290-Eur |
Reliatech |
|
| A91960Rb01-B |
Biotin-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1); Reactivity: Oryctolagus cuniculus (Rabbit) Clonality: Polyclonal Source: Guinea pig |
50ug |
430-Eur |
USCNLife |
|
| A91960Hu01-B |
Biotin-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1); Reactivity: Homo sapiens (Human) Clonality: Polyclonal Source: Rabbit |
50ug |
343-Eur |
USCNLife |
|
| SNAP1-101AP |
Polyclonal Antibody Alfa soluble N-ethymaleimide sensitive factor attachment protein Immunogen: peptide (16mer) Host: Rabbit |
200ul |
304-Eur |
FGen |
|
| SFC-017 |
FGFR-2_Fc Chimera, soluble Human Host: Insect cells FGFR2; BEK; JWS; CEK3; CFD1; ECT1; KGFR; TK14; TK25; BFR-1; CD332; K-SAM |
10 |
88-Eur |
Reliatech |
|
| SFC-018 |
FGFR-2_Fc Chimera, soluble Human Host: Insect cells FGFR2; BEK; JWS; CEK3; CFD1; ECT1; KGFR; TK14; TK25; BFR-1; CD332; K-SAM |
50 |
199-Eur |
Reliatech |
|
| 102-P120G |
FAS Ligand, soluble, Host: Goat, Species: Anti-Human, Synonyms: FASLG; FASL; CD178; CD95L; CD95-L; TNFSF6; APT1LG1 |
100 ug |
310-Eur |
Reliatech |
|
| 100-119 |
TNF receptor type II, soluble, Host: E. coli, Species: Human, Synonyms: TNFRSF1B;p75; TBPII; TNFBR; TNFR2; CD120b; TNFR1B; TNFR80; TNF-R75; p75TNFR; TNF-R-II |
20 ug |
232-Eur |
Reliatech |
|
| 25-946 |
UGT1A1 is a UDP-glucuronosyltransferase, an enzyme of the glucuronidation pathway that transforms small lipophilic molecules, such as steroids, bilirubin, hormones, and drugs, into water-soluble, excr |
0.05 mg |
632-Eur |
Prosci |
|
| 27-813 |
SEMA4A is a member of the semaphorin family of soluble and transmembrane proteins. Semaphorins are involved in guidance of axonal migration during neuronal development and in immune responses. |
0.1 mg |
496-Eur |
Prosci |
rat |
| 29-979 |
UGT1A1 is a UDP-glucuronosyltransferase, an enzyme of the glucuronidation pathway that transforms small lipophilic molecules, such as steroids, bilirubin, hormones, and drugs, into water-soluble, excr |
0.1 mg |
496-Eur |
Prosci |
|
| 100-117 |
RANK Receptor, soluble, Host: E. coli, Species: Human, Synonyms: TNFSF11; ODF; OPGL; sOdf; CD254; OPTB2; RANKL; TRANCE; hRANKL2 |
100 ug |
232-Eur |
Reliatech |
|
| S01-061 |
IL-1 receptor antagonist, soluble, Host: E. coli, Species: Human, Synonyms: IL1RN; DIRA; IRAP; IL1F3; IL1RA; MVCD4; IL-1RN; IL-1ra; IL-1ra3; ICIL-1RA |
100 ug |
232-Eur |
Reliatech |
|
| CSB-E07370r |
Rat soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 201-20-6670 |
LGALS3BP{lectin, galactoside-binding, soluble, 3 binding protein}mouse.mAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| 15022-44 |
1‐Ethyl‐3‐(3‐dimethylaminopropyl)carbodiimide Hydrochloride 〔Water Soluble Carbodiimide〕 CAS: 25952-53-8 |
100G |
543-Eur |
Nacalai |
|
| 201-20-3099 |
LGALS3BP{lectin, galactoside-binding, soluble, 3 binding protein}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| S-1011-010 |
Reagents - HyNic Crosslinkers: Sulfo S-HyNic Crosslinker (Water Soluble) |
10 mg |
299-Eur |
Solulink |
|
| 201-20-6669 |
LGALS3BP{lectin, galactoside-binding, soluble, 3 binding protein}mouse.mAb |
0.2ml |
651-Eur |
Shanghai Sunred |
|
| E91766Hu |
ELISA Kit for Lectin Galactoside Binding, Soluble 3 Binding Protein (LGALS3BP) |
96T/Kit |
682-Eur |
USCNLife |
|
| LGALS7 |
LGALS3BP Gene lectin, galactoside-binding, soluble, 3 binding protein |
|
----Eur |
Transposagen |
|
| 15022-86 |
1‐Ethyl‐3‐(3‐dimethylaminopropyl)carbodiimide Hydrochloride 〔Water Soluble Carbodiimide〕 CAS: 25952-53-8 |
5G |
142-Eur |
Nacalai |
|
| S-1011-105 |
Reagents - HyNic Crosslinkers: Sulfo S-HyNic Crosslinker (Water Soluble) |
5 x 1.0 mg |
240-Eur |
Solulink |
|
| 15022-02 |
1‐Ethyl‐3‐(3‐dimethylaminopropyl)carbodiimide Hydrochloride 〔Water Soluble Carbodiimide〕 CAS: 25952-53-8 |
25G |
248-Eur |
Nacalai |
|
| 8GSL1 |
Human enzymes and proteins Glycosylated Soluble LOX_1, Human, recombinant |
0,1 mg |
1147-Eur |
Hytest |
recombinant |
| S01-039 |
4-1BB receptor, soluble (TNFRSF9) Human Host: E. coli TNFRSF9; ILA; 4-1BB; CD137; CDw137 |
20 |
232-Eur |
Reliatech |
|
| PHP193 |
RECOMBINANT HUMAN VEGF RECEPTOR 1 (SOLUBLE) Recombinant Protein Host: N_A |
10 |
554-Eur |
AbD Serotec |
|
| BQ016A-CR |
CLINICAL CHEMISTRY KITS (CHEMISTRY AUTOANALYZER): Y-GT Soluble, Kinetic, 10 x 15 ml |
150tests |
284-Eur |
Bioquant |
|
| S01-031 |
CD22, soluble Human Host: CHO cells CD22; SIGLEC2; SIGLEC-2 |
20 |
232-Eur |
Reliatech |
|
| CK-E97194 |
Human soluble human leucocyte antigen G1,sHLA-G ELISAkit |
|
----Eur |
Glory |
|
| Sac100-FITC |
Soluble adenylate cyclase 1 N-Terminal, FITC conjugates |
200ul |
460-Eur |
FabGennix |
|
| Sac110-FITC |
Soluble adenylate cyclase Mid Region, FITC conjugates |
200ul |
460-Eur |
FabGennix |
|
| Sac121-FITC |
Soluble adenylate cyclase1 C-Epitope, FITC conjugates |
200ul |
460-Eur |
FabGennix |
|
| sGCA1-FITC |
Soluble Guanylate Cyclase alfa1, FITC conjugates |
200ul |
460-Eur |
FabGennix |
|
| CSB-E13397h |
Human Soluble Human Leucocyte Antigen G1(SHLA_G) ELISA Kit |
96T |
856-Eur |
Cusabio |
elisa |
| CSB-E13397h |
Human Soluble Human Leucocyte Antigen G1(SHLA_G) ELISA KIT |
96tests |
797-Eur |
Cusabio |
elisa |
| CSB-E06895Rb |
rabbit Soluble protein-100B,S-100B ELISA Kit SpeciesRabbit |
96T |
981-Eur |
Cusabio |
|
| PR27033-10 |
Recombinant Human soluble CD40 Ligand_TRAP (sCD40 Human), 50 ug. |
|
255-Eur |
Neuromics |
|
| PR27033-2 |
Recombinant Human soluble CD40 Ligand_TRAP (sCD40 Human), 10 ug. |
|
138-Eur |
Neuromics |
|
| 8GSL1 |
Glycosylated Soluble LOX-1, Human, recombinant, Human enzymes and proteins |
0,1mg |
1005-Eur |
Hytest |
|
| 8GSL1 |
Human enzymes and proteins Glycosylated Soluble LOX-1, Human, recombinant |
0,1mg |
1055-Eur |
Hytest |
|
| CSB-E08065h |
Human Soluble protein-100B,S-100B ELISA Kit SpeciesHuman |
96T |
959-Eur |
Cusabio |
|
| CK-E11388 |
Human soluble human leucocyte antigen G1,sHLA-G ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| PHP192 |
RECOMBINANT HUMAN CD95 (SOLUBLE) Recombinant Protein Host: N_A |
25 |
299-Eur |
AbD Serotec |
|
| E0440Hu |
Human soluble human leucocyte antigen G1,sHLA-G ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| 201-12-0441 |
Human soluble human leucocyte antigen G1,sHLA-G ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CSB-E13397h |
Human Soluble Human Leucocyte Antigen G1(SHLA_G) ELISA KIT |
96tests |
856-Eur |
Cusabio |
elisa |
| PIP026 |
NATIVE TOXOPLASMA GONDII SOLUBLE ANTIGEN Antigen Host: N_A |
1 ml |
1500-Eur |
TRC |
|
| PR27033-10 |
Recombinant Human soluble CD40 Ligand_TRAP (sCD40 Human), 50 ug. |
1 |
283-Eur |
Neuromics |
recombinant |
| PR27033-2 |
Recombinant Human soluble CD40 Ligand_TRAP (sCD40 Human), 10 ug. |
1 |
160-Eur |
Neuromics |
recombinant |
| PHP191 |
RECOMBINANT HUMAN CD54 (SOLUBLE) Recombinant Protein Host: N_A |
50 |
299-Eur |
AbD Serotec |
|
| 15022-44 |
1‐Ethyl‐3‐(3‐dimethylaminopropyl)carbodiimide Hydrochloride 〔Water Soluble Carbodiimide〕 |
100G |
572-Eur |
Nacalai |
|
| 15022-02 |
1‐Ethyl‐3‐(3‐dimethylaminopropyl)carbodiimide Hydrochloride 〔Water Soluble Carbodiimide〕 |
25G |
260-Eur |
Nacalai |
|
| orb25181 |
Ox-Fibrinogen (Soluble) antibody Polyclonal Antibody Host: Rabbit |
20ul |
233-Eur |
Biorb |
|
| sGCB-Biotin |
Soluble Guanylate Cyclase beta , Biotin conjugates |
200ul |
460-Eur |
FabGennix |
|
| sGCA2-Biotin |
Soluble Guanylate Cyclase alfa2, Biotin conjugates |
200ul |
460-Eur |
FabGennix |
|
| 201-12-0441 |
Human soluble human leucocyte antigen G1,sHLA-G ELISA Kit |
96T |
476-Eur |
SunBT |
|
| sGCA2-FITC |
Soluble Guanylate Cyclase alfa2, FITC conjugates |
200ul |
460-Eur |
FabGennix |
|
| sGCB-FITC |
Soluble Guanylate Cyclase beta , FITC conjugates |
200ul |
460-Eur |
FabGennix |
|
| Sac100-Biotin |
Soluble adenylate cyclase 1 N-Terminal, Biotin conjugates |
200ul |
460-Eur |
FabGennix |
|
| 15022-86 |
1‐Ethyl‐3‐(3‐dimethylaminopropyl)carbodiimide Hydrochloride 〔Water Soluble Carbodiimide〕 |
5G |
150-Eur |
Nacalai |
|
| Sac110-Biotin |
Soluble adenylate cyclase Mid Region, Biotin conjugates |
200ul |
460-Eur |
FabGennix |
|
| Sac121-Biotin |
Soluble adenylate cyclase1 C-Epitope, Biotin conjugates |
200ul |
460-Eur |
FabGennix |
|
| sGCA1-Biotin |
Soluble Guanylate Cyclase alfa1, Biotin conjugates |
200ul |
460-Eur |
FabGennix |
|
| S01-064 |
CD34, soluble, Host: CHO cells, Species: Human, Synonyms: CD34 |
20 ug |
232-Eur |
Reliatech |
|
| QY-E02474 |
Human soluble Human leucocyte antigen G1(sHLA-G)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| 8SLX1 |
Human enzymes and proteins Recombinant soluble LOX_1, Human |
0,1 mg |
554-Eur |
Hytest |
recombinant |
| 201-12-0441 |
Human soluble Human leucocyte antigen G1(sHLA-G)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E0440Hu |
Human soluble human leucocyte antigen G1,sHLA-G ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| orb25181 |
Ox-Fibrinogen (Soluble) antibody Polyclonal Antibodies Primary antibodies |
20 |
244-Eur |
Biorb |
|
| BQ016B-CR |
CLINICAL CHEMISTRY KITS (CHEMISTRY AUTOANALYZER): Y-GT Soluble, Kinetic, 8 x 50 ml |
400tests |
413-Eur |
Bioquant |
|
| CK-E95037 |
Human Soluble Human Leucocyte Antigen G(SHLA-G) ELISA Kit |
96T |
728-Eur |
Glory |
|
| PHP193 |
RECOMBINANT HUMAN VEGF RECEPTOR 1 (SOLUBLE)-RECOMBINANT PROTEIN |
10 |g |
831-Eur |
AbD Serotec |
recombinant |
| 4TR26 |
Monoclonal Antibodies to Human Enzymes and Serum ProteinsTransferrin Receptor Soluble, Human |
1mg |
263-Eur |
Hytest |
|
| CSB-EL020975RA |
Rat soluble E-selectin,sE-selectin ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
735-Eur |
Cusabio |
elisa |
| S01-031 |
CD22, soluble, Host: CHO cells, Species: Human, Synonyms: CD22; SIGLEC2; SIGLEC-2 |
20 ug |
232-Eur |
Reliatech |
|
| E-EL-P1689 |
Porcine LGALS3BP (Lectin Galactoside Binding, Soluble 3 Binding Protein) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| K88345R |
Soluble form Receptor Activator of NF-KappaB Ligand (sRANK Ligand)Rabbit Aff.Pur. |
100ug |
474-Eur |
Meridian Life Science |
|
| M10-080 |
RANKL, soluble Mouse Host: E. coli Tnfsf11; ODF; OPG; OPGL; RANKL; Ly109l; Trance |
10 |
232-Eur |
Reliatech |
|
| HGP13-R |
Recombinant (E. coli) HIV gp13 protein (HIV-gp13 Subtype O), soluble Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
238-Eur |
ADI |
|
| E-EL-Ch1808 |
Chicken LGALS3BP (Lectin Galactoside Binding, Soluble 3 Binding Protein) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| MCA2766 |
MOUSE ANTI HUMAN LOX-1 (SOLUBLE) Monoclonal Antibody Host: Mouse IgG2a |
0.2 mg |
324-Eur |
AbD Serotec |
|
| E-EL-MK0363 |
Monkey LGALS3BP (Lectin Galactoside Binding, Soluble 3 Binding Protein) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| S01-033 |
IL-4 receptor alpha (CD124), soluble Human Host: HEK 293 cells IL4R; CD124; IL4RA |
15 |
232-Eur |
Reliatech |
|
| MCA2765 |
MOUSE ANTI HUMAN LOX-1 (SOLUBLE) Monoclonal Antibody Host: Mouse IgG1 |
0.2 mg |
324-Eur |
AbD Serotec |
|
| S01-028 |
Lyve-1, soluble Human Host: Insect cells LYVE1; HAR; XLKD1; LYVE-1; CRSBP-1 |
20 |
121-Eur |
Reliatech |
|
| CSB-E08106p |
Pig soluble P-selectin,sP-Selectin ELISA Kit, Species Pig, Sample Type serum, plasma |
96T |
779-Eur |
Cusabio |
elisa |
| 201-02-1300 |
Mouse Lectin Galactoside Binding, Soluble 3 Binding Protein(LGALS3BP)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| 201-12-4143 |
Human Lectin Galactoside Binding, Soluble 3 Binding Protein(LGALS3BP)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 10321 |
sAPPb (soluble β Amyloid Precursor Protein-Swedish) Protein A IgG3 mono |
100 |
417-Eur |
Demeditec |
|
| QY-E02471 |
Human Lectin Galactoside Binding, Soluble 3 Binding Protein(LGALS3BP)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| MCA2776 |
MOUSE ANTI HUMAN CD71 (SOLUBLE) Monoclonal Antibody Host: Mouse IgG2a |
0.2 mg |
252-Eur |
AbD Serotec |
|
| SNAP1-Biotin |
Alfa soluble N-ethymaleimide sensitive factor attachment protein, Biotin conjugates |
200ul |
460-Eur |
FabGennix |
|
| S01-050 |
CD23, soluble Human Host: E. coli FCER2; CD23; FCE2; CD23A; IGEBF; CLEC4J |
20 |
232-Eur |
Reliatech |
|
| MCA2756 |
MOUSE ANTI HUMAN CD154 (SOLUBLE) Monoclonal Antibody Host: Mouse IgG1 |
0.2 mg |
317-Eur |
AbD Serotec |
|
| S01-063 |
CD100, soluble Human Host: CHO cells SEMA4D; CD100; SEMAJ; coll-4; C9orf164; M-sema-G |
20 |
232-Eur |
Reliatech |
|
| MCA2775 |
MOUSE ANTI HUMAN CD71 (SOLUBLE) Monoclonal Antibody Host: Mouse IgG2b |
0.2 mg |
252-Eur |
AbD Serotec |
|
| MCA2755 |
MOUSE ANTI HUMAN CD154 (SOLUBLE) Monoclonal Antibody Host: Mouse IgG1 |
0.2 mg |
317-Eur |
AbD Serotec |
|
| CSB-EL020643RA |
Rat Soluble protein-100B,S-100B ELISA Kit, Species Rat, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| SNAP1-FITC |
Alfa soluble N-ethymaleimide sensitive factor attachment protein, FITC conjugates |
200ul |
460-Eur |
FabGennix |
|
| CSB-E06894Rb |
rabbit Soluble protein-100,S-100 ELISA Kit, Species rabbit, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| S01-039 |
4-1BB receptor, soluble (TNFRSF9), Host: E. coli, Species: Human, Synonyms: TNFRSF9; ILA; 4-1BB; CD137; CDw137 |
20 ug |
232-Eur |
Reliatech |
|
| 4GC1 |
Monoclonal Antibodies to Human Enzymes and Serum ProteinsGuanylate cyclase (hsGC,) Human soluble |
1mg |
410-Eur |
Hytest |
|
| SPC-506D |
Amyloid Oligomers (A11) Polyclonals Ab, Host Rabbit Synthetic molecular mimic of soluble oligomers. |
100ul |
315-Eur |
Stressmarq |
|
| CSB-E14063p |
Pig Soluble protein-100B,S-100B ELISA Kit, Species Pig, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| 4TR26 |
Transferrin Receptor Soluble, Human, Monoclonal Antibodies to Human Enzymes and Serum Proteins |
1mg |
251-Eur |
Hytest |
|
| SEB766Mu |
ELISA Kit for Lectin Galactoside Binding, Soluble 3 Binding Protein (LGALS3BP) Mus musculus (Mouse) |
96T |
675-Eur |
USCNLife |
|
| GS-1210a |
lectin, galactoside-binding, soluble, 3 binding protein primary antibody, Host: Rabbit |
200ul |
792-Eur |
Glory |
|
| CSB-EL020622MO |
Mouse Soluble protein-100,S-100 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| CSB-EL020622HU |
Human Soluble protein-100,S-100 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| S01-026 |
Lyve-1, soluble Mouse Host: Insect cells Lyve1; Xlkd1; Lyve-1; Crsbp-1; 1200012G08Rik |
20 |
121-Eur |
Reliatech |
|
| 4TR26 |
Monoclonal Antibodies to Human Enzymes and Serum Proteins Transferrin Receptor Soluble, Human |
1 mg |
287-Eur |
Hytest |
recombinant |
| FASL12-C |
Human soluble FAS Ligand (FASL_CD95L) Recombinant protein for Western Species Reactivity: Human |
100 ul Product tipe: WB Control |
303-Eur |
ADI |
|
| E07S0281 |
Porcine Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
608-Eur |
BGene |
|
| E0213Hu |
Human soluble platelet-selectin,sP-selectin ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| 8SLX1 |
Recombinant soluble LOX-1, Human, Human enzymes and proteins |
0,1mg |
485-Eur |
Hytest |
|
| 201-12-1287 |
Human Soluble protein-100B,S-100B ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E09S0252 |
Monkey Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| E-EL-MK0541 |
Monkey S-100B (Soluble protein-100B ) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E06S0252 |
Goat Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
608-Eur |
BGene |
|
| E01S0281 |
Human Soluble platelet-selectin ELISA, SP-Selectin |
|
689-Eur |
Blue Gene Biotech |
|
| E08S0252 |
Canine Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E97492 |
Human Soluble protein-100B,S-100B ELISAkit |
|
----Eur |
Glory |
|
| E01S0252 |
Human Soluble Endothelial Selectin ELISA, SE-selectin |
|
689-Eur |
Blue Gene Biotech |
|
| E01S0263 |
Human Anti-anti-soluble liver antigen |
96 Tests/kit |
1087-Eur |
BlueGen |
human |
| 201-20-6441 |
XPNPEP1{X-prolyl aminopeptidase (aminopeptidase P) 1, soluble}rabbit.pAb |
0.2ml |
582-Eur |
Shanghai Sunred |
|
| AR1018 |
Water Soluble Sealing Reagent-IHC Related Reagent |
50ml |
104-Eur |
SDlabs |
|
| E11S0252 |
Bovine Soluble Endothelial Selectin ELISA, SE-selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E0276Mo |
Mouse soluble endothelium-selectin,sE-selectin ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| AR1018 |
IHC Related Reagent Water Soluble Sealing Reagent |
50ml |
79-Eur |
Boster biotechnology |
|
| E14S0281 |
Sheep Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| E12S0252 |
Chicken Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| E11S0281 |
Bovine Soluble platelet-selectin ELISA, SP-Selectin |
|
715-Eur |
Blue Gene Biotech |
|
| 201-12-0214 |
Human soluble platelet-selectin,sP-selectin ELISA Kit |
96T |
476-Eur |
SunBT |
|
| E1286Hu |
Human Soluble protein-100B,S-100B ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| MPP004 |
ADENOVIRUS TYPE 3 SOLUBLE ANTIGEN Antigen Host: N_A |
1 ml |
477-Eur |
AbD Serotec |
|
| MPP005 |
ADENOVIRUS TYPE 11 SOLUBLE ANTIGEN Antigen Host: N_A |
1 ml |
477-Eur |
AbD Serotec |
|
| QY-E30102 |
rabbit Soluble protein-100B,S-100B ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| E13S0263 |
Anserine anti - anti-soluble liver antigen |
96 Tests/kit |
1128-Eur |
BlueGen |
|
| 201-12-0263 |
Human soluble endothelium-selectin(sE-selectin)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| 201-09-0035 |
rabbit soluble endothelium-selectin,sE-selectin ELISA Kit |
96T |
719-Eur |
SunBT |
|
| 8SLX1 |
Human enzymes and proteins Recombinant soluble LOX-1, Human |
0,1mg |
509-Eur |
Hytest |
|
| E0213Hu |
Human soluble platelet-selectin,sP-selectin ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| CSB-E08066r |
Rat Soluble protein-100B,S-100B ELISA Kit SpeciesRat |
96T |
981-Eur |
Cusabio |
|
| QY-E21369 |
Mouse soluble endothelium-selectin(sE-selectin)ELISA Kit |
96T |
519-Eur |
SQBIO |
|
| 201-09-0024 |
Rabbit Soluble protein-100B,S-100B ELISA Kit |
96T |
719-Eur |
SunBT |
|
| E06S0281 |
Goat Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
608-Eur |
BGene |
|
| E0697Mo |
Mouse soluble platelet-selectin,sP-selectin ELISA Kit |
96T |
656-Eur |
Eastbio |
|
| 201-09-0028 |
Rabbit soluble platelet-selectin,sP-selectin ELISA Kit |
96T |
719-Eur |
SunBT |
|
| E0262Hu |
Human soluble endothelium-selectin,sE-selectin ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E-EL-P0166 |
Porcine S-100B (Soluble protein-100B ) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| 201-12-0214 |
Human soluble platelet-selectin(sP-selectin)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E09S0281 |
Monkey Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| E-EL-H0163 |
Human S-100B (Soluble protein-100B ) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E12S0252 |
Chicken Soluble Endothelial Selectin ELISA, SE-selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E14S0252 |
Sheep Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| E07S0263 |
Porcine anti-anti-soluble liver antigen |
96 Tests/kit |
1101-Eur |
BlueGen |
porcine |
| E09S0252 |
Monkey Soluble Endothelial Selectin ELISA, SE-selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E12S0281 |
Chicken Soluble platelet-selectin ELISA, SP-Selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E1856h |
Human soluble human leucocyte antigen G ELISA Kit |
96T |
706-Eur |
EIAab |
elisa |
| E11S0263 |
Bovine anti-anti-soluble liver antigen |
96 Tests/kit |
1128-Eur |
BlueGen |
bovine |
| QY-E30108 |
rabbit soluble endothelium-selectin,sE-selectin ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| S-1002-105 |
Reagents - HyNic Crosslinkers: S-HyNic Crosslinker (DMF Soluble) |
5 x 1.0 mg |
177-Eur |
Solulink |
|
| S-1002-010 |
Reagents - HyNic Crosslinkers: S-HyNic Crosslinker (DMF Soluble) |
10 mg |
240-Eur |
Solulink |
|
| E14S0252 |
Sheep Soluble Endothelial Selectin ELISA, SE-selectin |
|
715-Eur |
Blue Gene Biotech |
|
| 201-12-0263 |
Human soluble endothelium-selectin,sE-selectin ELISA Kit |
96T |
476-Eur |
SunBT |
|
| QY-E30104 |
rabbit soluble platelet-selectin,sP-selectin ELISA Kit |
96T |
646-Eur |
SQBIO |
|
| MPP001 |
ADENOVIRUS TYPE 5 SOLUBLE ANTIGEN Antigen Host: N_A |
1 ml |
477-Eur |
AbD Serotec |
|
| E-EL-Ch1944 |
Chicken S-100B (Soluble protein-100B ) ELISA Kit |
96T |
646-Eur |
Elabscience |
|
| E14S0281 |
Sheep Soluble platelet-selectin ELISA, SP-Selectin |
|
715-Eur |
Blue Gene Biotech |
|
| 201-12-1287 |
Human Soluble protein-100B(S-100B)ELISA Kit |
96T |
602-Eur |
SunBT |
|
| E08S0281 |
Canine Soluble platelet-selectin ELISA, SP-Selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E04S0263 |
Rabbit anti-anti-soluble liver antigen |
96 Tests/kit |
1087-Eur |
BlueGen |
polyclonal |
| E11S0281 |
Bovine Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| 201-02-0277 |
Mouse soluble endothelium-selectin(sE-selectin)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| PIP026 |
NATIVE TOXOPLASMA GONDII SOLUBLE ANTIGEN-ANTIGEN |
1 ml |
2017-Eur |
AbD Serotec |
|
| E1286Hu |
Human Soluble protein-100B,S-100B ELISA Kit |
96T |
483-Eur |
Eastbio |
|
| E08S0281 |
Canine Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| CK-E99200 |
rabbit Soluble protein-100B,S-100B ELISAkit |
|
----Eur |
Glory |
|
| IRKTAH1517-1 Kit (96 Wells) |
Human Soluble IL-1R 4_ST2 ELISA Kit 60 Kit (96 Wells) |
|
818-Eur |
Innovative Research INC |
|
| E05S0263 |
Guinea anti-anti-soluble liver antigen |
96 Tests/kit |
1101-Eur |
BlueGen |
|
| E06S0263 |
Goat anti-anti-soluble liver antigen |
96 Tests/kit |
1101-Eur |
BlueGen |
polyclonal |
| E09S0281 |
Monkey Soluble platelet-selectin ELISA, SP-Selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E01S0252 |
Human Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
601-Eur |
BGene |
|
| 201-09-0035 |
rabbit soluble endothelium-selectin(sE-selectin)ELISA Kit |
96T |
607-Eur |
Sunred |
|
| 201-09-0028 |
Rabbit soluble platelet-selectin(sP-selectin)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| E01S0281 |
Human Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
601-Eur |
BGene |
|
| 201-09-0024 |
Rabbit Soluble protein-100B(S-100B)ELISA Kit |
96T |
539-Eur |
Sunred |
|
| U1856h |
Human soluble human leucocyte antigen G CLIA KIT |
96T |
706-Eur |
EIAab |
assays |
| PHP192 |
RECOMBINANT HUMAN CD95 (SOLUBLE)-RECOMBINANT PROTEIN |
25 |g |
456-Eur |
AbD Serotec |
recombinant |
| PHP191 |
RECOMBINANT HUMAN CD54 (SOLUBLE)-RECOMBINANT PROTEIN |
50 |g |
456-Eur |
AbD Serotec |
recombinant |
| AR1018 |
IHC Related Reagent: Water Soluble Sealing Reagent |
50ml |
89-Eur |
Boster biotechnology |
|
| E08S0252 |
Canine Soluble Endothelial Selectin ELISA, SE-selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E07S0252 |
Porcine Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
608-Eur |
BGene |
|
| E06S0252 |
Goat Soluble Endothelial Selectin ELISA, SE-selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E06S0281 |
Goat Soluble platelet-selectin ELISA, SP-Selectin |
|
715-Eur |
Blue Gene Biotech |
|
| E05S0252 |
Guinea pig Soluble Endothelial Selectin ELISA, SE-selectin |
|
689-Eur |
Blue Gene Biotech |
|
| E11S0252 |
Bovine Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| E04S0252 |
Rabbit Soluble Endothelial Selectin ELISA, SE-selectin |
|
689-Eur |
Blue Gene Biotech |
|
| 201-02-0698 |
Mouse soluble platelet-selectin(sP-selectin)ELISA Kit |
96T |
548-Eur |
Sunred |
|
| CK-E11686 |
Human Soluble protein-100B,S-100B ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| IRKTAH1406-1 Kit (96 Wells) |
Human HBEGF (Soluble) ELISA Kit 80 Kit (96 Wells) |
|
652-Eur |
Innovative Research INC |
|
| IRKTAH1514-1 Kit (96 Wells) |
Mouse Soluble CD36 ELISA Kit 62 Kit (96 Wells) |
|
696-Eur |
Innovative Research INC |
|
| 2-hsGC |
Soluble guanylate cyclase, human (hsGC), antibody |
200ug |
418-Eur |
Advenced Immuno Chemical |
human |
| AR1018 |
IHC Related Reagent Water Soluble Sealing Reagent |
50ml |
93-Eur |
Boster biotechnology |
|
| IRKTAH1513-1 Kit (96 Wells) |
Human Soluble CD36 ELISA Kit 63 Kit (96 Wells) |
|
696-Eur |
Innovative Research INC |
|
| E05S0281 |
Guinea pig Soluble platelet-selectin ELISA, SP-Selectin |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0281 |
Rabbit Soluble platelet-selectin ELISA, SP-Selectin |
|
689-Eur |
Blue Gene Biotech |
|
| 2-hsGC |
Soluble guanylate cyclase, human (hsGC), antibody |
500ug |
580-Eur |
Advenced Immuno Chemical |
human |
| E0262Hu |
Human soluble endothelium-selectin,sE-selectin ELISA Kit |
48T |
306-Eur |
Eastbio |
|
| E0697Mo |
Mouse soluble platelet-selectin,sP-selectin ELISA Kit |
48T |
386-Eur |
Sunlog |
|
| E03S0263 |
Mouse anti-anti-soluble liver antigen |
96 Tests/kit |
1087-Eur |
BlueGen |
mouse |
| E12S0281 |
Chicken Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
622-Eur |
BGene |
|
| E03S0281 |
Mouse Soluble platelet-selectin ELISA, SP-Selectin |
|
689-Eur |
Blue Gene Biotech |
|
| E04S0252 |
Rabbit Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
601-Eur |
BGene |
|
| 201-12-0263 |
Human soluble endothelium-selectin,sE-selectin ELISA Kit |
48T |
295-Eur |
SunBT |
|
| E07S0281 |
Porcine Soluble platelet-selectin ELISA, SP-Selectin |
|
715-Eur |
Blue Gene Biotech |
|
| QY-E21383 |
Mouse Soluble protein-100B(S-100B)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E02476 |
Human soluble platelet-selectin(sP-selectin)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| AR1018 |
IHC Related Reagent Water Soluble Sealing Reagent |
50ml |
77-Eur |
Bouster Immunoleader |
|
| 1909-5 |
KN-93, Water-Soluble; Appearance White to off-white solid |
5 mg |
489-Eur |
Biovision |
|
| 1909-1 |
KN-93, Water-Soluble; Appearance White to off-white solid |
1 mg |
177-Eur |
Biovision |
|
| E03S0252 |
Mouse Soluble Endothelial Selectin ELISA, SE-selectin |
|
689-Eur |
Blue Gene Biotech |
|
| E03S0281 |
Mouse Soluble platelet-selectin ELISA,SP-Selectin |
96 Tests/kit |
601-Eur |
BGene |
|
| E04S0281 |
Rabbit Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
601-Eur |
BGene |
|
| E07S0252 |
Porcine Soluble Endothelial Selectin ELISA, SE-selectin |
|
715-Eur |
Blue Gene Biotech |
|
| QY-E21381 |
Mouse soluble platelet-selectin(sP-selectin)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| 201-12-1287 |
Human Soluble protein-100B,S-100B ELISA Kit |
48T |
295-Eur |
SunBT |
|
| CK-E80179 |
rabbit Soluble protein-100B,S-100B ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| QY-E02477 |
Human soluble endothelium-selectin(sE-selectin)ELISA Kit |
96T |
640-Eur |
SQBIO |
|
| E0276Mo |
Mouse soluble endothelium-selectin,sE-selectin ELISA Kit |
48T |
386-Eur |
Eastbio |
|
| E03S0252 |
Mouse Soluble Endothelial Selectin ELISA,SE-selectin |
96 Tests/kit |
601-Eur |
BGene |
|
| 201-12-0214 |
Human soluble platelet-selectin,sP-selectin ELISA Kit |
48T |
295-Eur |
SunBT |
|
| QY-E04632 |
Human Soluble protein-100B(S-100B)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| 30-864 |
CCDC50 is a soluble, cytoplasmic, tyrosine-phosphorylated protein with multiple ubiquitin-interacting domains. Mutations in this gene cause nonsyndromic, postlingual, progressive sensorineural DFNA44 |
0.05 mg |
632-Eur |
Prosci |
|
| 100-115 |
CD40 Ligand_TRAP, soluble, Host: E. coli, Species: Human, Synonyms: CD40LG; IGM; IMD3; TRAP; gp39; CD154; CD40L; HIGM1; T-BAM; TNFSF5; hCD40L |
50 ug |
232-Eur |
Reliatech |
|
| Sac-112AP |
P-Sac110 (Antigenic peptide) Soluble adenylate cyclase Mid Region Immunogen: peptide Host: Rabbit |
100ul |
180-Eur |
FGen |
|
| E91766Mu |
ELISA Kit for Lectin Galactoside Binding, Soluble 3 Binding Protein (LGALS3BP) Organism: Mus musculus (Mouse) |
96T |
618-Eur |
USCNLife |
|
| CSB-EL007667HU |
Human Soluble Endoglin,sENG_sCD105 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| SEB766Hu |
ELISA Kit for Lectin Galactoside Binding, Soluble 3 Binding Protein (LGALS3BP) Homo sapiens (Human) |
96T |
659-Eur |
USCNLife |
|
| CSB-EL011670HU |
Human Soluble Interleukin-7 Receptor,sIL-7R ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| Sac-121AP |
P-Sac121 (Antigenic peptide) Soluble adenylate cyclase1 C-Epitope Immunogen: peptide Host: Rabbit |
100ul |
180-Eur |
FGen |
|
| CSB-EL023577HU |
Human Thymidine Kinase 1,Soluble(TK1) ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL001161BO |
Bovine aconitase 1, soluble (ACO1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL001161RB |
Rabbit aconitase 1, soluble (ACO1) ELISA kit, Species Rabbit, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| Sac-101AP |
P-Sac100 (Antigenic peptide) Soluble adenylate cyclase 1 N-Terminal Immunogen: peptide Host: Rabbit |
100ul |
180-Eur |
FGen |
|
| CSB-EL026218RA |
Rat X-prolyl aminopeptidase (aminopeptidase P) 1, soluble (XPNPEP1) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E10051m |
Mouse Leptin Soluble Receptor,sLR ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
637-Eur |
Cusabio |
elisa |
| CSB-EL004882HU |
Human soluble CD163(sCD163) ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
806-Eur |
Cusabio |
elisa |
| S01-033 |
IL-4 receptor alpha (CD124), soluble, Host: E. coli, Species: Human, Synonyms: IL4R; CD124; IL4RA |
15 ug |
232-Eur |
Reliatech |
|
| CSB-E05191Rb |
Rabbit soluble adhesion molecules,Sam ELISA Kit, Species Rabbit, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| M10-080 |
RANKL, soluble, Host: E. coli, Species: Mouse, Synonyms: Tnfsf11; ODF; OPG; OPGL; RANKL; Ly109l; Trance |
10 ug |
232-Eur |
Reliatech |
|
| CSB-EL023577CH |
Chicken thymidine kinase 1, soluble (TK1) ELISA kit, Species Chicken, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 4GC1 |
Monoclonal Antibodies to Human Enzymes and Serum Proteins Guanylate cyclase (hsGC,) Human soluble |
1 mg |
448-Eur |
Hytest |
monoclonal |
| YM9067B |
TNF alpha, Free Soluble (17kD), Membrane (26kD), Receptor_bound, Clone T3, Mab anti_Human, Clone T3, Mab anti_ |
50 µg. |
738-Eur |
Accurate |
recombinant |
| CSB-E09905Rb |
Rabbit soluble interleukin-1 receptor Ⅰ,IL-1sR Ⅰ ELISA kit, Species Rabbit, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| S01-040 |
EGFR, soluble Human Host: Insect cells EGFR; ERBB; HER1; mENA; ERBB1; PIG61 |
25 |
329-Eur |
Reliatech |
|
| CSB-EL001161MO |
Mouse aconitase 1, soluble (ACO1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL007667MO |
Mouse Soluble Endoglin,ENG_sCD105 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| CSB-EL023605HU |
Human Soluble Toll-like Receptor 6(TLR-6) ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL023577MO |
Mouse thymidine kinase 1, soluble (TK1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL008534HU |
Human soluble CD23(sCD23) ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| CSB-EL004912HU |
Human Soluble CD276,sCD276_sB7-H3 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| 4GC1 |
Guanylate cyclase (hsGC,) Human soluble, Monoclonal Antibodies to Human Enzymes and Serum Proteins |
1mg |
391-Eur |
Hytest |
|
| CSB-EL023994HU |
Human soluble OX40L (sOX40L) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL001161CH |
Chicken aconitase 1, soluble (ACO1) ELISA kit, Species Chicken, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL001161HU |
Human aconitase 1, soluble (ACO1) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL023577BO |
Bovine thymidine kinase 1, soluble (TK1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 1220 |
Human soluble Transferrin Receptor (sTfR) ELISA Kit, 96 tests, Quantitative Species Reactivity: Human |
1 kit Product tipe: Kit |
823-Eur |
ADI |
|
| MCA2623 |
MOUSE ANTI GUANYLATE CYCLASE ALPHA 1 (SOLUBLE) Monoclonal Antibody Host: Mouse IgG1 |
0.2 mg |
249-Eur |
AbD Serotec |
|
| CSB-EL011649MO |
Mouse soluble interleukin-2 receptor,sIL-2Rα ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| 18983 |
soluble á2,6_Sialyltransferase (rST6GalI_E41) Antigen Rat Immunized Animal Rabbit poly IgG, serum Antigen peptide |
100 µg |
420-Eur |
Demeditec |
polyclonal |
| 91-68-9 |
3_Di Ethyl Amino Phenol 3_Di Ethyl Amino Phen |
1g |
----Eur |
chemotra |
|
| CSB-EL004965MO |
Mouse soluble Cluster of differentiation 86,sCD86 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL013621CH |
Chicken malate dehydrogenase 1, NAD (soluble) (MDH1) ELISA kit, Species Chicken, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL017613CH |
Chicken phosphoenolpyruvate carboxykinase 1 (soluble) (PCK1) ELISA kit, Species Chicken, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL023608MO |
Mouse Soluble Toll-like Receptor 9,sTLR9_sCD289 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| CSB-EL001337RB |
Rabbit adenylate cyclase 10 (soluble) (ADCY10) ELISA kit, Species Rabbit, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022397RH |
Monkey superoxide dismutase 1, soluble (SOD1) ELISA kit, Species Monkey, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022397CH |
Chicken superoxide dismutase 1, soluble (SOD1) ELISA kit, Species Chicken, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL023603MO |
Mouse Soluble Toll-like Receptor 4,sTLR4 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL011621MO |
Mouse soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL001176CH |
Chicken acid phosphatase 1, soluble (ACP1) ELISA kit, Species Chicken, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL001176MO |
Mouse acid phosphatase 1, soluble (ACP1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL021272BO |
Bovine serine hydroxymethyltransferase 1 (soluble) (SHMT1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL001176BO |
Bovine acid phosphatase 1, soluble (ACP1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL013621BO |
Bovine malate dehydrogenase 1, NAD (soluble) (MDH1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL013622BO |
Bovine malate dehydrogenase 1B, NAD (soluble) (MDH1B) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL013622MO |
Mouse malate dehydrogenase 1B, NAD (soluble) (MDH1B) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL020990HU |
Human soluble Cluster of differentiation 100(sCD100)ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL004966BO |
Bovine soluble cluster of differentiation 8(sCD8) ELISA Kit, Species Bovine, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-E06859b |
Bovine soluble Cluster of differentiation 86,sCD86 ELISA Kit, Species Bovine, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| CSB-EL021272MO |
Mouse serine hydroxymethyltransferase 1 (soluble) (SHMT1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL001337MO |
Mouse adenylate cyclase 10 (soluble) (ADCY10) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022397GU |
Guinea pig superoxide dismutase 1, soluble (SOD1) ELISA kit, Species Guinea pig, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL001176HU |
Human acid phosphatase 1, soluble (ACP1) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL011650HU |
Human soluble interleukin-2 receptor,IL-2sRβ ELISA kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| S01-001 |
VEGFR-2_KDR (D7), soluble, Host: Insect cells, Species: Human, Synonyms: KDR; FLK1; CD309; VEGFR; VEGFR2 |
5 ug |
69-Eur |
Reliatech |
|
| CSB-E14110h |
Human Soluble Elastin Fragments (sELAF) ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL011649HU |
Human soluble interleukin-2 receptor,IL-2sRα ELISA kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| E91766Hu |
ELISA Kit for Lectin Galactoside Binding, Soluble 3 Binding Protein (LGALS3BP) Organism Homo sapiens (Human) |
96T |
639-Eur |
USCNLife |
elisa |
| S01-002 |
VEGFR-2_KDR (D7), soluble, Host: Insect cells, Species: Human, Synonyms: KDR; FLK1; CD309; VEGFR; VEGFR2 |
50 ug |
244-Eur |
Reliatech |
|
| SPC-506D |
Amyloid Oligomers (A11) Antibody Polyclonal Host: Rabbit Immunogen: Synthetic molecular mimic of soluble oligomers. |
100ul |
270-Eur |
Stressmarq |
|
| CSB-EL011621HU |
Human soluble interleukin-1 receptor Ⅰ,IL-1sRⅠ ELISA kit, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| CSB-EL011622HU |
Human soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| CSB-EL004965HU |
Human soluble Cluster of differentiation 86,sCD86 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
583-Eur |
Cusabio |
elisa |
| CSB-EL004959HU |
Human Soluble Cluster of Differentiation 80 (sCD80) ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL011622MO |
Mouse soluble interleukin-1 receptor Ⅱ,IL-1sRⅡ ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL001337HU |
Human adenylate cyclase 10 (soluble) (ADCY10) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E08987h |
Human anti-soluble liver antigen,SLA ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL021272HU |
Human serine hydroxymethyltransferase 1 (soluble) (SHMT1) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E11336h |
Human soluble cluster of differentiation 146,sCD146 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL013622HU |
Human malate dehydrogenase 1B, NAD (soluble) (MDH1B) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL005934HU |
Human Soluble Cluster of differentiation 21,sCD21 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
583-Eur |
Cusabio |
elisa |
| CSB-EL004913HU |
human soluble cluster of differentiation 28,sCD28 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| CSB-EL004929HU |
Human Soluble Cluster of differentiation 38,sCD38 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL023601MO |
Mouse Soluble Toll-like Receptor 2,sTLR2 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| S01-050 |
CD23, soluble, Host: E. coli, Species: Human, Synonyms: FCER2; CD23; FCE2; CD23A; IGEBF; CLEC4J |
20 ug |
232-Eur |
Reliatech |
|
| Sac-101AP |
Sac100-Biotin (Biotin Conjugates) Soluble adenylate cyclase 1 N-Terminal Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| Sac-112AP |
Sac110-FITC (FITC-conjugates) Soluble adenylate cyclase Mid Region Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| CSB-EL004879HU |
Human soluble cluster of differentiation 14,sCD14 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| CSB-EL021272SH |
Sheep serine hydroxymethyltransferase 1 (soluble) (SHMT1) ELISA kit, Species Sheep, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL022397SH |
Sheep superoxide dismutase 1, soluble (SOD1) ELISA kit, Species Sheep, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| Sac-121AP |
Sac121-FITC (FITC-conjugates) Soluble adenylate cyclase1 C-Epitope Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| MCA2624 |
MOUSE ANTI HUMAN GUANYLATE CYCLASE BETA 1 (SOLUBLE) Monoclonal Antibody Host: Mouse IgG2b |
0.2 mg |
249-Eur |
AbD Serotec |
|
| 100-276 |
RANKL, soluble Human Host: E. coli TNFSF11; ODF; OPGL; sOdf; CD254; OPTB2; RANKL; TRANCE; hRANKL2 |
10 |
232-Eur |
Reliatech |
|
| Sac-101AP |
Sac100-FITC (FITC-conjugates) Soluble adenylate cyclase 1 N-Terminal Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| sGCA-101AP |
P-sGCA1 (Antigenic peptide) Soluble Guanylate Cyclase alfa1 Immunogen: peptide Host: Rabbit |
100ul |
180-Eur |
FGen |
|
| sGCA-201AP |
P-sGCB (Antigenic peptide) Soluble Guanylate Cyclase beta Immunogen: peptide Host: Rabbit |
100ul |
180-Eur |
FGen |
|
| sGCA-112AP |
P-sGCA2 (Antigenic peptide) Soluble Guanylate Cyclase alfa2 Immunogen: peptide Host: Rabbit |
100ul |
180-Eur |
FGen |
|
| 103-P71 |
RANKL, soluble, Host: Rabbit, Species: Anti-Mouse, Synonyms: Tnfsf11; ODF; OPG; OPGL; RANKL; Ly109l; Trance |
100 ug |
290-Eur |
Reliatech |
|
| S01-028 |
Lyve-1 receptor, soluble, Host: Insect cells, Species: Human, Synonyms: LYVE1; HAR; XLKD1; LYVE-1; CRSBP-1 |
20 ug |
121-Eur |
Reliatech |
|
| S01-063 |
CD100, soluble, Host: CHO cells, Species: Human, Synonyms: SEMA4D; CD100; SEMAJ; coll-4; C9orf164; M-sema-G |
20 ug |
232-Eur |
Reliatech |
|
| Sac-112AP |
Sac110-Biotin (Biotin Conjugates) Soluble adenylate cyclase Mid Region Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| 4Tr26-23D10 |
CD71 _ TFRC (soluble form) Clone 23D10 antibody Isotype IgG2b Host Mouse |
1 mg |
489-Eur |
ACR |
|
| 4Tr26-5B11 |
CD71 _ TFRC (soluble form) Clone 5B11 antibody Isotype IgG2b Host Mouse |
1 mg |
489-Eur |
ACR |
|
| 4Tr26-11F5 |
CD71 _ TFRC (soluble form) Clone 11F5 antibody Isotype IgG2b Host Mouse |
1 mg |
489-Eur |
ACR |
|
| CSB-EL022397RB |
Rabbit superoxide dismutase 1, soluble (SOD1) ELISA kit, Species Rabbit, Sample Type serum, plasma |
96T |
781-Eur |
Cusabio |
elisa |
| CSB-EL021272RB |
Rabbit serine hydroxymethyltransferase 1 (soluble) (SHMT1) ELISA kit, Species Rabbit, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| E91766Hu |
ELISA Kit for Lectin Galactoside Binding, Soluble 3 Binding Protein (LGALS3BP) Organism: Homo sapiens (Human) |
96T |
604-Eur |
USCNLife |
|
| S01-038 |
BAFF receptor, soluble Human Host: E. coli TNFRSF13C; BAFFR; CD268; CVID4; BAFF-R; BROMIX; prolixin |
50 |
232-Eur |
Reliatech |
|
| 4Tr26-13E4 |
CD71 _ TFRC (soluble form) Clone 13E4 antibody Isotype IgG2a Host Mouse |
1 mg |
489-Eur |
ACR |
|
| Sac-121AP |
Sac121-Biotin (Biotin Conjugates) Soluble adenylate cyclase1 C-Epitope Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| CK-E11337 |
Human soluble P-selectin,sP-selectin ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| 20170 |
Human Soluble E-selectin (sE-selectin) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| QY-E70111 |
Canine soluble E-selectin,sE-selectin ELISA Kit |
96T |
555-Eur |
SQBIO |
|
| IRKTAH1523-1 Kit (96 Wells) |
Human Soluble LOX-1 ELISA Kit 58 Kit (96 Wells) |
|
818-Eur |
Innovative Research INC |
|
| 201-16-0046 |
Chicken soluble E-selectin(sE-selectin)ELISA Kit |
96T |
734-Eur |
Sunred |
|
| CK-E20530 |
Mouse soluble P-selectin,sP-selectin ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| E02S0252 |
Rat Soluble Endothelial Selectin ELISA, SE-selectin |
|
689-Eur |
Blue Gene Biotech |
|
| 201-11-0409 |
Rat soluble endothelium-selectin,sE-selectin ELISA Kit |
96T |
490-Eur |
SunBT |
|
| E0408Ra |
Rat soluble endothelium-selectin,sE-selectin ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E02S0252 |
Rat Soluble Endothelial Selectin ELISA, SE-selectin |
96 Tests/kit |
601-Eur |
BGene |
|
| MPP005 |
ADENOVIRUS TYPE 11 SOLUBLE ANTIGEN-ANTIGEN |
1 ml |
717-Eur |
AbD Serotec |
|
| MPP001 |
ADENOVIRUS TYPE 5 SOLUBLE ANTIGEN-ANTIGEN |
1 ml |
717-Eur |
AbD Serotec |
|
| E0075Ra |
Rat Soluble protein-100B,S-100B ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| MPP004 |
ADENOVIRUS TYPE 3 SOLUBLE ANTIGEN-ANTIGEN |
1 ml |
717-Eur |
AbD Serotec |
|
| E0409Ra |
Rat soluble platelet-selectin,sP-selectin ELISA Kit |
96T |
490-Eur |
Eastbio |
|
| E02S0281 |
Rat Soluble platelet-selectin ELISA, SP-Selectin |
96 Tests/kit |
601-Eur |
BGene |
|
| CK-E98807 |
Porcine soluble P-selectin,sP-Selectin ELISAkit |
|
----Eur |
Glory |
|
| E0217Po |
Porcine soluble P-selectin,sP-Selectin ELISA Kit |
48T |
380-Eur |
Eastbio |
|
| CK-E99169 |
rabbit soluble E-selectin,sE-selectin ELISAkit |
|
----Eur |
Glory |
|
| CK-E99204 |
rabbit soluble P-selectin,sP-selectin ELISAkit |
|
----Eur |
Glory |
|
| IRKTAH1520-1 Kit (96 Wells) |
Human Soluble IL-1R II ELISA Kit 59 Kit (96 Wells) |
|
818-Eur |
Innovative Research INC |
|
| CK-E30417 |
Rat Soluble protein-100B,S-100B ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E98452 |
Rat Soluble protein-100B,S-100B ELISAkit |
|
----Eur |
Glory |
|
| CSB-E07996r |
Rat soluble E-selectin,sE-selectin ELISA Kit SpeciesRat |
96T |
735-Eur |
Cusabio |
|
| CK-E98923 |
Chicken soluble E-selectin,sE-selectin ELISAkit |
|
----Eur |
Glory |
|
| E0216Po |
Porcine soluble E-selectin,sE-selectin ELISA Kit |
48T |
380-Eur |
Eastbio |
|
| CK-E50009 |
Porcine soluble E-selectin,sE-selectin ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| S01-065 |
CD34, soluble Human Host: CHO cells CD34 |
20 |
232-Eur |
Reliatech |
|
| 201-11-0410 |
Rat soluble platelet-selectin,sP-selectin ELISA Kit |
96T |
490-Eur |
SunBT |
|
| CK-E95894 |
Human soluble E-selectin,sE-selectin ELISAkit |
|
----Eur |
Glory |
|
| E02S0263 |
Rat anti-anti-soluble liver antigen |
96 Tests/kit |
1087-Eur |
BlueGen |
rat |
| CK-E80183 |
rabbit soluble P-selectin,sP-selectin ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E80148 |
rabbit soluble E-selectin,sE-selectin ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E60036 |
Chicken soluble E-selectin,sE-selectin ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E50058 |
Porcine soluble P-selectin,sP-Selectin ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E98758 |
Porcine soluble E-selectin,sE-selectin ELISAkit |
|
----Eur |
Glory |
|
| 201-11-0076 |
Rat Soluble protein-100B,S-100B ELISA Kit |
96T |
490-Eur |
SunBT |
|
| 20310 |
Human Soluble P-selectin (sP-selectin) ELISA Kit |
96T |
650-Eur |
Bio-Medical |
elisa |
| QY-E11235 |
Rat soluble platelet-selectin(sP-selectin)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| CK-E97143 |
Human soluble P-selectin,sP-selectin ELISAkit |
|
----Eur |
Glory |
|
| CSB-E09869Ch |
Chicken soluble E-selectin,sE-selectin ELISA Kit |
96T |
524-Eur |
Cusabio |
|
| QY-E11236 |
Rat soluble endothelium-selectin(sE-selectin)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| SOD1 |
SOD1 Gene superoxide dismutase 1, soluble |
|
----Eur |
Transposagen |
|
| 20236 |
Rat Soluble Platelet-Selectin(sP-Selectin) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| SHMT1 |
SHMT1 Gene serine hydroxymethyltransferase 1 (soluble) |
|
----Eur |
Transposagen |
|
| 201-11-0076 |
Rat Soluble protein-100B(S-100B)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| E0075Ra |
Rat Soluble protein-100B,S-100B ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| QY-E11569 |
Rat Soluble protein-100B(S-100B)ELISA Kit |
96T |
464-Eur |
SQBIO |
|
| QY-E40090 |
Porcine soluble P-selectin (sP-Selectin) ELISA Kit |
96T |
519-Eur |
SQBIO |
|
| E-EL-R0904 |
Rat S-100B (Soluble Protein-100B) ELISA Kit |
96T |
583-Eur |
Elabscience |
|
| E02S0281 |
Rat Soluble platelet-selectin ELISA, SP-Selectin |
|
689-Eur |
Blue Gene Biotech |
|
| QY-E40042 |
Porcine soluble E-selectin (sE-selectin) ELISA Kit |
96T |
519-Eur |
SQBIO |
|
| CSB-E08074h |
Human soluble P-selectin,sP-selectin ELISA Kit |
96T |
524-Eur |
Cusabio |
|
| CSB-E06941Rb |
rabbit soluble E-selectin,sE-selectin ELISA Kit |
96T |
594-Eur |
Cusabio |
|
| 201-11-0410 |
Rat soluble platelet-selectin(sP-selectin)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 201-11-0409 |
Rat soluble endothelium-selectin(sE-selectin)ELISA Kit |
96T |
620-Eur |
SunBT |
|
| 20363 |
Mouse Soluble P-Selectin(sP-selectin) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| CK-E10087 |
Human soluble E-selectin,sE-selectin ELISA Kit |
96T |
728-Eur |
Eastbio |
|
| CK-E98027 |
Mouse soluble P-selectin,sP-selectin ELISAkit |
|
----Eur |
Glory |
|
| E0409Ra |
Rat soluble platelet-selectin,sP-selectin ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| 23852 |
Rat Soluble protein-100B(S-100B) ELISA Kit |
96T |
878-Eur |
Bio-Medical |
elisa |
| E0408Ra |
Rat soluble endothelium-selectin,sE-selectin ELISA Kit |
48T |
320-Eur |
Eastbio |
|
| E0216Po |
Porcine soluble E-selectin,sE-selectin ELISA Kit |
96T |
560-Eur |
Eastbio |
|
| E0217Po |
Porcine soluble P-selectin,sP-Selectin ELISA Kit |
96T |
560-Eur |
Eastbio |
|
| TM 366 |
COOKED MEAT MEDIUM (R.C. MEDIUM) (COMPLETE SOLUBLE) |
500 gm |
114-Eur |
TitanBiotech |
cell culture |
| CSB-E06861Rb |
rabbit soluble P-selectin,sP-selectin ELISA Kit |
96T |
594-Eur |
Cusabio |
|
| 25869-98-1 |
Berlin blue Milory blue; soluble for |
1g |
----Eur |
chemotra |
|
| SFC-017 |
FGFR-2_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FGFR2; BEK; JWS; CEK3; CFD1; ECT1; KGFR; TK14; TK25; BFR-1; CD332; K-SAM |
10 ug |
88-Eur |
Reliatech |
|
| 27-091 |
SFRP2 is a member of the SFRP family that contains a cysteine-rich domain homologous to the putative Wnt-binding site of Frizzled proteins. SFRPs act as soluble modulators of Wnt signaling. Methylatio |
0.05 mg |
632-Eur |
Prosci |
human |
| SFC-018 |
FGFR-2_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FGFR2; BEK; JWS; CEK3; CFD1; ECT1; KGFR; TK14; TK25; BFR-1; CD332; K-SAM |
50 ug |
199-Eur |
Reliatech |
|
| 779-88-4 |
2,5_Bis(trifluoromethyl)phenol 2,5_Bis(trifluoromethyl) |
1g |
----Eur |
chemotra |
|
| 96-94-6 |
2,4_Bis(1_methylbutyl)phenol 2,4_Bis(1_methylbutyl)p |
1g |
----Eur |
chemotra |
|
| 370-98-9 |
p-[2-(methylamino)ethyl]phenol p-[2-(methylamino)ethyl |
1g |
----Eur |
chemotra |
|
| 609-21-2 |
4_Amino_2,6_Dibromo phenol 4_Amino_2,6_Dibromo p |
1g |
----Eur |
chemotra |
|
| 349-58-6 |
3,5_Bis(trifluoromethyl)phenol 3,5_Bis(trifluoromethyl) |
1g |
----Eur |
chemotra |
|
| sGCA-201AP |
sGCB-Biotin (Biotin Conjugates) Soluble Guanylate Cyclase beta Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| sGCA-112AP |
sGCA2-Biotin (Biotin Conjugates) Soluble Guanylate Cyclase alfa2 Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| CSB-EL018743HU |
Human soluble endothelial protein C receptor,sEPCR ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL015289HU |
Human soluble myosin heavy chain 1,sMHC-1 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| sGCA-101AP |
sGCA1-Biotin (Biotin Conjugates) Soluble Guanylate Cyclase alfa1 Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| sGCA-201AP |
sGCB-FITC (FITC-conjugates) Soluble Guanylate Cyclase beta Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| CSB-EL001064HU |
Human Soluble Mesothelin Related Peptide(SMRP)ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL004937HU |
Human Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
826-Eur |
Cusabio |
elisa |
| CSB-EL023996HU |
Human Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| sGCA-112AP |
sGCA2-FITC (FITC-conjugates) Soluble Guanylate Cyclase alfa2 Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| S01-003 |
VEGFR-2_KDR (native), soluble, Host: Insect cells, Species: Human, Synonyms: KDR; FLK1; CD309; VEGFR; VEGFR2 |
5 ug |
154-Eur |
Reliatech |
|
| sGCA-101AP |
sGCA1-FITC (FITC-conjugates) Soluble Guanylate Cyclase alfa1 Immunogen: peptide Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| CSB-EL018743MO |
Mouse soluble endothelial protein C receptor,sEPCR ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| CSB-E12742h |
Human soluble terminal complement complex SC5b9 ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| EL10034-2 |
Interleukin-6 Soluble Receptor (IL-6 sR) ELISA Kits for Human Cytokines and Receptors, sensitivity: <1.75 pg_ml, array range: 1.75-400 pg_ml |
96 wells |
840-Eur |
Anogen |
|
| EL10034 |
Interleukin-6 Soluble Receptor (IL-6 sR) ELISA Kits for Human Cytokines and Receptors, sensitivity: <1.75 pg_ml, array range: 1.75-400 pg_ml |
96 wells |
492-Eur |
Anogen |
|
| BMDV10075 |
Laminin Receptor, 67kD, partially inhibits binding of soluble Laminin, Clone MLuC5, Mab anti_Human; paraffin, IH_flow |
0.5 ml. |
718-Eur |
Accurate |
recombinant |
| CSB-EL009709RB |
Rabbit glycerol-3-phosphate dehydrogenase 1 (soluble) (GPD1) ELISA kit, Species Rabbit, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL015289MO |
Mouse soluble myosin heavy chain 1,sMHC-1 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| HGP412-R |
Recombinant (E. coli) HIV_1 gp41 protein (Contains all the immunogenic determinants found in gp41 and a small portion of gp120) (soluble) |
100 ug |
262-Eur |
Alpha Diagnostics |
recombinant |
| CSB-EL015303MO |
Mouse soluble myosin heavy chain 2,sMHC-2 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL012882SH |
Sheep lectin, galactoside-binding, soluble, 1 (LGALS1) ELISA kit, Species Sheep, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010989SH |
Sheep isocitrate dehydrogenase 1 (NADP+), soluble (IDH1) ELISA kit, Species Sheep, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| Sac-121AP |
Soluble adenylate cyclase1 C-Epitope Polyclonal Antibody Host Species: Rabbit Immunogen: peptide Epitope Location: |
200ul |
320-Eur |
FGen |
|
| CSB-E17405m |
Mouse soluble terminal complement complex SC5b9 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| EIAAB45309 |
14.5 kDa translational inhibitor protein,Hrsp12,Perchloric acid soluble protein,Psp1,Rat,Rattus norvegicus,Ribonuclease UK114 |
|
1191-Eur |
EIAab |
|
| CSB-EL012888RA |
Rat lectin, galactoside-binding, soluble, 3 binding protein (LGALS3BP) ELISA kit, Species Rat, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E06943Rb |
rabbit Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit, Species rabbit, Sample Type serum, plasma |
96T |
779-Eur |
Cusabio |
elisa |
| CSB-E10364Rb |
Rabbit soluble Factor-related Apoptosis,sFAS_Apo-1 ELISA Kit, Species Rabbit, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| CSB-E09835Rb |
Rabbit soluble endothelial protein C receptor,sEPCR ELISA Kit, Species Rabbit, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| CSB-E09267Rb |
Rabbit soluble cluster of differentiation 40 ligand,sCD40L ELISA Kit, Species Rabbit, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| CSB-EL004937MO |
Mouse Soluble Cluster of differentiation 40 ligand,sCD40L ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL023996MO |
Mouse Soluble Cluster of differentiation 30 ligand,sCD30L ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| SFC-008 |
VEGFR-2_KDR-Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: KDR; FLK1; CD309; VEGFR; VEGFR2 |
50 ug |
199-Eur |
Reliatech |
|
| S01-004 |
VEGFR-2_KDR (native), soluble, Host: Insect cells, Species: Human, Synonyms: KDR; FLK1; CD309; VEGFR; VEGFR2 |
20 ug |
348-Eur |
Reliatech |
|
| SFC-007 |
VEGFR-2_KDR-Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: KDR; FLK1; CD309; VEGFR; VEGFR2 |
10 ug |
88-Eur |
Reliatech |
|
| CSB-EL010949RH |
Monkey Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit, Species Monkey, Sample Type serum, plasma |
96T |
779-Eur |
Cusabio |
elisa |
| CSB-EL009709MO |
Mouse glycerol-3-phosphate dehydrogenase 1 (soluble) (GPD1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010050MO |
Mouse guanylate cyclase 1, soluble, alpha 3 (GUCY1A3) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| EL10034 |
ELISA Kits for Cytokines and Receptors Interleukin-6 Soluble Receptor (IL-6 sR), human, Sensitivity <1.75 pg_ml, Assay Range 1.75-400 pg_ml |
96 wells |
666-Eur |
Anogen |
|
| EL10034-6 |
Interleukin-6 Soluble Receptor (IL-6 sR) ELISA Kits for Human Cytokines and Receptors, sensitivity: <1.75 pg_ml, array range: 1.75-400 pg_ml |
96 wells |
1948-Eur |
Anogen |
|
| CSB-EL010052MO |
Mouse guanylate cyclase 1, soluble, beta 3 (GUCY1B3) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010989MO |
Mouse isocitrate dehydrogenase 1 (NADP+), soluble (IDH1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| M1296 |
8_Octanoyloxypyrene_1,3,6_trisulfonic acid trisodium salt, Highly polar, highly water soluble lipase substrate, 25mg |
|
128-Eur |
MarkerGene |
rat |
| CSB-EL012882MO |
Mouse lectin, galactoside-binding, soluble, 1 (LGALS1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012883MO |
Mouse lectin, galactoside-binding, soluble, 12 (LGALS12) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012886MO |
Mouse lectin, galactoside-binding, soluble, 2 (LGALS2) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012889MO |
Mouse lectin, galactoside-binding, soluble, 4 (LGALS4) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012892MO |
Mouse lectin, galactoside-binding, soluble, 7 (LGALS7) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012894MO |
Mouse lectin, galactoside-binding, soluble, 8 (LGALS8) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012895MO |
Mouse lectin, galactoside-binding, soluble, 9 (LGALS9) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012887RB |
Rabbit lectin, galactoside-binding, soluble, 3 (LGALS3) ELISA kit, Species Rabbit, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012883HU |
Human lectin, galactoside-binding, soluble, 12 (LGALS12) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012889BO |
Bovine lectin, galactoside-binding, soluble, 4 (LGALS4) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012882BO |
Bovine lectin, galactoside-binding, soluble, 1 (LGALS1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010989BO |
Bovine isocitrate dehydrogenase 1 (NADP+), soluble (IDH1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012886HU |
Human lectin, galactoside-binding, soluble, 2 (LGALS2) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL009709BO |
Bovine glycerol-3-phosphate dehydrogenase 1 (soluble) (GPD1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012885HU |
Human lectin, galactoside-binding, soluble, 14 (LGALS14) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E14255Ha |
Hamster Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit, Species Hamster, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012882HU |
Human lectin, galactoside-binding, soluble, 1 (LGALS1) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010052HU |
Human guanylate cyclase 1, soluble, beta 3 (GUCY1B3) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| S01-040 |
EGFR, soluble, Host: Insect cells, Species: Human, Synonyms: EGFR; ERBB; HER1; mENA; ERBB1; PIG61 |
25 ug |
329-Eur |
Reliatech |
|
| CSB-EL010051HU |
Human guanylate cyclase 1, soluble, beta 2 (GUCY1B2) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| S01-026 |
Lyve-1 receptor, soluble, Host: Insect cells, Species: Mouse, Synonyms: Lyve1; Xlkd1; Lyve-1; Crsbp-1; 1200012G08Rik |
20 ug |
121-Eur |
Reliatech |
|
| CSB-EL010050HU |
Human guanylate cyclase 1, soluble, alpha 3 (GUCY1A3) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010049HU |
Human guanylate cyclase 1, soluble, alpha 2 (GUCY1A2) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012895BO |
Bovine lectin, galactoside-binding, soluble, 9 (LGALS9) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012889HU |
Human lectin, galactoside-binding, soluble, 4 (LGALS4) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012895HU |
Human lectin, galactoside-binding, soluble, 9 (LGALS9) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012894HU |
Human lectin, galactoside-binding, soluble, 8 (LGALS8) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL009709HU |
Human glycerol-3-phosphate dehydrogenase 1 (soluble) (GPD1) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E09870Ch |
Chicken Soluble Intercellular Adhesion Molecule-1,sICAM-1 ELISA Kit, Species Chicken, Sample Type serum, plasma |
96T |
688-Eur |
Cusabio |
elisa |
| CSB-E04529Ch |
Chicken soluble endothelial protein C receptor,sEPCR ELISA Kit, Species Chicken, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012896HU |
Human lectin, galactoside-binding, soluble, 9B (LGALS9B) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012897HU |
Human lectin, galactoside-binding, soluble, 9C (LGALS9C) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012892HU |
Human lectin, galactoside-binding, soluble, 7 (LGALS7) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012887HU |
human lectin-galactose binding-soluble 3,Lgals3 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| SFC-M06 |
VEGFR-1_Flt-1(D7)-Fc Chimera, soluble, Host: Insect cells, Species: Mouse, Synonyms: Flt1; Flt-1; sFlt1; VEGFR1; VEGFR-1; AI323757 |
50 ug |
199-Eur |
Reliatech |
|
| CSB-E10037Mo |
Monkey soluble Vascular cell adhesion molecule 1,sVCAM-1 ELISA Kit, Species Monkey, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| S01-038 |
BAFF receptor, soluble, Host: E. coli, Species: Human, Synonyms: TNFRSF13C; BAFFR; CD268; CVID4; BAFF-R; BROMIX; prolixin |
50 ug |
232-Eur |
Reliatech |
|
| CSB-EL023977HU |
Human Tumor necrosis factor soluble receptor Ⅰ,TNFsR-ⅠELISA KIT, Species Human, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| CSB-EL023968HU |
Human Soluble Receptor Activator of Nuclear Factor-kB,sRANK ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E14253Ha |
Hamster soluble Vascular cell adhesion molecule 1,sVCAM-1 ELISA Kit, Species Hamster, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL023978HU |
Human soluble tumor necrosis factor receptor 2,sTNF-R2 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012891MO |
Mouse lectin, galactoside-binding, soluble, 6 (galectin 6) (LGALS6) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL020662HU |
Human testicular soluble adenylyl cyclase (non-HGNC gene) (SAC) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 102-PA19S |
VEGFR-2_KDR (Peptide), soluble, Host: Rabbit, Species: Anti-Human, Synonyms: KDR; FLK1; CD309; VEGFR; VEGFR2 |
100 ug |
180-Eur |
Reliatech |
|
| CSB-EL010566MO |
Mouse 3-hydroxy-3-methylglutaryl-Coenzyme A synthase 1 (soluble) (HMGCS1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL010566CH |
Chicken 3-hydroxy-3-methylglutaryl-Coenzyme A synthase 1 (soluble) (HMGCS1) ELISA kit, Species Chicken, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 102-PA19 |
VEGFR-2_KDR (Peptide), soluble, Host: Rabbit, Species: Anti-Human, Synonyms: KDR; FLK1; CD309; VEGFR; VEGFR2 |
200 ug |
270-Eur |
Reliatech |
|
| HGP412-R |
Recombinant (E. coli) HIV-1 gp41 protein ( Contains all the immunogenic determinants found in gp41 and a small portion of gp120) (soluble) Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
238-Eur |
ADI |
|
| CSB-EL012890HU |
Human lectin, galactoside-binding, soluble, 5 (galectin 5) (LGALS5) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 100-276 |
RANKL, soluble, Host: E. coli, Species: Human, Synonyms: TNFSF11; ODF; OPGL; sOdf; CD254; OPTB2; RANKL; TRANCE; hRANKL2 |
10 ug |
232-Eur |
Reliatech |
|
| CSB-EL023977MO |
Mouse Tumor necrosis factor soluble receptor Ⅰ,TNFsR-Ⅰ ELISA KIT, Species Mouse, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| CSB-EL023978MO |
Mouse Tumor necrosis factor soluble receptor Ⅱ,TNFsR-Ⅱ ELISA KIT, Species Mouse, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| CSB-EL012891HU |
Human lectin, galactoside-binding, soluble, 6 (galectin 6) (LGALS6) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| SFC-M05 |
VEGFR-1_Flt-1(D7)-Fc Chimera, soluble, Host: Insect cells, Species: Mouse, Synonyms: Flt1; Flt-1; sFlt1; VEGFR1; VEGFR-1; AI323757 |
10 ug |
88-Eur |
Reliatech |
|
| 28-095 |
VPS24 encodes a protein that acts in the sorting of transmembrane proteins into lysosomes_vacuoles via the multivesicular body (MVB) pathway. This protein, along with other soluble coiled-coil contain |
0.05 mg |
632-Eur |
Prosci |
|
| CSB-E06944Rb |
Rabbit soluble Vascular cell adhesion molecule 1,sVCAM-1 ELISA Kit, Species Rabbit, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| 4GC1-GC25 |
Guanylate cyclase soluble GUCY1B3 (beta subunit) Clone GC25 antibody Isotype IgG2a Host Mouse |
1 mg |
653-Eur |
ACR |
|
| 30-113 |
SOD1 binds copper and zinc ions and is one of two isozymes responsible for destroying free superoxide radicals in the body. This isozyme is a soluble cytoplasmic protein, acting as a homodimer to conv |
0.1 mg |
496-Eur |
Prosci |
human |
| SNAP1-101AP |
Alfa soluble N-ethymaleimide sensitive factor attachment protein Polyclonal Antibody Host Species: Rabbit Immunogen: peptide (16mer) Epitope Location: 265-295 |
200ul |
320-Eur |
FGen |
|
| M1227 |
8_Octadecyloxypyrene_1,3,6_trisulfonic acid trisodium salt, Highly water soluble polar fluorescent lipid probe for the sensitive fluorimetric assay of cationic surfactants, 10mg |
|
223-Eur |
MarkerGene |
elisa |
| CSB-EL016331MO |
Mouse soluble Lectin-like Oxidized Low Density Lipoprotein Receptor-1(sLOX-1)ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL009679MO |
Mouse glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) (GOT1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| S01-021 |
BMP receptor-1A, soluble Human Host: Insect cells ALK3; SKR5; CD292; ACVRLK3; 10q23del; bone morphogenetic protein receptor, type IA |
100 |
238-Eur |
Reliatech |
|
| CSB-EL024404MO |
Mouse soluble Triggering Receptor Expresses on Myeloid Cells-1,sTREM-1 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 553-851 |
Aqua Clean -Acryl-, Waterbath additives and Disinfectant spray, Microbiocidal Additive for water soluble heating bath for aluminium and acryl glass |
1 x 500 ml |
258-Eur |
Biozidat |
|
| EL10033 |
Interleukin-2 Soluble Receptor alpha (IL-2 sRa) ELISA Kits for Human Cytokines and Receptors, sensitivity: <10 pg_mL, array range: 10-2000 pg_mL |
96 wells |
492-Eur |
Anogen |
|
| EL10033-2 |
Interleukin-2 Soluble Receptor alpha (IL-2 sRa) ELISA Kits for Human Cytokines and Receptors, sensitivity: <10 pg_mL, array range: 10-2000 pg_mL |
96 wells |
840-Eur |
Anogen |
|
| M10-054 |
CD40 Ligand_TRAP, soluble Mouse Host: E. coli Cd40lg; IGM; IMD3; Ly62; TRAP; gp39; CD154; Cd40l; HIGM1; Ly-62; T-BAM; CD40-L; Tnfsf5 |
25 |
232-Eur |
Reliatech |
|
| EL10033-6 |
Interleukin-2 Soluble Receptor alpha (IL-2 sRa) ELISA Kits for Human Cytokines and Receptors, sensitivity: <10 pg_mL, array range: 10-2000 pg_mL |
96 wells |
1948-Eur |
Anogen |
|
| 10321 |
sAPPb (soluble â Amyloid Precursor Protein _Swedish ) Antigen Human Immunized Animal Mouse mono IgG3, supernatant Protein A |
100 µg |
420-Eur |
Demeditec |
recombinant |
| CSB-EL017767MO |
Mouse soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| M1228 |
Octyl â_D_1_thioglucopyranoside, A non_ionic detergent for purification of soluble proteins from cells, including bacteria, and for solubilization and reconstitution of membrane proteins, 500mg |
|
103-Eur |
MarkerGene |
recombinant |
| A91960Ra01-F |
FITC-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1) Clonality: Polyclonal Source: Rabbit ReactivityRattus norvegicus (Rat) Conjugate: FITC |
50ug |
380-Eur |
USCNLife |
|
| CSB-EL023986MO |
Mouse soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| 553-852 |
Aqua Clean -Acryl-, Waterbath additives and Disinfectant spray, Microbiocidal Additive for water soluble heating bath for aluminium and acryl glass |
1 x 1000 ml |
367-Eur |
Biozidat |
|
| 553-850 |
Aqua Clean -Acryl-, Waterbath additives and Disinfectant spray, Microbiocidal Additive for water soluble heating bath for aluminium and acryl glass |
1 x 250 ml |
162-Eur |
Biozidat |
|
| EL10033 |
ELISA Kits for Cytokines and Receptors Interleukin-2 Soluble Receptor alpha (IL-2 sRα), human, Sensitivity <10 pg_mL, Assay Range 10-2000 pg_mL |
96 wells |
666-Eur |
Anogen |
|
| CSB-EL017712MO |
Mouse Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| S01-M03 |
VEGFR-2_Flk-1 (native), soluble, Host: Insect cells, Species: Mouse, Synonyms: Kdr; Flk1; Ly73; Flk-1; Krd-1; VEGFR2; VEGFR-2; sVEGFR-2; 6130401C07 |
5 ug |
154-Eur |
Reliatech |
|
| S01-M04 |
VEGFR-2_Flk-1 (native), soluble, Host: Insect cells, Species: Mouse, Synonyms: Kdr; Flk1; Ly73; Flk-1; Krd-1; VEGFR2; VEGFR-2; sVEGFR-2; 6130401C07 |
20 ug |
348-Eur |
Reliatech |
|
| 101-M82 |
RANKL, soluble, Host: Mouse, Species: Anti-Human, Synonyms: TNFSF11; ODF; OPGL; sOdf; CD254; OPTB2; RANKL; TRANCE; hRANKL2 |
500 ug |
290-Eur |
Reliatech |
|
| CSB-EL009679BO |
Bovine glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) (GOT1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| 26-161 |
LYVE1 is a type I integral membrane glycoprotein. It acts as a receptor and binds to both soluble and immobilized hyaluronan. This protein may function in lymphatic hyaluronan transport and have a rol |
0.05 mg |
632-Eur |
Prosci |
recombinant |
| CSB-EL009679RB |
Rabbit glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) (GOT1) ELISA kit, Species Rabbit, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E13567h |
Human soluble lectin-like oxidized low density lipoprotein receptor-1(sLOX-1)ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-EL009679HO |
Horse glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) (GOT1) ELISA kit, Species Horse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-E08133h |
Human soluble platelet endothelial cell adhesion molecule 1,sPECAM-1 ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| CSB-EL023986HU |
Human soluble receptor activator of nuclear factor-kB ligand,sRANKL ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL017712HU |
Human Platelet-Derived Growth Factor Soluble Receptor α,PDGFsR-α ELISA kit, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| SNAP1-101AP |
PC-SNAP1 (WB control) Alfa soluble N-ethymaleimide sensitive factor attachment protein Immunogen: peptide (16mer) Host: Rabbit |
100-150ul |
221-Eur |
FGen |
|
| M1228 |
Octyl β-D-1-thioglucopyranoside, A non-ionic detergent for purification of soluble proteins from cells, including bacteria, and for solubilization and reconstitution of membrane proteins, 500mg |
|
103-Eur |
MarkerGene |
recombinant |
| CSB-E07996r |
Rat soluble E-selectin,sE-selectin ELISA Kit |
96T |
557-Eur |
Cusabio |
|
| CSB-E08106p |
Pig soluble P-selectin,sP-Selectin ELISA Kit |
96T |
594-Eur |
Cusabio |
|
| CK-E30415 |
Rat soluble P-selectin,sP-selectin ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| CK-E98517 |
Rat soluble E-selectin,sE-selectin ELISAkit |
|
----Eur |
Glory |
|
| A36272 |
Aurantia water soluble in 25% water |
5 G |
280-Eur |
pfalslandbauer. |
|
| CK-E30482 |
Rat soluble E-selectin,sE-selectin ELISA Kit |
96T |
454-Eur |
Eastbio |
|
| A36272 |
Aurantia water soluble in 25% water |
1 G |
128-Eur |
pfalslandbauer. |
|
| CK-E98450 |
Rat soluble P-selectin,sP-selectin ELISAkit |
|
----Eur |
Glory |
|
| PMP01 |
PURIFIED MOUSE IgG, Product Type Purified Protein, Specificity IgG, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
2 mg |
118-Eur |
AbD Serotec |
cat |
| PMP01X |
PURIFIED MOUSE IgG, Product Type Purified Protein, Specificity IgG, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
10 mg |
409-Eur |
AbD Serotec |
cat |
| SCH-PMP01X |
PURIFIED MOUSE IgG, Product Type Purified Protein, Specificity IgG, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
10 mg |
409-Eur |
Serotech |
cat |
| SCH-PEP001 |
PURIFIED HORSE IgG, Product Type Purified Protein, Specificity IgG, Target Species Horse, Host N_A, Format Purified, Isotypes , Applications E, ID, Clone |
10 mg |
296-Eur |
Serotech |
cat |
| OBT1036 |
PURIFIED RABBIT IgM, Product Type Purified Protein, Specificity IgM, Target Species Rabbit, Host N_A, Format Purified, Isotypes IgM, Applications E, Clone N_A |
1 mg |
385-Eur |
AbD Serotec |
polyclonal |
| SCH-PAP001 |
PURIFIED CHICKEN IgG, Product Type Purified Protein, Specificity IgG, Target Species Chicken, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
397-Eur |
Serotech |
cat |
| PEP001 |
PURIFIED HORSE IgG, Product Type Purified Protein, Specificity IgG, Target Species Horse, Host N_A, Format Purified, Isotypes , Applications E, ID, Clone |
10 mg |
266-Eur |
AbD Serotec |
cat |
| PCP001 |
PURIFIED GOAT IgG, Product Type Purified Protein, Specificity IgG, Target Species Goat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
243-Eur |
AbD Serotec |
polyclonal |
| SCH-PMP01 |
PURIFIED MOUSE IgG, Product Type Purified Protein, Specificity IgG, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
2 mg |
118-Eur |
Serotech |
cat |
| SCH-PCP001 |
PURIFIED GOAT IgG, Product Type Purified Protein, Specificity IgG, Target Species Goat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
266-Eur |
Serotech |
polyclonal |
| PAP001 |
PURIFIED CHICKEN IgG, Product Type Purified Protein, Specificity IgG, Target Species Chicken, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
397-Eur |
AbD Serotec |
cat |
| PSP01 |
PURIFIED SHEEP IgG, Product Type Purified Protein, Specificity IgG, Target Species Sheep, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
195-Eur |
AbD Serotec |
cat |
| SCH-OBT1036 |
PURIFIED RABBIT IgM, Product Type Purified Protein, Specificity IgM, Target Species Rabbit, Host N_A, Format Purified, Isotypes IgM, Applications E, Clone N_A |
1 mg |
385-Eur |
Serotech |
polyclonal |
| PBP002 |
PURIFIED BOVINE IgG, Product Type Purified Protein, Specificity IgG, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
266-Eur |
AbD Serotec |
cat |
| SCH-PBP002 |
PURIFIED BOVINE IgG, Product Type Purified Protein, Specificity IgG, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
266-Eur |
Serotech |
cat |
| SCH-PSP01 |
PURIFIED SHEEP IgG, Product Type Purified Protein, Specificity IgG, Target Species Sheep, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
195-Eur |
Serotech |
cat |
| AS08 372 |
Antibody: AtPex14p | peroxysomal marker, Immunogen: recombinant, soluble N-terminal domain of Arabidopsis thaliana Pex14p (Q9FE40) that mediates PEX5 and PEX19 binding. The transmembrane and coiled-co |
200 |
337-Eur |
Gentaur |
|
| OBT1524 |
HUMAN IgM PURIFIED IMMUNOGLOBULIN, Product Type Purified Protein, Specificity IgM, Target Species Human, Host N_A, Format Purified, Isotypes IgM, Applications E, Clone |
2 mg |
290-Eur |
AbD Serotec |
human |
| OBT1107 |
PURIFIED HAMSTER IgG, Product Type Purified Protein, Specificity IgG, Target Species Hamster, Host N_A, Format Purified, Isotypes Polyclonal IgG, Applications E, Clone |
10 mg |
350-Eur |
AbD Serotec |
polyclonal |
| SCH-PRABP01 |
PURIFIED RABBIT IgG, Product Type Purified Protein, Specificity IgG, Target Species Rabbit, Host N_A, Format Purified, Isotypes Polyclonal IgG, Applications E, Clone |
10 mg |
195-Eur |
Serotech |
polyclonal |
| PRABP01 |
PURIFIED RABBIT IgG, Product Type Purified Protein, Specificity IgG, Target Species Rabbit, Host N_A, Format Purified, Isotypes Polyclonal IgG, Applications E, Clone |
10 mg |
195-Eur |
AbD Serotec |
polyclonal |
| SCH-PHP133 |
PURIFIED HUMAN SECRETORY IgA, Product Type Purified Protein, Specificity IgA , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
361-Eur |
Serotech |
human |
| SCH-OBT1524 |
HUMAN IgM PURIFIED IMMUNOGLOBULIN, Product Type Purified Protein, Specificity IgM, Target Species Human, Host N_A, Format Purified, Isotypes IgM, Applications E, Clone |
2 mg |
290-Eur |
Serotech |
human |
| PHP133 |
PURIFIED HUMAN SECRETORY IgA, Product Type Purified Protein, Specificity IgA , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
361-Eur |
AbD Serotec |
human |
| SCH-OBT1107 |
PURIFIED HAMSTER IgG, Product Type Purified Protein, Specificity IgG, Target Species Hamster, Host N_A, Format Purified, Isotypes Polyclonal IgG, Applications E, Clone |
10 mg |
350-Eur |
Serotech |
polyclonal |
| PNb-0044 |
RANKL, soluble, Host: Nicotiana benthamiana, Species: Human, Synonyms: TNFSF11; ODF; OPGL; sOdf; CD254; OPTB2; RANKL; TRANCE; hRANKL4 |
50 ug |
394-Eur |
Reliatech |
|
| 26-093 |
Soluble guanylate cyclase (sGC), a heterodimeric protein consisting of an alpha subunit and a beta subunit, typically GUCY1B3, catalyzes conversion of GTP to the second messenger cGMP and functions as |
0.05 mg |
632-Eur |
Prosci |
cat |
| A91960Mu01-F |
FITC-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1) Clonality: Polyclonal Source: Rabbit ReactivityMus musculus (Mouse) Conjugate: FITC |
50ug |
450-Eur |
USCNLife |
|
| A91960Rb01-F |
FITC-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1) Clonality: Polyclonal Source: Guniea pig ReactivityOryctolagus cuniculus (Rabbit) Conjugate: FITC |
50ug |
460-Eur |
USCNLife |
|
| orb80431 |
Human Soluble IL-6 Receptor alpha protein sIL-6R Human Recombinant produced in E.coli is a single, non-glycosylated polypeptide chain containing 338 amino acids (20-357) corresponding to the mature IL |
5 |
154-Eur |
Biorb |
recombinant |
| orb80411 |
Human ST2 protein ST2 Human Recombinant produced in E.coli is a single, non-glycosylated, Polypeptide chain containing 310 amino acids fragment (19-328) corresponding to the soluble ST2 coding sequenc |
2 |
154-Eur |
Biorb |
recombinant |
| S01-036 |
TRAIL R-2_DR5, soluble Human Host: E. coli TNFRSF10B; DR5; CD262; KILLER; TRICK2; TRICKB; ZTNFR9; TRAILR2; TRICK2A; TRICK2B; TRAIL-R2; KILLER_DR5 |
50 |
232-Eur |
Reliatech |
|
| PNb-0043 |
RANKL, soluble, Host: Nicotiana benthamiana, Species: Human, Synonyms: TNFSF11; ODF; OPGL; sOdf; CD254; OPTB2; RANKL; TRANCE; hRANKL3 |
10 ug |
192-Eur |
Reliatech |
|
| 29-649 |
At present, eight distinct classes of the soluble cytoplasmic mammalian glutathione S-transferases have been identified alpha, kappa, mu, omega, pi, sigma, theta and zeta. GSTM2 is a glutathione S-tr |
0.05 mg |
632-Eur |
Prosci |
|
| SFC-015 |
FGFR-1_Fc Chimera, soluble Human Host: Insect cells FGFR1; CEK; FLG; OGD; FLT2; KAL2; BFGFR; CD331; FGFBR; FLT-2; HBGFR; N-SAM; FGFR-1; bFGF-R-1 |
10 |
88-Eur |
Reliatech |
|
| 103-PA19S |
VEGFR-2_Flk-1 (Peptide), soluble, Host: Rabbit, Species: Anti-Mouse, Synonyms: Kdr; Flk1; Ly73; Flk-1; Krd-1; VEGFR2; VEGFR-2; sVEGFR-2; 6130401C07 |
100 ug |
180-Eur |
Reliatech |
|
| 103-PA19 |
VEGFR-2_Flk-1 (Peptide), soluble, Host: Rabbit, Species: Anti-Mouse, Synonyms: Kdr; Flk1; Ly73; Flk-1; Krd-1; VEGFR2; VEGFR-2; sVEGFR-2; 6130401C07 |
200 ug |
270-Eur |
Reliatech |
|
| SFC-016 |
FGFR-1_Fc Chimera, soluble Human Host: Insect cells FGFR1; CEK; FLG; OGD; FLT2; KAL2; BFGFR; CD331; FGFBR; FLT-2; HBGFR; N-SAM; FGFR-1; bFGF-R-1 |
50 |
199-Eur |
Reliatech |
|
| 30-239 |
UGT1A4 is an enzyme of the glucuronidation pathway that transforms small lipophilic molecules, such as steroids, bilirubin, hormones, and drugs, into water-soluble, excretable metabolites. This enzyme |
0.05 mg |
632-Eur |
Prosci |
|
| CSB-EL013540MO |
Mouse mannose-binding lectin (protein C) 2, soluble (opsonic defect) (MBL2) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL023987HU |
Human soluble tumor necrosis factor-like weak inducer of apoptosis (sTWEAK)ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| CSB-E11885h |
Human soluble Vascular endothelial cell growth factor receptor 1,VEGFR-1 ELISA kit, Species Human, Sample Type serum, plasma |
96T |
688-Eur |
Cusabio |
elisa |
| 104-M01 |
Aminopeptidase P , Host: Mouse, Species: Anti-Rat, Synonyms: X-prolyl aminopeptidase (aminopeptidase P) 1, soluble |
100 ug |
251-Eur |
Reliatech |
|
| CSB-E13397h |
Human soluble human leucocyte antigen G1(sHLA-G) ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| orb80873 |
Mouse TIE-1 Fc Chimera protein Soluble TIE-1 Mouse Recombinant fused with the Fc part of human IgG1 produced in CHO is monomeric, glycosylated, polypeptide containing 749 amino acids and having total |
2 |
154-Eur |
Biorb |
recombinant |
| orb80875 |
Mouse TIE-2 Fc Chimera protein Soluble TIE-2 Mouse Recombinant fused with the Fc part of human IgG1 produced in CHO is monomeric, glycosylated, polypeptide containing 740 amino acids and having total |
2 |
154-Eur |
Biorb |
recombinant |
| orb80812 |
Human VEGF receptor-1 D1-5 protein Soluble FLT1 D1-5 Human Recombinant produced in baculovirus is monomeric, glycosylated, polypeptide containing 562 amino acids and having a molecular mass of 70 kDa. |
2 |
154-Eur |
Biorb |
recombinant |
| CSB-EL023985MO |
Mouse soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT, Species Mouse, Sample Type serum, plasma |
96T |
816-Eur |
Cusabio |
elisa |
| orb80573 |
Human Soluble CD4 protein sCD4 Human Recombinant produced in Baculovirus is a single, glycosylated polypeptide chain containing 365 amino acids and having non glycosilated molecular mass of 45 kDa. As |
2 |
154-Eur |
Biorb |
recombinant |
| A91960Bo01-F |
FITC-linked Antibody to Superoxide Dismutase 1, Soluble (SOD1) Clonality: Monoclonal Source: Mouse ReactivityBos taurus; Bovine (Cattle) Conjugate: FITC |
50ug |
380-Eur |
USCNLife |
|
| M10-054 |
CD40 Ligand_TRAP, soluble, Host: E. coli, Species: Mouse, Synonyms: Cd40lg; IGM; IMD3; Ly62; TRAP; gp39; CD154; Cd40l; HIGM1; Ly-62; T-BAM; CD40-L; Tnfsf5 |
25 ug |
232-Eur |
Reliatech |
|
| orb80577 |
Human soluble CD40 Ligand_TRAP His Tag protein sCD40 Human Recombinant produced in E.coli is a single, non-glycosylated, Polypeptide chain containing 149 amino acids fragment (113-261) corresponding t |
2 |
154-Eur |
Biorb |
recombinant |
| orb80811 |
Human VEGF receptor-1 D1-4 protein Soluble FLT1 D1-4 Human Recombinant produced in baculovirus is monomeric, glycosylated, polypeptide containing 457 amino acids and having a molecular mass of 55 kDa. |
2 |
154-Eur |
Biorb |
recombinant |
| orb80809 |
Human VEGF receptor-1 D1-3 protein Soluble FLT1 D1-3 Human Recombinant produced in baculovirus is monomeric, glycosylated, polypeptide containing 352 amino acids and having a molecular mass of 45 kDa. |
2 |
154-Eur |
Biorb |
recombinant |
| CSB-EL023985HU |
Human soluble tumor necrosis factor-related apoptosis inducing ligand,sTRAIL ELISA KIT, Species Human, Sample Type serum, plasma |
96T |
714-Eur |
Cusabio |
elisa |
| S01-021 |
BMP receptor-1A, soluble, Host: Insect cells, Species: Human, Synonyms: ALK3; SKR5; CD292; ACVRLK3; 10q23del, bone morphogenetic protein receptor, type IA |
100 ug |
238-Eur |
Reliatech |
|
| orb60723 |
Vitamin B12 Vitamin b12 is a water soluble vitamin with a key role in the normal functioning of the brain and nervous system, and for the formation of blood. For research use only. |
10 mg |
203-Eur |
Biorb |
|
| S01-036 |
TRAIL R-2_DR5, soluble, Host: E. coli, Species: Human, Synonyms: TNFRSF10B; DR5; CD262; KILLER; TRICK2; TRICKB; ZTNFR9; TRAILR2; TRICK2A; TRICK2B; TRAIL-R2; KILLER_DR5 |
50 ug |
232-Eur |
Reliatech |
|
| SMCC15-N-50 |
Sulfo-SMCC (Sulfosuccinimidyl-trans-4-(N-maleimidomethyl)cyclohexane-1-carboxylate) (water soluble linker to couple cysteine-containing proteins and peptides to carrier proteins) Species Reactivity: |
50 mg Product tipe: |
186-Eur |
ADI |
|
| orb80630 |
Human TRAIL (114-281) protein Soluble TNF-related apoptosis-inducing ligand Human Recombinant produced in E.coli is a single, non-glycosylated polypeptide chain containing 169 amino acids (114-281) an |
10 |
154-Eur |
Biorb |
recombinant |
| orb80815 |
Human VEGF receptor-3 protein Soluble FLT4 Human Recombinant fused with carboxy-terminal 6X histidine-tag produced in baculovirus is monomeric, glycosylated, polypeptide containing the extracellular p |
2 |
154-Eur |
Biorb |
recombinant |
| orb80808 |
Human VEGF receptor-1 protein Soluble FLT1 Human Recombinant produced in baculovirus is monomeric, glycosylated, polypeptide containing 688 amino acids and having a molecular mass of 96 kDa. The solub |
2 |
154-Eur |
Biorb |
elisa |
| orb80829 |
Human Lymphatic Endothelial Hyluronan Receptor-1 protein Soluble LYVE1 Human Recombinant fused to GST-tag produced in E.coli is a single, non-glycosylated, polypeptide containing 243-323 amino acids a |
2 |
277-Eur |
Biorb |
recombinant |
| 31-085 |
Secreted frizzled-related protein 1 (SFRP1) is a member of the SFRP family that contains a cysteine-rich domain homologous to the putative Wnt-binding site of Frizzled proteins. SFRPs act as soluble m |
0.1 mg |
496-Eur |
Prosci |
human |
| SFC-015 |
FGFR-1_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FGFR1; CEK; FLG; OGD; FLT2; KAL2; BFGFR; CD331; FGFBR; FLT-2; HBGFR; N-SAM; FGFR-1; bFGF-R-1 |
10 ug |
88-Eur |
Reliatech |
|
| SFC-016 |
FGFR-1_Fc Chimera, soluble, Host: Insect cells, Species: Human, Synonyms: FGFR1; CEK; FLG; OGD; FLT2; KAL2; BFGFR; CD331; FGFBR; FLT-2; HBGFR; N-SAM; FGFR-1; bFGF-R-1 |
50 ug |
199-Eur |
Reliatech |
|
| orb80417 |
Human Soluble IIL2 Receptor alpha protein IL2R Human Recombinant produced in E.coli is a single, non-glycosylated polypeptide chain containing 192 amino acids (223-798) corresponding to the mature IL2 |
5 |
154-Eur |
Biorb |
recombinant |
| orb80099 |
Human soluble CD40 Ligand_TRAP protein sCD40 Human Recombinant produced in E.coli is non-glycosylated, Polypeptide chain containing 149 amino acids and having a molecular mass of 16308 Dalton. The sCD |
10 |
154-Eur |
Biorb |
recombinant |
| orb80578 |
Mouse soluble CD40 Ligand_TRAP protein sCD40 Mouse Recombinant produced in E.coli is non-glycosylated, Polypeptide chain containing 149 amino acids and having a molecular mass of 16409 Dalton. The sCD |
5 |
154-Eur |
Biorb |
recombinant |
| orb80629 |
Human TRAIL protein Soluble TNF-related apoptosis-inducing ligand Human Recombinant produced in E.coli is a single, non-glycosylated polypeptide chain containing 168 amino acids and having a molecular |
10 |
154-Eur |
Biorb |
recombinant |
| 104-M01 |
Aminopeptidase P Anti-Rat Host: Mouse X-prolyl aminopeptidase (aminopeptidase P) 1, soluble; |
100 |
251-Eur |
Reliatech |
|
| 29-692 |
RBP1 is the carrier protein involved in the transport of retinol (vitamin A alcohol) from the liver storage site to peripheral tissue. Vitamin A is a fat-soluble vitamin necessary for growth, reproduc |
0.1 mg |
496-Eur |
Prosci |
tissue |
| orb80872 |
Human TIE-1 Fc Chimera protein Soluble TIE-1 Human Recombinant fused with the Fc part of human IgG1 produced in baculovirus is homodimeric, glycosylated, polypeptide containing 749 amino acids and hav |
2 |
154-Eur |
Biorb |
recombinant |
| CSB-PA021272GA01HU |
Rabbit anti-human serine hydroxymethyltransferase 1 (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA022397GA01HU |
Rabbit anti-human superoxide dismutase 1, soluble polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA023577GA01HU |
Rabbit anti-human thymidine kinase 1, soluble polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA013621GA01HU |
Rabbit anti-human malate dehydrogenase 1, NAD (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA017613GA01HU |
Rabbit anti-human phosphoenolpyruvate carboxykinase 1 (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| EIAAB42303 |
Endo-oligopeptidase A,Endopeptidase 24.15,PZ-peptidase,Rat,Rattus norvegicus,Soluble metallo-endopeptidase,Thimet oligopeptidase,Thop1 |
|
1191-Eur |
EIAab |
|
| CSB-PA022397GA01HU |
Rabbit anti-human superoxide dismutase 1, soluble polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA021272GA01HU |
Rabbit anti-human serine hydroxymethyltransferase 1 (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| orb60965 |
Pantothenic acid Pantothenic acid(pantothenate) is a water-soluble vitamin and an essential nutrient for for many animals. For research use only. |
10 mg |
437-Eur |
Biorb |
|
| CSB-PA013621GA01HU |
Rabbit anti-human malate dehydrogenase 1, NAD (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA017613GA01HU |
Rabbit anti-human phosphoenolpyruvate carboxykinase 1 (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA023577GA01HU |
Rabbit anti-human thymidine kinase 1, soluble polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-EL020643RB |
rabbit Soluble protein-100B,S-100B ELISA Kit, Species Rabbit, Sample Type serum, plasma |
96T |
981-Eur |
Cusabio |
elisa |
| CSB-EL020643HU |
Human Soluble protein-100B,S-100B ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
959-Eur |
Cusabio |
elisa |
| CSB-PA012889GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 4 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-EL026218BO |
Bovine X-prolyl aminopeptidase (aminopeptidase P) 1, soluble (XPNPEP1) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-PA012886GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 2 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA012895GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 9 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA010989GA01HU |
Rabbit anti-human isocitrate dehydrogenase 1 (NADP+), soluble polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA010052GA01HU |
Rabbit anti-human guanylate cyclase 1, soluble, beta 3 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA012882GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 1 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA010050GA01HU |
Rabbit anti-human guanylate cyclase 1, soluble, alpha 3 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA012892GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 7 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA012889GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 4 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA012892GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 7 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-EL026218MO |
Mouse X-prolyl aminopeptidase (aminopeptidase P) 1, soluble (XPNPEP1) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-PA012886GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 2 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA009709GA01HU |
Rabbit anti-human glycerol-3-phosphate dehydrogenase 1 (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-PA010052GA01HU |
Rabbit anti-human guanylate cyclase 1, soluble, beta 3 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA010050GA01HU |
Rabbit anti-human guanylate cyclase 1, soluble, alpha 3 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA009709GA01HU |
Rabbit anti-human glycerol-3-phosphate dehydrogenase 1 (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA012895GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 9 polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA010989GA01HU |
Rabbit anti-human isocitrate dehydrogenase 1 (NADP+), soluble polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA012882GA01HU |
Rabbit anti-human lectin, galactoside-binding, soluble, 1 polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-EL026218HU |
Human X-prolyl aminopeptidase (aminopeptidase P) 1, soluble (XPNPEP1) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-PA001161GA01HU |
Rabbit anti-human aconitase 1, soluble polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-E08074h |
Human soluble P-selectin,sP-selectin ELISA Kit, Species Human, Sample Type serum, plasma |
96T |
688-Eur |
Cusabio |
elisa |
| CSB-E06861Rb |
rabbit soluble P-selectin,sP-selectin ELISA Kit, Species rabbit, Sample Type serum, plasma |
96T |
779-Eur |
Cusabio |
elisa |
| CSB-E06941Rb |
rabbit soluble E-selectin,sE-selectin ELISA Kit, Species rabbit, Sample Type serum, plasma |
96T |
779-Eur |
Cusabio |
elisa |
| CSB-E09869Ch |
Chicken soluble E-selectin,sE-selectin ELISA Kit, Species Chicken, Sample Type serum, plasma |
96T |
688-Eur |
Cusabio |
elisa |
| QY-E05281 |
Human Lectin, Galactoside-Binding Soluble 1(LGALS1)ELISA Kit=Human Galectin 1(GAL1)ELISA Kit |
96T |
580-Eur |
SQBIO |
|
| CSB-PA001161GA01HU |
Rabbit anti-human aconitase 1, soluble polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| orb60652 |
Niacin Niacin(Nicotinic acid) is a water-soluble vitamin belonging to the vitamin B family. For research use only. |
10 mg |
226-Eur |
Biorb |
|
| CSB-PA010566GA01HU |
Rabbit anti-human 3-hydroxy-3-methylglutaryl-Coenzyme A synthase 1 (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| CSB-PA010566GA01HU |
Rabbit anti-human 3-hydroxy-3-methylglutaryl-Coenzyme A synthase 1 (soluble) polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| orb80585 |
Mouse Soluble RANK Ligand protein sRANKL Mouse Recombinant produced in E.coli is a single, non-glycosylated, polypeptide chain containing 174 amino acids and having total molecular mass of 19.9kDa.CD2 |
2 |
154-Eur |
Biorb |
recombinant |
| 103-PA18 |
VEGFR-2_Flk-1, soluble, Host: Rabbit, Species: Anti-Mouse, Synonyms: Flk1; Ly73; Flk-1; Krd-1; VEGFR2; VEGFR-2; sVEGFR-2; 6130401C07; kinase insert domain protein receptor |
200 ug |
270-Eur |
Reliatech |
|
| 103-PA18S |
VEGFR-2_Flk-1, soluble, Host: Rabbit, Species: Anti-Mouse, Synonyms: Flk1; Ly73; Flk-1; Krd-1; VEGFR2; VEGFR-2; sVEGFR-2; 6130401C07; kinase insert domain protein receptor |
100 ug |
180-Eur |
Reliatech |
|
| orb80583 |
Human Soluble RANK Ligand protein sRANKL Human Recombinant produced in E.coli is a single, non-glycosylated polypeptide chain containing 176 amino acids and having a molecular mass of 20006 Dalton. CD |
2 |
154-Eur |
Biorb |
recombinant |
| orb80831 |
Human Lymphatic Vessel Endothelial Hyaluronic Acid Receptor 1 Sf9 protein Soluble LYVE1 Human Recombinant fused to C-terminal His-tag (6xHis) produced in baculovirus is monomeric, glycosylated, polype |
2 |
154-Eur |
Biorb |
recombinant |
| AS07 235 |
Antibody: Toc34 | chloroplast outer envelope membrane translocon complex protein, Immunogen: soluble domain of Pisum sativum Toc34 overexpressed in E.coli and purifiedby His-tag affinity purification. |
50 |
337-Eur |
Gentaur |
|
| orb80832 |
Mouse Lymphatic Vessel Endothelial Hyaluronic Acid Receptor 1 Sf9 protein Soluble LYVE1 Mouse Recombinant fused to C-terminal His-tag (6xHis) produced in baculovirus is monomeric, glycosylated, polype |
2 |
154-Eur |
Biorb |
recombinant |
| orb80874 |
Human TIE-2 Fc Chimera protein Soluble TIE-2 Human Recombinant fused with the Fc part of human IgG1 produced in baculovirus is monomeric, glycosylated, polypeptide containing 730 amino acids and havin |
2 |
154-Eur |
Biorb |
recombinant |
| orb60721 |
Nicotinamide Nicotinamide(Niacinamide) is a water-soluble vitamin and is part of the vitamin B group. For research use only. |
10 mg |
226-Eur |
Biorb |
|
| CSB-PA009679GA01HU |
Rabbit anti-human glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) polyclonal Antibody Primary antibody Host:Rabbit IgG |
50ul |
425-Eur |
Cusabio |
|
| HNS45-R |
Recombinant (E. coli) Hepatitis C Virus (HCV) NS4 protein, fragments of the NS4 immunodominant region derived from 11 Hepatitis C Virus (HCV) genotypes, (soluble) Species Reactivity: |
100 ug Product tipe: Recomb. Protein |
264-Eur |
ADI |
|
| CSB-PA009679GA01HU |
Rabbit anti-human glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1) polyclonal Antibody Primary antibody Host:Rabbit IgG |
150ul |
749-Eur |
Cusabio |
|
| CSB-EL012888BO |
Bovine lectin, galactoside-binding, soluble, 3 binding protein (LGALS3BP) ELISA kit, Species Bovine, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| HCV21-R |
Recombinant (E. coli, his-tag) Hepatitis C Virus (Hepatitis C Virus (HCV)) core protein Mosaic (nucleocapsid immunodominant regions) (soluble) Species Reactivity: HCV |
100 ug Product tipe: Recomb. Protein |
303-Eur |
ADI |
|
| HCV36-R |
Recombiant (E. coli) Hepatitis C Virus (Hepatitis C Virus (HCV)) Antigens-GST fusion protein (mosaic of several antigenic epitopes) (soluble) Species Reactivity: HCV |
100 ug Product tipe: Recomb. Protein |
303-Eur |
ADI |
|
| S01-042 |
CD30 Ligand, soluble Human Host: CHO cells TNFSF8, CD153, CD30L; TNFSF8 tumor necrosis factor (ligand) superfamily, member 8 |
50 |
232-Eur |
Reliatech |
|
| CSB-EL012888MO |
Mouse lectin, galactoside-binding, soluble, 3 binding protein (LGALS3BP) ELISA kit, Species Mouse, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| CSB-EL012888HU |
Human lectin, galactoside-binding, soluble, 3 binding protein (LGALS3BP) ELISA kit, Species Human, Sample Type serum, plasma |
96T |
913-Eur |
Cusabio |
elisa |
| orb80813 |
Human VEGF receptor-1 D1-7 protein Soluble FLT1 Human Recombinant fused with the Fc part of human IgG1 produced in baculovirus is disulfide-linked homodimeric, glycosylated, polypeptide containing 751 |
2 |
154-Eur |
Biorb |
recombinant |
| 26-317 |
Cytosolic and membrane-bound forms of glutathione S-transferase are encoded by two distinct supergene families. At present, eight distinct classes of the soluble cytoplasmic mammalian glutathione S-tr |
0.05 mg |
632-Eur |
Prosci |
|
| 29-642 |
Cytosolic and membrane-bound forms of glutathione S-transferase are two distinct supergene families. At present, eight distinct classes of the soluble cytoplasmic mammalian glutathione S-transferases |
0.05 mg |
632-Eur |
Prosci |
|
| 30-882 |
Cytosolic and membrane-bound forms of glutathione S-transferase are encoded by two distinct supergene families. At present, eight distinct classes of the soluble cytoplasmic mammalian glutathione S-tr |
0.05 mg |
632-Eur |
Prosci |
|
| SNAP1-101AP |
P-SNAP1 (Antigenic peptide) Alfa soluble N-ethymaleimide sensitive factor attachment protein Immunogen: peptide (16mer) Host: Rabbit |
100ul |
180-Eur |
FGen |
|
| 25-595 |
ATP5G2 is a subunit of mitochondrial ATP synthase. ATP synthase is composed of two linked multi-subunit complexes the soluble catalytic core, F1, and the membrane-spanning component, F0, comprising t |
0.05 mg |
632-Eur |
Prosci |
cat |
| PHP144 |
PURIFIED HUMAN PROLACTIN, Product Type Purified Protein, Specificity PROLACTIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
0.1 mg |
628-Eur |
AbD Serotec |
human |
| SCH-PHP144 |
PURIFIED HUMAN PROLACTIN, Product Type Purified Protein, Specificity PROLACTIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
0.1 mg |
628-Eur |
Serotech |
human |
| SCH-PBP003 |
PURIFIED BOVINE IgG1, Product Type Purified Protein, Specificity IgG1, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
373-Eur |
Serotech |
cat |
| PBP003 |
PURIFIED BOVINE IgG1, Product Type Purified Protein, Specificity IgG1, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
338-Eur |
AbD Serotec |
cat |
| SCH-PHP156 |
PURIFIED HUMAN MYOGLOBIN, Product Type Purified Protein, Specificity MYOGLOBIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
290-Eur |
Serotech |
human |
| PHP156 |
PURIFIED HUMAN MYOGLOBIN, Product Type Purified Protein, Specificity MYOGLOBIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
290-Eur |
AbD Serotec |
human |
| SCH-PBP004 |
PURIFIED BOVINE IgG2, Product Type Purified Protein, Specificity IgG2, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
373-Eur |
Serotech |
cat |
| PBP004 |
PURIFIED BOVINE IgG2, Product Type Purified Protein, Specificity IgG2, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
338-Eur |
AbD Serotec |
cat |
| GB9518 |
Influenza B Soluble Antigen (B_Lee_40 Strain)MDCK Cells MDCK Cells |
1mL |
700-Eur |
Meridian Life Science |
|
| SL10033E |
Human ELISpot Kits Human Interleukin-2 Soluble Receptor alpha (IL-2 sRα) ELISpot Kit |
96 wells |
666-Eur |
Anogen |
|
| PHP149 |
PURIFIED HUMAN ALBUMIN, Product Type Purified Protein, Specificity SERUM ALBUMIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
160-Eur |
AbD Serotec |
human |
| SCH-PHP149 |
PURIFIED HUMAN ALBUMIN, Product Type Purified Protein, Specificity SERUM ALBUMIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
160-Eur |
Serotech |
human |
| E2096h |
ELISA Gal-13,Galactoside-binding soluble lectin 13,Galectin-13,Homo sapiens,Human,LGALS13,PLAC8,Placental protein 13,Placental tissue protein 13,PP13 |
96T |
788-Eur |
EIAab |
|
| 26-441 |
EDAR is a member of the tumor necrosis factor receptor family. It is a receptor for the soluble ligand ectodysplasin A, and can activate the nuclear factor-kappaB, JNK, and caspase-independent cell de |
0.05 mg |
632-Eur |
Prosci |
recombinant |
| E2096h |
ELISA kit Gal-13,Galactoside-binding soluble lectin 13,Galectin-13,Homo sapiens,Human,LGALS13,PLAC8,Placental protein 13,Placental tissue protein 13,PP13 |
96T |
858-Eur |
EIAab |
|
| SNAP1-101AP |
SNAP1-Biotin (Biotin Conjugates) Alfa soluble N-ethymaleimide sensitive factor attachment protein Immunogen: peptide (16mer) Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| S01-042 |
CD30 ligand, soluble, Host: CHO cells, Species: Human, Synonyms: TNFSF8, CD153, CD30L; TNFSF8 tumor necrosis factor (ligand) superfamily, member 8 |
50 ug |
232-Eur |
Reliatech |
|
| U2096h |
CLIA kit Gal-13,Galactoside-binding soluble lectin 13,Galectin-13,Homo sapiens,Human,LGALS13,PLAC8,Placental protein 13,Placental tissue protein 13,PP13 |
96T |
858-Eur |
EIAab |
|
| U2096h |
CLIA Gal-13,Galactoside-binding soluble lectin 13,Galectin-13,Homo sapiens,Human,LGALS13,PLAC8,Placental protein 13,Placental tissue protein 13,PP13 |
96T |
788-Eur |
EIAab |
|
| SNAP1-101AP |
SNAP1-FITC (FITC-conjugates) Alfa soluble N-ethymaleimide sensitive factor attachment protein Immunogen: peptide (16mer) Host: Rabbit |
200ul |
414-Eur |
FGen |
|
| 28-068 |
ENO1 is one of three enolase isoenzymes found in mammals; it encodes alpha-enolase, a homodimeric soluble enzyme, and also encodes a shorter monomeric structural lens protein, tau-crystallin. The two |
0.1 mg |
496-Eur |
Prosci |
human |
| orb80805 |
Human FGFR3 protein Soluble FGFR-3a (IIIc) Fc Chimera Human Recombinant fused with Xa cleavage site with the Fc part of human IgG1 produced in baculovirus is heterodimeric, glycosylated, Polypeptide c |
2 |
154-Eur |
Biorb |
recombinant |
| orb80816 |
Human VEGF receptor-3 Fc Chimera protein Soluble FLT4 Human Recombinant fused with the Fc part of human IgG1 produced in baculovirus is monomeric, glycosylated, polypeptide containing 774 amino acids |
2 |
154-Eur |
Biorb |
recombinant |
| orb80878 |
Human VEGF receptor-2 Fc Chimera protein Soluble VEGFR-2 Fc Human Recombinant fused with the Fc part of human IgG1 produced in baculovirus is disulfide-linked homodimeric, glycosylated, polypeptide co |
2 |
154-Eur |
Biorb |
recombinant |
| orb80803 |
Human FGFR1 protein Soluble FGFR-1a (IIIc) Fc Chimera Human Recombinant fused with Xa cleavage site with the Fc part of human IgG1 produced in baculovirus is heterodimeric, glycosylated, Polypeptide c |
2 |
154-Eur |
Biorb |
recombinant |
| orb80806 |
Human FGFR4 protein Soluble FGFR-4a (IIIc) Fc Chimera Human Recombinant fused with Xa cleavage site with the Fc part of human IgG1 produced in baculovirus is heterodimeric, glycosylated, Polypeptide c |
2 |
154-Eur |
Biorb |
recombinant |
| orb80804 |
Human FGFR2 protein Soluble FGFR-2a (IIIc) Fc Chimera Human Recombinant fused with Xa cleavage site with the Fc part of human IgG1 produced in baculovirus is heterodimeric, glycosylated, Polypeptide c |
2 |
154-Eur |
Biorb |
recombinant |
| orb80570 |
Rat Prolactin Soluble Receptor protein Prolactin Receptor Rat Extra Celleular Domain Recombinant produced in E.coli is non-glycosylated, Polypeptide chain containing 206 amino acids and having a molec |
10 |
154-Eur |
Biorb |
recombinant |
| orb80628 |
Mouse Thrombopoietin protein Thrombopoietin Mouse Recombinant produced in E.coli is a single, non-glycosylated soluble polypeptide chain containing 174 amino acids and having a molecular mass of 18704 |
2 |
154-Eur |
Biorb |
recombinant |
| orb80114 |
Human Thrombopoietin protein Thrombopoietin Human Recombinant produced in E.coli is a single, non-glycosylated soluble polypeptide chain containing 174 amino acids and having a molecular mass of 18608 |
2 |
154-Eur |
Biorb |
recombinant |
| 28-773 |
ENO1 is one of three enolase isoenzymes found in mammals; its gene encodes alpha-enolase, a homodimeric soluble enzyme, and also encodes a shorter monomeric structural lens protein, tau-crystallin. Th |
0.1 mg |
496-Eur |
Prosci |
human |
| EIAAB46563 |
Aminoacylproline aminopeptidase,Cytosolic aminopeptidase P,Homo sapiens,Human,sAmp,Soluble aminopeptidase P,Xaa-Pro aminopeptidase 1,XPNPEP1,XPNPEPL,XPNPEPL1,X-Pro aminopeptidase 1,X-prolyl aminopepti |
|
1109-Eur |
EIAab |
|
| orb80827 |
Human Jun N-terminal kinase 2, alpha 2 protein JNK2 is soluble 51 kDa protein (amino acids 2-424) that is activated in response to cellular stress, radiation and growth factors. JNK2 binds to the amin |
2 |
154-Eur |
Biorb |
human |
| EIAAB38987 |
Bos taurus,Bovine,SNAP29,SNAP-29,Soluble 29 kDa NSF attachment protein,Synaptosomal-associated protein 29,Vesicle-membrane fusion protein SNAP-29 |
|
1333-Eur |
EIAab |
|
| EIAAB26982 |
Endopeptidase 24.16,MEP,Microsomal endopeptidase,Mitochondrial oligopeptidase M,Neurolysin, mitochondrial,Neurotensin endopeptidase,NLN,Pig,SABP,Soluble angiotensin-binding protein,Sus scrofa |
|
1333-Eur |
EIAab |
|
| EIAAB38989 |
Homo sapiens,Human,SNAP29,SNAP-29,Soluble 29 kDa NSF attachment protein,Synaptosomal-associated protein 29,Vesicle-membrane fusion protein SNAP-29 |
|
1109-Eur |
EIAab |
|
| orb22197 |
Human IgG, Extra Purified Extra purified human IgG. Purified human IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immuno |
100 mg |
539-Eur |
Biorb |
elisa |
| SCH-0200-0473 |
PURIFIED MOUSE MONOCLONAL IgG1, Product Type Purified Protein, Specificity IgG1, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG1, Applications E, Clone |
0.2 mg |
207-Eur |
Serotech |
monoclonal |
| 0200-0473 |
PURIFIED MOUSE MONOCLONAL IgG1, Product Type Purified Protein, Specificity IgG1, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG1, Applications E, Clone |
0.2 mg |
207-Eur |
AbD Serotec |
monoclonal |
| 31-235 |
MBP-1 encodes one of three enolase isoenzymes found in mammals; it encodes alpha-enolase, a homodimeric soluble enzyme, and also encodes a shorter monomeric structural lens protein, tau-crystallin. Th |
0.05 mg |
632-Eur |
Prosci |
human |
| EIAAB38988 |
Golgi SNARE of 32 kDa,Gs32,Mouse,Mus musculus,Snap29,SNAP-29,Soluble 29 kDa NSF attachment protein,Synaptosomal-associated protein 29,Vesicle-membrane fusion protein SNAP-29 |
|
1164-Eur |
EIAab |
|
| EIAAB38986 |
Golgi SNARE of 32 kDa,Gs32,Rat,Rattus norvegicus,Snap29,SNAP-29,Soluble 29 kDa NSF attachment protein,Synaptosomal-associated protein 29,Vesicle-membrane fusion protein SNAP-29 |
|
1191-Eur |
EIAab |
|
| orb60614 |
Testosterone cypionate Testosterone cypionate is the oil-soluble 17 (beta)-cyclopentylpropionate ester of the androgenic hormone testosterone. For research use only. |
10 mg |
583-Eur |
Biorb |
assays |
| EIAAB46562 |
Aminoacylproline aminopeptidase,App,Cytosolic aminopeptidase P,Rat,Rattus norvegicus,sAmp,Soluble aminopeptidase P,Xaa-Pro aminopeptidase 1,Xpnpep1,X-Pro aminopeptidase 1,X-prolyl aminopeptidase 1, so |
|
1191-Eur |
EIAab |
|
| 10-663-45158 |
Soluble TNF Receptor Inhibitor_Fc chimera (TNFRSF1A) Human - Receptor activator of nuclear factor kappa B ligand; RANKL; TNF-related activation-induced cytokine; TRANCE; Osteoprotegerin ligand; OPGL; |
0.05 mg |
530-Eur |
GenWay |
recombinant |
| 10-663-45158 |
Soluble TNF Receptor Inhibitor_Fc chimera (TNFRSF1A) Human - Receptor activator of nuclear factor kappa B ligand; RANKL; TNF-related activation-induced cytokine; TRANCE; Osteoprotegerin ligand; OPGL; |
1 mg |
7259-Eur |
GenWay |
recombinant |
| 10-663-45158 |
Soluble TNF Receptor Inhibitor_Fc chimera (TNFRSF1A) Human - Receptor activator of nuclear factor kappa B ligand; RANKL; TNF-related activation-induced cytokine; TRANCE; Osteoprotegerin ligand; OPGL; |
0.01 mg |
270-Eur |
GenWay |
recombinant |
| 100-117 |
RANK Receptor, soluble Human Host: E. coli tumor necrosis factor receptor superfamily, member 11a, NFKappa-B activator; FEO; OFE; ODFR; OSTS; PDB2; RANK; CD265; OPTB7; TRANCER; LOH18CR1 |
100 |
232-Eur |
Reliatech |
|
| orb80617 |
Human 4-1BB Receptor protein 4-1BB Soluble Receptor Recombinant Human also called TNF receptor superfamily member produced in E.coli is a single, non-glycosylated polypeptide chain containing 167 amin |
5 |
154-Eur |
Biorb |
recombinant |
| 28-069 |
ENO1 encodes one of three enolase isoenzymes found in mammals; it encodes alpha-enolase, a homodimeric soluble enzyme, and also encodes a shorter monomeric structural lens protein, tau-crystallin. The |
0.05 mg |
632-Eur |
Prosci |
human |
| 25-718 |
Albumin is a soluble, monomeric protein which comprises about one-half of the blood serum protein. Albumin functions primarily as a carrier protein for steroids, fatty acids, and thyroid hormones and |
0.05 mg |
632-Eur |
Prosci |
|
| 25-717 |
Albumin is a soluble, monomeric protein which comprises about one-half of the blood serum protein. Albumin functions primarily as a carrier protein for steroids, fatty acids, and thyroid hormones and |
0.05 mg |
632-Eur |
Prosci |
|
| PHP135 |
PURIFIED HUMAN BETA 2 MICROGLOBULIN, Product Type Purified Protein, Specificity BETA 2 MICROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, WB, Clone |
1 mg |
361-Eur |
AbD Serotec |
human |
| SCH-PHP135 |
PURIFIED HUMAN BETA 2 MICROGLOBULIN, Product Type Purified Protein, Specificity BETA 2 MICROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, WB, Clone |
1 mg |
361-Eur |
Serotech |
human |
| SCH-PHP157G |
PURIFIED HUMAN PLACENTAL LACTOGEN, Product Type Purified Protein, Specificity PLACENTAL LACTOGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
480-Eur |
Serotech |
human |
| PHP157G |
PURIFIED HUMAN PLACENTAL LACTOGEN, Product Type Purified Protein, Specificity PLACENTAL LACTOGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
480-Eur |
AbD Serotec |
human |
| SCH-PHP152 |
PURIFIED HUMAN ALPHA FETOPROTEIN, Product Type Purified Protein, Specificity ALPHA FETOPROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
919-Eur |
Serotech |
human |
| PHP152 |
PURIFIED HUMAN ALPHA FETOPROTEIN, Product Type Purified Protein, Specificity ALPHA FETOPROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
919-Eur |
AbD Serotec |
human |
| 29-587 |
FN1 is a glycoprotein present in a soluble dimeric form in plasma, and in a dimeric or multimeric form at the cell surface and in extracellular matrix. Fibronectin is involved in cell adhesion and mig |
0.05 mg |
632-Eur |
Prosci |
|
| CLRS1011 |
Collagen, Standard, Sircol™ Collagen Rat Standard, tail acid soluble collagen, 0.5mg_ml. |
set |
474-Eur |
Accurate |
rat |
| orb80566 |
Rabbit Prolactin Soluble Receptor protein Prolactin Receptor Rabbit Extra Celleular Domain Recombinant produced in E.coli is non-glycosylated, Polypeptide chain containing 207 amino acids and having a |
10 |
154-Eur |
Biorb |
recombinant |
| orb80568 |
Bovine Prolactin Soluble Receptor protein Prolactin Receptor Bovine Extra Celleular Domain Recombinant produced in E.coli is non-glycosylated, Polypeptide chain containing 213 amino acids and having a |
10 |
154-Eur |
Biorb |
recombinant |
| orb80567 |
Ovine Prolactin Soluble Receptor protein Prolactin Receptor Ovine Extra Celleular Domain Recombinant produced in E.coli is non-glycosylated, Polypeptide chain containing 213 amino acids and having a m |
10 |
154-Eur |
Biorb |
recombinant |
| 45-001 |
ADAM12 Antibody. This antibody is expected to recognize both the longer membrane-bound form of human ADAM12 (NP_003465) and the shorter soluble ADAM12 splice isoform (NP_067673). This antibody does no |
0.1 mg |
482-Eur |
Prosci |
recombinant |
| orb80826 |
Human Jun N-terminal kinase 2, alpha 1 protein JNK2 is soluble 48 kDa protein that is activated in response to cellular stress, radiation and growth factors. JNK2 binds to the amino terminal activatio |
2 |
154-Eur |
Biorb |
human |
| SMUPAR-HIS |
MOUSE UPAR Soluble Mouse uPAR, His-tagged |
0.1 mg |
592-Eur |
Molecular Innovations |
|
| SMUPAR-HIS |
MOUSE UPAR Soluble Mouse uPAR, His-tagged |
1.0 mg |
4371-Eur |
Molecular Innovations |
|
| 100-19 |
Proteins: Human soluble RANK Ligand; RANK Ligand |
2ug |
108-Eur |
Shenandoah Biotechnology, Inc. |
|
| 100-19 |
Proteins: Human soluble RANK Ligand; RANK Ligand |
10ug |
196-Eur |
Shenandoah Biotechnology, Inc. |
|
| 200-04 |
Proteins: Mouse soluble RANK Ligand; RANK Ligand |
2ug |
108-Eur |
Shenandoah Biotechnology, Inc. |
|
| XPNPEP1 |
XPNPEP1 Gene X-prolyl aminopeptidase (aminopeptidase P) 1, soluble |
|
----Eur |
Transposagen |
|
| EIAAB05276 |
Apyrase homolog,CANT1,Homo sapiens,Human,Putative MAPK-activating protein PM09,Putative NF-kappa-B-activating protein 107,SCAN-1,SHAPY,Soluble calcium-activated nucleotidase 1 |
|
1109-Eur |
EIAab |
|
| 10-663-45114 |
Soluble CD40 (CD154) Ligand_TRAP Human - CD40-L; Tumor necrosis factor ligand superfamily member 5; TNF-related activation protein; TRAP; T cell antigen Gp39; CD154 antigen N_A |
0.05 mg |
352-Eur |
GenWay |
human |
| 10-663-45114 |
Soluble CD40 (CD154) Ligand_TRAP Human - CD40-L; Tumor necrosis factor ligand superfamily member 5; TNF-related activation protein; TRAP; T cell antigen Gp39; CD154 antigen N_A |
1 mg |
3301-Eur |
GenWay |
human |
| orb80569 |
Raibow Trout Prolactin Soluble Receptor protein Prolactin Receptor Rainbow Trout Extra Celleular Domain Recombinant produced in E.coli is non-glycosylated, Polypeptide chain containing 210 amino acids |
10 |
154-Eur |
Biorb |
recombinant |
| 10-663-45156 |
Soluble B Lymphocyte Stimulator (BAFF_BLyS) Human - TNF- and APOL-related leukocyte expressed ligand 1; TALL-1; B lymphocyte stimulator; BLyS; B cell-activating factor; BAFF; Dendritic cell-derived TN |
0.005 mg |
161-Eur |
GenWay |
human |
| 10-663-45156 |
Soluble B Lymphocyte Stimulator (BAFF_BLyS) Human - TNF- and APOL-related leukocyte expressed ligand 1; TALL-1; B lymphocyte stimulator; BLyS; B cell-activating factor; BAFF; Dendritic cell-derived TN |
1 mg |
10863-Eur |
GenWay |
human |
| 10-663-45114 |
Soluble CD40 (CD154) Ligand_TRAP Human - CD40-L; Tumor necrosis factor ligand superfamily member 5; TNF-related activation protein; TRAP; T cell antigen Gp39; CD154 antigen N_A |
0.01 mg |
161-Eur |
GenWay |
human |
| PNb-044 |
RANKL, soluble Human Host: Nicotiana benthamiana TNFSF11; ODF; OPGL; sOdf; CD254; OPTB2; RANKL; TRANCE; hRANKL3Tumor necrosis factor ligand superfamily member 11 (TNFSF11), Osteoprotegerin ligand (OPG |
50 |
406-Eur |
Reliatech |
|
| 10-663-45156 |
Soluble B Lymphocyte Stimulator (BAFF_BLyS) Human - TNF- and APOL-related leukocyte expressed ligand 1; TALL-1; B lymphocyte stimulator; BLyS; B cell-activating factor; BAFF; Dendritic cell-derived TN |
0.02 mg |
352-Eur |
GenWay |
human |
| 182-01471 |
RANK Ligand Soluble, Human, recombinant (RANKL) Source Human RANK ligand cDNA expressed in E. coli Appearance Lyophilized powder (carrier free) Molecular weight 20,000 Biological Activity The |
10 ug |
493-Eur |
B-Bridge |
recombinant |
| PNb-043 |
RANKL, soluble Human Host: Nicotiana benthamiana TNFSF11; ODF; OPGL; sOdf; CD254; OPTB2; RANKL; TRANCE; hRANKL2 Tumor necrosis factor ligand superfamily member 11 (TNFSF11), Osteoprotegerin ligand (OP |
10 |
195-Eur |
Reliatech |
|
| 186-01474 |
RANK Ligand Soluble, Human, recombinant (RANKL) Source Human RANK ligand cDNA expressed in E. coli Appearance Lyophilized powder (carrier free) Molecular weight 20,000 Biological Activity The |
50 ug |
1975-Eur |
B-Bridge |
recombinant |
| 32-215 |
Alpha-synuclein (SNCA), with 140-amino acid protein (about 15kDa), belongs to the synuclein family, which also includes beta- and gamma-synuclein. SNCA is a soluble protein, expressed principally in t |
0.1 mL |
441-Eur |
Prosci |
|
| EIAAB38918 |
Alpha-soluble NSF attachment protein,Homo sapiens,Human,NAPA,N-ethylmaleimide-sensitive factor attachment protein alpha,SNAPA,SNAP-alpha |
|
1109-Eur |
EIAab |
|
| EIAAB38927 |
Gamma-soluble NSF attachment protein,Homo sapiens,Human,NAPG,N-ethylmaleimide-sensitive factor attachment protein gamma,SNAPG,SNAP-gamma |
|
1109-Eur |
EIAab |
|
| EIAAB38924 |
Beta-soluble NSF attachment protein,Homo sapiens,Human,NAPB,N-ethylmaleimide-sensitive factor attachment protein beta,SNAPB,SNAP-beta |
|
1109-Eur |
EIAab |
|
| EIAAB24992 |
Membrane metallo-endopeptidase-like 1,Mmel1,Mouse,Mus musculus,NEP2,Nep2,NEP2(m),NEPII,NEPLP,Neprilysin II,Neprilysin-2,Neprilysin-like 1,Neprilysin-like peptidase,Nl1,NL-1,NL2,Sep,Soluble secreted en |
|
1164-Eur |
EIAab |
|
| EIAAB38926 |
Bos taurus,Bovine,Gamma-soluble NSF attachment protein,NAPG,N-ethylmaleimide-sensitive factor attachment protein gamma,SNAPG,SNAP-gamma |
|
1333-Eur |
EIAab |
|
| EIAAB38925 |
Gamma-soluble NSF attachment protein,Mouse,Mus musculus,Napg,N-ethylmaleimide-sensitive factor attachment protein gamma,Snapg,SNAP-gamma |
|
1164-Eur |
EIAab |
|
| EIAAB38923 |
Beta-soluble NSF attachment protein,Napb,N-ethylmaleimide-sensitive factor attachment protein beta,Rat,Rattus norvegicus,Snapb,SNAP-beta |
|
1191-Eur |
EIAab |
|
| EIAAB38922 |
Beta-soluble NSF attachment protein,Bos taurus,Bovine,NAPB,N-ethylmaleimide-sensitive factor attachment protein beta,SNAPB,SNAP-beta |
|
1333-Eur |
EIAab |
|
| EIAAB38919 |
Alpha-soluble NSF attachment protein,Bos taurus,Bovine,NAPA,N-ethylmaleimide-sensitive factor attachment protein alpha,SNAPA,SNAP-alpha |
|
1333-Eur |
EIAab |
|
| EIAAB38920 |
Alpha-soluble NSF attachment protein,Mouse,Mus musculus,Napa,N-ethylmaleimide-sensitive factor attachment protein alpha,Snapa,SNAP-alpha |
|
1164-Eur |
EIAab |
|
| MPP001 |
ADENOVIRUS TYPE 5 SOLUBLE ANTIGEN, Product Type Antigen, Specificity ADENOVIRUS TYPE 5, Target Species Viral, Host N_A, Format Inactivated Pathogen, Isotypes , Applications E, Clone |
1 ml |
605-Eur |
AbD Serotec |
cat |
| SCH-MPP005 |
ADENOVIRUS TYPE 11 SOLUBLE ANTIGEN, Product Type Antigen, Specificity ADENOVIRUS TYPE 11, Target Species Viral, Host N_A, Format Inactivated Pathogen, Isotypes , Applications E, Clone |
1 ml |
605-Eur |
Serotech |
cat |
| SCH-MPP004 |
ADENOVIRUS TYPE 3 SOLUBLE ANTIGEN, Product Type Antigen, Specificity ADENOVIRUS TYPE 3, Target Species Viral, Host N_A, Format Inactivated Pathogen, Isotypes , Applications E, Clone |
1 ml |
605-Eur |
Serotech |
cat |
| SCH-MPP001 |
ADENOVIRUS TYPE 5 SOLUBLE ANTIGEN, Product Type Antigen, Specificity ADENOVIRUS TYPE 5, Target Species Viral, Host N_A, Format Inactivated Pathogen, Isotypes , Applications E, Clone |
1 ml |
605-Eur |
Serotech |
cat |
| MPP005 |
ADENOVIRUS TYPE 11 SOLUBLE ANTIGEN, Product Type Antigen, Specificity ADENOVIRUS TYPE 11, Target Species Viral, Host N_A, Format Inactivated Pathogen, Isotypes , Applications E, Clone |
1 ml |
605-Eur |
AbD Serotec |
cat |
| MPP004 |
ADENOVIRUS TYPE 3 SOLUBLE ANTIGEN, Product Type Antigen, Specificity ADENOVIRUS TYPE 3, Target Species Viral, Host N_A, Format Inactivated Pathogen, Isotypes , Applications E, Clone |
1 ml |
605-Eur |
AbD Serotec |
cat |
| orb82814 |
Mouse TNF alpha protein The recombinant mouse TNF-alpha is a soluble 157 amino acid protein which corresponds to C-terminal extracellular domain of the full length transmembrane protein. Tumor necrosi |
1 mg |
2079-Eur |
Biorb |
recombinant |
| orb22422 |
Rat Peroxidase-Anti-Peroxidase Polyclonal Soluble rat peroxidase-anti-peroxidase immune complex. Peroxidase staining of unlabelled rat IgG antibodies. |
0.25 ml |
375-Eur |
Biorb |
polyclonal |
| 188-01473 |
RANK Ligand Soluble, Human, recombinant (RANKL) Receptor activator of nuclear factor kappa_B ligand (RANKL), also known as tumor necrosis factor ligand superfamily member 11 (TNFSF11), TNF_related ac |
1 mg |
----Eur |
B-Bridge |
recombinant |
| SCH-PMP04Z |
PURIFIED MOUSE NERVE GROWTH FACTOR 2.5S, Product Type Purified Protein, Specificity NERVE GROWTH FACTOR 2.5S, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
1 mg |
723-Eur |
Serotech |
cat |
| PMP04Z |
PURIFIED MOUSE NERVE GROWTH FACTOR 2.5S, Product Type Purified Protein, Specificity NERVE GROWTH FACTOR 2.5S, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
1 mg |
723-Eur |
AbD Serotec |
cat |
| PHP147 |
PURIFIED HUMAN SEX HORMONE BINDING GLOBULIN, Product Type Purified Protein, Specificity SEX HORMONE BINDING GLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY |
0.1 mg |
338-Eur |
AbD Serotec |
human |
| SCH-PHP147 |
PURIFIED HUMAN SEX HORMONE BINDING GLOBULIN, Product Type Purified Protein, Specificity SEX HORMONE BINDING GLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY |
0.1 mg |
338-Eur |
Serotech |
human |
| 20-000702 |
HIV1 p24 antibody (IgG purified), Purified Polyclonal Antibodies, Host Sheep |
100 ug |
324-Eur |
Fitzgerald |
|
| PMP04Z |
PURIFIED MOUSE NERVE GROWTH FACTOR 2.5S Purified Protein Host: N_A |
1 mg |
573-Eur |
AbD Serotec |
|
| PHP147 |
PURIFIED HUMAN SEX HORMONE BINDING GLOBULIN Purified Protein Host: N_A |
0.1 mg |
267-Eur |
AbD Serotec |
|
| PMP04Z |
PURIFIED MOUSE NERVE GROWTH FACTOR 2.5S-PURIFIED PROTEIN |
1 mg |
862-Eur |
AbD Serotec |
mouse |
| PHP157G |
PURIFIED HUMAN PLACENTAL LACTOGEN Purified Protein Host: N_A |
1 mg |
382-Eur |
AbD Serotec |
|
| OBT1107F |
PURIFIED HAMSTER IgG:FITC Purified Protein Host: N_A Polyclonal IgG |
1 mg |
219-Eur |
AbD Serotec |
|
| PHP152 |
PURIFIED HUMAN ALPHA FETOPROTEIN Purified Protein Host: N_A |
1 mg |
725-Eur |
AbD Serotec |
|
| PHP147 |
PURIFIED HUMAN SEX HORMONE BINDING GLOBULIN-PURIFIED PROTEIN |
0.1 mg |
397-Eur |
AbD Serotec |
human |
| PHP135 |
PURIFIED HUMAN BETA 2 MICROGLOBULIN Purified Protein Host: N_A |
1 mg |
286-Eur |
AbD Serotec |
|
| 0200-0473 |
PURIFIED MOUSE MONOCLONAL IgG1-PURIFIED PROTEIN |
0.2 mg |
239-Eur |
AbD Serotec |
monoclonal |
| PRABP01F |
PURIFIED RABBIT IgG:FITC Purified Protein Host: N_A Polyclonal IgG |
0.1 mg |
257-Eur |
AbD Serotec |
|
| PHP135 |
PURIFIED HUMAN BETA 2 MICROGLOBULIN-PURIFIED PROTEIN |
1 mg |
428-Eur |
AbD Serotec |
human |
| OBT1107 |
PURIFIED HAMSTER IgG Purified Protein Host: N_A Polyclonal IgG |
10 mg |
277-Eur |
AbD Serotec |
|
| PHP289 |
PURIFIED HUMAN FIBRONECTIN Purified Protein Host: N_A |
1 mg |
165-Eur |
AbD Serotec |
|
| PHP133 |
PURIFIED HUMAN SECRETORY IgA Purified Protein Host: N_A |
0.5 mg |
286-Eur |
AbD Serotec |
|
| PBP017 |
PURIFIED BOVINE FIBRONECTIN Purified Protein Host: N_A |
1 mg |
165-Eur |
AbD Serotec |
|
| OBT1524 |
HUMAN IgM PURIFIED IMMUNOGLOBULIN Purified Protein Host: N_A IgM |
2 mg |
230-Eur |
AbD Serotec |
|
| PHP152 |
PURIFIED HUMAN ALPHA FETOPROTEIN-PURIFIED PROTEIN |
1 mg |
1090-Eur |
AbD Serotec |
human |
| PHP156 |
PURIFIED HUMAN MYOGLOBIN Purified Protein Host: N_A |
1 mg |
230-Eur |
AbD Serotec |
|
| PBP004 |
PURIFIED BOVINE IgG2 Purified Protein Host: N_A |
1 mg |
297-Eur |
AbD Serotec |
|
| PHP157G |
PURIFIED HUMAN PLACENTAL LACTOGEN-PURIFIED PROTEIN |
1 mg |
571-Eur |
AbD Serotec |
human |
| PBP003 |
PURIFIED BOVINE IgG1 Purified Protein Host: N_A |
1 mg |
297-Eur |
AbD Serotec |
|
| PRABP01 |
PURIFIED RABBIT IgG Purified Protein Host: N_A Polyclonal IgG |
10 mg |
152-Eur |
AbD Serotec |
|
| PHP149 |
PURIFIED HUMAN ALBUMIN Purified Protein Host: N_A |
1 mg |
125-Eur |
AbD Serotec |
|
| SCH-PHP192 |
RECOMBINANT HUMAN CD95 (SOLUBLE), Product Type Recombinant Protein, Specificity CD95 , Target Species Human, Host N_A, Format Rec. Protein, Isotypes , Applications FN, Clone |
25 µg |
385-Eur |
Serotech |
recombinant |
| PHP192 |
RECOMBINANT HUMAN CD95 (SOLUBLE), Product Type Recombinant Protein, Specificity CD95 , Target Species Human, Host N_A, Format Rec. Protein, Isotypes , Applications FN, Clone |
25 µg |
385-Eur |
AbD Serotec |
recombinant |
| PHP191 |
RECOMBINANT HUMAN CD54 (SOLUBLE), Product Type Recombinant Protein, Specificity CD54 , Target Species Human, Host N_A, Format Rec. Protein, Isotypes , Applications IA, Clone |
50 µg |
385-Eur |
AbD Serotec |
recombinant |
| SCH-PHP191 |
RECOMBINANT HUMAN CD54 (SOLUBLE), Product Type Recombinant Protein, Specificity CD54 , Target Species Human, Host N_A, Format Rec. Protein, Isotypes , Applications IA, Clone |
50 µg |
385-Eur |
Serotech |
recombinant |
| 18-003-42965 |
Alpha-soluble NSF attachment protein - SNAP-alpha; N-ethylmaleimide-sensitive factor attachment protein. alpha Polyclonal |
0.1 mg Protein A |
310-Eur |
GenWay |
polyclonal |
| 10-288-22418F |
Galectin-3-binding protein - Lectin galactoside-binding soluble 3-binding protein; Mac-2-binding protein; Mac-2 BP; MAC2BP; Tumor-associated antigen 90K |
0.1 mg |
353-Eur |
GenWay |
|
| 10-288-22418F |
Galectin-3-binding protein - Lectin galactoside-binding soluble 3-binding protein; Mac-2-binding protein; Mac-2 BP; MAC2BP; Tumor-associated antigen 90K |
0.05 mg |
248-Eur |
GenWay |
|
| PHP207 |
PURIFIED HUMAN CYSTATIN C-PURIFIED PROTEIN |
0.1 mg |
1741-Eur |
AbD Serotec |
human |
| PHP283 |
PURIFIED HUMAN C3 Purified Protein Host: N_A |
0.25 mg |
330-Eur |
AbD Serotec |
|
| OBT1107F |
PURIFIED HAMSTER IgG FITC-PURIFIED PROTEIN |
1 mg |
325-Eur |
AbD Serotec |
fitc |
| PHP144 |
PURIFIED HUMAN PROLACTIN-PURIFIED PROTEIN |
0.1 mg |
744-Eur |
AbD Serotec |
human |
| OBT1524 |
HUMAN IgM PURIFIED IMMUNOGLOBULIN-PURIFIED PROTEIN |
2 mg |
342-Eur |
AbD Serotec |
human |
| PHP156 |
PURIFIED HUMAN MYOGLOBIN-PURIFIED PROTEIN |
1 mg |
342-Eur |
AbD Serotec |
human |
| PBP003 |
PURIFIED BOVINE IgG1-PURIFIED PROTEIN |
1 mg |
397-Eur |
AbD Serotec |
bovine |
| PHP149 |
PURIFIED HUMAN ALBUMIN-PURIFIED PROTEIN |
1 mg |
182-Eur |
AbD Serotec |
human |
| PMP01 |
PURIFIED MOUSE IgG Purified Protein Host: N_A |
2 mg |
96-Eur |
AbD Serotec |
|
| PHP133 |
PURIFIED HUMAN SECRETORY IgA-PURIFIED PROTEIN |
0.5 mg |
428-Eur |
AbD Serotec |
human |
| PSP01 |
PURIFIED SHEEP IgG Purified Protein Host: N_A |
10 mg |
152-Eur |
AbD Serotec |
|
| PRP40 |
PURIFIED RAT FIBRONECTIN Purified Protein Host: N_A |
1 mg |
304-Eur |
AbD Serotec |
|
| PAP001 |
PURIFIED CHICKEN IgG Purified Protein Host: N_A |
10 mg |
315-Eur |
AbD Serotec |
|
| PBP002 |
PURIFIED BOVINE IgG Purified Protein Host: N_A |
10 mg |
210-Eur |
AbD Serotec |
|
| PCP001 |
PURIFIED GOAT IgG Purified Protein Host: N_A |
10 mg |
211-Eur |
AbD Serotec |
|
| PEP001 |
PURIFIED HORSE IgG Purified Protein Host: N_A |
10 mg |
232-Eur |
AbD Serotec |
|
| PHP145 |
PURIFIED hCG ALPHA Purified Protein Host: N_A |
0.1 mg |
983-Eur |
AbD Serotec |
|
| PRABP01F |
PURIFIED RABBIT IgG FITC-PURIFIED PROTEIN |
0.1 mg |
384-Eur |
AbD Serotec |
polyclonal |
| PRP12 |
PURIFIED RAT IgG (POLYCLONAL) Purified Protein Host: N_A |
20 mg |
306-Eur |
AbD Serotec |
|
| PMP01X |
PURIFIED MOUSE IgG Purified Protein Host: N_A |
10 mg |
324-Eur |
AbD Serotec |
|
| PBP004 |
PURIFIED BOVINE IgG2-PURIFIED PROTEIN |
1 mg |
397-Eur |
AbD Serotec |
bovine |
| OBT1036 |
PURIFIED RABBIT IgM Purified Protein Host: N_A IgM |
1 mg |
306-Eur |
AbD Serotec |
|
| B65275G |
CMV (Purified & disrupted virions)Goat Purified |
1mL |
307-Eur |
Meridian Life Science |
|
| EIAAB38921 |
Beta-soluble NSF attachment protein,Brain protein I47,Mouse,Mus musculus,Napb,N-ethylmaleimide-sensitive factor attachment protein beta,Snapb,SNAP-beta |
|
1164-Eur |
EIAab |
|
| 10-288-22162F |
Alpha-soluble NSF attachment protein - SNAP-alpha; N-ethylmaleimide-sensitive factor attachment protein. alpha |
0.1 mg |
329-Eur |
GenWay |
|
| 10-288-22162F |
Alpha-soluble NSF attachment protein - SNAP-alpha; N-ethylmaleimide-sensitive factor attachment protein. alpha |
0.05 mg |
229-Eur |
GenWay |
|
| orb80302 |
Rat EGF protein EGF Rat purified from submandibular gland is a single, glycosylated, polypeptide chain having a molecular mass of 6.15 kDa.The EGF is purified by proprietary chromatographic techniques |
2 |
277-Eur |
Biorb |
rat |
| SCH-PRP07A |
RAT IgE KAPPA , Product Type Purified Protein, Specificity IgE, Target Species Rat, Host N_A, Format Purified, Isotypes IgE, Applications E, Clone |
0.1 mg |
255-Eur |
Serotech |
cat |
| PRP07A |
RAT IgE KAPPA , Product Type Purified Protein, Specificity IgE, Target Species Rat, Host N_A, Format Purified, Isotypes IgE, Applications E, Clone |
0.1 mg |
255-Eur |
AbD Serotec |
cat |
| orb80512 |
Human Leptin Binding Domain protein Leptin Binding Domain Human Recombinant also called Leptin soluble receptor produced in E.coli is a single, non-glycosylated, polypeptide chain containing 208 amino |
10 |
228-Eur |
Biorb |
recombinant |
| PRP01 |
RAT IgA KAPPA , Product Type Purified Protein, Specificity IgA, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR22 |
1 mg |
794-Eur |
AbD Serotec |
cat |
| orb22421 |
Rat IgG Polyclonal Chromatographically purified rat IgG. Purified rat IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immu |
10 mg |
539-Eur |
Biorb |
elisa |
| SCH-PRP08 |
RAT IgM KAPPA , Product Type Purified Protein, Specificity IgM, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR473 |
1 mg |
409-Eur |
Serotech |
cat |
| PRP08 |
RAT IgM KAPPA , Product Type Purified Protein, Specificity IgM, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR473 |
1 mg |
409-Eur |
AbD Serotec |
cat |
| 6379-8050 |
SYNTHETIC MDR 1, Product Type Purified Protein, Specificity MDR 1, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
cat |
| SCH-PRP01 |
RAT IgA KAPPA , Product Type Purified Protein, Specificity IgA, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR22 |
1 mg |
794-Eur |
Serotech |
cat |
| SCH-4220-1454 |
NATIVE RAT EGF, Product Type Purified Protein, Specificity EGF, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 µg |
385-Eur |
Serotech |
cat |
| 4220-1454 |
NATIVE RAT EGF, Product Type Purified Protein, Specificity EGF, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 µg |
385-Eur |
AbD Serotec |
cat |
| SCH-6379-8050 |
SYNTHETIC MDR 1, Product Type Purified Protein, Specificity MDR 1, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
cat |
| PRP12 |
PURIFIED RAT IgG (POLYCLONAL)-PURIFIED PROTEIN |
20 mg |
456-Eur |
AbD Serotec |
polyclonal |
| PHP150 |
PURIFIED hCG Purified Protein Host: N_A |
1 mg |
324-Eur |
AbD Serotec |
|
| PBP002 |
PURIFIED BOVINE IgG-PURIFIED PROTEIN |
10 mg |
311-Eur |
AbD Serotec |
bovine |
| PRABP01 |
PURIFIED RABBIT IgG-PURIFIED PROTEIN |
10 mg |
224-Eur |
AbD Serotec |
polyclonal |
| B65875G |
HIV-1, (purified Virions)Goat Purified |
1mL |
294-Eur |
Meridian Life Science |
|
| PMP01X |
PURIFIED MOUSE IgG-PURIFIED PROTEIN |
10 mg |
485-Eur |
AbD Serotec |
mouse |
| PMP01 |
PURIFIED MOUSE IgG-PURIFIED PROTEIN |
2 mg |
138-Eur |
AbD Serotec |
mouse |
| PHP283 |
PURIFIED HUMAN C3-PURIFIED PROTEIN |
0.25 mg |
494-Eur |
AbD Serotec |
human |
| 14-6046-82 |
Anti-Noxa Purified Purified 100 ug |
|
351-Eur |
eBioscience |
|
| PAP001 |
PURIFIED CHICKEN IgG-PURIFIED PROTEIN |
10 mg |
470-Eur |
AbD Serotec |
|
| OBT1036 |
PURIFIED RABBIT IgM-PURIFIED PROTEIN |
1 mg |
456-Eur |
AbD Serotec |
polyclonal |
| OBT1107 |
PURIFIED HAMSTER IgG-PURIFIED PROTEIN |
10 mg |
412-Eur |
AbD Serotec |
|
| PHP145 |
PURIFIED hCG ALPHA-PURIFIED PROTEIN |
0.1 mg |
1482-Eur |
AbD Serotec |
|
| OBT2270 |
PURIFIED DOG IgG Purified Protein Host: N_A IgG |
10 mg |
277-Eur |
AbD Serotec |
|
| PCP001 |
PURIFIED GOAT IgG-PURIFIED PROTEIN |
10 mg |
283-Eur |
AbD Serotec |
polyclonal |
| PEP001 |
PURIFIED HORSE IgG-PURIFIED PROTEIN |
10 mg |
311-Eur |
AbD Serotec |
horse |
| RA-80E-Z |
IgE Purified (Myeloma),Purified , Host: Human |
0.1 mg |
238-Eur |
ICL I.C.L |
|
| PPP012 |
PURIFIED PIG IgG Purified Protein Host: N_A |
10 mg |
324-Eur |
AbD Serotec |
|
| PSP01 |
PURIFIED SHEEP IgG-PURIFIED PROTEIN |
10 mg |
224-Eur |
AbD Serotec |
|
| RA-80E-Z |
IgE Purified (Myeloma) Purified Host Human |
0.1 mg |
204-Eur |
ICL |
human |
| AI-43-641-2 |
Rhesus Monkey Purified IgG Purified Immunoglobulin |
2 mg |
154-Eur |
LeeBio |
|
| AI-43-641-50 |
Rhesus Monkey Purified IgG Purified Immunoglobulin |
50 mg |
758-Eur |
LeeBio |
|
| AI-43-641-10 |
Rhesus Monkey Purified IgG Purified Immunoglobulin |
10 mg |
433-Eur |
LeeBio |
|
| PFP001 |
PURIFIED CAT IgG Purified Protein Host: N_A |
10 mg |
182-Eur |
AbD Serotec |
|
| EIAAB38917 |
Alpha-soluble NSF attachment protein,Napa,N-ethylmaleimide-sensitive factor attachment protein alpha,Rat,Rattus norvegicus,Snap,Snapa,SNAP-alpha |
|
1191-Eur |
EIAab |
|
| SCH-OBT7209 |
ACROLEIN_BSA CONJUGATE, Product Type Purified Protein, Specificity ACROLEIN, Target Species , Host N_A, Format Purified, Isotypes , Applications C, IF, P, Clone |
1 mg |
373-Eur |
Serotech |
cat |
| OBT7209 |
ACROLEIN_BSA CONJUGATE, Product Type Purified Protein, Specificity ACROLEIN, Target Species , Host N_A, Format Purified, Isotypes , Applications C, IF, P, Clone |
1 mg |
373-Eur |
AbD Serotec |
cat |
| PHP193 |
RECOMBINANT HUMAN VEGF RECEPTOR 1 (SOLUBLE), Product Type Recombinant Protein, Specificity VEGF RECEPTOR 1 , Target Species Human, Host N_A, Format Rec. Protein, Isotypes , Applications FN, Clo |
10 µg |
700-Eur |
AbD Serotec |
recombinant |
| SCH-PHP193 |
RECOMBINANT HUMAN VEGF RECEPTOR 1 (SOLUBLE), Product Type Recombinant Protein, Specificity VEGF RECEPTOR 1 , Target Species Human, Host N_A, Format Rec. Protein, Isotypes , Applications FN, Clo |
10 µg |
700-Eur |
Serotech |
recombinant |
| AS09 564 |
Antibody: 3-hyrdoxybutyrate dehydrogenase, Affinity purified, Immunogen: 3-hydroxybutyrate dexydrogenase isolated and purified from Rhodobacter sphaeroides, Host: rabbit, polyclonal, Confirmed reactiv |
1 mg |
438-Eur |
Gentaur |
|
| 4110-5004 |
ENDOTHELIAL CELL GROWTH SUPPLEMENT, Product Type Purified Protein, Specificity ECGS, Target Species , Host N_A, Format Purified, Isotypes , Applications TC, Clone |
50 mg |
278-Eur |
AbD Serotec |
cat |
| SCH-4110-5004 |
ENDOTHELIAL CELL GROWTH SUPPLEMENT, Product Type Purified Protein, Specificity ECGS, Target Species , Host N_A, Format Purified, Isotypes , Applications TC, Clone |
50 mg |
278-Eur |
Serotech |
cat |
| PAS9370 |
Polyclonal antibody: Cerebral : NEUTROPHIL GELATINASE ASSOCIATE LIPOCALIN (NGAL) Affintiy Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| HIST21-N-1 |
Purified bovine histone, H2a_F2a2 and H4 (f2a1) (slightly lysine rich, ~14.5_11.3 kda) purified Species Reactivity: Bovine |
1 mg Product tipe: WB Control |
277-Eur |
ADI |
|
| orb22146 |
Goat Peroxidase-Anti-Peroxidase Polyclonal Soluble goat peroxidase-anti-peroxidase immune complex. Peroxidase staining of unlabelled goat IgG antibodies. |
1 ml |
342-Eur |
Biorb |
polyclonal |
| orb22294 |
Rabbit Peroxidase-Anti-Peroxidase Polyclonal Soluble rabbit peroxidase-anti-peroxidase immune complex. Peroxidase staining of unlabelled Rabbit IgG antibodies. |
1 ml |
375-Eur |
Biorb |
polyclonal |
| orb21309 |
Sheep Peroxidase-Anti-Peroxidase Polyclonal Soluble sheep peroxidase-anti-peroxidase immune complex. Peroxidase staining of unlabelled sheep IgG antibodies. |
1 ml |
375-Eur |
Biorb |
polyclonal |
| ACE25-R-10 |
Recombinant purified Human Angiotensin converting enzyme-2 purified protein Species Reactivity: Human |
10 ug Product tipe: Rec. Protein |
693-Eur |
ADI |
|
| HIST22-N-1 |
Purified bovine histone, H2b_F2b (slightly lysine rich, ~13.7 kda) purified Species Reactivity: Bovine |
1 mg Product tipe: WB Control |
277-Eur |
ADI |
|
| orb82255 |
Purified Human Myoglobin protein Myoglobin (Antigen grade) is a purified cardiac marker. For research use only. |
1 mg |
588-Eur |
Biorb |
human |
| SCH-9420-0002 |
NATIVE ULEX EUROPAEUS LECTIN 1, Product Type Purified Protein, Specificity ALPHA_L_FUCOSE, Target Species Broad, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
160-Eur |
Serotech |
cat |
| HIST31-N-1 |
Purified bovine histone, H3_F3 (Arginine rich, ~15.3 kda) purified Species Reactivity: Bovine |
1 mg Product tipe: WB Control |
277-Eur |
ADI |
|
| HIST11-N-1 |
Purified bovine histone, H1_F1 (lysine rich, ~21.5 kda) purified Species Reactivity: Bovine |
1 mg Product tipe: WB Control |
277-Eur |
ADI |
|
| AI-43-636-10 |
Human Purified IgG Purified Immunoglobulin |
10 mg |
191-Eur |
LeeBio |
human |
| AI-43-637-10 |
Mouse Purified IgG Purified Immunoglobulin |
10 mg |
300-Eur |
LeeBio |
mouse |
| AI-43-640-50 |
Sheep Purified IgG Purified Immunoglobulin |
50 mg |
371-Eur |
LeeBio |
|
| AI-43-640-100 |
Sheep Purified IgG Purified Immunoglobulin |
100 mg |
532-Eur |
LeeBio |
|
| AI-43-640-10 |
Sheep Purified IgG Purified Immunoglobulin |
10 g |
137-Eur |
LeeBio |
|
| AI-43-636-50 |
Human Purified IgG Purified Immunoglobulin |
50 mg |
558-Eur |
LeeBio |
human |
| PHP150 |
PURIFIED hCG-PURIFIED PROTEIN |
1 mg |
485-Eur |
AbD Serotec |
|
| AI-43-634-10 |
Goat Purified IgG Purified Immunoglobulin |
10 mg |
129-Eur |
LeeBio |
polyclonal |
| PPP012 |
PURIFIED PIG IgG-PURIFIED PROTEIN |
10 mg |
485-Eur |
AbD Serotec |
|
| AI-43-646-50 |
Chimpanzee Purified IgG Purified Immunoglobulin |
50 mg |
3317-Eur |
LeeBio |
|
| AI-43-634-50 |
Goat Purified IgG Purified Immunoglobulin |
50 mg |
337-Eur |
LeeBio |
polyclonal |
| RA-80E-Z |
IgE Purified (Myeloma) Purified Human |
0.1 mg |
244-Eur |
ICL I.C.L |
human |
| AI-43-630-10 |
Rabbit Purified IgG Purified Immunoglobulin |
10 mg |
121-Eur |
LeeBio |
polyclonal |
| AI-43-630-100 |
Rabbit Purified IgG Purified Immunoglobulin |
100 mg |
440-Eur |
LeeBio |
polyclonal |
| AI-43-646-10 |
Chimpanzee Purified IgG Purified Immunoglobulin |
10 mg |
736-Eur |
LeeBio |
|
| AI-43-635-50 |
Guinea Pig Purified IgG Purified Immunoglobulin |
50 mg |
510-Eur |
LeeBio |
|
| AI-43-630-50 |
Rabbit Purified IgG Purified Immunoglobulin |
50 mg |
322-Eur |
LeeBio |
polyclonal |
| AI-43-631 |
Bovine Purified IgG Purified Immunoglobulin |
10 mg |
----Eur |
LeeBio |
bovine |
| AI-43-635-10 |
Guinea Pig Purified IgG Purified Immunoglobulin |
10 mg |
176-Eur |
LeeBio |
|
| AI-43-634-100 |
Goat Purified IgG Purified Immunoglobulin |
100 mg |
466-Eur |
LeeBio |
polyclonal |
| AI-43-636-100 |
Human Purified IgG Purified Immunoglobulin |
100 mg |
790-Eur |
LeeBio |
human |
| AI-43-633-50 |
Dog (Canine) Purified IgG Purified Immunoglobulin |
50 mg |
703-Eur |
LeeBio |
dog |
| AI-43-639-50 |
Horse Purified IgG Purified Immunoglobulin |
50 mg |
307-Eur |
LeeBio |
horse |
| AI-43-632-50 |
Feline (Cat) Purified IgG Purified Immunoglobulin |
50 mg |
393-Eur |
LeeBio |
cat |
| PFP001 |
PURIFIED CAT IgG-PURIFIED PROTEIN |
10 mg |
269-Eur |
AbD Serotec |
cat |
| AI-43-631-100 |
Bovine Purified IgG Purified Immunoglobulin |
100 mg |
397-Eur |
LeeBio |
bovine |
| AI-43-631-10 |
Bovine Purified IgG Purified Immunoglobulin |
10 mg |
119-Eur |
LeeBio |
bovine |
| AI-43-637-50 |
Mouse Purified IgG Purified Immunoglobulin |
50 mg |
1096-Eur |
LeeBio |
mouse |
| AI-43-646-2 |
Chimpanzee Purified IgG Purified Immunoglobulin |
2 mg |
323-Eur |
LeeBio |
|
| AI-43-632-10 |
Feline (Cat) Purified IgG Purified Immunoglobulin |
10 mg |
142-Eur |
LeeBio |
cat |
| AI-43-639-10 |
Horse Purified IgG Purified Immunoglobulin |
10 mg |
119-Eur |
LeeBio |
horse |
| 0BT2270 |
PURIFIED DOG IgG-PURIFIED PROTEIN |
10 mg |
412-Eur |
AbD Serotec |
dog |
| AI-43-633-10 |
Dog (Canine) Purified IgG Purified Immunoglobulin |
10 mg |
212-Eur |
LeeBio |
dog |
| AI-43-631-50 |
Bovine Purified IgG Purified Immunoglobulin |
50 mg |
262-Eur |
LeeBio |
bovine |
| PAS9400 |
Polyclonal antibody: Interleukins : INTERLEUKIN 7 (IL-7) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9360 |
Polyclonal antibody: Interleukins : INTERLEUKIN 13 (IL-13) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| EGF1 |
MOUSE EGF, Product Type Purified Protein, Specificity EGF, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
1 mg |
522-Eur |
AbD Serotec |
cat |
| PAS9396 |
Polyclonal antibody: Chemokines : RANTES Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9407 |
Polyclonal antibody: Metabolic : RESISTIN Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS10086 |
Polyclonal antibody: Chemokines : FRACTALKINE Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9403 |
Polyclonal antibody: Cardiac : PROCALCITONIN (PCT) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9362 |
Polyclonal antibody: Interleukins : INTERLEUKIN 6 (IL-6) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9345 |
Polyclonal antibody: Interleukins : INTERLEUKIN 15 (IL-15) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9350 |
Polyclonal antibody: Interleukins : INTERLEUKIN 2 (IL-2) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9361 |
Polyclonal antibody: Interleukins : INTERLEUKIN 3 (IL-3) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-EGF1 |
MOUSE EGF, Product Type Purified Protein, Specificity EGF, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
1 mg |
522-Eur |
Serotech |
cat |
| PAS9391 |
Polyclonal antibody: Interleukins : INTERLEUKIN 10 (IL-10) Affinity Purified , Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9351 |
Polyclonal antibody: Interleukins : INTERLEUKIN 4 (IL-4) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9359 |
Polyclonal antibody: Interleukins : INTERLEUKIN 8 (IL-8) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-OBT7258 |
D_BIOTIN CONJUGATE, Product Type Purified Protein, Specificity D_BIOTIN, Target Species , Host N_A, Format Purified, Isotypes , Applications C, P, Clone |
1 mg |
373-Eur |
Serotech |
cat |
| PAS9363 |
Polyclonal antibody: Biochemical Messengers : S100A10 Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| orb80301 |
Mouse EGF protein EGF Mouse purified from submaxillary gland is a single, glycosylated, polypeptide chain having a molecular mass of 6.1 kDa.The EGF is purified by proprietary chromatographic techniqu |
10 |
154-Eur |
Biorb |
mouse |
| PAS10104 |
Polyclonal antibody: Cardiac : HUMAN TRANSFERRIN Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS10100 |
Polyclonal antibody: Cerebral : HUMAN APOLOPOPROTEIN A1 Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS10100 |
Polyclonal antibody: Cancer : HUMAN APOLOPOPROTEIN A1 Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| OBT7235 |
NO_L_DOPA CONJUGATE, Product Type Purified Protein, Specificity NO_L_DOPA, Target Species , Host N_A, Format Purified, Isotypes , Applications C, P, Clone |
1 mg |
373-Eur |
AbD Serotec |
cat |
| PAS9364 |
Polyclonal antibody: Biochemical Messengers : S100A11 Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9342 |
Polyclonal antibody: Biochemical Messengers : S100B Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PHP003 |
HUMAN IgM KAPPA, Product Type Purified Protein, Specificity IgM, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
326-Eur |
AbD Serotec |
human |
| PHP001 |
HUMAN IgG (POLYCLONAL), Product Type Purified Protein, Specificity IgG, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
735-Eur |
AbD Serotec |
polyclonal |
| SCH-PHP001 |
HUMAN IgG (POLYCLONAL), Product Type Purified Protein, Specificity IgG, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
735-Eur |
Serotech |
polyclonal |
| PAS9369 |
Polyclonal antibody: Cancer : CYTOKERATIN-18 (CK18) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-PMP68 |
MOUSE IgE KAPPA, Product Type Purified Protein, Specificity IgE, Target Species Mouse, Host N_A, Format Purified, Isotypes IgE, Applications E, Clone |
0.5 mg |
290-Eur |
Serotech |
cat |
| PHP237 |
NATIVE HUMAN FSH , Product Type Purified Protein, Specificity FSH, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
350-Eur |
AbD Serotec |
human |
| SCH-PHP003 |
HUMAN IgM KAPPA, Product Type Purified Protein, Specificity IgM, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
326-Eur |
Serotech |
human |
| PAS10100 |
Polyclonal antibody: Metabolic : HUMAN APOLOPOPROTEIN A1 Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9356 |
Polyclonal antibody: Adhesion Molecules : L-SELECTIN Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS10098 |
Polyclonal antibody: Cancer : HUMAN APOLOPOPROTEIN B Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9357 |
Polyclonal antibody: Interleukins : INTERLEUKIN 1 ALPHA (IL-1a) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9357 |
Polyclonal antibody: Interleukins : INTERLEUKIN 1 BETA (IL-1b) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS10090 |
Polyclonal antibody: Cardiac : TISSUE FACTOR Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| OBT7258 |
D_BIOTIN CONJUGATE, Product Type Purified Protein, Specificity D_BIOTIN, Target Species , Host N_A, Format Purified, Isotypes , Applications C, P, Clone |
1 mg |
373-Eur |
AbD Serotec |
cat |
| SCH-OBT7235 |
NO_L_DOPA CONJUGATE, Product Type Purified Protein, Specificity NO_L_DOPA, Target Species , Host N_A, Format Purified, Isotypes , Applications C, P, Clone |
1 mg |
373-Eur |
Serotech |
cat |
| SCH-PHP237 |
NATIVE HUMAN FSH , Product Type Purified Protein, Specificity FSH, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
350-Eur |
Serotech |
human |
| PMP68 |
MOUSE IgE KAPPA, Product Type Purified Protein, Specificity IgE, Target Species Mouse, Host N_A, Format Purified, Isotypes IgE, Applications E, Clone |
0.5 mg |
290-Eur |
AbD Serotec |
cat |
| PAS9399 |
Polyclonal antibody: Chemokines : INDUCIBLE PROTEIN 10 (IP-10) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-OBT7240 |
DL_CITRULLINE CONJUGATE, Product Type Purified Protein, Specificity DL_CITRULLINE, Target Species , Host N_A, Format Purified, Isotypes , Applications C, E, Clone |
1 mg |
373-Eur |
Serotech |
cat |
| PAS10098 |
Polyclonal antibody: Metabolic : HUMAN APOLOPOPROTEIN B Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9399 |
Polyclonal antibody: Cancer : INDUCIBLE PROTEIN 10 (IP-10) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| OBT7240 |
DL_CITRULLINE CONJUGATE, Product Type Purified Protein, Specificity DL_CITRULLINE, Target Species , Host N_A, Format Purified, Isotypes , Applications C, E, Clone |
1 mg |
373-Eur |
AbD Serotec |
cat |
| PAS9355 |
Polyclonal antibody: Adhesion Molecules : E-SELECTIN Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| 0200-0473 |
PURIFIED MOUSE MONOCLONAL IgG1 Purified Protein Host: N_A IgG1 |
0.2 mg |
162-Eur |
TRC |
|
| PRP06 |
RAT IgG2c KAPPA , Product Type Purified Protein, Specificity IgG2c, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR304 |
1 mg |
759-Eur |
AbD Serotec |
cat |
| PRP05 |
RAT IgG2b KAPPA , Product Type Purified Protein, Specificity IgG2b, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR863 |
1 mg |
444-Eur |
AbD Serotec |
cat |
| 9536-0709 |
SYNTHETIC ARG_VASOPRESSIN, Product Type Purified Protein, Specificity ARG_VASOPRESSIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
148-Eur |
AbD Serotec |
cat |
| 5455-0002 |
SYNTHETIC ISOTOCIN, Product Type Purified Protein, Specificity ISOTOCIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
160-Eur |
AbD Serotec |
cat |
| SCH-4560-6404 |
NATIVE HUMAN FSH, Product Type Purified Protein, Specificity FSH, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
290-Eur |
Serotech |
human |
| 2722-7509 |
DESMOPRESSIN, Product Type Purified Protein, Specificity DESMOPRESSIN, Target Species Chemical, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
160-Eur |
AbD Serotec |
cat |
| 0200-0497 |
SYNTHETIC RAT TGF BETA 3, Product Type Purified Protein, Specificity TGF BETA 3, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
cat |
| SCH-9293-2009 |
SYNTHETIC TUFTSIN, Product Type Purified Protein, Specificity TUFTSIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, R, Clone |
10 mg |
148-Eur |
Serotech |
cat |
| PAS9366 |
Polyclonal antibody: Cardiac : CARBONIC ANHYDRASE III (CA III) (MUSCLE) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| 2150-1915 |
NATIVE RAT COLLAGEN I, Product Type Purified Protein, Specificity COLLAGEN I, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
195-Eur |
AbD Serotec |
cat |
| SCH-8450-1004 |
SYNTHETIC SUBSTANCE P, Product Type Purified Protein, Specificity SUBSTANCE P, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
195-Eur |
Serotech |
cat |
| SCH-PHP142 |
HUMAN IgE LAMBDA MYELOMA, Product Type Purified Protein, Specificity IgE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
409-Eur |
Serotech |
human |
| PAS9369 |
Polyclonal antibody: Biochemical Messengers : CYTOKERATIN-18 (CK18) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-9536-0709 |
SYNTHETIC ARG_VASOPRESSIN, Product Type Purified Protein, Specificity ARG_VASOPRESSIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
148-Eur |
Serotech |
cat |
| PMP52 |
MOUSE IgM KAPPA, Product Type Purified Protein, Specificity IgM, Target Species Mouse, Host N_A, Format Purified, Isotypes IgM, Applications E, Clone MADNP_5 |
1 mg |
545-Eur |
AbD Serotec |
cat |
| SCH-PRP02 |
RAT IgG1 KAPPA , Product Type Purified Protein, Specificity IgG1, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR27 |
1 mg |
444-Eur |
Serotech |
cat |
| 0100-0313 |
NATIVE RABBIT ACE, Product Type Purified Protein, Specificity ACE, Target Species Rabbit, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
0.25 UNITS |
338-Eur |
AbD Serotec |
polyclonal |
| PAS9393 |
Polyclonal antibody: Cytokines : INTERFERON GAMMA (IFNg) Affinity Purified , Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-PMP52 |
MOUSE IgM KAPPA, Product Type Purified Protein, Specificity IgM, Target Species Mouse, Host N_A, Format Purified, Isotypes IgM, Applications E, Clone MADNP_5 |
1 mg |
545-Eur |
Serotech |
cat |
| 9293-2009 |
SYNTHETIC TUFTSIN, Product Type Purified Protein, Specificity TUFTSIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, R, Clone |
10 mg |
148-Eur |
AbD Serotec |
cat |
| PAS9410 |
Polyclonal antibody: Cytokines : Monocyte Chemotatic Protein 1 (MCP-1) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
100 |
300-Eur |
RANDOX |
|
| 4497-1060 |
SYNTHETIC DYKDDDDK TAG, Product Type Purified Protein, Specificity DYKDDDDK TAG, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
cat |
| 2148-1004 |
NATIVE PIG COLIPASE, Product Type Purified Protein, Specificity COLIPASE, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
231-Eur |
AbD Serotec |
recombinant |
| SCH-PRP05 |
RAT IgG2b KAPPA , Product Type Purified Protein, Specificity IgG2b, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR863 |
1 mg |
444-Eur |
Serotech |
cat |
| 6420-3006 |
NATIVE HUMAN MBP, Product Type Purified Protein, Specificity MBP, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
255-Eur |
AbD Serotec |
human |
| SCH-2722-7509 |
DESMOPRESSIN, Product Type Purified Protein, Specificity DESMOPRESSIN, Target Species Chemical, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
160-Eur |
Serotech |
cat |
| SCH-6420-0100 |
NATIVE BOVINE MBP, Product Type Purified Protein, Specificity MBP, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
195-Eur |
Serotech |
cat |
| PHP142 |
HUMAN IgE LAMBDA MYELOMA, Product Type Purified Protein, Specificity IgE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
409-Eur |
AbD Serotec |
human |
| SCH-5455-0002 |
SYNTHETIC ISOTOCIN, Product Type Purified Protein, Specificity ISOTOCIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
160-Eur |
Serotech |
cat |
| PAS10146 |
Polyclonal antibody: Cancer : Hepatocyte growth factor A Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-0100-0313 |
NATIVE RABBIT ACE, Product Type Purified Protein, Specificity ACE, Target Species Rabbit, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
0.25 UNITS |
338-Eur |
Serotech |
polyclonal |
| SCH-2150-1915 |
NATIVE RAT COLLAGEN I, Product Type Purified Protein, Specificity COLLAGEN I, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
195-Eur |
Serotech |
cat |
| 8450-1004 |
SYNTHETIC SUBSTANCE P, Product Type Purified Protein, Specificity SUBSTANCE P, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
195-Eur |
AbD Serotec |
cat |
| SCH-4497-1060 |
SYNTHETIC DYKDDDDK TAG, Product Type Purified Protein, Specificity DYKDDDDK TAG, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
cat |
| SCH-PRP06 |
RAT IgG2c KAPPA , Product Type Purified Protein, Specificity IgG2c, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR304 |
1 mg |
759-Eur |
Serotech |
cat |
| SCH-6420-3006 |
NATIVE HUMAN MBP, Product Type Purified Protein, Specificity MBP, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
255-Eur |
Serotech |
human |
| PAS9343 |
Polyclonal antibody: Cerebral : NEURONAL SPECIFIC ENOLASE (NSE) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9409 |
Polyclonal antibody: Metabolic : PLASMINOGEN ACTIVATOR INHIBITOR 1 (PAI-1) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| 6420-0100 |
NATIVE BOVINE MBP, Product Type Purified Protein, Specificity MBP, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
195-Eur |
AbD Serotec |
cat |
| PRP02 |
RAT IgG1 KAPPA , Product Type Purified Protein, Specificity IgG1, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR27 |
1 mg |
444-Eur |
AbD Serotec |
cat |
| SCH-2148-1004 |
NATIVE PIG COLIPASE, Product Type Purified Protein, Specificity COLIPASE, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
231-Eur |
Serotech |
recombinant |
| 4560-6404 |
NATIVE HUMAN FSH, Product Type Purified Protein, Specificity FSH, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
290-Eur |
AbD Serotec |
human |
| PAS9395 |
Polyclonal antibody: Interleukins : INTERLEUKIN 1 RECEPTOR ANTAGONIST (IL-1Ra) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-0200-0497 |
SYNTHETIC RAT TGF BETA 3, Product Type Purified Protein, Specificity TGF BETA 3, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
cat |
| 9420-0002 |
NATIVE ULEX EUROPAEUS LECTIN 1, Product Type Purified Protein, Specificity ALPHA_L_FUCOSE, Target Species Broad, Host N_A, Format Purified, Isotypes , Applications E, Clone [Discontinued] [DISC |
1 mg |
160-Eur |
AbD Serotec |
cat |
| 0100-0253 |
NATIVE BOVINE BMP COCKTAIL, Product Type Purified Protein, Specificity BMP, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 µg |
278-Eur |
AbD Serotec |
cat |
| PAS9405 |
Polyclonal antibody: Biochemical Messengers : RETINOL BINDING PROTEIN Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| 1406-1159 |
SYNTHETIC RAT BMP_6 (aa17_30), Product Type Purified Protein, Specificity BMP_6 , Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
cat |
| 0152-0507 |
NATIVE ADENOVIRUS, Product Type Purified Protein, Specificity ADENOVIRUS, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 ml |
290-Eur |
AbD Serotec |
cat |
| SCH-0152-0507 |
NATIVE ADENOVIRUS, Product Type Purified Protein, Specificity ADENOVIRUS, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 ml |
290-Eur |
Serotech |
cat |
| PAS9402 |
Polyclonal antibody: Cytokines : GRANULOCYTE MACROPHAGE COLONY STIMULATING FACTOR (GM-CSF) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280 |
500 |
999-Eur |
RANDOX |
|
| PAS9726 |
Polyclonal antibody: Biochemical Messengers : SERUM AMYLOID A (SAA, HUMAN) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-7371-0107 |
SYNTHETIC PHOSPHOTYROSINE, Product Type Purified Protein, Specificity PHOSPHOTYROSINE, Target Species Chemical, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
243-Eur |
Serotech |
cat |
| SCH-1406-1159 |
SYNTHETIC RAT BMP_6 (aa17_30), Product Type Purified Protein, Specificity BMP_6 , Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
cat |
| 7371-0107 |
SYNTHETIC PHOSPHOTYROSINE, Product Type Purified Protein, Specificity PHOSPHOTYROSINE, Target Species Chemical, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
243-Eur |
AbD Serotec |
cat |
| PAS9354 |
Polyclonal antibody: Cardiac : INTERCELLULAR ADHESION MOLECULE 1 (ICAM-1) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9344 |
Polyclonal antibody: Chemokines : MACROPHAGE INFLAMMATORY PROTEIN 1 ALPHA (MIP-1a) AFFINITY PURIFIED, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-0100-0253 |
NATIVE BOVINE BMP COCKTAIL, Product Type Purified Protein, Specificity BMP, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 µg |
278-Eur |
Serotech |
cat |
| orb81948 |
Purified Mouse Apo AI protein Apolipoprotein AI (Apo AI), Mouse is a purified lipoprotein. For research use only. |
50 |
784-Eur |
Biorb |
mouse |
| orb82141 |
Purified Plasmin protein Plasmin is a purified platelets_hemostasis antigen. For research use only. |
1 mg |
178-Eur |
Biorb |
|
| orb82019 |
Purified SS-B (La) Antigen protein SS-B (La) Antigen is a purified autoimmune reagent. For research use only. |
1000 IU |
981-Eur |
Biorb |
|
| G-023-83 |
Spexin, Prepro (73_116) (Human) Purified IgG Antibody _ Purified IgG Antibody _ 200ug |
200 µg |
692-Eur |
Phoenix Peptide |
human |
| orb81949 |
Purified Hamster Apo AI protein Apolipoprotein AI (Apo AI), Hamster is a purified lipoprotein. For research use only. |
100 |
1407-Eur |
Biorb |
|
| PAS9367 |
Polyclonal antibody: Biochemical Messengers : CYCLIN-DEPENDENT KINASE 4 (CDK4) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| 1720-8502 |
SYNTHETIC SALMON CALCITONIN, Product Type Purified Protein, Specificity CALCITONIN, Target Species Fish, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
278-Eur |
AbD Serotec |
cat |
| SCH-1720-8502 |
SYNTHETIC SALMON CALCITONIN, Product Type Purified Protein, Specificity CALCITONIN, Target Species Fish, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
278-Eur |
Serotech |
cat |
| 9345-0002 |
NATIVE MUSHROOM TYROSINASE, Product Type Purified Protein, Specificity TYROSINASE, Target Species Fungal, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
100 mg |
290-Eur |
AbD Serotec |
cat |
| SCH-9345-0002 |
NATIVE MUSHROOM TYROSINASE, Product Type Purified Protein, Specificity TYROSINASE, Target Species Fungal, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
100 mg |
290-Eur |
Serotech |
cat |
| SCH-2150-1425 |
NATIVE COLLAGEN I (TAIL TENDON), Product Type Purified Protein, Specificity COLLAGEN I , Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
255-Eur |
Serotech |
cat |
| 2150-1425 |
NATIVE COLLAGEN I (TAIL TENDON), Product Type Purified Protein, Specificity COLLAGEN I , Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
255-Eur |
AbD Serotec |
cat |
| SCH-7130-0106 |
NATIVE CARICA PAPAYA PAPAIN, Product Type Purified Protein, Specificity PAPAIN, Target Species Plants, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
100 mg |
290-Eur |
Serotech |
cat |
| PAS9346 |
Polyclonal antibody: Cytokines : PLATELET-DERIVED GROWTH FACTOR A CHAIN (PDGF-A) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| PAS9347 |
Polyclonal antibody: Cytokines : PLATELET-DERIVED GROWTH FACTOR B CHAIN (PDGF-B) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| 7130-0106 |
NATIVE CARICA PAPAYA PAPAIN, Product Type Purified Protein, Specificity PAPAIN, Target Species Plants, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
100 mg |
290-Eur |
AbD Serotec |
cat |
| orb22192 |
Guinea Pig IgG Chromatographically purified guinea pig IgG. Purified guinea pig IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays inc |
10 mg |
457-Eur |
Biorb |
elisa |
| 730001S |
PROTEIN A, Product Type Purified Protein, Specificity PROTEIN A, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
172-Eur |
AbD Serotec |
cat |
| 730001L |
PROTEIN A, Product Type Purified Protein, Specificity PROTEIN A, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
409-Eur |
AbD Serotec |
cat |
| SCH-730001L |
PROTEIN A, Product Type Purified Protein, Specificity PROTEIN A, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
409-Eur |
Serotech |
cat |
| SCH-730001S |
PROTEIN A, Product Type Purified Protein, Specificity PROTEIN A, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
172-Eur |
Serotech |
cat |
| orb22136 |
Chicken IgG Chromatographically purified chicken IgG. Purified chicken IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including im |
10 mg |
260-Eur |
Biorb |
elisa |
| orb22193 |
Human Fab Of Normal IgG Chromatographically purified Fab fragment of human IgG. Purified human Fab may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of i |
10 mg |
539-Eur |
Biorb |
human |
| orb22135 |
Bovine IgG Chromatographically purified Bovine IgG. Purified Bovine IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immun |
100 mg |
457-Eur |
Biorb |
elisa |
| orb22143 |
Goat IgG Chromatographically purified goat IgG. Purified goat IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immunodiffu |
100 mg |
457-Eur |
Biorb |
elisa |
| SCH-PRP04 |
RAT IgG2a KAPPA , Product Type Purified Protein, Specificity IgG2a, Target Species Rat, Host N_A, Format Purified, Isotypes IgG2a, Applications E, Clone |
1 mg |
444-Eur |
Serotech |
cat |
| orb80238 |
Swine IgG Chromatographically purified swine IgG. Purified swine IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immunodif |
100 mg |
457-Eur |
Biorb |
elisa |
| PRP04 |
RAT IgG2a KAPPA , Product Type Purified Protein, Specificity IgG2a, Target Species Rat, Host N_A, Format Purified, Isotypes IgG2a, Applications E, Clone |
1 mg |
444-Eur |
AbD Serotec |
cat |
| orb22128 |
Human IgE Chromatographically purified monoclonal Human IgE kappa. Purified Human IgE may be used as a reference antigen, calibrator, coating protein in a variety of immunoassays including immunodiff |
0.1 mg |
441-Eur |
Biorb |
elisa |
| orb22196 |
Human IgG Chromatographically purified human IgG. Purified human IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immunodi |
100 mg |
457-Eur |
Biorb |
elisa |
| orb22423 |
Sheep IgG Chromatographically purified sheep IgG. Purified sheep IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immunodi |
100 mg |
457-Eur |
Biorb |
elisa |
| orb22292 |
Rabbit IgG Chromatographically purified Rabbit IgG. Purified Rabbit IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immun |
100 mg |
457-Eur |
Biorb |
elisa |
| orb22216 |
Mouse IgG Chromatographically purified Mouse IgG. Purified Mouse IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays including immunodi |
10 mg |
539-Eur |
Biorb |
elisa |
| orb80232 |
Rat Serum Albumin Chromatographically purified rat albumin. Purified rat albumin may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays includi |
10 mg |
195-Eur |
Biorb |
elisa |
| PAS9365 |
Polyclonal antibody: Cardiac : FATTY ACID BINDING PROTEIN (FABP) (MUSCLE AND HEART) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-7840-0604 |
NATIVE STAPHYLOCOCCUS AUREUS PROTEIN A, Product Type Purified Protein, Specificity PROTEIN A, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications IP, Clone |
5 mg |
326-Eur |
Serotech |
cat |
| 7840-0604 |
NATIVE STAPHYLOCOCCUS AUREUS PROTEIN A, Product Type Purified Protein, Specificity PROTEIN A, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications IP, Clone |
5 mg |
326-Eur |
AbD Serotec |
cat |
| orb22138 |
Chromatographically Purified Human IgA2(1+,2-) Lambda Chromatographically purified human IgA2 (1+,2-) lambda. Purified human IgA2 lambda may be used as a reference antigen, calibrator, coating protei |
0.5 mg |
457-Eur |
Biorb |
human |
| SCH-PMOP001 |
RHESUS MONKEY IgG, Product Type Purified Protein, Specificity IgG, Target Species Rhesus Monkey, Host N_A, Format Purified, Isotypes IgG, Applications IY, Clone |
2 mg |
219-Eur |
Serotech |
cat |
| PMOP001 |
RHESUS MONKEY IgG, Product Type Purified Protein, Specificity IgG, Target Species Rhesus Monkey, Host N_A, Format Purified, Isotypes IgG, Applications IY, Clone |
2 mg |
219-Eur |
AbD Serotec |
cat |
| SCH-PRABP01F |
PURIFIED RABBIT IgG FITC, Product Type Purified Protein, Specificity IgG, Target Species Rabbit, Host N_A, Format FITC, Isotypes Polyclonal IgG, Applications F, Clone |
0.1 mg |
326-Eur |
Serotech |
polyclonal |
| SCH-PMP79 |
NATIVE MOUSE OSTEOCALCIN , Product Type Purified Protein, Specificity OSTEOCALCIN, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 ng |
243-Eur |
Serotech |
cat |
| SCH-OBT1107F |
PURIFIED HAMSTER IgG FITC, Product Type Purified Protein, Specificity IgG, Target Species Hamster, Host N_A, Format FITC, Isotypes Polyclonal IgG, Applications F, Clone |
1 mg |
278-Eur |
Serotech |
polyclonal |
| AS07 208 |
Antibody: PR-2 | GLU I | class I beta-1,3-glucanase, Immunogen: purified tobacco class I, basic ß-1,3-glucanase. Purified GLU I consists of a mixture of closely related polypeptides encoded by a |
2 mg |
337-Eur |
Gentaur |
|
| PHP238 |
NATIVE HUMAN TRANSFERRIN , Product Type Purified Protein, Specificity TRANSFERRIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
296-Eur |
AbD Serotec |
human |
| SCH-PHP239 |
NATIVE HUMAN LACTOFERRIN , Product Type Purified Protein, Specificity LACTOFERRIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
148-Eur |
Serotech |
human |
| SCH-PHP238 |
NATIVE HUMAN TRANSFERRIN , Product Type Purified Protein, Specificity TRANSFERRIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
296-Eur |
Serotech |
human |
| OBT1107F |
PURIFIED HAMSTER IgG FITC, Product Type Purified Protein, Specificity IgG, Target Species Hamster, Host N_A, Format FITC, Isotypes Polyclonal IgG, Applications F, Clone |
1 mg |
278-Eur |
AbD Serotec |
polyclonal |
| PMP79 |
NATIVE MOUSE OSTEOCALCIN , Product Type Purified Protein, Specificity OSTEOCALCIN, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 ng |
243-Eur |
AbD Serotec |
cat |
| PRABP01F |
PURIFIED RABBIT IgG FITC, Product Type Purified Protein, Specificity IgG, Target Species Rabbit, Host N_A, Format FITC, Isotypes Polyclonal IgG, Applications F, Clone |
0.1 mg |
326-Eur |
AbD Serotec |
polyclonal |
| PHP010 |
HUMAN IgG1 KAPPA , Product Type Purified Protein, Specificity IgG1, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
385-Eur |
AbD Serotec |
human |
| SCH-143001 |
NATIVE GOAT FIBRONECTIN, Product Type Purified Protein, Specificity FIBRONECTIN, Target Species Goat, Host N_A, Format Purified, Isotypes , Applications E, WB, Clone |
1 mg |
255-Eur |
Serotech |
polyclonal |
| 143001 |
NATIVE GOAT FIBRONECTIN, Product Type Purified Protein, Specificity FIBRONECTIN, Target Species Goat, Host N_A, Format Purified, Isotypes , Applications E, WB, Clone |
1 mg |
255-Eur |
AbD Serotec |
polyclonal |
| PHP012 |
HUMAN IgG2 KAPPA , Product Type Purified Protein, Specificity IgG2, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
326-Eur |
AbD Serotec |
human |
| PHP239 |
NATIVE HUMAN LACTOFERRIN , Product Type Purified Protein, Specificity LACTOFERRIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
148-Eur |
AbD Serotec |
human |
| SCH-PHP012 |
HUMAN IgG2 KAPPA , Product Type Purified Protein, Specificity IgG2, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
326-Eur |
Serotech |
human |
| AS09 549 |
Antibody: HRP | horseradish peroxidase, Affinity purified, Immunogen: native peroxidase isolated and purified from horseradish, Host: rabbit, polyclonal, Confirmed reactivity: Armoracia rusticana |
1 mg |
438-Eur |
Gentaur |
|
| SCH-PHP236 |
NATIVE HUMAN THYROGLOBULIN , Product Type Purified Protein, Specificity THYROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
338-Eur |
Serotech |
human |
| SCH-PHP010 |
HUMAN IgG1 KAPPA , Product Type Purified Protein, Specificity IgG1, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
385-Eur |
Serotech |
human |
| PHP236 |
NATIVE HUMAN THYROGLOBULIN , Product Type Purified Protein, Specificity THYROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
338-Eur |
AbD Serotec |
human |
| AS10 799 |
Antibody: Goat anti-human IgG Fc, Affinity purified, Unconjugated, min. cross-reactivity to human IgA+IgM, affinity purified, polyclonal |
1 mg |
210-Eur |
Gentaur |
|
| orb82275 |
Purified Bovine Osteonectin protein Osteonectin, Bovine (SPARC), (BM-40) is a purified reagent for bone and calcium metabolism. For research use only. |
50 |
424-Eur |
Biorb |
bovine |
| 2150-0150 |
NATIVE HUMAN COLLAGEN IV, Product Type Purified Protein, Specificity COLLAGEN IV, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
385-Eur |
AbD Serotec |
human |
| 9202-1107 |
NATIVE HUMAN TROPONIN T, Product Type Purified Protein, Specificity TROPONIN T, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
361-Eur |
AbD Serotec |
human |
| SCH-8640-0502 |
NATIVE HUMAN TENASCIN , Product Type Purified Protein, Specificity TENASCIN , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
581-Eur |
Serotech |
human |
| 2150-0230 |
NATIVE HUMAN COLLAGEN VI, Product Type Purified Protein, Specificity COLLAGEN VI, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
231-Eur |
AbD Serotec |
human |
| 4420-4804 |
NATIVE HUMAN FERRITIN, Product Type Purified Protein, Specificity FERRITIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications F, Clone |
1 mg |
207-Eur |
AbD Serotec |
human |
| 2150-0190 |
NATIVE HUMAN COLLAGEN V, Product Type Purified Protein, Specificity COLLAGEN V, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
385-Eur |
AbD Serotec |
human |
| 5980-0957 |
NATIVE HUMAN PRO_MMP_9, Product Type Purified Protein, Specificity PRO_MMP_9, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
5 µg |
397-Eur |
AbD Serotec |
human |
| SCH-2150-0555 |
NATIVE BOVINE COLLAGEN III, Product Type Purified Protein, Specificity COLLAGEN III, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
219-Eur |
Serotech |
cat |
| 2150-0555 |
NATIVE BOVINE COLLAGEN III, Product Type Purified Protein, Specificity COLLAGEN III, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
219-Eur |
AbD Serotec |
cat |
| 6450-1104 |
NATIVE HUMAN MYOGLOBIN, Product Type Purified Protein, Specificity MYOGLOBIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.25 mg |
219-Eur |
AbD Serotec |
human |
| 8900-1004 |
NATIVE HUMAN THYROGLOBULIN, Product Type Purified Protein, Specificity THYROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
314-Eur |
AbD Serotec |
human |
| SCH-5220-2959 |
MONOCLONAL MOUSE IgG1, Product Type Purified Protein, Specificity IgG1, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
290-Eur |
Serotech |
monoclonal |
| SCH-4620-1504 |
SYNTHETIC HUMAN GASTRIN 34, Product Type Purified Protein, Specificity GASTRIN 34, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
231-Eur |
Serotech |
human |
| 2150-0030 |
NATIVE HUMAN COLLAGEN I, Product Type Purified Protein, Specificity COLLAGEN I, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
409-Eur |
AbD Serotec |
human |
| 8900-1354 |
NATIVE BOVINE THYROGLOBULIN, Product Type Purified Protein, Specificity THYROGLOBULIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
290-Eur |
AbD Serotec |
cat |
| 8040-0106 |
NATIVE BOVINE RIBONUCLEASE A, Product Type Purified Protein, Specificity RIBONUCLEASE A, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
100 mg |
350-Eur |
AbD Serotec |
cat |
| 5390-0004 |
NATIVE PIG INTRINSIC FACTOR, Product Type Purified Protein, Specificity INTRINSIC FACTOR, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
1 KU |
830-Eur |
AbD Serotec |
cat |
| 0560-0609 |
SYNTHETIC HUMAN ANGIOTENSIN II, Product Type Purified Protein, Specificity ANGIOTENSIN II, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
118-Eur |
AbD Serotec |
human |
| 2150-0515 |
NATIVE BOVINE COLLAGEN I, Product Type Purified Protein, Specificity COLLAGEN I, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
219-Eur |
AbD Serotec |
cat |
| PAS9354 |
Polyclonal antibody: Adhesion Molecules : INTERCELLULAR ADHESION MOLECULE 1 (ICAM-1) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| SCH-1740-2384 |
NATIVE BOVINE CALMODULIN, Product Type Purified Protein, Specificity CALMODULIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
373-Eur |
Serotech |
cat |
| 5620-0604 |
NATIVE HUMAN LAMININ, Product Type Purified Protein, Specificity LAMININ, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
0.1 mg |
338-Eur |
AbD Serotec |
human |
| 0560-1509 |
SYNTHETIC HUMAN ANGIOTENSIN III, Product Type Purified Protein, Specificity ANGIOTENSIN III, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
160-Eur |
AbD Serotec |
human |
| SCH-0200-0131 |
NATIVE SHEEP COX_2, Product Type Purified Protein, Specificity COX_2, Target Species Sheep, Host N_A, Format Purified, Isotypes , Applications WB, Clone |
10 µg |
338-Eur |
Serotech |
cat |
| 1500-0059 |
SYNTHETIC HUMAN BRADYKININ, Product Type Purified Protein, Specificity BRADYKININ, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
118-Eur |
AbD Serotec |
human |
| 5720-8104 |
NATIVE PIG LUTEINIZING HORMONE, Product Type Purified Protein, Specificity LUTEINIZING HORMONE, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
0.1 mg |
652-Eur |
AbD Serotec |
cat |
| SCH-7870-6200 |
SYNTHETIC HUMAN DECORIN, Product Type Purified Protein, Specificity DECORIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| SCH-7060-9031 |
SYNTHETIC HUMAN OSTEOPONTIN, Product Type Purified Protein, Specificity OSTEOPONTIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| SCH-2150-0230 |
NATIVE HUMAN COLLAGEN VI, Product Type Purified Protein, Specificity COLLAGEN VI, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
231-Eur |
Serotech |
human |
| SCH-6490-3004 |
NATIVE RABBIT MYOSIN, Product Type Purified Protein, Specificity MYOSIN, Target Species Rabbit, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
255-Eur |
Serotech |
polyclonal |
| SCH-7060-1855 |
NATIVE MOUSE OSTEOCALCIN, Product Type Purified Protein, Specificity OSTEOCALCIN, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 ng |
409-Eur |
Serotech |
cat |
| SCH-7060-1054 |
NATIVE BOVINE OSTEOCALCIN, Product Type Purified Protein, Specificity OSTEOCALCIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 µg |
409-Eur |
Serotech |
cat |
| 4620-1504 |
SYNTHETIC HUMAN GASTRIN 34, Product Type Purified Protein, Specificity GASTRIN 34, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
231-Eur |
AbD Serotec |
human |
| 1716-7060 |
SYNTHETIC HUMAN CALBINDIN, Product Type Purified Protein, Specificity CALBINDIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| 4400-9554 |
NATIVE HUMAN FACTOR H, Product Type Purified Protein, Specificity FACTOR H, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.25 mg |
872-Eur |
AbD Serotec |
human |
| 1740-2384 |
NATIVE BOVINE CALMODULIN, Product Type Purified Protein, Specificity CALMODULIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
373-Eur |
AbD Serotec |
cat |
| SCH-1820-5904 |
NATIVE HUMAN CD66e, Product Type Purified Protein, Specificity CD66e, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
492-Eur |
Serotech |
human |
| 0650-1004 |
NATIVE HUMAN APOLIPOPROTEIN B, Product Type Purified Protein, Specificity APOLIPOPROTEIN B, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
290-Eur |
AbD Serotec |
human |
| 0650-0311 |
NATIVE HUMAN APOLIPOPROTEIN A1, Product Type Purified Protein, Specificity APOLIPOPROTEIN A1, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
290-Eur |
AbD Serotec |
human |
| 0560-1529 |
SYNTHETIC HUMAN ANGIOTENSIN IV, Product Type Purified Protein, Specificity ANGIOTENSIN IV, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
160-Eur |
AbD Serotec |
human |
| 8640-0502 |
NATIVE HUMAN TENASCIN , Product Type Purified Protein, Specificity TENASCIN , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
581-Eur |
AbD Serotec |
human |
| 1406-0830 |
SYNTHETIC HUMAN BMP_4, Product Type Purified Protein, Specificity BMP_4, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| 7870-6160 |
SYNTHETIC HUMAN PROTEOGLYCAN 1, Product Type Purified Protein, Specificity PROTEOGLYCAN 1, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| SCH-1500-0309 |
SYNTHETIC HUMAN KALLIDIN II, Product Type Purified Protein, Specificity KALLIDIN II, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
160-Eur |
Serotech |
human |
| SCH-2150-0150 |
NATIVE HUMAN COLLAGEN IV, Product Type Purified Protein, Specificity COLLAGEN IV, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
385-Eur |
Serotech |
human |
| SCH-7750-0609 |
SYNTHETIC HUMAN C_PEPTIDE, Product Type Purified Protein, Specificity C_PEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
385-Eur |
Serotech |
human |
| 0619-9010 |
SYNTHETIC YEAST ANTIPAIN, Product Type Purified Protein, Specificity ANTIPAIN, Target Species Yeast, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
195-Eur |
AbD Serotec |
cat |
| SCH-0619-9010 |
SYNTHETIC YEAST ANTIPAIN, Product Type Purified Protein, Specificity ANTIPAIN, Target Species Yeast, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
195-Eur |
Serotech |
cat |
| 2100-0202 |
NATIVE BOVINE CHYMOTRYPSIN, Product Type Purified Protein, Specificity CHYMOTRYPSIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
207-Eur |
AbD Serotec |
cat |
| SCH-2150-0190 |
NATIVE HUMAN COLLAGEN V, Product Type Purified Protein, Specificity COLLAGEN V, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
385-Eur |
Serotech |
human |
| SCH-9400-1502 |
NATIVE BOVINE UBIQUITIN, Product Type Purified Protein, Specificity UBIQUITIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
25 mg |
350-Eur |
Serotech |
cat |
| SCH-7750-0502 |
SYNTHETIC HUMAN C_PEPTIDE, Product Type Purified Protein, Specificity C_PEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
266-Eur |
Serotech |
human |
| SCH-1406-0830 |
SYNTHETIC HUMAN BMP_4, Product Type Purified Protein, Specificity BMP_4, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| SCH-4400-9554 |
NATIVE HUMAN FACTOR H, Product Type Purified Protein, Specificity FACTOR H, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.25 mg |
872-Eur |
Serotech |
human |
| 4890-0504 |
NATIVE HUMAN HAPTOGLOBIN, Product Type Purified Protein, Specificity HAPTOGLOBIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
243-Eur |
AbD Serotec |
human |
| SCH-0560-0609 |
SYNTHETIC HUMAN ANGIOTENSIN II, Product Type Purified Protein, Specificity ANGIOTENSIN II, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
118-Eur |
Serotech |
human |
| SCH-5720-8104 |
NATIVE PIG LUTEINIZING HORMONE, Product Type Purified Protein, Specificity LUTEINIZING HORMONE, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
0.1 mg |
652-Eur |
Serotech |
cat |
| 7750-0609 |
SYNTHETIC HUMAN C_PEPTIDE, Product Type Purified Protein, Specificity C_PEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
385-Eur |
AbD Serotec |
human |
| 7060-9031 |
SYNTHETIC HUMAN OSTEOPONTIN, Product Type Purified Protein, Specificity OSTEOPONTIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| SCH-2050-0704 |
SYNTHETIC HUMAN CHOLECYSTOKININ, Product Type Purified Protein, Specificity CHOLECYSTOKININ, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
160-Eur |
Serotech |
human |
| SCH-4450-6002 |
SYNTHETIC HUMAN FIBRINOPEPTIDE A, Product Type Purified Protein, Specificity FIBRINOPEPTIDE A, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
160-Eur |
Serotech |
human |
| SCH-4440-8604 |
NATIVE HUMAN FIBRINOGEN, Product Type Purified Protein, Specificity FIBRINOGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
25 mg |
160-Eur |
Serotech |
human |
| SCH-4870-2002 |
NATIVE BOVINE HEMOGLOBIN, Product Type Purified Protein, Specificity HEMOGLOBIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 g |
195-Eur |
Serotech |
cat |
| SCH-0560-1509 |
SYNTHETIC HUMAN ANGIOTENSIN III, Product Type Purified Protein, Specificity ANGIOTENSIN III, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
160-Eur |
Serotech |
human |
| SCH-0560-1529 |
SYNTHETIC HUMAN ANGIOTENSIN IV, Product Type Purified Protein, Specificity ANGIOTENSIN IV, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
160-Eur |
Serotech |
human |
| 0300-0025 |
SYNTHETIC HUMAN VEGF, Product Type Purified Protein, Specificity VEGF, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| SCH-2150-0515 |
NATIVE BOVINE COLLAGEN I, Product Type Purified Protein, Specificity COLLAGEN I, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
219-Eur |
Serotech |
cat |
| 9110-0300 |
NATIVE HUMAN CD71, Product Type Purified Protein, Specificity CD71, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
20 µg |
255-Eur |
AbD Serotec |
human |
| 9110-0320 |
NATIVE HUMAN CD71, Product Type Purified Protein, Specificity CD71, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
581-Eur |
AbD Serotec |
human |
| 4440-0256 |
NATIVE HUMAN D_DIMER, Product Type Purified Protein, Specificity D_DIMER, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
338-Eur |
AbD Serotec |
human |
| 0200-0131 |
NATIVE SHEEP COX_2, Product Type Purified Protein, Specificity COX_2, Target Species Sheep, Host N_A, Format Purified, Isotypes , Applications WB, Clone |
10 µg |
338-Eur |
AbD Serotec |
cat |
| 7750-0502 |
SYNTHETIC HUMAN C_PEPTIDE, Product Type Purified Protein, Specificity C_PEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
266-Eur |
AbD Serotec |
human |
| SCH-4420-4804 |
NATIVE HUMAN FERRITIN, Product Type Purified Protein, Specificity FERRITIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications F, Clone |
1 mg |
207-Eur |
Serotech |
human |
| SCH-8040-0106 |
NATIVE BOVINE RIBONUCLEASE A, Product Type Purified Protein, Specificity RIBONUCLEASE A, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
100 mg |
350-Eur |
Serotech |
cat |
| SCH-0300-0025 |
SYNTHETIC HUMAN VEGF, Product Type Purified Protein, Specificity VEGF, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| 4670-1617 |
SYNTHETIC RAT GLUCOSE TRANSPORTER 1, Product Type Purified Protein, Specificity GLUCOSE TRANSPORTER 1, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
231-Eur |
AbD Serotec |
cat |
| SCH-7870-6160 |
SYNTHETIC HUMAN PROTEOGLYCAN 1, Product Type Purified Protein, Specificity PROTEOGLYCAN 1, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| 7600-0604 |
NATIVE HUMAN PREALBUMIN, Product Type Purified Protein, Specificity PREALBUMIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
255-Eur |
AbD Serotec |
human |
| SCH-7370-9902 |
NATIVE RABBIT PHOSPHORYLASE B, Product Type Purified Protein, Specificity PHOSPHORYLASE B, Target Species Rabbit, Host N_A, Format Purified, Isotypes , Applications E, Clone |
25 mg |
195-Eur |
Serotech |
polyclonal |
| SCH-9110-0300 |
NATIVE HUMAN CD71, Product Type Purified Protein, Specificity CD71, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
20 µg |
255-Eur |
Serotech |
human |
| SCH-6730-0604 |
SYNTHETIC HUMAN NEUROPEPTIDE Y, Product Type Purified Protein, Specificity NEUROPEPTIDE Y, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
195-Eur |
Serotech |
human |
| SCH-9110-0320 |
NATIVE HUMAN CD71, Product Type Purified Protein, Specificity CD71, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
581-Eur |
Serotech |
human |
| orb90093 |
Human FK506 Binding Protein 1A protein FKPB1A Human Recombinant fused to N-terminal His-Tag produced in E.coli is a single, non-glycosylated polypeptide chain purified purified through Ni2+-affinity c |
2 |
154-Eur |
Biorb |
recombinant |
| SCH-2100-0202 |
NATIVE BOVINE CHYMOTRYPSIN, Product Type Purified Protein, Specificity CHYMOTRYPSIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
207-Eur |
Serotech |
cat |
| 2050-0704 |
SYNTHETIC HUMAN CHOLECYSTOKININ, Product Type Purified Protein, Specificity CHOLECYSTOKININ, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
160-Eur |
AbD Serotec |
human |
| SCH-5030-9954 |
NATIVE BOVINE HYALURONIDASE, Product Type Purified Protein, Specificity HYALURONIDASE, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 g |
207-Eur |
Serotech |
cat |
| SCH-5980-0957 |
NATIVE HUMAN PRO_MMP_9, Product Type Purified Protein, Specificity PRO_MMP_9, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
5 µg |
397-Eur |
Serotech |
human |
| 7060-1855 |
NATIVE MOUSE OSTEOCALCIN, Product Type Purified Protein, Specificity OSTEOCALCIN, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 ng |
409-Eur |
AbD Serotec |
cat |
| SCH-9202-1107 |
NATIVE HUMAN TROPONIN T, Product Type Purified Protein, Specificity TROPONIN T, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
361-Eur |
Serotech |
human |
| 7060-1054 |
NATIVE BOVINE OSTEOCALCIN, Product Type Purified Protein, Specificity OSTEOCALCIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 µg |
409-Eur |
AbD Serotec |
cat |
| SCH-5620-0604 |
NATIVE HUMAN LAMININ, Product Type Purified Protein, Specificity LAMININ, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
0.1 mg |
338-Eur |
Serotech |
human |
| 5545-0202 |
SYNTHETIC HUMAN KATACALCIN, Product Type Purified Protein, Specificity KATACALCIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
160-Eur |
AbD Serotec |
human |
| 4561-8509 |
SYNTHETIC HUMAN FSH RECEPTOR, Product Type Purified Protein, Specificity FSH RECEPTOR, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
recombinant |
| 6730-0604 |
SYNTHETIC HUMAN NEUROPEPTIDE Y, Product Type Purified Protein, Specificity NEUROPEPTIDE Y, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
195-Eur |
AbD Serotec |
human |
| 5220-2959 |
MONOCLONAL MOUSE IgG1, Product Type Purified Protein, Specificity IgG1, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
290-Eur |
AbD Serotec |
monoclonal |
| SCH-5980-0357 |
NATIVE HUMAN MMP_3, Product Type Purified Protein, Specificity MMP_3, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 µg |
290-Eur |
Serotech |
human |
| SCH-8900-1354 |
NATIVE BOVINE THYROGLOBULIN, Product Type Purified Protein, Specificity THYROGLOBULIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 mg |
290-Eur |
Serotech |
cat |
| SCH-6450-1104 |
NATIVE HUMAN MYOGLOBIN, Product Type Purified Protein, Specificity MYOGLOBIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.25 mg |
219-Eur |
Serotech |
human |
| SCH-4670-1617 |
SYNTHETIC RAT GLUCOSE TRANSPORTER 1, Product Type Purified Protein, Specificity GLUCOSE TRANSPORTER 1, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
231-Eur |
Serotech |
cat |
| 4450-6002 |
SYNTHETIC HUMAN FIBRINOPEPTIDE A, Product Type Purified Protein, Specificity FIBRINOPEPTIDE A, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
160-Eur |
AbD Serotec |
human |
| 7370-9902 |
NATIVE RABBIT PHOSPHORYLASE B, Product Type Purified Protein, Specificity PHOSPHORYLASE B, Target Species Rabbit, Host N_A, Format Purified, Isotypes , Applications E, Clone |
25 mg |
195-Eur |
AbD Serotec |
polyclonal |
| SCH-5390-0004 |
NATIVE PIG INTRINSIC FACTOR, Product Type Purified Protein, Specificity INTRINSIC FACTOR, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
1 KU |
830-Eur |
Serotech |
cat |
| 1500-0309 |
SYNTHETIC HUMAN KALLIDIN II, Product Type Purified Protein, Specificity KALLIDIN II, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
160-Eur |
AbD Serotec |
human |
| SCH-1716-7060 |
SYNTHETIC HUMAN CALBINDIN, Product Type Purified Protein, Specificity CALBINDIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| 7770-1104 |
NATIVE HUMAN PROLACTIN, Product Type Purified Protein, Specificity PROLACTIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
0.1 mg |
444-Eur |
AbD Serotec |
human |
| SCH-1500-0059 |
SYNTHETIC HUMAN BRADYKININ, Product Type Purified Protein, Specificity BRADYKININ, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
118-Eur |
Serotech |
human |
| 5030-9954 |
NATIVE BOVINE HYALURONIDASE, Product Type Purified Protein, Specificity HYALURONIDASE, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 g |
207-Eur |
AbD Serotec |
cat |
| SCH-0650-1004 |
NATIVE HUMAN APOLIPOPROTEIN B, Product Type Purified Protein, Specificity APOLIPOPROTEIN B, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
290-Eur |
Serotech |
human |
| 4440-8604 |
NATIVE HUMAN FIBRINOGEN, Product Type Purified Protein, Specificity FIBRINOGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
25 mg |
160-Eur |
AbD Serotec |
human |
| 7870-6200 |
SYNTHETIC HUMAN DECORIN, Product Type Purified Protein, Specificity DECORIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| 5980-0357 |
NATIVE HUMAN MMP_3, Product Type Purified Protein, Specificity MMP_3, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 µg |
290-Eur |
AbD Serotec |
human |
| SCH-5545-0202 |
SYNTHETIC HUMAN KATACALCIN, Product Type Purified Protein, Specificity KATACALCIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
160-Eur |
Serotech |
human |
| 4870-2002 |
NATIVE BOVINE HEMOGLOBIN, Product Type Purified Protein, Specificity HEMOGLOBIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 g |
195-Eur |
AbD Serotec |
cat |
| SCH-7600-0604 |
NATIVE HUMAN PREALBUMIN, Product Type Purified Protein, Specificity PREALBUMIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
255-Eur |
Serotech |
human |
| 9400-1502 |
NATIVE BOVINE UBIQUITIN, Product Type Purified Protein, Specificity UBIQUITIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
25 mg |
350-Eur |
AbD Serotec |
cat |
| SCH-0650-0311 |
NATIVE HUMAN APOLIPOPROTEIN A1, Product Type Purified Protein, Specificity APOLIPOPROTEIN A1, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.5 mg |
290-Eur |
Serotech |
human |
| SCH-8900-1004 |
NATIVE HUMAN THYROGLOBULIN, Product Type Purified Protein, Specificity THYROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
314-Eur |
Serotech |
human |
| AS09 544 |
Antibody: GLYR | glyoxylate reductase, Affinity purified, Immunogen: native glyoxylate reductase purified from spinach, Host: rabbit, polyclonal, Confirmed reactivity: Spinacia oleracea |
1 mg |
438-Eur |
Gentaur |
|
| AS09 451 |
Antibody: GLUC | beta-glucosidase, Affinity purified, Immunogen: native beta- glucosidase purified from almonds, Host: rabbit, polyclonal, Confirmed reactivity: Prunus dulcis |
1 mg |
438-Eur |
Gentaur |
|
| 1820-5904 |
NATIVE HUMAN CD66e, Product Type Purified Protein, Specificity CD66e, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
492-Eur |
AbD Serotec |
human |
| SCH-4440-0256 |
NATIVE HUMAN D_DIMER, Product Type Purified Protein, Specificity D_DIMER, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
338-Eur |
Serotech |
human |
| SCH-4890-0504 |
NATIVE HUMAN HAPTOGLOBIN, Product Type Purified Protein, Specificity HAPTOGLOBIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
243-Eur |
Serotech |
human |
| SCH-7770-1104 |
NATIVE HUMAN PROLACTIN, Product Type Purified Protein, Specificity PROLACTIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
0.1 mg |
444-Eur |
Serotech |
human |
| AS09 650 |
Antibody: Alpha-mannosidase, Affinity purified, Immunogen: native alpha-mannosidase purified from jack beans, Host: rabbit, polyclonal, Confirmed reactivity: Canavalia ensiformis |
1 mg |
426-Eur |
Gentaur |
|
| 8350-1250 |
SYNTHETIC HUMAN SPASTIN, Product Type Purified Protein, Specificity SPASTIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| 6490-3004 |
NATIVE RABBIT MYOSIN, Product Type Purified Protein, Specificity MYOSIN, Target Species Rabbit, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
255-Eur |
AbD Serotec |
polyclonal |
| SCH-4561-8509 |
SYNTHETIC HUMAN FSH RECEPTOR, Product Type Purified Protein, Specificity FSH RECEPTOR, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
recombinant |
| SCH-2150-0030 |
NATIVE HUMAN COLLAGEN I, Product Type Purified Protein, Specificity COLLAGEN I, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
409-Eur |
Serotech |
human |
| SCH-8350-1250 |
SYNTHETIC HUMAN SPASTIN, Product Type Purified Protein, Specificity SPASTIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| SCH-1406-1290 |
SYNTHETIC HUMAN BMP_7 (aa1_14), Product Type Purified Protein, Specificity BMP_7 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| 6400-2504 |
NATIVE MYCOPLASMA PNEUMONIAE, Product Type Purified Protein, Specificity MYCOPLASMA PNEUMONIAE, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 ml |
266-Eur |
AbD Serotec |
cat |
| 7270-1704 |
NATIVE HORSERADISH PEROXIDASE, Product Type Purified Protein, Specificity HORSERADISH PEROXIDASE, Target Species Plants, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 mg |
255-Eur |
AbD Serotec |
cat |
| 5596-0009 |
SYNTHETIC BOVINE KYOTORPHIN (BRAIN), Product Type Purified Protein, Specificity KYOTORPHIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 mg |
160-Eur |
AbD Serotec |
cat |
| 0240-0504 |
NATIVE YEAST ALCOHOL DEHYDROGENASE, Product Type Purified Protein, Specificity ALCOHOL DEHYDROGENASE, Target Species , Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
75000 UNITS |
255-Eur |
AbD Serotec |
cat |
| SCH-9202-0707 |
NATIVE HUMAN TROPONIN I (CARDIAC), Product Type Purified Protein, Specificity TROPONIN I, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 µg |
409-Eur |
Serotech |
human |
| SCH-4050-0184 |
NATIVE HUMAN ELASTASE (NEUTROPHIL), Product Type Purified Protein, Specificity ELASTASE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
409-Eur |
Serotech |
human |
| 0300-1706 |
NATIVE CALF ALKALINE PHOSPHATASE, Product Type Purified Protein, Specificity ALKALINE PHOSPHATASE, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
130-Eur |
AbD Serotec |
cat |
| SCH-7270-1704 |
NATIVE HORSERADISH PEROXIDASE, Product Type Purified Protein, Specificity HORSERADISH PEROXIDASE, Target Species Plants, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 mg |
255-Eur |
Serotech |
cat |
| SCH-5596-0009 |
SYNTHETIC BOVINE KYOTORPHIN (BRAIN), Product Type Purified Protein, Specificity KYOTORPHIN, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 mg |
160-Eur |
Serotech |
cat |
| 5329-4102 |
SYNTHETIC HUMAN INSULIN B CHAIN, Product Type Purified Protein, Specificity INSULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
231-Eur |
AbD Serotec |
human |
| 4050-0184 |
NATIVE HUMAN ELASTASE (NEUTROPHIL), Product Type Purified Protein, Specificity ELASTASE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
409-Eur |
AbD Serotec |
human |
| 4670-5144 |
SYNTHETIC HUMAN GluR2 (aa831_842), Product Type Purified Protein, Specificity GluR2 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| SCH-5329-4102 |
SYNTHETIC HUMAN INSULIN B CHAIN, Product Type Purified Protein, Specificity INSULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
231-Eur |
Serotech |
human |
| SCH-9220-2102 |
NATIVE TRYPSIN INHIBITOR, Product Type Purified Protein, Specificity TRYPSIN INHIBITOR, Target Species Plants, Host N_A, Format Purified, Isotypes , Applications E, Clone |
250 mg |
290-Eur |
Serotech |
cat |
| SCH-6380-1004 |
NATIVE MUMPS VIRUS, Product Type Purified Protein, Specificity MUMPS VIRUS, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 ml |
290-Eur |
Serotech |
cat |
| 0195-8080 |
SYNTHETIC HUMAN AGGRECAN (aa4_17), Product Type Purified Protein, Specificity AGGRECAN , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
recombinant |
| 6380-1004 |
NATIVE MUMPS VIRUS, Product Type Purified Protein, Specificity MUMPS VIRUS, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 ml |
290-Eur |
AbD Serotec |
cat |
| SCH-4670-5144 |
SYNTHETIC HUMAN GluR2 (aa831_842), Product Type Purified Protein, Specificity GluR2 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| SCH-0300-1706 |
NATIVE CALF ALKALINE PHOSPHATASE, Product Type Purified Protein, Specificity ALKALINE PHOSPHATASE, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
130-Eur |
Serotech |
cat |
| 1406-1290 |
SYNTHETIC HUMAN BMP_7 (aa1_14), Product Type Purified Protein, Specificity BMP_7 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| SCH-0240-0504 |
NATIVE YEAST ALCOHOL DEHYDROGENASE, Product Type Purified Protein, Specificity ALCOHOL DEHYDROGENASE, Target Species , Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
75000 UNITS |
255-Eur |
Serotech |
cat |
| 9220-2102 |
NATIVE TRYPSIN INHIBITOR, Product Type Purified Protein, Specificity TRYPSIN INHIBITOR, Target Species Plants, Host N_A, Format Purified, Isotypes , Applications E, Clone |
250 mg |
290-Eur |
AbD Serotec |
cat |
| 9202-0707 |
NATIVE HUMAN TROPONIN I (CARDIAC), Product Type Purified Protein, Specificity TROPONIN I, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 µg |
409-Eur |
AbD Serotec |
human |
| SCH-6400-2504 |
NATIVE MYCOPLASMA PNEUMONIAE, Product Type Purified Protein, Specificity MYCOPLASMA PNEUMONIAE, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 ml |
266-Eur |
Serotech |
cat |
| SCH-0195-8080 |
SYNTHETIC HUMAN AGGRECAN (aa4_17), Product Type Purified Protein, Specificity AGGRECAN , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
recombinant |
| orb82278 |
Purified Bovine Osteocalcin protein Osteocalcin, Bovine is a purified reagent for bone and calcium metabolism. For research use only. |
100 |
441-Eur |
Biorb |
bovine |
| SCH-5575-5539 |
NATIVE HUMAN KININOGEN HMW DOUBLE CHAIN, Product Type Purified Protein, Specificity KININOGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
231-Eur |
Serotech |
human |
| 5575-5539 |
NATIVE HUMAN KININOGEN HMW DOUBLE CHAIN, Product Type Purified Protein, Specificity KININOGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
231-Eur |
AbD Serotec |
human |
| SCH-5575-5559 |
NATIVE HUMAN KININOGEN HMW SINGLE CHAIN, Product Type Purified Protein, Specificity KININOGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
255-Eur |
Serotech |
human |
| SCH-8750-1530 |
SYNTHETIC TETANUS TOXIN PEPTIDE (C_TERMINAL), Product Type Purified Protein, Specificity TETANUS TOXIN , Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
cat |
| SCH-2069-9954 |
NATIVE CANDIDA RUGOSA CHOLESTEROL ESTERASE, Product Type Purified Protein, Specificity CHOLESTEROL ESTERASE, Target Species Fungal, Host N_A, Format Purified, Isotypes , Applications E, FN, Clo |
500 UNITS |
219-Eur |
Serotech |
cat |
| PAS9365 |
Polyclonal antibody: FABP : FATTY ACID BINDING PROTEIN (FABP) (MUSCLE AND HEART) Affinity Purified, Host Animal: Sheep, Format: Affinity Purified Ig, Ig Concentration: >5mg_ml (U.V.abs @ 280nm) |
500 |
999-Eur |
RANDOX |
|
| 2069-9954 |
NATIVE CANDIDA RUGOSA CHOLESTEROL ESTERASE, Product Type Purified Protein, Specificity CHOLESTEROL ESTERASE, Target Species Fungal, Host N_A, Format Purified, Isotypes , Applications E, FN, Clo |
500 UNITS |
219-Eur |
AbD Serotec |
cat |
| 8750-1530 |
SYNTHETIC TETANUS TOXIN PEPTIDE (C_TERMINAL), Product Type Purified Protein, Specificity TETANUS TOXIN , Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
cat |
| 5575-5559 |
NATIVE HUMAN KININOGEN HMW SINGLE CHAIN, Product Type Purified Protein, Specificity KININOGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
255-Eur |
AbD Serotec |
human |
| orb22137 |
Chromatographically Purified Human IgA1 Kappa, Polymer Chromatographically purified human IgA1 kappa, polymer. Purified human IgA1 kappa may be used as a reference antigen, calibrator, coating protei |
0.5 mg |
457-Eur |
Biorb |
human |
| orb80311 |
Bovine FGF basic protein FGF-2 Bovine purified from bovine piruitary is a single, glycosylated, polypeptide chain having a molecular mass of 16kDa.The basic-FGF is purified by proprietary chromatograp |
2 |
211-Eur |
Biorb |
bovine |
| D0103-2H |
Human IgG, Fc, Immunogen Purified human immunoglobulin G (Fc fragment), Species reactivity Human, Host species Duck, Isotype Mouse IgG-adsorbed, Affinity-purified IgY(∆Fc) |
200 ug |
391-Eur |
Good Biotech Corp |
|
| D7101-2H |
Mouse IgG, Immunogen Purified mouse IgG（H_L）, Species reactivity Mouse, Host species Duck, Isotype Normal human serum adsorbed, affinity purified IgY(∆Fc) |
100 ug |
315-Eur |
Good Biotech Corp |
|
| orb22199 |
Monkey(Rhesus) IgG Chromatographically purified Rhesus monkey IgG. Purified monkey IgG may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays |
10 mg |
457-Eur |
Biorb |
elisa |
| D5101-2H (0001) |
Rabbit IgG, Immunogen Purified rabbit immunoglobulin G, Species reactivity Rabbit, Host species Duck, Isotype Normal human serum adsorbed, affinity purified IgY(∆Fc) |
500 ug |
296-Eur |
Good Biotech Corp |
|
| MPP003 |
ADENOVIRUS TYPE 5 PURIFIED PARTICLES, Product Type Antigen, Specificity ADENOVIRUS TYPE 5 , Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 ml |
361-Eur |
AbD Serotec |
cat |
| SCH-MPP003 |
ADENOVIRUS TYPE 5 PURIFIED PARTICLES, Product Type Antigen, Specificity ADENOVIRUS TYPE 5 , Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 ml |
361-Eur |
Serotech |
cat |
| orb80608 |
Human TGF Beta 1 protein Human TGF beta purified from Human Platelets having a molecular mass of 25kDa.The TGF-b is purified by proprietary chromatographic techniques. For research use only. |
1 |
539-Eur |
Biorb |
human |
| PMP51 |
MOUSE IgG3 KAPPA, Product Type Purified Protein, Specificity IgG3, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG3, Applications E, Clone MADNP_4 |
1 mg |
492-Eur |
AbD Serotec |
cat |
| SCH-PMP48 |
MOUSE IgG1 KAPPA, Product Type Purified Protein, Specificity IgG1, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG1, Applications E, Clone MADNP_1 |
1 mg |
545-Eur |
Serotech |
cat |
| SCH-PMP49 |
MOUSE IgG2a KAPPA, Product Type Purified Protein, Specificity IgG2a, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG2a, Applications E, Clone MADNP_2 |
1 mg |
545-Eur |
Serotech |
cat |
| 5248-3004 |
NATIVE HUMAN IgG3, Product Type Purified Protein, Specificity IgG3, Target Species Human, Host N_A, Format Purified, Isotypes IgG3, Applications ID, Clone |
0.5 mg |
860-Eur |
AbD Serotec |
human |
| PMP50 |
MOUSE IgG2b KAPPA, Product Type Purified Protein, Specificity IgG2b, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG2b, Applications E, Clone MADNP_3 |
1 mg |
545-Eur |
AbD Serotec |
cat |
| PMP48 |
MOUSE IgG1 KAPPA, Product Type Purified Protein, Specificity IgG1, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG1, Applications E, Clone MADNP_1 |
1 mg |
545-Eur |
AbD Serotec |
cat |
| PMP49 |
MOUSE IgG2a KAPPA, Product Type Purified Protein, Specificity IgG2a, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG2a, Applications E, Clone MADNP_2 |
1 mg |
545-Eur |
AbD Serotec |
cat |
| SCH-PMP50 |
MOUSE IgG2b KAPPA, Product Type Purified Protein, Specificity IgG2b, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG2b, Applications E, Clone MADNP_3 |
1 mg |
545-Eur |
Serotech |
cat |
| SCH-5248-3004 |
NATIVE HUMAN IgG3, Product Type Purified Protein, Specificity IgG3, Target Species Human, Host N_A, Format Purified, Isotypes IgG3, Applications ID, Clone |
0.5 mg |
860-Eur |
Serotech |
human |
| SCH-PMP51 |
MOUSE IgG3 KAPPA, Product Type Purified Protein, Specificity IgG3, Target Species Mouse, Host N_A, Format Purified, Isotypes IgG3, Applications E, Clone MADNP_4 |
1 mg |
492-Eur |
Serotech |
cat |
| D5101-2H (0001-7101) |
Rabbit IgG, Immunogen Purified rabbit immunoglobulin G, Species reactivity Rabbit, Host species Duck, Isotype Normal human serum' mouse IgG adsorbed, affinity purified IgY(∆Fc) |
100 ug |
391-Eur |
Good Biotech Corp |
|
| R8102-1I |
Duck IgY (ΔFc), Immunogen Purified duck IgY(ΔFc), Species reactivity Duck, Host species Rabbit, Isotype Affinity-purified IgG-HRPO conjugated |
50ul |
344-Eur |
Good Biotech Corp |
|
| orb82140 |
Purified Plasma Kallikrein protein Kallikrein, Plasma is a purified protein_bioactive peptide. For research use only. |
50 |
244-Eur |
Biorb |
|
| orb82125 |
Purified Human Cathepsin D protein Cathepsin D is a purified reagent for cancer research. For research use only. |
25 |
260-Eur |
Biorb |
human |
| AI-43-638-50 |
Rat Purified IgG Purified Immunoglobulin |
50 mg |
480-Eur |
LeeBio |
rat |
| AI-43-638-10 |
Rat Purified IgG Purified Immunoglobulin |
10 mg |
220-Eur |
LeeBio |
rat |
| R9101-1D |
Chicken IgY, Immunogen Purified chicken egg yolk IgY (H_L), Species reactivity Chicken, Host species Rabbit, Isotype Affinity-purified IgG |
500 ug |
296-Eur |
Good Biotech Corp |
|
| R8101-1D |
Duck IgY, Immunogen Purified duck egg yolk IgY (H_L), Species reactivity Duck, Host species Rabbit, Isotype Affinity-purified IgG |
500 ug |
296-Eur |
Good Biotech Corp |
|
| D0106-2D |
Human IgG, Immunogen Purified human immunoglobulin G (H_L), Species reactivity Human, Host species Duck, Isotype Affinity-purified IgY(ΔFc) |
500ug |
296-Eur |
Good Biotech Corp |
|
| R8102-1D |
Duck IgY (ΔFc), Immunogen Purified duck egg yolk IgY(ΔFc), Species reactivity Duck, Host species Rabbit, Isotype Affinity-purified IgG |
500 ug |
296-Eur |
Good Biotech Corp |
|
| AS09 554 |
Antibody: Bromelain, Affinity purified, Immunogen: native bromelain isolated and purified from Ananas comosus, Host: rabbit, polyclonal, Confirmed reactivity: Ananas comosus |
1 mg |
438-Eur |
Gentaur |
|
| AS09 547 |
Antibody: PPI | papain, Affinity purified, Immunogen: native papain isolated and purified from Carica papaya, Host: rabbit, polyclonal, Confirmed reactivity: Carica papaya |
1 mg |
438-Eur |
Gentaur |
|
| 4670-1202 |
NATIVE YEAST GLUCOSE_6_PHOSPHATE DEHYDROGENASE, Product Type Purified Protein, Specificity GLUCOSE_6_PHOSPHATE DEHYDROGENASE, Target Species Yeast, Host N_A, Format Purified, Isotypes , Applicat |
1 KU |
255-Eur |
AbD Serotec |
cat |
| SCH-2550-0104 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN DIL, Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications F, IA, Clo |
0.2 mg |
290-Eur |
Serotech |
human |
| OBT1527 |
GOAT ANTI MOUSE IgG Fab AFFINITY PURIFIED, Product Type Polyclonal Antibody, Specificity IgG , Target Species Mouse, Host Goat, Format Purified, Isotypes Polyclonal IgG, Applications E, WB, Clo |
1 ml |
290-Eur |
AbD Serotec |
polyclonal |
| 4670-7204 |
NATIVE PIG GLUTAMIC PYRUVIC TRANSAMINASE, Product Type Purified Protein, Specificity GLUTAMIC PYRUVIC TRANSAMINASE, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications FN, Cl |
1 KU |
231-Eur |
AbD Serotec |
cat |
| SCH-5725-2009 |
SYNTHETIC RAT LUTEINIZING HORMONE RECEPTOR, Product Type Purified Protein, Specificity LUTEINIZING HORMONE RECEPTOR, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Cl |
50 µg |
160-Eur |
Serotech |
recombinant |
| SCH-PRP03 |
RAT IgG1 LAMBDA MYELOMA, Product Type Purified Protein, Specificity IgG1 LAMBDA MYELOMA, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR31 |
1 mg |
444-Eur |
Serotech |
cat |
| PRP03 |
RAT IgG1 LAMBDA MYELOMA, Product Type Purified Protein, Specificity IgG1 LAMBDA MYELOMA, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Clone IR31 |
1 mg |
444-Eur |
AbD Serotec |
cat |
| 8970-1054 |
THYROXINE BINDING GLOBULIN, Product Type Purified Protein, Specificity THYROXINE BINDING GLOBULIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
290-Eur |
AbD Serotec |
cat |
| 8970-1004 |
THYROXINE BINDING GLOBULIN, Product Type Purified Protein, Specificity THYROXINE BINDING GLOBULIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
314-Eur |
AbD Serotec |
cat |
| SCH-OBT1527 |
GOAT ANTI MOUSE IgG Fab AFFINITY PURIFIED, Product Type Polyclonal Antibody, Specificity IgG , Target Species Mouse, Host Goat, Format Purified, Isotypes Polyclonal IgG, Applications E, WB, Clo |
1 ml |
290-Eur |
Serotech |
polyclonal |
| SCH-4670-7204 |
NATIVE PIG GLUTAMIC PYRUVIC TRANSAMINASE, Product Type Purified Protein, Specificity GLUTAMIC PYRUVIC TRANSAMINASE, Target Species Pig, Host N_A, Format Purified, Isotypes , Applications FN, Cl |
1 KU |
231-Eur |
Serotech |
cat |
| 2550-0104 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN DIL, Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications F, IA, Clo |
0.2 mg |
290-Eur |
AbD Serotec |
human |
| PIP024 |
NATIVE HEPATITIS B SURFACE ANTIGEN AY, Product Type Purified Protein, Specificity HEPATITIS B SURFACE ANTIGEN AY, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clo |
1 mg |
1435-Eur |
AbD Serotec |
cat |
| PIP025 |
NATIVE HEPATITIS B SURFACE ANTIGEN AD, Product Type Purified Protein, Specificity HEPATITIS B SURFACE ANTIGEN AD, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clo |
1 mg |
1435-Eur |
AbD Serotec |
cat |
| 5725-2009 |
SYNTHETIC RAT LUTEINIZING HORMONE RECEPTOR, Product Type Purified Protein, Specificity LUTEINIZING HORMONE RECEPTOR, Target Species Rat, Host N_A, Format Purified, Isotypes , Applications E, Cl |
50 µg |
160-Eur |
AbD Serotec |
recombinant |
| SCH-8970-1004 |
THYROXINE BINDING GLOBULIN, Product Type Purified Protein, Specificity THYROXINE BINDING GLOBULIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
314-Eur |
Serotech |
cat |
| SCH-8970-1054 |
THYROXINE BINDING GLOBULIN, Product Type Purified Protein, Specificity THYROXINE BINDING GLOBULIN, Target Species , Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
290-Eur |
Serotech |
cat |
| SCH-4670-1202 |
NATIVE YEAST GLUCOSE_6_PHOSPHATE DEHYDROGENASE, Product Type Purified Protein, Specificity GLUCOSE_6_PHOSPHATE DEHYDROGENASE, Target Species Yeast, Host N_A, Format Purified, Isotypes , Applicat |
1 KU |
255-Eur |
Serotech |
cat |
| AS09 558 |
Antibody: PLD | phospholipase D, Affinity purified, Immunogen: phospholipase D isolated and purified from Brassica oleracea, Host: rabbit, polyclonal, Confirmed reactivity: Brassica oleracea |
1 mg |
438-Eur |
Gentaur |
|
| SCH-6732-0170 |
SYNTHETIC HUMAN NEUROPEPTIDE Y RECEPTOR 1, Product Type Purified Protein, Specificity NEUROPEPTIDE Y RECEPTOR 1, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clon |
50 µg |
160-Eur |
Serotech |
recombinant |
| 7895-0104 |
NATIVE RABBIT PYRUVATE KINASE, Product Type Purified Protein, Specificity PYRUVATE KINASE, Target Species Rabbit, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 KU |
106-Eur |
AbD Serotec |
polyclonal |
| SCH-6220-1004 |
NATIVE HUMAN ALPHA 1 MICROGLOBULIN, Product Type Purified Protein, Specificity ALPHA 1 MICROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
397-Eur |
Serotech |
human |
| SCH-5685-3204 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN, Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
5 mg |
409-Eur |
Serotech |
human |
| SCH-5685-3404 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN (ACETYLATED), Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN , Target Species Human, Host N_A, Format Purified, Isotypes , Applications |
2 mg |
468-Eur |
Serotech |
human |
| SCH-5685-3557 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN (OXIDIZED), Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN , Target Species Human, Host N_A, Format Purified, Isotypes , Applications FN |
2 mg |
545-Eur |
Serotech |
human |
| SCH-2550-0004 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN (ACETYLATED) DIL, Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN , Target Species Human, Host N_A, Format Purified, Isotypes , Applicatio |
0.2 mg |
569-Eur |
Serotech |
human |
| 1790-0526 |
NATIVE BOVINE CARBONIC ANHYDRASE, Product Type Purified Protein, Specificity CARBONIC ANHYDRASE, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
250 mg |
219-Eur |
AbD Serotec |
cat |
| SCH-6732-0270 |
SYNTHETIC HUMAN NEUROPEPTIDE Y RECEPTOR 2, Product Type Purified Protein, Specificity NEUROPEPTIDE Y RECEPTOR 2, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clon |
50 µg |
160-Eur |
Serotech |
recombinant |
| 6240-0824 |
NATIVE HUMAN BETA 2 MICROGLOBULIN, Product Type Purified Protein, Specificity BETA 2 MICROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, WB, Clone |
1 mg |
314-Eur |
AbD Serotec |
human |
| 8475-0204 |
NATIVE BOVINE SUPEROXIDE DISMUTASE, Product Type Purified Protein, Specificity SUPEROXIDE DISMUTASE, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 KU |
314-Eur |
AbD Serotec |
cat |
| SCH-7895-0104 |
NATIVE RABBIT PYRUVATE KINASE, Product Type Purified Protein, Specificity PYRUVATE KINASE, Target Species Rabbit, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 KU |
106-Eur |
Serotech |
polyclonal |
| 7100-2004 |
SYNTHETIC HUMAN PANCREATIC POLYPEPTIDE, Product Type Purified Protein, Specificity PANCREATIC POLYPEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
195-Eur |
AbD Serotec |
human |
| PIP029 |
NATIVE HERPES SIMPLEX VIRUS 2 gG2, Product Type Purified Protein, Specificity HERPES SIMPLEX VIRUS 2 gG2, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 ml |
990-Eur |
AbD Serotec |
cat |
| 5543-6207 |
NATIVE HUMAN PLASMA KALLIKREIN, Product Type Purified Protein, Specificity PLASMA KALLIKREIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
20 µg |
409-Eur |
AbD Serotec |
human |
| SCH-2150-2506 |
NATIVE MOUSE COLLAGEN I_III, Product Type Purified Protein, Specificity COLLAGEN I_III, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
195-Eur |
Serotech |
cat |
| SCH-0580-0150 |
SYNTHETIC HUMAN ERYTHROCYTE ANKYRIN 2.1 (aa1862_1874), Product Type Purified Protein, Specificity ERYTHROCYTE ANKYRIN 2.1, Target Species Human, Host N_A, Format Purified, Isotypes , Application |
50 µg |
160-Eur |
Serotech |
human |
| SCH-8475-0204 |
NATIVE BOVINE SUPEROXIDE DISMUTASE, Product Type Purified Protein, Specificity SUPEROXIDE DISMUTASE, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 KU |
314-Eur |
Serotech |
cat |
| 6220-1004 |
NATIVE HUMAN ALPHA 1 MICROGLOBULIN, Product Type Purified Protein, Specificity ALPHA 1 MICROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
397-Eur |
AbD Serotec |
human |
| SCH-7100-2004 |
SYNTHETIC HUMAN PANCREATIC POLYPEPTIDE, Product Type Purified Protein, Specificity PANCREATIC POLYPEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
195-Eur |
Serotech |
human |
| 7770-6020 |
SYNTHETIC HUMAN PROLACTIN RECEPTOR, Product Type Purified Protein, Specificity PROLACTIN RECEPTOR, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
recombinant |
| 5685-3557 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN (OXIDIZED), Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN , Target Species Human, Host N_A, Format Purified, Isotypes , Applications FN |
2 mg |
545-Eur |
AbD Serotec |
human |
| 0300-2304 |
NATIVE HUMAN ALKALINE PHOSPHATASE, Product Type Purified Protein, Specificity ALKALINE PHOSPHATASE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 UNITS |
231-Eur |
AbD Serotec |
human |
| SCH-0260-0004 |
NATIVE YEAST ALDEHYDE DEHYDROGENASE, Product Type Purified Protein, Specificity ALDEHYDE DEHYDROGENASE, Target Species Yeast, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
250 UNITS |
326-Eur |
Serotech |
cat |
| 0200-0434 |
SYNTHETIC HUMAN HISTAMINE RECEPTOR 3 (aa173_188), Product Type Purified Protein, Specificity HISTAMINE RECEPTOR 3 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, C |
50 µg |
160-Eur |
AbD Serotec |
recombinant |
| SCH-0300-2304 |
NATIVE HUMAN ALKALINE PHOSPHATASE, Product Type Purified Protein, Specificity ALKALINE PHOSPHATASE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
100 UNITS |
231-Eur |
Serotech |
human |
| SCH-5850-2004 |
NATIVE HUMAN ALPHA 2 MACROGLOBULIN, Product Type Purified Protein, Specificity ALPHA 2 MACROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
338-Eur |
Serotech |
human |
| 2550-0004 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN (ACETYLATED) DIL, Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN , Target Species Human, Host N_A, Format Purified, Isotypes , Applicatio |
0.2 mg |
569-Eur |
AbD Serotec |
human |
| 0100-0316 |
NATIVE HUMAN FACTOR XIII A, Product Type Purified Protein, Specificity FACTOR XIII A, Target Species Human, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
50 µg |
747-Eur |
AbD Serotec |
human |
| 5685-3404 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN (ACETYLATED), Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN , Target Species Human, Host N_A, Format Purified, Isotypes , Applications |
2 mg |
468-Eur |
AbD Serotec |
human |
| 6732-0270 |
SYNTHETIC HUMAN NEUROPEPTIDE Y RECEPTOR 2, Product Type Purified Protein, Specificity NEUROPEPTIDE Y RECEPTOR 2, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clon |
50 µg |
160-Eur |
AbD Serotec |
recombinant |
| SCH-0100-0316 |
NATIVE HUMAN FACTOR XIII A, Product Type Purified Protein, Specificity FACTOR XIII A, Target Species Human, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
50 µg |
747-Eur |
Serotech |
human |
| SCH-0100-0565 |
SYNTHETIC HUMAN GLUCOSE TRANSPORTER 8 (aa467_477), Product Type Purified Protein, Specificity GLUCOSE TRANSPORTER 8 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, |
50 µg |
160-Eur |
Serotech |
human |
| PIP028 |
NATIVE RUBELLA VIRUS ANTIGEN , Product Type Purified Protein, Specificity RUBELLA VIRUS ANTIGEN, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
1435-Eur |
AbD Serotec |
cat |
| SCH-5543-6207 |
NATIVE HUMAN PLASMA KALLIKREIN, Product Type Purified Protein, Specificity PLASMA KALLIKREIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
20 µg |
409-Eur |
Serotech |
human |
| SCH-0200-0434 |
SYNTHETIC HUMAN HISTAMINE RECEPTOR 3 (aa173_188), Product Type Purified Protein, Specificity HISTAMINE RECEPTOR 3 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, C |
50 µg |
160-Eur |
Serotech |
recombinant |
| SCH-4670-1727 |
SYNTHETIC HUMAN GLUCOSE TRANSPORTER 4, Product Type Purified Protein, Specificity GLUCOSE TRANSPORTER 4, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
160-Eur |
Serotech |
human |
| 2150-2506 |
NATIVE MOUSE COLLAGEN I_III, Product Type Purified Protein, Specificity COLLAGEN I_III, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
195-Eur |
AbD Serotec |
cat |
| SCH-7770-6020 |
SYNTHETIC HUMAN PROLACTIN RECEPTOR, Product Type Purified Protein, Specificity PROLACTIN RECEPTOR, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
recombinant |
| PIP027 |
NATIVE RUBELLA VIRUS ANTIGEN, Product Type Purified Protein, Specificity RUBELLA VIRUS ANTIGEN, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
1435-Eur |
AbD Serotec |
cat |
| SCH-1790-0526 |
NATIVE BOVINE CARBONIC ANHYDRASE, Product Type Purified Protein, Specificity CARBONIC ANHYDRASE, Target Species Bovine, Host N_A, Format Purified, Isotypes , Applications E, Clone |
250 mg |
219-Eur |
Serotech |
cat |
| SCH-6240-0824 |
NATIVE HUMAN BETA 2 MICROGLOBULIN, Product Type Purified Protein, Specificity BETA 2 MICROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, WB, Clone |
1 mg |
314-Eur |
Serotech |
human |
| 5685-3204 |
NATIVE HUMAN LOW DENSITY LIPOPROTEIN, Product Type Purified Protein, Specificity LOW DENSITY LIPOPROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications FN, Clone |
5 mg |
409-Eur |
AbD Serotec |
human |
| 4670-1727 |
SYNTHETIC HUMAN GLUCOSE TRANSPORTER 4, Product Type Purified Protein, Specificity GLUCOSE TRANSPORTER 4, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
160-Eur |
AbD Serotec |
human |
| 5850-2004 |
NATIVE HUMAN ALPHA 2 MACROGLOBULIN, Product Type Purified Protein, Specificity ALPHA 2 MACROGLOBULIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
338-Eur |
AbD Serotec |
human |
| 6732-0170 |
SYNTHETIC HUMAN NEUROPEPTIDE Y RECEPTOR 1, Product Type Purified Protein, Specificity NEUROPEPTIDE Y RECEPTOR 1, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clon |
50 µg |
160-Eur |
AbD Serotec |
recombinant |
| 0580-0150 |
SYNTHETIC HUMAN ERYTHROCYTE ANKYRIN 2.1 (aa1862_1874), Product Type Purified Protein, Specificity ERYTHROCYTE ANKYRIN 2.1, Target Species Human, Host N_A, Format Purified, Isotypes , Application |
50 µg |
160-Eur |
AbD Serotec |
human |
| 0300-0106 |
SYNTHETIC SARS CORONAVIRUS P65 HOMOLOGUE, Product Type Purified Protein, Specificity SARS CORONAVIRUS P65 HOMOLOGUE, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, |
50 µg |
160-Eur |
AbD Serotec |
human |
| SCH-0300-0106 |
SYNTHETIC SARS CORONAVIRUS P65 HOMOLOGUE, Product Type Purified Protein, Specificity SARS CORONAVIRUS P65 HOMOLOGUE, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, |
50 µg |
160-Eur |
Serotech |
human |
| SCH-0300-0105 |
SYNTHETIC SARS CORONAVIRUS E2 GLYCOPROTEIN, Product Type Purified Protein, Specificity SARS CORONAVIRUS E2 GLYCOPROTEIN, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications |
50 µg |
160-Eur |
Serotech |
cat |
| 0300-0105 |
SYNTHETIC SARS CORONAVIRUS E2 GLYCOPROTEIN, Product Type Purified Protein, Specificity SARS CORONAVIRUS E2 GLYCOPROTEIN, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications |
50 µg |
160-Eur |
AbD Serotec |
cat |
| 0260-0004 |
NATIVE YEAST ALDEHYDE DEHYDROGENASE, Product Type Purified Protein, Specificity ALDEHYDE DEHYDROGENASE, Target Species Yeast, Host N_A, Format Purified, Isotypes , Applications E, FN, Clone |
250 UNITS |
326-Eur |
AbD Serotec |
cat |
| 0100-0565 |
SYNTHETIC HUMAN GLUCOSE TRANSPORTER 8 (aa467_477), Product Type Purified Protein, Specificity GLUCOSE TRANSPORTER 8 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, |
50 µg |
160-Eur |
AbD Serotec |
human |
| orb22066 |
Purified hyperimmune Rabbit IgG antibodies Polyclonal Purified hyperimmune Rabbit IgG antibodies lyophilised from a solution in phosphate buffered saline (PBS, pH 7.2), stabilized with dextran. This p |
1 mg |
457-Eur |
Biorb |
polyclonal |
| SCH-0100-0407 |
NATIVE HELICOBACTER PYLORI ANTIGEN, Product Type Purified Protein, Specificity HELICOBACTER PYLORI ANTIGEN, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
231-Eur |
Serotech |
cat |
| 0100-0197 |
SYNTHETIC HUMAN ACTIN BETA (aa1_16), Product Type Purified Protein, Specificity ACTIN BETA, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| 0100-0407 |
NATIVE HELICOBACTER PYLORI ANTIGEN, Product Type Purified Protein, Specificity HELICOBACTER PYLORI ANTIGEN, Target Species Bacterial, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
231-Eur |
AbD Serotec |
cat |
| SCH-0100-0197 |
SYNTHETIC HUMAN ACTIN BETA (aa1_16), Product Type Purified Protein, Specificity ACTIN BETA, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| SCH-1720-8650 |
SYNTHETIC HUMAN CALCITONIN FRAGMENT (aa1_10), Product Type Purified Protein, Specificity CALCITONIN FRAGMENT , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
231-Eur |
Serotech |
human |
| SCH-0490-1916 |
SYNTHETIC HUMAN BETA AMYLOID (aa 672_711), Product Type Purified Protein, Specificity BETA AMYLOID, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
255-Eur |
Serotech |
human |
| 1720-8650 |
SYNTHETIC HUMAN CALCITONIN FRAGMENT (aa1_10), Product Type Purified Protein, Specificity CALCITONIN FRAGMENT , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
231-Eur |
AbD Serotec |
human |
| 0490-1916 |
SYNTHETIC HUMAN BETA AMYLOID (aa 672_711), Product Type Purified Protein, Specificity BETA AMYLOID, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
255-Eur |
AbD Serotec |
human |
| SCH-7950-3009 |
NATIVE RESPIRATORY SYNCYTIAL VIRUS, Product Type Purified Protein, Specificity RESPIRATORY SYNCYTIAL VIRUS, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
385-Eur |
Serotech |
cat |
| 7950-3009 |
NATIVE RESPIRATORY SYNCYTIAL VIRUS, Product Type Purified Protein, Specificity RESPIRATORY SYNCYTIAL VIRUS, Target Species Viral, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
385-Eur |
AbD Serotec |
cat |
| orb22191 |
Goat Serum Albumin Chromatographically purified goat albumin. Purified goat albumin may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays incl |
100 mg |
457-Eur |
Biorb |
elisa |
| orb22420 |
Rabbit Serum Albumin Chromatographically purified rabbit albumin. Purified rabbit albumin may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassa |
100 mg |
457-Eur |
Biorb |
polyclonal |
| orb80188 |
Bovine Serum Albumin Chromatographically purified bovine albumin. Purified bovine albumin may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassay |
100 mg |
457-Eur |
Biorb |
elisa |
| orb80211 |
Human Serum Albumin Chromatographically purified human albumin. Purified human albumin may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays i |
10 mg |
195-Eur |
Biorb |
elisa |
| orb80234 |
Sheep Serum Albumin Chromatographically purified sheep albumin. Purified sheep albumin may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of immunoassays i |
100 mg |
457-Eur |
Biorb |
elisa |
| P0200 |
Polyclonal Antibodies: Affinity Purified Rabbit Human Ig's; Specificity: Affinity Purified Rabbit Human Ig's ; Application: Elisa, WB, immunohistochemistry, immunoprecipitation |
gram |
4600-Eur |
Antagene |
|
| orb22122 |
Human Secretory IgA Chromatographically purified human secretory IgA. Purified human secretory IgA may be used as a reference antigen, calibrator, coating protein and blocking agent in a variety of i |
0.5 mg |
457-Eur |
Biorb |
human |
| 1707-2004 |
NATIVE HUMAN C_REACTIVE PROTEIN, Product Type Purified Protein, Specificity C_REACTIVE PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
361-Eur |
AbD Serotec |
human |
| SCH-1707-2004 |
NATIVE HUMAN C_REACTIVE PROTEIN, Product Type Purified Protein, Specificity C_REACTIVE PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
361-Eur |
Serotech |
human |
| 1707-2029 |
NATIVE HUMAN C_REACTIVE PROTEIN, Product Type Purified Protein, Specificity C_REACTIVE PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
290-Eur |
AbD Serotec |
human |
| 4737-1020 |
SYNTHETIC MOUSE G PROTEIN ALPHA 0, Product Type Purified Protein, Specificity G PROTEIN ALPHA 0, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
cat |
| SCH-4737-1020 |
SYNTHETIC MOUSE G PROTEIN ALPHA 0, Product Type Purified Protein, Specificity G PROTEIN ALPHA 0, Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
cat |
| 7672-5509 |
SYNTHETIC HUMAN PRION PROTEIN, Product Type Purified Protein, Specificity PRION PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| SCH-7672-5509 |
SYNTHETIC HUMAN PRION PROTEIN, Product Type Purified Protein, Specificity PRION PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| SCH-1707-2029 |
NATIVE HUMAN C_REACTIVE PROTEIN, Product Type Purified Protein, Specificity C_REACTIVE PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
290-Eur |
Serotech |
human |
| SCH-0030-5059 |
SYNTHETIC RAT ACETYLCHOLINE TRANSPORTER PROTEIN, Product Type Purified Protein, Specificity ACETYLCHOLINE TRANSPORTER PROTEIN, Target Species Rat, Host N_A, Format Purified, Isotypes , Applicati |
50 µg |
160-Eur |
Serotech |
cat |
| 0030-5059 |
SYNTHETIC RAT ACETYLCHOLINE TRANSPORTER PROTEIN, Product Type Purified Protein, Specificity ACETYLCHOLINE TRANSPORTER PROTEIN, Target Species Rat, Host N_A, Format Purified, Isotypes , Applicati |
50 µg |
160-Eur |
AbD Serotec |
cat |
| 4737-2320 |
SYNTHETIC HUMAN G PROTEIN ALPHA 13 (aa368_377), Product Type Purified Protein, Specificity G PROTEIN ALPHA 13 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| SCH-4737-2220 |
SYNTHETIC HUMAN G PROTEIN ALPHA 12 (aa371_380), Product Type Purified Protein, Specificity G PROTEIN ALPHA 12 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| SCH-4737-2320 |
SYNTHETIC HUMAN G PROTEIN ALPHA 13 (aa368_377), Product Type Purified Protein, Specificity G PROTEIN ALPHA 13 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
Serotech |
human |
| 4737-2220 |
SYNTHETIC HUMAN G PROTEIN ALPHA 12 (aa371_380), Product Type Purified Protein, Specificity G PROTEIN ALPHA 12 , Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
160-Eur |
AbD Serotec |
human |
| D0202-2D |
Human beta-2-microglobin (B2M), Immunogen Purified human beta-2-microglobulin, Species reactivity Human, Host species Duck, Isotype Affinity-purified IgY(ΔFc) |
500 ug |
296-Eur |
Good Biotech Corp |
|
| R0202-1D |
Human beta-2-microglobin (B2M), Immunogen Purified human beta-2-microglobulin, Species reactivity Human, Host species Rabbit, Isotype Affinity-purified IgG |
500 ug |
296-Eur |
Good Biotech Corp |
|
| PHP160 |
HUMAN LAMBDA LIGHT CHAIN, Product Type Purified Protein, Specificity LAMBDA LIGHT CHAIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
373-Eur |
AbD Serotec |
human |
| AS09 561 |
Antibody: Urease, Affinity purified, Immunogen: urease isolated and purified from Canavalia ensiformis (common jack-beans), Host: rabbit, polyclonal, Confirmed reactivity: Canavalia ensiformis (common |
1 mg |
438-Eur |
Gentaur |
|
| SCH-PHP160 |
HUMAN LAMBDA LIGHT CHAIN, Product Type Purified Protein, Specificity LAMBDA LIGHT CHAIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications IY, Clone |
1 mg |
373-Eur |
Serotech |
human |
| D0101-2D |
Human albumin, Immunogen Purified human serum albumin, Species reactivity Human, Host species Duck, Isotype Affinity-purified IgY(ΔFc) |
500 ug |
296-Eur |
Good Biotech Corp |
|
| D0107-2D |
Human Ferritin, Immunogen Purified human liver ferritin, Species reactivity Human, Host species Duck, Isotype Affinity-purified IgY(ΔFc) |
500 ug |
296-Eur |
Good Biotech Corp |
|
| R0111-1D |
Human Immunoglobulin M (μ-chain), Immunogen Purified human IgM μ-chain, Species reactivity Human, Host species Rabbit, Isotype Affinity-purified IgG |
200 ug |
391-Eur |
Good Biotech Corp |
|
| R0101-1D |
Human albumin, Immunogen Purified human serum albumin, Species reactivity Human, Host species Rabbit, Isotype Affinity-purified IgG |
500 ug |
296-Eur |
Good Biotech Corp |
|
| 7820-0504 |
NATIVE HUMAN PROSTATE SPECIFIC ANTIGEN, Product Type Purified Protein, Specificity PROSTATE SPECIFIC ANTIGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, WB, Clo |
0.1 mg |
397-Eur |
AbD Serotec |
human |
| SCH-6045-0504 |
SYNTHETIC ALPHA MELANOCYTE STIMULATING HORMONE, Product Type Purified Protein, Specificity ALPHA MELANOCYTE STIMULATING HORMONE, Target Species , Host N_A, Format Purified, Isotypes , Applicatio |
0.5 mg |
148-Eur |
Serotech |
cat |
| SCH-7820-0504 |
NATIVE HUMAN PROSTATE SPECIFIC ANTIGEN, Product Type Purified Protein, Specificity PROSTATE SPECIFIC ANTIGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, WB, Clo |
0.1 mg |
397-Eur |
Serotech |
human |
| 6045-0504 |
SYNTHETIC ALPHA MELANOCYTE STIMULATING HORMONE, Product Type Purified Protein, Specificity ALPHA MELANOCYTE STIMULATING HORMONE, Target Species , Host N_A, Format Purified, Isotypes , Applicatio |
0.5 mg |
148-Eur |
AbD Serotec |
cat |
| SCH-5685-2004 |
NATIVE HUMAN HIGH DENSITY LIPOPROTEIN, Product Type Purified Protein, Specificity HIGH DENSITY LIPOPROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
278-Eur |
Serotech |
human |
| 5268-6307 |
NATIVE HUMAN KAPPA LIGHT CHAIN, Product Type Purified Protein, Specificity KAPPA LIGHT CHAIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
266-Eur |
AbD Serotec |
human |
| SCH-5268-6307 |
NATIVE HUMAN KAPPA LIGHT CHAIN, Product Type Purified Protein, Specificity KAPPA LIGHT CHAIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
266-Eur |
Serotech |
human |
| 5269-6207 |
NATIVE HUMAN LAMBDA LIGHT CHAIN, Product Type Purified Protein, Specificity LAMBDA LIGHT CHAIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
255-Eur |
AbD Serotec |
human |
| SCH-1505-0502 |
SYNTHETIC HUMAN BRAIN NATRIURETIC PEPTIDE, Product Type Purified Protein, Specificity BRAIN NATRIURETIC PEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clon |
0.1 mg |
160-Eur |
Serotech |
human |
| SCH-5269-6207 |
NATIVE HUMAN LAMBDA LIGHT CHAIN, Product Type Purified Protein, Specificity LAMBDA LIGHT CHAIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
5 mg |
255-Eur |
Serotech |
human |
| 7820-0604 |
NATIVE HUMAN PROSTATE SPECIFIC ANTIGEN, Product Type Purified Protein, Specificity PROSTATE SPECIFIC ANTIGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
290-Eur |
AbD Serotec |
human |
| SCH-7825-1004 |
NATIVE HUMAN PROSTATIC ACID PHOSPHATASE, Product Type Purified Protein, Specificity PROSTATIC ACID PHOSPHATASE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
326-Eur |
Serotech |
human |
| 6720-2004 |
NATIVE HUMAN NEURON SPECIFIC ENOLASE, Product Type Purified Protein, Specificity NEURON SPECIFIC ENOLASE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
195-Eur |
AbD Serotec |
human |
| 5685-2004 |
NATIVE HUMAN HIGH DENSITY LIPOPROTEIN, Product Type Purified Protein, Specificity HIGH DENSITY LIPOPROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
10 mg |
278-Eur |
AbD Serotec |
human |
| SCH-7820-0604 |
NATIVE HUMAN PROSTATE SPECIFIC ANTIGEN, Product Type Purified Protein, Specificity PROSTATE SPECIFIC ANTIGEN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.2 mg |
290-Eur |
Serotech |
human |
| 1505-0502 |
SYNTHETIC HUMAN BRAIN NATRIURETIC PEPTIDE, Product Type Purified Protein, Specificity BRAIN NATRIURETIC PEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clon |
0.1 mg |
160-Eur |
AbD Serotec |
human |
| SCH-6720-2004 |
NATIVE HUMAN NEURON SPECIFIC ENOLASE, Product Type Purified Protein, Specificity NEURON SPECIFIC ENOLASE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
50 µg |
195-Eur |
Serotech |
human |
| 7825-1004 |
NATIVE HUMAN PROSTATIC ACID PHOSPHATASE, Product Type Purified Protein, Specificity PROSTATIC ACID PHOSPHATASE, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
0.1 mg |
326-Eur |
AbD Serotec |
human |
| D0105-2D |
Human Transferrin, Immunogen Purified human transferrin, Species reactivity Human, Host species Duck, Isotype Affinity-purified IgY(∆Fc) |
500 ug |
296-Eur |
Good Biotech Corp |
|
| R0105-1D |
Human Transferrin, Immunogen Purified human transferrin, Species reactivity Human, Host species Rabbit, Isotype Affinity-purified IgG |
500 ug |
296-Eur |
Good Biotech Corp |
|
| orb22125 |
Human IgG1 Lamda G1M(F) Chromatographically purified human IgG1 lambda, allotype G1m(f). Purified human IgG1 lambda may be used as a reference antigen, calibrator, coating protein and blocking agent |
0.5 mg |
457-Eur |
Biorb |
human |
| R0204-1D |
PSA ( Prostate Specific Antigen), Immunogen Purified prostate specific antigen (PSA), Species reactivity Human, Host species Rabbit, Isotype Affinity-purified IgG |
100 ug |
391-Eur |
Good Biotech Corp |
|
| 4737-5220 |
SYNTHETIC MOUSE G PROTEIN ALPHA Q_11 (aa344_353), Product Type Purified Protein, Specificity G PROTEIN ALPHA Q_11 , Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, C |
50 µg |
160-Eur |
AbD Serotec |
cat |
| SCH-4737-5220 |
SYNTHETIC MOUSE G PROTEIN ALPHA Q_11 (aa344_353), Product Type Purified Protein, Specificity G PROTEIN ALPHA Q_11 , Target Species Mouse, Host N_A, Format Purified, Isotypes , Applications E, C |
50 µg |
160-Eur |
Serotech |
cat |
| 7970-0504 |
NATIVE HUMAN RETINOL BINDING PROTEIN, Product Type Purified Protein, Specificity RETINOL BINDING PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
290-Eur |
AbD Serotec |
human |
| SCH-7970-0504 |
NATIVE HUMAN RETINOL BINDING PROTEIN, Product Type Purified Protein, Specificity RETINOL BINDING PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Clone |
1 mg |
290-Eur |
Serotech |
human |
| SCH-6420-5150 |
SYNTHETIC HUMAN MYELIN PROTEOLIPID PROTEIN, Product Type Purified Protein, Specificity MYELIN PROTEOLIPID PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Cl |
50 µg |
160-Eur |
Serotech |
human |
| 4440-0626 |
NATIVE HUMAN FIBRIN DEGRADATION PRODUCT X, Product Type Purified Protein, Specificity FIBRIN DEGRADATION PRODUCT X, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, C |
0.2 mg |
266-Eur |
AbD Serotec |
human |
| 6420-5150 |
SYNTHETIC HUMAN MYELIN PROTEOLIPID PROTEIN, Product Type Purified Protein, Specificity MYELIN PROTEOLIPID PROTEIN, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, Cl |
50 µg |
160-Eur |
AbD Serotec |
human |
| 4440-0826 |
NATIVE HUMAN FIBRIN DEGRADATION PRODUCT Y, Product Type Purified Protein, Specificity FIBRIN DEGRADATION PRODUCT Y, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, C |
0.2 mg |
266-Eur |
AbD Serotec |
human |
| SCH-4440-0826 |
NATIVE HUMAN FIBRIN DEGRADATION PRODUCT Y, Product Type Purified Protein, Specificity FIBRIN DEGRADATION PRODUCT Y, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, C |
0.2 mg |
266-Eur |
Serotech |
human |
| SCH-4440-0456 |
NATIVE HUMAN FIBRIN DEGRADATION PRODUCT E, Product Type Purified Protein, Specificity FIBRIN DEGRADATION PRODUCT E, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, C |
0.1 mg |
326-Eur |
Serotech |
human |
| SCH-4440-0626 |
NATIVE HUMAN FIBRIN DEGRADATION PRODUCT X, Product Type Purified Protein, Specificity FIBRIN DEGRADATION PRODUCT X, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, C |
0.2 mg |
266-Eur |
Serotech |
human |
| 4440-0456 |
NATIVE HUMAN FIBRIN DEGRADATION PRODUCT E, Product Type Purified Protein, Specificity FIBRIN DEGRADATION PRODUCT E, Target Species Human, Host N_A, Format Purified, Isotypes , Applications E, C |
0.1 mg |
326-Eur |
AbD Serotec |
human |
| orb22127 |
Human IgG4 Kappa Gm4A Chromatographically purified human myeloma IgG4 kappa, allotype Gm4b. Purified human IgG4 kappa may be used as a reference antigen, calibrator, coating protein and blocking agen |
0.5 mg |
457-Eur |
Biorb |
human |
| orb22123 |
Human Human IgG3 Lambda G3M (G) Chromatographically purified human myeloma IgG3 kappa, allotype G3m(b). Purified human IgG3 kappa may be used as a reference antigen, calibrator, coating protein and b |
0.5 mg |
457-Eur |
Biorb |
human |
| 62-301 |
anti_Rnq1 (S. cerevisiae) antibody, affinity purified Affinity purified rabbit polyclonal antibody to Rnq1. The glutamine_ and asparagine_rich protein, Rnq1, is a putative yeast prion. Rnq1 protein w |
100 ul |
404-Eur |
B-Bridge |
polyclonal |
| 7170-9355 |
SYNTHETIC HUMAN PARATHYROID HORMONE RELATED PEPTIDE, Product Type Purified Protein, Specificity PARATHYROID HORMONE RELATED PEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , A |
0.1 mg |
231-Eur |
AbD Serotec |
human |
| SCH-7170-9355 |
SYNTHETIC HUMAN PARATHYROID HORMONE RELATED PEPTIDE, Product Type Purified Protein, Specificity PARATHYROID HORMONE RELATED PEPTIDE, Target Species Human, Host N_A, Format Purified, Isotypes , A |
0.1 mg |
231-Eur |
Serotech |
human |
| orb22124 |
Human IgG1 Lambda G1M (A) Chromatographically purified human IgG1 lambda, allotype G1m(a). Purified human IgG1 lambda may be used as a reference antigen, calibrator, coating protein and blocking agen |
0.5 mg |
457-Eur |
Biorb |
human |
| orb22195 |
Human IgA2 Lambda A2M (1-, 2+) Chromatographically purified human IgA2 (1-, 2+) lambda, dimers and polymers. Purified human IgA2 lambda may be used as a reference antigen, calibrator, coating protein |
0.5 mg |
457-Eur |
Biorb |
human |
| orb22198 |
Human IgG2 Lambda G2M (N+) Chromatographically purified human myeloma IgG2 lambda, allotype G2m(n+). Purified human IgG2 lambda may be used as a reference antigen, calibrator, coating protein and blo |
0.5 mg |
457-Eur |
Biorb |
human |
| D0201-2D |
Human alpha-fetoprotein (AFP), Immunogen Purified human alpha-fetoprotein, Species reactivity Human, Host species Duck, Isotype Affinity-purified IgY(ΔFc) |
500 ug |
296-Eur |
Good Biotech Corp |
|
| orb22194 |
Human IgA Lambda (Dimer) Chromatographically purified human IgA1 lambda, dimer. Purified human IgA1 lambda may be used as a reference antigen, calibrator, coating protein and blocking agent in a vari |
0.5 mg |
457-Eur |
Biorb |
human |
| 4440-0276 |
NATIVE HUMAN FIBRIN DEGRADATION PRODUCT D_MONOMER, Product Type Purified Protein, Specificity FIBRIN DEGRADATION PRODUCT D_MONOMER, Target Species Human, Host N_A, Format Purified, Isotypes , Ap |
0.2 mg |
373-Eur |
AbD Serotec |
human |
| SCH-4440-0276 |
NATIVE HUMAN FIBRIN DEGRADATION PRODUCT D_MONOMER, Product Type Purified Protein, Specificity FIBRIN DEGRADATION PRODUCT D_MONOMER, Target Species Human, Host N_A, Format Purified, Isotypes , Ap |
0.2 mg |
373-Eur |
Serotech |
human |
| orb22126 |
Human IgG4 Kappa Gm4A Chromatographically purified human myeloma IgG4 kappa, allotype Gm4a. Purified human IgG4 kappa may be used as a reference antigen, calibrator, coating protein and blocking agen |
0.5 mg |
457-Eur |
Biorb |
human |
| FG-G-070-94A |
Exendin_4 _ _ FAM Labeled Purified IgG _ 100ul Purified IgG _ FAM Labeled _ 100ul |
100 µl |
763-Eur |
Phoenix Peptide |
labeled |
| orb80220 |
Mouse Serum Albumin Chromatographically purified mouse albumin. Chromatographically purified mouse albumin. For research use only. |
10 mg |
277-Eur |
Biorb |
mouse |
| orb80184 |
Human Bence Jones Kappa Chromatographically purified human Bence Jones kappa protein. Purified human Bence Jones kappa protein may be used as a reference antigen, calibrator, coating protein and block |
1.0 mg |
457-Eur |
Biorb |
human |
| P20-105 |
Purified Cat IgG |
10 mg |
228-Eur |
Bethyl |
cat |
| orb80185 |
Human Bence Jones Lambda Chromatographically purified human Bence Jones lambda protein. Purified human Bence Jones lambda protein may be used as a reference antigen, calibrator, coating protein and bl |
1.0 mg |
457-Eur |
Biorb |
human |
| RT-GF |
Rat IgG, Protein A Purified |
50 mg |
150-Eur |
Molinn |
|
| ABS5418 |
PURIFIED PIG IgG |
10 mg |
358-Eur |
AbD Serotec |
|
| P100-105 |
Purified Pig IgG |
10 mg |
166-Eur |
Bethyl |
|
| P10-115 |
Purified Bovine IgG |
10 mg |
166-Eur |
Bethyl |
bovine |
| ABS5120 |
PURIFIED DOG IgG |
10 mg |
300-Eur |
AbD Serotec |
dog |
| P10-215 |
Purified Bovine IgG |
50 mg |
393-Eur |
Bethyl |
bovine |
| AS10926 |
Rat purified IgG (1 g) |
1 g |
586-Eur |
Agrisera |
rat |
| P115 |
Purified Dog IgE |
100 ug |
1326-Eur |
Bethyl |
dog |
| AS10924 |
Rat purified IgG (5 mg) |
5 mg |
272-Eur |
Agrisera |
rat |
| AS10925 |
Rat purified IgG (50 mg) |
50 mg |
486-Eur |
Agrisera |
rat |
| ABS3378 |
PURIFIED hCG |
1 mg |
358-Eur |
AbD Serotec |
|
| RA-80E-Z |
IgE Purified (Myeloma) |
0.1 mg |
204-Eur |
ICL |
|
| P70-206 |
Purified Horse IgG |
50 mg |
393-Eur |
Bethyl |
horse |
| YSRTPHP150 |
Purified hCG |
1 mg. |
516-Eur |
Accurate |
|
| P50-100 |
Purified Goat IgG |
50 mg |
393-Eur |
Bethyl |
polyclonal |
| P10-315 |
Purified Bovine IgG |
100 mg |
544-Eur |
Bethyl |
bovine |
| P70-106 |
Purified Horse IgG |
10 mg |
166-Eur |
Bethyl |
horse |
| P50-200 |
Purified Goat IgG |
100 mg |
544-Eur |
Bethyl |
polyclonal |
| ABS5178 |
PURIFIED CAT IgG |
10 mg |
184-Eur |
AbD Serotec |
cat |
| RT-GF |
Rat IgG, Protein A Purified |
10 mg |
118-Eur |
Molinn |
|
| B65140G |
AdenovirusGoat Purified |
1mL |
346-Eur |
Meridian Life Science |
|
| B65131G |
HSV-1Goat Purified |
1mL |
294-Eur |
Meridian Life Science |
|
| B65121S |
HSV-2Sheep Purified |
1mL |
294-Eur |
Meridian Life Science |
|
| CP17-N-25 |
Ceruloplasmin Rat, purified |
25 ug |
262-Eur |
Alpha Diagnostics |
rat |
| HLS002594 |
Hyaluronidase, purified |
50KU |
133-Eur |
Bio Basic Inc. |
|
| Y103281 |
CD51 Purified MAb |
1 ml |
928-Eur |
ABM Goods |
monoclonal |
| C3C11-A |
Anti_Human C3c IgG, purified |
100 ug |
407-Eur |
Alpha Diagnostics |
human |
| B65951G |
HIV-1, p24Goat Purified |
1mL |
331-Eur |
Meridian Life Science |
|
| SW-GF |
Swine IgG, Protein G Purified |
1000 mg |
330-Eur |
Molinn |
|
| SA6042 |
IPP (1-157) antigen Purified |
0.1 mg |
237-Eur |
ACR |
|
| IR-HS-GF |
Horse IgG Protein G Purified |
50mg |
138-Eur |
Innovative Research INC |
|
| PR27067-10 |
G-CSF antigen Purified |
10 |
435-Eur |
ACR |
|
| B65821R |
AspergillusRabbit Purified |
1mL |
378-Eur |
Meridian Life Science |
|
| PR27067-2 |
G-CSF antigen Purified |
2 |
327-Eur |
ACR |
|
| P304-3 |
SS-B _ La antigen Purified |
0.1 mg |
561-Eur |
ACR |
|
| B65891R |
KlebsiellaRabbit Purified |
1mL |
313-Eur |
Meridian Life Science |
|
| AS10 924 |
Antibody: Rat purified IgG (5 mg) |
5 mg |
188-Eur |
Gentaur |
|
| NLS004761 |
Neuraminidase, Purified |
10U |
554-Eur |
Bio Basic Inc. |
|
| CLS005275 |
Collagenase, purified |
4KU |
253-Eur |
Bio Basic Inc. |
|
| B65107R |
HSV-1&2Rabbit Purified |
1mL |
323-Eur |
Meridian Life Science |
|
| PR27050-10 |
HGF antigen Purified |
10 |
282-Eur |
ACR |
|
| PR27049-2 |
HGF antigen Purified |
2 |
165-Eur |
ACR |
|
| O705084 |
Ovalbumin, purified |
1G |
60-Eur |
Bio Basic Inc. |
|
| PR27042-5 |
MIF antigen Purified |
5 |
165-Eur |
ACR |
|
| PR27042-25 |
MIF antigen Purified |
25 |
282-Eur |
ACR |
|
| PR27038-5 |
CD4 (26-226) antigen Purified |
5 |
435-Eur |
ACR |
|
| P269-3 |
RNP U1 68k antigen Purified |
0.1 mg |
561-Eur |
ACR |
|
| P249-3 |
Sm-BB' antigen Purified |
0.1 mg |
561-Eur |
ACR |
|
| PR27038-2 |
CD4 (26-226) antigen Purified |
2 |
327-Eur |
ACR |
|
| PR27032-2 |
CD4 antigen Purified |
2 |
210-Eur |
ACR |
|
| PR27032-10 |
CD4 antigen Purified |
10 |
327-Eur |
ACR |
|
| PR27050-2 |
HGF antigen Purified |
2 |
165-Eur |
ACR |
|
| PR27054-1 |
Bcl-2 (1-218) antigen Purified |
1 |
165-Eur |
ACR |
|
| B65105G |
RubellaGoat Purified |
1mL |
294-Eur |
Meridian Life Science |
|
| DLS004315 |
Dextranase, Purified |
1000U |
343-Eur |
Bio Basic Inc. |
|
| B47385G |
E. coliGoat Purified |
1mL |
593-Eur |
Meridian Life Science |
|
| IR-GT-GF |
Goat IgG Protein G Purified |
1000mg |
460-Eur |
Innovative Research INC |
|
| PR27066-2 |
G-CSF antigen Purified |
2 |
327-Eur |
ACR |
|
| Y104206 |
p24 (HIV_1IIIB) _ IgG Purified |
100ug |
527-Eur |
ABM Goods |
|
| PR27066-10 |
G-CSF antigen Purified |
10 |
435-Eur |
ACR |
|
| SA6042X |
IPP (1-157) antigen Purified |
0.5 mg |
516-Eur |
ACR |
|
| Y105850 |
Rat IgG (H&L), affinity purified |
1 mg |
378-Eur |
ABM Goods |
rat |
| PR27055-10 |
Bax antigen Purified |
1 |
246-Eur |
ACR |
|
| PR27054-5 |
Bcl-2 (1-218) antigen Purified |
5 |
282-Eur |
ACR |
|
| PR27019-5 |
FGF-19 antigen Purified |
5 |
165-Eur |
ACR |
|
| B65961G |
HIV-1, gp120Goat Purified |
1mL |
378-Eur |
Meridian Life Science |
|
| IR-GT-GF |
Goat IgG Protein G Purified |
50mg |
161-Eur |
Innovative Research INC |
|
| 14-6785-80 |
Anti-c-Myc p67 Purified 25 ug |
|
174-Eur |
eBioscience |
|
| 14-6774-81 |
Anti-GFP Purified 50 ug |
|
201-Eur |
eBioscience |
|
| 14-6774-63 |
Anti-GFP Purified 10 ug |
|
119-Eur |
eBioscience |
|
| PA1265X |
MMP-3 antigen Purified |
20 |
183-Eur |
ACR |
|
| 14-6756-81 |
Anti-HA tag Purified 50 ug |
|
215-Eur |
eBioscience |
|
| 14-6756-63 |
Anti-HA tag Purified 10 ug |
|
119-Eur |
eBioscience |
|
| ABS3376 |
PURIFIED MOUSE IgG |
10 mg |
358-Eur |
AbD Serotec |
mouse |
| PR27049-10 |
HGF antigen Purified |
10 |
282-Eur |
ACR |
|
| 0810011SP |
SIV Mac 251 Sucrose Purified |
MG |
1059-Eur |
Zeptometrix |
|
| PA155X |
EGF antigen Purified |
0.5 mg |
237-Eur |
ACR |
|
| 14-6785-82 |
Anti-c-Myc p67 Purified 100 ug |
|
310-Eur |
eBioscience |
|
| 14-6796-80 |
Anti-V5 Tag Purified 25 ug |
|
174-Eur |
eBioscience |
|
| 14-6999-82 |
Anti-Rat Bax Purified 100 ug |
|
297-Eur |
eBioscience |
|
| 14-6999-81 |
Anti-Rat Bax Purified 50 ug |
|
201-Eur |
eBioscience |
|
| 14-6997-82 |
Anti-Bax Purified 100 ug |
|
297-Eur |
eBioscience |
|
| PA155 |
EGF antigen Purified |
0.1 mg |
147-Eur |
ACR |
|
| GTX76212 |
CD4 Rat antibody Ab Purified |
0.1 mg |
300-Eur |
ACR |
|
| 14-6997-81 |
Anti-Bax Purified 50 ug |
|
201-Eur |
eBioscience |
|
| PR27070-2 |
GM-CSF antigen Purified |
2 |
165-Eur |
ACR |
|
| 14-6994-82 |
Anti-Bcl-xL Purified 100 ug |
|
297-Eur |
eBioscience |
|
| 14-6994-81 |
Anti-Bcl-xL Purified 50 ug |
|
201-Eur |
eBioscience |
|
| 14-6796-82 |
Anti-V5 Tag Purified 100 ug |
|
351-Eur |
eBioscience |
|
| IR-HT-GF |
Hamster IgG Protein G Purified |
10mg |
138-Eur |
Innovative Research INC |
|
| IR-HT-GF |
Hamster IgG Protein G Purified |
50mg |
179-Eur |
Innovative Research INC |
|
| 14-0040-81 |
Anti-Rat CD4 Purified 50 ug |
|
147-Eur |
eBioscience |
|
| 14-0040-82 |
Anti-Rat CD4 Purified 100 ug |
|
215-Eur |
eBioscience |
|
| 14-0040-85 |
Anti-Rat CD4 Purified 500 ug |
|
310-Eur |
eBioscience |
|
| T200-1 |
EGF antigen Purified |
0.1 mg |
192-Eur |
ACR |
|
| PR27168-5 |
MMP-7 antigen Purified |
5 |
201-Eur |
ACR |
|
| PR27069-10 |
GM-CSF antigen Purified |
10 |
282-Eur |
ACR |
|
| HLS002592 |
Hyaluronidase, purified |
300KU |
461-Eur |
Bio Basic Inc. |
|
| PR27168-20 |
MMP-7 antigen Purified |
20 |
282-Eur |
ACR |
|
| BV-GF |
Bovine IgG, Protein G Purified |
50 mg |
105-Eur |
Molinn |
|
| IR-HS-GF |
Horse IgG Protein G Purified |
10mg |
120-Eur |
Innovative Research INC |
|
| PR27069-2 |
GM-CSF antigen Purified |
2 |
165-Eur |
ACR |
|
| PR27070-10 |
GM-CSF antigen Purified |
10 |
282-Eur |
ACR |
|
| IR-HT-GF |
Hamster IgG Protein G Purified |
1000mg |
576-Eur |
Innovative Research INC |
|
| GTX76350 |
CD8 Rat antibody Ab Purified |
0.25 mg |
327-Eur |
ACR |
|
| GTX76351 |
CD8 Rat antibody Ab Purified |
0.1 mg |
264-Eur |
ACR |
|
| 0810003SP |
CMV Sucrose Purified (HHV-5) |
ML |
1059-Eur |
Zeptometrix |
|
| 14-0030-81 |
Anti-Rat CD3 Purified 50 ug |
|
133-Eur |
eBioscience |
|
| IR-GT-GF |
Goat IgG Protein G Purified |
10mg |
120-Eur |
Innovative Research INC |
|
| 14-0030-82 |
Anti-Rat CD3 Purified 100 ug |
|
187-Eur |
eBioscience |
|
| NLS004759 |
Neuraminidase, Purified |
5U |
330-Eur |
Bio Basic Inc. |
|
| 14-0030-85 |
Anti-Rat CD3 Purified 500 ug |
|
351-Eur |
eBioscience |
|
| PR27074-2 |
GM-CSF _ IL-3 antigen Purified |
2 |
165-Eur |
ACR |
|
| B65971G |
HIV-1, gp41Goat Purified |
1mL |
323-Eur |
Meridian Life Science |
|
| PR27019-25 |
FGF-19 antigen Purified |
25 |
282-Eur |
ACR |
|
| GTX108133 |
MC4-R antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 20005-1-FC |
Rat IgG (Fc) fragment, purified |
0.5 mg |
291-Eur |
Alpha Diagnostics |
rat |
| 20005-1-FAB |
Rat IgG Fab fragment, purified |
1 mg |
190-Eur |
Alpha Diagnostics |
rat |
| SW-GF |
Swine IgG, Protein G Purified |
1 gram |
246-Eur |
Molinn |
|
| W90004C |
IgGSheep Purified |
1mL |
236-Eur |
Meridian Life Science |
|
| M0101 |
Multiple Tag (Purified) |
200ug |
186-Eur |
Genscript |
|
| ABS5194 |
PURIFIED RABBIT IgM |
1 mg |
335-Eur |
AbD Serotec |
polyclonal |
| HBM-PS30/2 |
PURIFIED EXOSOMES for |
1 |
261-Eur |
HansaBioMed |
|
| HBM-PS30/4 |
PURIFIED EXOSOMES for |
1 |
431-Eur |
HansaBioMed |
|
| HBM-PS30/6 |
PURIFIED EXOSOMES for |
1 |
602-Eur |
HansaBioMed |
|
| HBM-PEU100/2 |
PURIFIED EXOSOMES for |
1 |
517-Eur |
HansaBioMed |
|
| IR-SH-GF |
Sheep IgG Protein G Purified |
1000mg |
460-Eur |
Innovative Research INC |
|
| SW-GF |
Swine IgG, Protein G Purified |
2 grams |
409-Eur |
Molinn |
|
| PR27074-10 |
GM-CSF _ IL-3 antigen Purified |
10 |
282-Eur |
ACR |
|
| 20016-1-FAB |
Dog IgG Fab fragment, purified |
0.5 mg |
233-Eur |
Alpha Diagnostics |
dog |
| A01374H |
IgD >95% PureHuman Purified |
25ug |
512-Eur |
Meridian Life Science |
|
| ABS5430 |
PURIFIED hCG ALPHA |
0.1 mg |
1158-Eur |
AbD Serotec |
|
| ABS5310 |
PURIFIED SHEEP IgG |
10 mg |
149-Eur |
AbD Serotec |
|
| ABS5284 |
PURIFIED RAT IgG (POLYCLONAL) |
20 mg |
335-Eur |
AbD Serotec |
polyclonal |
| ABS5248 |
PURIFIED MOUSE IgG |
2 mg |
79-Eur |
AbD Serotec |
mouse |
| ABS5228 |
PURIFIED HAMSTER IgG |
10 mg |
300-Eur |
AbD Serotec |
|
| HBM-PEU100/4 |
PURIFIED EXOSOMES for |
1 |
901-Eur |
HansaBioMed |
|
| HBM-PEU100/6 |
PURIFIED EXOSOMES for |
1 |
1286-Eur |
HansaBioMed |
|
| BV-GF |
Bovine IgG, Protein G Purified |
100 mg |
136-Eur |
Molinn |
|
| YSRTPRABP01 |
Purified Rabbit IgG |
10 mg. |
270-Eur |
Accurate |
polyclonal |
| YSRTPHP159 |
Purified Human TSH |
0.1 mg. |
516-Eur |
Accurate |
human |
| YSRTPHP145 |
Purified hCG Alpha |
0.1 mg. |
1988-Eur |
Accurate |
|
| YNPBSA |
BSA, chromatographically purified |
100 mg. |
753-Eur |
Accurate |
|
| T40269R |
LamininRabbit Purified |
0.5mL |
773-Eur |
Meridian Life Science |
|
| YSRTPMP01X |
Mouse IgG, purified |
10 mg. |
412-Eur |
Accurate |
mouse |
| H2O5 |
Purified Water |
5L |
49-Eur |
Reagecon |
|
| YSRTPMP01 |
Mouse IgG, purified |
2 mg. |
128-Eur |
Accurate |
mouse |
| H2O25 |
Purified Water |
25L |
102-Eur |
Reagecon |
|
| H2O10 |
Purified Water |
10L |
83-Eur |
Reagecon |
|
| IG42003 |
Rat IgG, affinity purified |
10 mg |
284-Eur |
Anogen |
|
| C66440M |
AdenovirusMouse Purified IgG |
1mg |
307-Eur |
Meridian Life Science |
|
| YSRTPPP012 |
Purified Swine IgG |
10 mg. |
451-Eur |
Accurate |
porcine |
| IG42003 |
Rat IgG, affinity purified |
20 mg |
418-Eur |
Anogen |
|
| GTX116440 |
EHF antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| SPC-182A |
Calnexin_CT (Purified) |
50ug |
181-Eur |
Stressmarq |
|
| SPC-182B |
Calnexin_CT (Purified) |
200ug |
331-Eur |
Stressmarq |
|
| 14-0990-82 |
Anti-Rat IgM Purified 100 ug |
|
256-Eur |
eBioscience |
|
| Z02201 |
Purified Protein A |
10mg |
157-Eur |
Genscript |
|
| Z02201 |
Purified Protein A |
50mg |
575-Eur |
Genscript |
|
| Z02201 |
Purified Protein A |
500mg |
3891-Eur |
Genscript |
|
| YNNRaIgG |
Rat IgG, chromatographically purified |
10 mg. |
1061-Eur |
Accurate |
rat |
| IR-SH-GF |
Sheep IgG Protein G Purified |
10mg |
120-Eur |
Innovative Research INC |
|
| IR-SH-GF |
Sheep IgG Protein G Purified |
50mg |
161-Eur |
Innovative Research INC |
|
| PR27009-500 |
EGF antigen Purified |
0.5 mg |
282-Eur |
ACR |
|
| SA6053 |
MIF (1-115, His-tag) antigen Purified |
0.1 mg |
237-Eur |
ACR |
|
| SA6053X |
MIF (1-115, His-tag) antigen Purified |
0.5 mg |
516-Eur |
ACR |
|
| SA6057 |
VHL (1-154, His-tag) antigen Purified |
0.1 mg |
237-Eur |
ACR |
|
| SA6057X |
VHL (1-154, His-tag) antigen Purified |
0.5 mg |
516-Eur |
ACR |
|
| Z86213M |
IgG (Fc)Mouse Purified IgG |
1mg |
401-Eur |
Meridian Life Science |
|
| 1806 |
PURIFIED AGAR |
50kg |
----Eur |
Condalab -BULK |
|
| 1806 |
PURIFIED AGAR |
25kg |
----Eur |
Condalab -BULK |
|
| 14-5824-82 |
Anti-T-bet Purified 100 ug |
|
406-Eur |
eBioscience |
|
| 1806 |
PURIFIED AGAR |
10kg |
----Eur |
Condalab -BULK |
|
| 14-5824-80 |
Anti-T-bet Purified 25 ug |
|
174-Eur |
eBioscience |
|
| IR-HS-GF |
Horse IgG Protein G Purified |
1000mg |
460-Eur |
Innovative Research INC |
|
| 1806 |
PURIFIED AGAR |
5kg |
----Eur |
Condalab -BULK |
|
| R5V133-754 |
RicinRabbit Purified |
1mg |
677-Eur |
Meridian Life Science |
|
| PR15043-50 |
RET antigen Purified |
50 |
399-Eur |
ACR |
|
| Z86101M |
IgG (Fc)Mouse Purified IgG |
1mg |
394-Eur |
Meridian Life Science |
|
| PR27009-100 |
EGF antigen Purified |
0.1 mg |
165-Eur |
ACR |
|
| PR27007-500 |
EGF antigen Purified |
0.5 mg |
282-Eur |
ACR |
|
| PR27007-100 |
EGF antigen Purified |
0.1 mg |
165-Eur |
ACR |
|
| Y051152 |
Anti_Hirudin Purified IgG |
100μg |
592-Eur |
ABM Goods |
|
| PR27006-500 |
EGF antigen Purified |
0.5 mg |
282-Eur |
ACR |
|
| O705084 |
Ovalbumin, purified |
5G |
113-Eur |
Bio Basic Inc. |
|
| PR27006-100 |
EGF antigen Purified |
0.1 mg |
165-Eur |
ACR |
|
| W90075C |
IgG (Fd)Sheep Purified |
1mL |
448-Eur |
Meridian Life Science |
|
| PR27003-5 |
NGF antigen Purified |
5 |
165-Eur |
ACR |
|
| PR27003-20 |
NGF antigen Purified |
20 |
282-Eur |
ACR |
|
| PR27002-5 |
NGF antigen Purified |
5 |
165-Eur |
ACR |
|
| PR27002-20 |
NGF antigen Purified |
20 |
282-Eur |
ACR |
|
| PR15083-100 |
NGF antigen Purified |
0.1 mg |
381-Eur |
ACR |
|
| 10-783-79718 |
PURIFIED OVINE IgG - |
10 mg |
202-Eur |
GenWay |
|
| A63100H |
MyeloperoxidaseHuman Purified |
1mg |
1098-Eur |
Meridian Life Science |
|
| IR-RB-GF |
Rabbit IgG Protein A Purified |
10mg |
103-Eur |
Innovative Research INC |
|
| 10-783-79675 |
PURIFIED BOVINE IgG - |
10 mg |
202-Eur |
GenWay |
bovine |
| 10-783-79674 |
PURIFIED CHICKEN IgG (IgY) - IgY |
10 mg |
325-Eur |
GenWay |
|
| 10-783-79663 |
PURIFIED CANINE IgG - |
10 mg |
462-Eur |
GenWay |
dog |
| 10-783-79660 |
PURIFIED HAMSTER IgG - |
10 mg |
543-Eur |
GenWay |
|
| 18-783-78508 |
PURIFIED RABBIT IgM - |
1 mg |
598-Eur |
GenWay |
polyclonal |
| 25-783-76759 |
PURIFIED RABBIT IgG - |
10 mg |
216-Eur |
GenWay |
polyclonal |
| IR-RB-GF |
Rabbit IgG Protein A Purified |
1000mg |
477-Eur |
Innovative Research INC |
|
| 20016-1-FC |
Dog IgG (Fc) fragment, purified |
0.5 mg |
291-Eur |
Alpha Diagnostics |
dog |
| O705084 |
Ovalbumin, purified |
25G |
426-Eur |
Bio Basic Inc. |
|
| W01249G |
IgG (Fc), RabbitGoat Purified |
10mg |
202-Eur |
Meridian Life Science |
|
| ABS6092 |
PURIFIED HUMAN TSH |
0.1 mg |
277-Eur |
AbD Serotec |
human |
| A01302C |
IgY, ChickenChicken Purified |
50mg |
315-Eur |
Meridian Life Science |
|
| A01310S |
AngiotensinSynthetic Purified |
1mg |
289-Eur |
Meridian Life Science |
|
| 10-783-79678 |
PURIFIED GOAT IgG - |
10 mg |
284-Eur |
GenWay |
polyclonal |
| 10-783-79679 |
PURIFIED EQUINE IgG - |
10 mg |
202-Eur |
GenWay |
horse |
| 10-783-79717 |
PURIFIED RAT IgG (POLYCLONAL) - |
20 mg |
584-Eur |
GenWay |
polyclonal |
| 10-783-79708 |
PURIFIED PORCINE IgG - |
10 mg |
489-Eur |
GenWay |
porcine |
| 10-783-79705 |
PURIFIED MOUSE IgG - |
10 mg |
462-Eur |
GenWay |
mouse |
| 10-783-79704 |
PURIFIED MOUSE IgG - |
2 mg |
148-Eur |
GenWay |
mouse |
| 10-783-79701 |
PURIFIED HUMAN TSH - |
0.1 mg |
1130-Eur |
GenWay |
human |
| GTX107804 |
SYK antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 10-783-79693 |
PURIFIED HUMAN hCG - |
1 mg |
557-Eur |
GenWay |
human |
| 10-783-79690 |
PURIFIED HUMAN FSH - |
0.1 mg |
2222-Eur |
GenWay |
human |
| 10-783-79689 |
PURIFIED hCG ALPHA - |
0.1 mg |
2168-Eur |
GenWay |
|
| IR-RB-GF |
Rabbit IgG Protein A Purified |
50mg |
161-Eur |
Innovative Research INC |
|
| 10-783-79680 |
PURIFIED FELINE IgG - |
10 mg |
216-Eur |
GenWay |
cat |
| IR-RB-GF |
Rabbit IgG Protein A Purified |
500mg |
278-Eur |
Innovative Research INC |
|
| ABS6020 |
PURIFIED BOVINE IgG |
10 mg |
219-Eur |
AbD Serotec |
bovine |
| GTX101988 |
ST5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AS10868 |
Horse purified IgG (100 mg) |
100 mg |
280-Eur |
Agrisera |
horse |
| AS10867 |
Horse purified IgG (10 mg) |
10 mg |
230-Eur |
Agrisera |
horse |
| GTX29796 |
NGF antigen Purified |
20 |
354-Eur |
ACR |
|
| 1806 |
PURIFIED AGAR |
500 grams |
108-Eur |
Condalab -BULK |
|
| AS10862 |
Bovine purified IgG (1 g) |
1 g |
344-Eur |
Agrisera |
bovine |
| G01264S |
NorketamineSheep Purified |
100ug |
1910-Eur |
Meridian Life Science |
|
| G01263S |
NorketamineSheep Purified |
100ug |
1910-Eur |
Meridian Life Science |
|
| Q01116M |
AstrocytesMouse Purified IgM |
125ug |
454-Eur |
Meridian Life Science |
|
| AS10861 |
Bovine purified IgG (100 mg) |
100 mg |
272-Eur |
Agrisera |
bovine |
| AS10860 |
Bovine purified IgG (10 mg) |
10 mg |
201-Eur |
Agrisera |
bovine |
| G01262S |
NorketamineSheep Purified |
100ug |
1910-Eur |
Meridian Life Science |
|
| ABS3236 |
PURIFIED GOAT IgG |
10 mg |
198-Eur |
AbD Serotec |
polyclonal |
| G01261S |
NorketamineSheep Purified |
100ug |
1910-Eur |
Meridian Life Science |
|
| C66439M |
AdenovirusMouse Purified IgG |
1mg |
307-Eur |
Meridian Life Science |
|
| 601-680 |
dNK Rabbit antibody Ab Aff - Purified |
0.1 mg |
354-Eur |
ACR |
|
| AS10869 |
Horse purified IgG (1 g) |
1 g |
486-Eur |
Agrisera |
horse |
| AS10871 |
Guinea pig purified IgG (5 mg) |
5 mg |
272-Eur |
Agrisera |
|
| GTX105641 |
Bcl-2-like 5 antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| 601-400 |
MMP-12 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| L04366G |
IgDGoat Purified |
10mL |
227-Eur |
Meridian Life Science |
|
| C4P60-188 |
HirudinChicken Purified |
2mL |
255-Eur |
Meridian Life Science |
|
| 601-450 |
OCT-4 Rabbit antibody Ab Aff - Purified |
0.1 mg |
336-Eur |
ACR |
|
| K95001C |
ProthrombinDonkey Purified |
1mg |
188-Eur |
Meridian Life Science |
|
| GTX105150 |
BPI antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AS10877 |
Goat purified IgG (1 g) |
1 g |
386-Eur |
Agrisera |
polyclonal |
| AS10876 |
Goat purified IgG (100 mg) |
100 mg |
272-Eur |
Agrisera |
polyclonal |
| AS10875 |
Goat purified IgG (10 mg) |
10 mg |
230-Eur |
Agrisera |
polyclonal |
| K90052C |
ElastaseSheep Purified |
1mL |
401-Eur |
Meridian Life Science |
|
| F30282R |
VancomycinRabbit Purified |
0.2mL |
275-Eur |
Meridian Life Science |
|
| AS10873 |
Guinea pig purified IgG (1 g) |
1 g |
586-Eur |
Agrisera |
|
| AS10872 |
Guinea pig purified IgG (50 mg) |
50 mg |
486-Eur |
Agrisera |
|
| C66437M |
AdenovirusMouse Purified IgG |
1mg |
307-Eur |
Meridian Life Science |
|
| FG-G-SEF-01A |
Sef (Human) FAM Labeled Purified IgG |
100 µl |
763-Eur |
Phoenix Peptide |
labeled |
| 31C-CH0210 |
Cat IgG (Fab), Purified Immunoglobulins |
5 mg |
417-Eur |
Fitzgerald |
|
| AM26334PU-N |
MBL-A Rat IgG antibody Ab Purified |
0.1 mg |
390-Eur |
ACR |
|
| 31C-CH0213 |
Cat IgM, Purified Immunoglobulins |
1 mg |
458-Eur |
Fitzgerald |
|
| O705084 |
Ovalbumin, purified |
25G |
442-Eur |
BBI Biotech |
|
| O705084 |
Ovalbumin, purified |
5G |
121-Eur |
BBI Biotech |
|
| O705084 |
Ovalbumin, purified |
1G |
66-Eur |
BBI Biotech |
|
| K01253S |
ThrombopoietinSheep Purified |
1mg |
506-Eur |
Meridian Life Science |
|
| 31C-CH0401 |
Dog IgG, Purified Immunoglobulins |
10 mg |
274-Eur |
Fitzgerald |
|
| 31C-CH0404 |
Dog IgG (Fc), Purified Immunoglobulins |
1 mg |
403-Eur |
Fitzgerald |
|
| 31C-CH0410 |
Dog IgG (Fab), Purified Immunoglobulins |
1 mg |
417-Eur |
Fitzgerald |
|
| 31C-CH0413 |
Dog IgM, Purified Immunoglobulins |
1 mg |
510-Eur |
Fitzgerald |
|
| K01257S |
FibrinogenSheep Purified |
1mg |
519-Eur |
Meridian Life Science |
|
| K63142S |
ReninSheep Purified |
1mg |
593-Eur |
Meridian Life Science |
|
| K01276M |
PSF1Rat Purified IgG |
100ug |
886-Eur |
Meridian Life Science |
|
| 31C-CH0207 |
Cat IgG (Fab'2), Purified Immunoglobulins |
2 mg |
162-Eur |
Fitzgerald |
|
| 31C-CH0204 |
Cat IgG (Fc), Purified Immunoglobulins |
1 mg |
417-Eur |
Fitzgerald |
|
| BC-048 |
Osteocalcin, purified bovine |
100 ug |
609-Eur |
Kamiya Biomedical KB |
bovine |
| GTX101240 |
BAL _ CEL antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| K67430M |
PhosphoserineMouse Purified IgM,k |
100ug |
664-Eur |
Meridian Life Science |
|
| 1806 |
PURIFIED AGAR |
500 grams |
108-Eur |
Condalab |
|
| C65981M |
HIV-1, p17Mouse Purified IgG |
100ug |
388-Eur |
Meridian Life Science |
|
| K01248R |
VitronectinRabbit Purified |
0.2mg |
280-Eur |
Meridian Life Science |
|
| K63964R |
VitronectinRabbit Purified |
1mg |
666-Eur |
Meridian Life Science |
|
| K63819R |
UrokinaseRabbit Purified |
1mg |
680-Eur |
Meridian Life Science |
|
| K63679R |
UrokinaseRabbit Purified |
0.2mg |
283-Eur |
Meridian Life Science |
|
| K63235R |
FibrinogenRabbit Purified |
1mg |
593-Eur |
Meridian Life Science |
|
| BC-048 |
Osteocalcin, purified bovine |
100 ug |
609-Eur |
Kamiya Biomedical KB |
bovine |
| AM26335PU-N |
MBL-A Rat IgG antibody Ab Purified |
0.1 mg |
390-Eur |
ACR |
|
| K62605G |
MyoglobinGoat Purified |
10mL |
216-Eur |
Meridian Life Science |
|
| RS-15GFC |
Purified Rabbit IgG Fc |
1.0 mg |
192-Eur |
ICL |
polyclonal |
| K59200G |
FibrinogenGoat Purified |
50mg |
687-Eur |
Meridian Life Science |
|
| P130-200 |
Purified Sheep IgG |
100 mg |
544-Eur |
Bethyl |
|
| MEM24-211 |
S-100Mouse Purified IgM,k |
100ug |
273-Eur |
Meridian Life Science |
|
| GTX103510 |
AUH antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106413 |
Bcl-2-like 11 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX101811 |
FUS _ TLS antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| F01240S |
EscitalopramSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| F01239S |
TrazodoneSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| ABS3271 |
PURIFIED CHICKEN IgG |
10 mg |
346-Eur |
AbD Serotec |
|
| GTX101369 |
AGL _ GDE antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX101353 |
Bcl-2-like 8 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106483 |
HBZ antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| F01238S |
SecobarbitalSheep Purified |
100uL |
840-Eur |
Meridian Life Science |
|
| 600-700 |
PSA Rabbit antibody Ab Aff - Purified |
0.1 mg |
255-Eur |
ACR |
|
| F01237S |
SalvinorinSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| F01245S |
NorfluoxetineSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| F01246S |
ClenbuterolSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| AM09233PU-N |
CD8 Rat IgM antibody Ab Aff - Purified |
0.5 mg |
426-Eur |
ACR |
|
| F01241S |
NorsertralineSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| F01242S |
DesipramineSheep Purified |
100uL |
840-Eur |
Meridian Life Science |
|
| F01236S |
MescalineSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| MJL108-150 |
CD108Mouse Purified IgM |
100ug |
266-Eur |
Meridian Life Science |
|
| MJL15-158 |
CD15Mouse Purified IgM |
100ug |
252-Eur |
Meridian Life Science |
|
| MJL20-269 |
CD20Mouse Purified IgM |
100ug |
252-Eur |
Meridian Life Science |
|
| 0810011SP |
SIV Mac 251 Sucrose Purified |
|
----Eur |
Zeptometrix |
|
| MKF05-148 |
hCG, betaMouse Purified IgG |
1mg |
268-Eur |
Meridian Life Science |
|
| MKL25-140 |
CD25Mouse Purified IgM |
100ug |
252-Eur |
Meridian Life Science |
|
| MKL47-122 |
CD47Mouse Purified IgM |
100ug |
301-Eur |
Meridian Life Science |
|
| 0810011SP |
SIV Mac 251 Sucrose Purified |
|
----Eur |
Zeptometrix |
|
| N01244M |
ProthrombinRat Purified |
100ug |
356-Eur |
Meridian Life Science |
|
| N01245M |
PlasminogenRat Purified |
100ug |
356-Eur |
Meridian Life Science |
|
| 0810003SP |
CMV Sucrose Purified |
|
----Eur |
Zeptometrix |
|
| 0810003SP |
CMV Sucrose Purified |
|
----Eur |
Zeptometrix |
|
| F01243S |
CyclopentobarbitalSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| 602-950 |
Bcl-2-like 2 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| G55417M |
Enrofloxacin_CiprofloxacinMouse Purified IgM |
1mg |
548-Eur |
Meridian Life Science |
|
| MAL30-268 |
CD30Mouse Purified IgG |
100ug |
266-Eur |
Meridian Life Science |
|
| AS10917 |
Rabbit purified IgG (100 mg) |
100 mg |
287-Eur |
Agrisera |
polyclonal |
| AS10916 |
Rabbit purified IgG (10 mg) |
10 mg |
244-Eur |
Agrisera |
polyclonal |
| AS10914 |
Mouse purified IgG (1 g) |
1 g |
514-Eur |
Agrisera |
mouse |
| E01249M |
ProinsulinMouse Purified IgG |
1mg |
634-Eur |
Meridian Life Science |
|
| AS10913 |
Mouse purified IgG (100 mg) |
100 mg |
322-Eur |
Agrisera |
mouse |
| AS10912 |
Mouse purified IgG (10 mg) |
10 mg |
272-Eur |
Agrisera |
mouse |
| 150-56-6 |
Ethyl cyanoacetate purified |
1g |
----Eur |
chemotra |
|
| AS10896 |
Human purified IgG (1 g) |
1 g |
287-Eur |
Agrisera |
human |
| AS10895 |
Human purified IgG (100 mg) |
100 mg |
287-Eur |
Agrisera |
human |
| AS10882 |
Human purified IgG (10 mg) |
10 mg |
265-Eur |
Agrisera |
human |
| AS10881 |
Hamster purified IgG (1 g) |
1 g |
586-Eur |
Agrisera |
|
| AS10880 |
Hamster purified IgG (100 mg) |
100 mg |
322-Eur |
Agrisera |
|
| AS10879 |
Hamster purified IgG (10 mg) |
10 mg |
265-Eur |
Agrisera |
|
| GTX101290 |
PAH antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AS10918 |
Rabbit purified IgG (1 g) |
1 g |
379-Eur |
Agrisera |
polyclonal |
| AS10928 |
Sheep purified IgG (10 mg) |
10 mg |
272-Eur |
Agrisera |
|
| F01235R |
FentanylRabbit Purified |
1mg |
441-Eur |
Meridian Life Science |
|
| A23100M |
Purified Mouse Apo AI |
50ug |
1010-Eur |
Meridian Life Science |
mouse |
| A23250H |
Purified Hamster Apo AI |
100ug |
2058-Eur |
Meridian Life Science |
|
| A50175H |
Purified Human IgG (Fc) |
10mg |
525-Eur |
Meridian Life Science |
human |
| A50177H |
Purified Human IgG (Fab) |
5mg |
302-Eur |
Meridian Life Science |
human |
| P01287M |
CD57Mouse Purified IgM |
0.2mg |
394-Eur |
Meridian Life Science |
|
| A50192H |
Purified Plasmin |
1mg |
249-Eur |
Meridian Life Science |
|
| P18025M |
CD90 (Thy-1.2)Rat Purified IgM (Rat) |
0.2mg |
268-Eur |
Meridian Life Science |
|
| P18422M |
Interleukin 2 (IL-2)Rat Purified IgG |
0.2mg |
268-Eur |
Meridian Life Science |
|
| F01244S |
TrazodoneSheep Purified |
100uL |
1121-Eur |
Meridian Life Science |
|
| AS101401 |
Purified Human IgM |
10 mg |
550-Eur |
Agrisera |
human |
| AS101400 |
Purified Human IgM |
1 mg |
244-Eur |
Agrisera |
human |
| AS10930 |
Sheep purified IgG (1 g) |
1 g |
486-Eur |
Agrisera |
|
| AS10929 |
Sheep purified IgG (100 mg) |
100 mg |
272-Eur |
Agrisera |
|
| L62540G |
IgG (Fc)Goat Purified |
10mL |
315-Eur |
Meridian Life Science |
|
| P10-117 |
Purified Bovine IgG2 |
1 mg |
393-Eur |
Bethyl |
bovine |
| 25-511 |
Purified Water, Sterile |
|
91-Eur |
Genesee |
|
| GTX101022 |
NGF antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 31R-1046 |
Rat IgG (H + L), Purified Immunoglobulins |
5 mg |
267-Eur |
Fitzgerald |
|
| MI10-101 |
Purified Mouse IgA |
1 mg |
431-Eur |
Bethyl |
mouse |
| C11994M |
AdenovirusMouse Purified IgG |
1mg |
501-Eur |
Meridian Life Science |
|
| 31C-CH1201 |
Rat IgG, Purified Immunoglobulins |
10 mg |
274-Eur |
Fitzgerald |
|
| 31C-CH1204 |
Rat IgG (Fc), Purified Immunoglobulins |
1 mg |
417-Eur |
Fitzgerald |
|
| 31C-CH1207 |
Rat IgG (Fab'2), Purified Immunoglobulins |
2 mg |
162-Eur |
Fitzgerald |
|
| 31C-CH1210 |
Rat IgG (Fab), Purified Immunoglobulins |
2 mg |
329-Eur |
Fitzgerald |
|
| 31C-CH1213 |
Rat IgM, Purified Immunoglobulins |
1 mg |
458-Eur |
Fitzgerald |
|
| H2025 |
Purified Water |
25L |
89-Eur |
Reagecon |
|
| H2010 |
Purified Water |
10L |
63-Eur |
Reagecon |
|
| P10-116 |
Purified Bovine IgG1 |
1 mg |
393-Eur |
Bethyl |
bovine |
| RS-50GFC |
Purified Goat IgG Fc |
1.0 mg |
169-Eur |
ICL |
polyclonal |
| 8G4 |
GAPDH antigen Purified |
1 mg |
777-Eur |
ACR |
|
| H6T08-275 |
ThyroglobulinHuman Purified |
1mg |
375-Eur |
Meridian Life Science |
|
| VV147-1 |
VZV Purified Glycoproteins |
|
398-Eur |
Virusys |
|
| E86129M |
ThyroglobulinMouse Purified IgM |
1mg |
326-Eur |
Meridian Life Science |
|
| GTX101134 |
AP-1 _ c-Jun antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| E01248M |
ProinsulinMouse Purified IgG |
1mg |
634-Eur |
Meridian Life Science |
|
| GTX105691 |
PC5 _ PC6 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| E86125M |
ProlactinMouse Purified IgG |
1mg |
297-Eur |
Meridian Life Science |
|
| 610-030 |
GFP Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| E01293R |
AldosteroneRabbit Purified |
1mL |
534-Eur |
Meridian Life Science |
|
| C65514M |
AspergillusMouse Purified IgM |
100ug |
371-Eur |
Meridian Life Science |
|
| GTX29752 |
G-CSF antigen Purified |
10 |
354-Eur |
ACR |
|
| CV046-1 |
CMV Gradient Purified _ 1 mg |
|
861-Eur |
Virusys |
|
| GTX105756 |
SP4 _ SPR-1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 602-830 |
MMP-7 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| 602-840 |
MMP-13 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| 1806 |
PURIFIED AGAR |
500 grams |
108-Eur |
Condalab |
|
| 31R-1022 |
Rat IgG (H + L), Purified Immunoglobulins |
5 mg |
267-Eur |
Fitzgerald |
|
| 603-420 |
HIV p24 Mouse antibody Ab Aff - Purified |
0.1 mg |
309-Eur |
ACR |
|
| 603-410 |
HIV p24 Mouse antibody Ab Aff - Purified |
0.1 mg |
309-Eur |
ACR |
|
| 603-030 |
CD3(T3)-Hu Mouse antibody Ab Aff - Purified |
0.1 mg |
291-Eur |
ACR |
|
| CV046-100 |
CMV Gradient Purified _ 100 µg |
|
181-Eur |
Virusys |
|
| E82294M |
CortisolMouse Purified IgG |
1mg |
482-Eur |
Meridian Life Science |
|
| F82910R |
OxycodoneRabbit Purified |
1mg |
454-Eur |
Meridian Life Science |
|
| MI10-100 |
Purified Mouse IgM |
1 mg |
431-Eur |
Bethyl |
mouse |
| GTX102363 |
Bcl-7B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 31C-CH1401 |
Pig IgG, Purified Immunoglobulins |
25 mg |
274-Eur |
Fitzgerald |
|
| 31C-CH1404 |
Pig IgG (Fc), Purified Immunoglobulins |
1 mg |
399-Eur |
Fitzgerald |
|
| 31C-CH1407 |
Pig IgG (Fab'2), Purified Immunoglobulins |
2 mg |
417-Eur |
Fitzgerald |
|
| 31C-CH1410 |
Pig IgG (Fab), Purified Immunoglobulins |
2 mg |
417-Eur |
Fitzgerald |
|
| E82910M |
EstriolMouse Purified IgG |
1mg |
394-Eur |
Meridian Life Science |
|
| 31C-CH1413 |
Pig IgM, Purified Immunoglobulins |
1 mg |
417-Eur |
Fitzgerald |
|
| E82353M |
EstriolMouse Purified IgG |
1mg |
394-Eur |
Meridian Life Science |
|
| 31C-CH0407 |
Dog IgG (Fab'2), Purified Immunoglobulins |
2 mg |
162-Eur |
Fitzgerald |
|
| ABS3143 |
PURIFIED RABBIT IgG |
10 mg |
149-Eur |
AbD Serotec |
polyclonal |
| DLS004315 |
Dextranase, Purified |
1000U |
363-Eur |
BBI Biotech |
|
| RS-90E |
Purified Mouse IgE myeloma |
0.5 mg |
284-Eur |
ICL |
mouse |
| HLS002592 |
Hyaluronidase, purified |
300KU |
486-Eur |
BBI Biotech |
|
| P130-100 |
Purified Sheep IgG |
50 mg |
393-Eur |
Bethyl |
|
| K01278M |
SLD5Rat Purified IgG |
100ug |
747-Eur |
Meridian Life Science |
|
| GTX102679 |
NP antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| NLS004759 |
Neuraminidase, Purified |
5U |
348-Eur |
BBI Biotech |
|
| HLS002594 |
Hyaluronidase, purified |
50KU |
142-Eur |
BBI Biotech |
|
| 602-360 |
p56-LCK Rabbit antibody Ab Aff - Purified |
0.1 mg |
255-Eur |
ACR |
|
| 602-350 |
p56-LCK Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| P120-201 |
Purified Rabbit IgG |
50 mg |
418-Eur |
Bethyl |
polyclonal |
| CLS005275 |
Collagenase, purified |
4KU |
268-Eur |
BBI Biotech |
|
| 8S9-2b |
S100B (bb) antigen Purified |
1 mg |
1488-Eur |
ACR |
|
| P120-301 |
Purified Rabbit IgG |
100 mg |
570-Eur |
Bethyl |
polyclonal |
| NLS004761 |
Neuraminidase, Purified |
10U |
583-Eur |
BBI Biotech |
|
| GTX102676 |
RET antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| K55300H |
Bcl-3Hamster Purified IgG |
100ug |
523-Eur |
Meridian Life Science |
|
| H45506M |
HemoglobinMouse Purified IgG |
1MG |
375-Eur |
Meridian Life Science |
|
| K01277M |
PSF3Mouse Purified IgG |
100ug |
747-Eur |
Meridian Life Science |
|
| GTX100588 |
MMP-26 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| ABS3056 |
PURIFIED HORSE IgG |
10 mg |
221-Eur |
AbD Serotec |
horse |
| K50891R |
MyeloperoxidaseRabbit Purified |
1mL |
216-Eur |
Meridian Life Science |
|
| P120-101 |
Purified Rabbit IgG |
10 mg |
179-Eur |
Bethyl |
polyclonal |
| Z45190M |
IgMMouse Purified IgG1 |
1mg |
296-Eur |
Meridian Life Science |
|
| Z01236M |
IgGMouse Purified IgG1,k |
1mg |
236-Eur |
Meridian Life Science |
|
| LF-PA0206 |
LCK Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| AP13185PU-N |
MMP-7 Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX100489 |
ACADM antibody Ab Aff - Purified |
0.1 ml |
264-Eur |
ACR |
|
| AP07948PU-N |
MMP-2 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| Z01238M |
IgEMouse Purified IgG1,k |
1mg |
248-Eur |
Meridian Life Science |
|
| AP13186PU-N |
MMP-8 Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| Z45904M |
IgEMouse Purified IgG2b |
1mg |
375-Eur |
Meridian Life Science |
|
| GTX102805 |
XPC _ XPCC antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 20004-2-1 |
G. Pig (non_immune) Serum IgM, purified |
0.5 mg |
262-Eur |
Alpha Diagnostics |
|
| GTX100706 |
MMP-3 Rabbit antibody Ab Aff - Purified |
0.1 ml |
219-Eur |
ACR |
|
| Z20185M |
IgEMouse Purified IgG2b,k |
1mg |
382-Eur |
Meridian Life Science |
|
| AP13184PU-N |
MMP-3 Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| Z01235M |
IgMMouse Purified IgG1,k |
1mg |
248-Eur |
Meridian Life Science |
|
| 20005-10 |
Rat Serum IgG (non_immune), purified |
10 mg |
479-Eur |
Alpha Diagnostics |
rat |
| LF-PA20040 |
Bcl-2-like 8 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| GTX103961 |
MAGE-1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX127387-200 |
mak Rabbit antibody Ab Aff - Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX100504 |
Cathepsin L1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108456 |
Interleukin-8 _ IL8 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100704 |
MMP-12 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 20005-1 |
Rat Serum IgG (non_immune), purified |
1 mg |
146-Eur |
Alpha Diagnostics |
rat |
| GTX105738 |
Plexin A2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100705 |
MMP-14 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| W59168R |
Elastase, Pig PancreasRabbit Purified |
50mg |
625-Eur |
Meridian Life Science |
|
| GTX127387 |
mak Rabbit antibody Ab Aff - Purified |
50 |
228-Eur |
ACR |
|
| GTX102854 |
TDP1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP13182PU-N |
MMP-28 Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| LF-PA20041 |
Bcl-2-like 8 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| 20017-2-1 |
Pig (swine non_immune) IgM, purified |
0.5 mg |
262-Eur |
Alpha Diagnostics |
porcine |
| GTX100703 |
MMP-11 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| Z86104M |
IgE (Fc)Mouse Purified IgG2a |
1mg |
315-Eur |
Meridian Life Science |
|
| 20016-2-1 |
Dog (non_immune) Serum IgM, purified |
0.5 mg |
262-Eur |
Alpha Diagnostics |
dog |
| GTX108478 |
CD3 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP07945PU-N |
MMP-10 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX124266 |
Bcl-2-like 1 Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP07946PU-N |
MMP-16 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX108477 |
BTN1A1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108476 |
ASGR1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX124360-200 |
th Rabbit antibody Ab Purified |
0.2 ml |
354-Eur |
ACR |
|
| AP07947PU-N |
MMP-17 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX124360 |
th Rabbit IgG antibody Ab Purified |
50 |
228-Eur |
ACR |
|
| GTX100458 |
MMP-9 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108480 |
CD86 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100723 |
MMP-3 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| ON1210 |
Ox Bile, dihydrate, purified |
250G |
76-Eur |
Bio Basic Inc. |
rat |
| H86024M |
LactoferrinMouse Purified IgG1,k |
1mg |
315-Eur |
Meridian Life Science |
|
| AS09 558 |
PLD | phospholipase D (affinity purified) |
1 mg |
457-Eur |
Agrisera |
|
| GTX105800 |
NIT1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA41737 |
BID Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| GTX11610 |
MMP-11 Rabbit IgG antibody Ab Aff - Purified |
25 |
255-Eur |
ACR |
|
| AS09 561 |
Urease (affinity purified) |
1 mg |
457-Eur |
Agrisera |
|
| GTX108481 |
SCARB1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| Z86200M |
IgAMouse Purified IgG1 |
1mg |
309-Eur |
Meridian Life Science |
|
| ABP-PP-YTRNA02 |
Purified Yeast tRNA |
200 ug |
109-Eur |
Allele Biotech |
rna |
| AP02775PU-S |
Bcl-2-like 11 Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| G-04415 |
GLYCERINE Purified (Glycerol) CAS: 56-81-5 |
2.5Ltr. |
131-Eur |
Oxford Lab |
|
| GTX124357 |
cat Rabbit IgG antibody Ab Purified |
50 |
228-Eur |
ACR |
|
| GTX103959 |
Ephrin-A5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105763 |
TRIM16 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP13178PU-N |
MMP-24 Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| LF-PA20042 |
Bcl-2-like 8 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| Z86020M |
IgA, SecretoryMouse Purified IgG1 |
1mg |
315-Eur |
Meridian Life Science |
|
| GTX100612 |
FADD antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| Z54101M |
IgG (Fc)Mouse Purified IgG1 |
0.5mg |
380-Eur |
Meridian Life Science |
|
| GTX103957 |
STK32B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| G-04415 |
GLYCERINE Purified (Glycerol) CAS: 56-81-5 |
500 ml |
107-Eur |
Oxford Lab |
|
| GTX124359-200 |
erg Rabbit antibody Ab Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX124359 |
erg Rabbit IgG antibody Ab Purified |
50 |
228-Eur |
ACR |
|
| B-G-SEF-01 |
Sef (Human) Biotin Labeled Purified IgG |
100 µl |
763-Eur |
Phoenix Peptide |
labeled |
| AP02775PU-N |
Bcl-2-like 11 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| FC3-G-026-33 |
Alarin (Rat) _ Cy3 Labeled Purified IgG _ 100ul |
100 µl |
692-Eur |
Phoenix Peptide |
labeled |
| GTX124357-200 |
cat Rabbit antibody Ab Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX102911 |
MCC Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX100468 |
OCT3_4 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX105771 |
CD5 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 20004-1 |
G. Pig Serum IgG (non_immune), purified |
1 mg |
146-Eur |
Alpha Diagnostics |
|
| GTX103969 |
CYP3A7 antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX105648 |
PMVK antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100576 |
ICAM5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11608 |
MMP-8 Rabbit IgG antibody Ab Aff - Purified |
50 |
318-Eur |
ACR |
|
| GTX108467 |
CMTM1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP13403PU-N |
REL Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX105686 |
PAFAH1B3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AM26337PU-N |
LBP Rat IgG2a antibody Ab Purified |
0.1 mg |
399-Eur |
ACR |
|
| GTX124325-200 |
esd Rabbit antibody Ab Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX103994 |
HPD _ PPD Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX102875 |
PAH Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100631 |
MMP-2 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105699 |
RALA _ RAL antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 20007-1-FC |
Human IgG (Fc) fragment, purified |
0.5 mg |
240-Eur |
Alpha Diagnostics |
human |
| GTX11607 |
MMP-8 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| H86113M |
TransferrinMouse Purified IgG1 |
1mg |
388-Eur |
Meridian Life Science |
|
| GTX105650 |
ZNF138 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H86157M |
AlbuminMouse Purified IgG2b |
1mg |
448-Eur |
Meridian Life Science |
|
| GTX100632 |
Bcl-2-like 1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 20005-5 |
Rat Serum IgG (non_immune), purified |
5 mg |
335-Eur |
Alpha Diagnostics |
rat |
| AP07925PU-N |
MMP-28 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX124325 |
esd Rabbit IgG antibody Ab Purified |
50 |
228-Eur |
ACR |
|
| AP02709PU-N |
BCR Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| GTX100587 |
MTDH antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105667 |
PDK4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 20007-3P |
Human IgE (Plasma), purified |
50 ug |
479-Eur |
Alpha Diagnostics |
human |
| AM26373PU-N |
MGL Rat IgG2a antibody Ab Purified |
0.1 mg |
345-Eur |
ACR |
|
| AP22136PU-N |
RAX _ RX (300-350) Rabbit antibody Ab Aff - Purified |
0.1 mg |
300-Eur |
ACR |
|
| LF-PA41736 |
BID Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| GTX102866 |
NMI Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 20008-1-FAB |
Mouse IgG Fab fragment, purified |
1 mg |
190-Eur |
Alpha Diagnostics |
mouse |
| 20007-1-FAB |
Human IgG Fab fragment, purified |
1 mg |
233-Eur |
Alpha Diagnostics |
human |
| 20008-1-FC |
Mouse IgG (Fc) fragment, purified |
0.5 mg |
291-Eur |
Alpha Diagnostics |
mouse |
| GTX104027 |
GABRA1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP02709PU-S |
BCR Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| H86142M |
MyoglobinMouse Purified IgG1 |
1mg |
548-Eur |
Meridian Life Science |
|
| GTX102840 |
XPC _ XPCC antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| H86126M |
TransferrinMouse Purified IgG1 |
1mg |
415-Eur |
Meridian Life Science |
|
| 20009-1-FC |
Rabbit IgG (Fc) fragment, purified |
0.5 mg |
291-Eur |
Alpha Diagnostics |
polyclonal |
| GTX100626 |
MMP-9 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105661 |
Bcl-2-like 1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 20009-1-FAB |
Rabbit IgG Fab fragment, purified |
1 mg |
233-Eur |
Alpha Diagnostics |
polyclonal |
| AP07924PU-N |
MMP-27 Rabbit antibody Ab Purified |
50 |
381-Eur |
ACR |
|
| AP07937PU-N |
MLL _ HRX Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX116063 |
WRN Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108475 |
ASGR1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104050 |
IRF4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| T-09114 |
TRI CHLORO ETHYLENE (Purified) CAS: 79-01-6 |
500 ml |
110-Eur |
Oxford Lab |
|
| GTX100515 |
HFE _ HLAH antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 20005-1-200 |
Normal Rat Serum IgG purified |
0.5 ml |
81-Eur |
Alpha Diagnostics |
rat |
| GTX100665 |
MMP-13 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 20016-1 |
Dog (non_immune) Serum IgG, purified |
1 mg |
146-Eur |
Alpha Diagnostics |
dog |
| 20016-1-FAB2 |
Dog IgG F(ab')2 fragment, purified |
1 mg |
190-Eur |
Alpha Diagnostics |
dog |
| 20007-5-5 |
Human (non_immune) IgA purified |
5 mg |
697-Eur |
Alpha Diagnostics |
human |
| 20007-5-1 |
Human (non_immune) IgA purified |
1 mg |
190-Eur |
Alpha Diagnostics |
human |
| LF-PA41688 |
MAF Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| GTX105613 |
TMEM11 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100680 |
MMP-1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX124339-200 |
fbl Rabbit antibody Ab Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX124339 |
fbl Rabbit IgG antibody Ab Purified |
50 |
228-Eur |
ACR |
|
| GTX105617 |
SR-beta antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108455 |
RED _ RER Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| IRB-GF-ED-50 mg |
Rabbit IgG - Protein A Purified Low Endotoxin 50 mg |
|
635-Eur |
Innovative Research INC |
|
| GTX104041 |
FAM35A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105723 |
NRBP 2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA20652 |
REL Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| GTX100640 |
MMP-9 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AM26336PU-N |
LBP Rat IgG2a antibody Ab Purified |
0.1 mg |
399-Eur |
ACR |
|
| GTX102861 |
C14orf28 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104006 |
WDR77 _ MEP-50 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP07926PU-N |
MMP-7 (132-146) Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| 20005-2-1 |
Rat Serum IgM (non_immune),purified |
0.5 mg |
219-Eur |
Alpha Diagnostics |
rat |
| 20010-1 |
Chicken (non_immune) IgG, purified |
1 mg |
146-Eur |
Alpha Diagnostics |
|
| GTX105704 |
CTH Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA41713 |
APC _ DP2.5 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| 20010-5 |
Chicken (non_immune) IgG, purified |
5 mg |
262-Eur |
Alpha Diagnostics |
|
| GTX105722 |
SGK1 _ SGK antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100534 |
MMP-1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 20005-1-FAB2 |
Rat IgG F(ab')2 fragment, purified |
1 mg |
233-Eur |
Alpha Diagnostics |
rat |
| H86220M |
AdiponectinMouse Purified IgG2a |
1mg |
713-Eur |
Meridian Life Science |
|
| 20011-1-FC |
Goat IgG (Fc) fragment, purified |
0.5 mg |
291-Eur |
Alpha Diagnostics |
polyclonal |
| GTX105629 |
PIP5K3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA20659 |
ATM Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| 20011-1-FAB |
Goat IgG Fab fragment, purified |
0.5 mg |
233-Eur |
Alpha Diagnostics |
polyclonal |
| GTX105645 |
ZNF146 _ OZF antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| Z86201M |
IgAMouse Purified IgG2b |
1mg |
309-Eur |
Meridian Life Science |
|
| RA25085-100 |
c-Myc Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
444-Eur |
ACR |
|
| AP02564PU-N |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02564PU-S |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02565PU-N |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02565PU-S |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02566PU-N |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02566PU-S |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| K01256S |
Protein CSheep Purified |
0.2mg |
326-Eur |
Meridian Life Science |
|
| K01254S |
Factor IXSheep Purified |
1mg |
527-Eur |
Meridian Life Science |
|
| GTX105015 |
ZNF287 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| K01251R |
Alpha 2 AntiplasminRabbit Purified |
1mg |
792-Eur |
Meridian Life Science |
|
| AP02563PU-S |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02563PU-N |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| LF-PA41533 |
NOV Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| GTX79428 |
CD5 Rabbit IgG antibody Ab Purified |
6 ml |
327-Eur |
ACR |
|
| GTX116045 |
MLL _ HRX Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX116047 |
MYB Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 602-460 |
FOXP1 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| 602-370 |
Paxillin _ PXN Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| S28 |
MR-LBD. Purified GST-tagged MR LBD in complex with Hsp90. |
50 ug |
1051-Eur |
Vector |
|
| 602-340 |
LCK pTyr505 Rabbit antibody Ab Aff - Purified |
0.1 mg |
336-Eur |
ACR |
|
| GTX124425-200 |
hk1 Rabbit antibody Ab Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX124425 |
hk1 Rabbit IgG antibody Ab Purified |
50 |
228-Eur |
ACR |
|
| LF-PA41531 |
NOX-1 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| AP02567PU-N |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| K01250R |
Alpha 2 AntiplasminRabbit Purified |
1mg |
666-Eur |
Meridian Life Science |
|
| AP02577PU-N |
c-Myc Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02577PU-S |
c-Myc Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| H87560M |
PodoplaninMouse Purified IgG1 |
100ug |
732-Eur |
Meridian Life Science |
|
| AP02578PU-N |
c-Myc Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02578PU-S |
c-Myc Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| GTX127323 |
b2M Rabbit antibody Ab Aff - Purified |
50 |
228-Eur |
ACR |
|
| GTX79429 |
CD8 Rabbit IgG antibody Ab Purified |
6 ml |
327-Eur |
ACR |
|
| GTX105392 |
ACAD11 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX127323-200 |
b2M Rabbit antibody Ab Aff - Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX104137 |
ZNF131 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP02576PU-S |
c-Myc Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02576PU-N |
c-Myc Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| GTX101002 |
GM-CSF Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP02567PU-S |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02568PU-N |
Jun-B Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02568PU-S |
Jun-B Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP15363PU-N |
Bcl-6 Rabbit antibody Ab Purified |
1 ml |
390-Eur |
ACR |
|
| AP02569PU-N |
Jun-B Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02569PU-S |
Jun-B Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02570PU-N |
Jun-D Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02570PU-S |
Jun-D Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| GTX101005 |
FGF10 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX101003 |
EGF Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H86910M |
AlbuminMouse Purified IgG2a |
1mg |
448-Eur |
Meridian Life Science |
|
| GTX102609 |
SRP72 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 602-640 |
IRS2 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| 602-630 |
IRS2 Rabbit antibody Ab Aff - Purified |
0.1 mg |
282-Eur |
ACR |
|
| 602-620 |
IRS1 Rabbit antibody Ab Aff - Purified |
0.1 mg |
282-Eur |
ACR |
|
| GTX105335 |
ANKRD1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104222 |
PLA2G7 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108536 |
TRAM1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11599 |
MMP-2 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| AM32440PU-S |
Bcl-10 Rabbit IgG antibody Ab Purified |
0.1 ml |
255-Eur |
ACR |
|
| AP21990PU-N |
LC3 Rabbit antibody Ab Aff - Purified |
0.1 mg |
309-Eur |
ACR |
|
| AM32440PU-N |
Bcl-10 Rabbit IgG antibody Ab Purified |
1 ml |
543-Eur |
ACR |
|
| 602-650 |
CORIN Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| 602-670 |
Cytokeratin 19 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX104230 |
NR1D2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 602-940 |
MCSP Mouse antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| 602-920 |
MIG7 Rabbit antibody Ab Aff - Purified |
0.1 mg |
291-Eur |
ACR |
|
| 602-910 |
Fumarylacetoacetase Rabbit antibody Ab Aff - Purified |
0.1 mg |
309-Eur |
ACR |
|
| 602-900 |
Sialyltransferase Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| 602-890 |
Shaker (Sh) Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| 602-860 |
ROCK2 Rabbit antibody Ab Aff - Purified |
0.1 mg |
282-Eur |
ACR |
|
| AM32443PU-S |
CD3 Rabbit IgG antibody Ab Purified |
0.1 ml |
255-Eur |
ACR |
|
| AM32443PU-N |
CD3 Rabbit IgG antibody Ab Purified |
1 ml |
543-Eur |
ACR |
|
| AM32443PU-M |
CD3 Rabbit IgG antibody Ab Purified |
0.5 ml |
435-Eur |
ACR |
|
| GTX101044 |
SRY _ TDF Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AM32440PU-M |
Bcl-10 Rabbit IgG antibody Ab Purified |
0.5 ml |
435-Eur |
ACR |
|
| GTX108530 |
SEMA6C antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108521 |
MED17 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108519 |
Cytohesin 3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX102657 |
PTPN12 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX79414 |
CD5 Rabbit IgG antibody Ab Purified |
0.5 ml |
435-Eur |
ACR |
|
| GTX108511 |
SEMA3B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX102665 |
KCTD14 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104186 |
EHF Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX101018 |
Myostatin antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 602-490 |
FOXP4 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| 602-480 |
FOXP3 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02547PU-S |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| GTX104196 |
NLK Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX116014 |
MAP-1B Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108529 |
Noelin antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104215 |
HOMER2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| EV011-1 |
EBV gp125 _ Immunoaffinity Purified _ 1 ml |
|
194-Eur |
Virusys |
|
| GTX108526 |
RAMP3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| EV011-25 |
EBV gp125 _ Immunoaffinity Purified _ 25 ml |
|
2774-Eur |
Virusys |
|
| EV045-1 |
EBV VCA Concentrate _ Immunoaffinity Purified |
|
1015-Eur |
Virusys |
rat |
| AP08052PU-S |
ATM Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP08052PU-N |
ATM Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| RA30008-50 |
Bax Rabbit IgG antibody Ab Aff - Purified |
50 |
480-Eur |
ACR |
|
| EV045-5 |
EBV VCA Concentrate Immunoaffinity Purified _ 5 ml |
|
4995-Eur |
Virusys |
rat |
| 602-470 |
FOXP2 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| 602-300 |
Desmin Rabbit antibody Ab Aff - Purified |
0.1 mg |
255-Eur |
ACR |
|
| AP02605PU-S |
Bcl-2-like 8 Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| GTX102782 |
NEK4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX124376-200 |
lox Rabbit antibody Ab Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX127382 |
erh Rabbit antibody Ab Aff - Purified |
50 |
228-Eur |
ACR |
|
| AM31725PU-N |
BIK Mouse IgG antibody Ab Purified |
50 |
408-Eur |
ACR |
|
| GTX127382-200 |
erh Rabbit antibody Ab Aff - Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX124376 |
lox Rabbit IgG antibody Ab Purified |
50 |
228-Eur |
ACR |
|
| H86431M |
PlasminogenMouse Purified IgG1 |
1mg |
495-Eur |
Meridian Life Science |
|
| GTX124375-200 |
hk2 Rabbit antibody Ab Purified |
0.2 ml |
354-Eur |
ACR |
|
| GTX124375 |
hk2 Rabbit IgG antibody Ab Purified |
50 |
228-Eur |
ACR |
|
| GTX104067 |
GABRG1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX102775 |
MX2 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100800 |
Fucosyltransferase 1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105551 |
CDO1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104094 |
PKN1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104086 |
DEL1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108491 |
Glycophorin B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H86510M |
LeptinMouse Purified IgG1 |
1mg |
739-Eur |
Meridian Life Science |
|
| AM31860PU-N |
Platelets Rat IgM antibody Ab Purified |
0.25 mg |
291-Eur |
ACR |
|
| AM31858PU-N |
Ly-76 _ TER-119 Rat IgG2b antibody Ab Purified |
0.25 mg |
291-Eur |
ACR |
|
| 602-290 |
Desmin Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| GTX100827 |
CD11b antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX100824 |
CD4 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AM31857PU-N |
CD5 Rat IgG2a antibody Ab Purified |
0.25 mg |
309-Eur |
ACR |
|
| GTX100778 |
MMP-14 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| H86424M |
AlbuminMouse Purified IgG1 |
1mg |
362-Eur |
Meridian Life Science |
|
| GTX102792 |
GTF3C1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA41644 |
TFG Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| H86331M |
FerritinMouse Purified IgG2b |
1mg |
441-Eur |
Meridian Life Science |
|
| GTX105579 |
PSMB6 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| Z86410M |
IgEMouse Purified IgG2a |
1mg |
362-Eur |
Meridian Life Science |
|
| LF-PA20047 |
Bcl-2 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| GTX100736 |
Bcl-11B Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| Z86238M |
IgG (Fc)Mouse Purified IgG1 |
1mg |
339-Eur |
Meridian Life Science |
|
| LF-PA20046 |
Bcl-2 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| AP13176PU-N |
MMP-20 Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX100748 |
SYK Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| Z86411M |
IgE (Fc)Mouse Purified IgG2a |
1mg |
309-Eur |
Meridian Life Science |
|
| Z87304M |
IgEMouse Purified IgG1 |
0.5mg |
792-Eur |
Meridian Life Science |
|
| GTX100777 |
MMP-13 Rabbit IgG antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105572 |
PTP4A2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA20057 |
Bcl-2-like 11 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| H86412M |
LeptinMouse Purified IgG1 |
1mg |
739-Eur |
Meridian Life Science |
|
| GTX102788 |
CD13 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| LF-PA20052 |
BCR Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| AP13174PU-N |
MMP-17 Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| H86410M |
TNF-a, HumanMouse Purified IgG1,k |
1mg |
514-Eur |
Meridian Life Science |
|
| H86402M |
LactoferrinMouse Purified IgG1,k |
1mg |
362-Eur |
Meridian Life Science |
|
| LF-PA20050 |
Bcl-2-like 1 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| Z86210M |
IgA1Mouse Purified IgG1 |
1mg |
309-Eur |
Meridian Life Science |
|
| GTX104136 |
UGT2B10 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100897 |
Cathepsin H antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA20089 |
AP-1 _ c-Jun Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| H86730M |
LeptinMouse Purified IgG1 |
1mg |
739-Eur |
Meridian Life Science |
|
| GTX100895 |
Cathepsin B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA20088 |
AP-1 _ c-Jun Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| LF-PA20087 |
AP-1 _ c-Jun Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| LF-PA20086 |
AP-1 _ c-Jun Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| H86703M |
MyoglobinMouse Purified IgG1 |
1mg |
548-Eur |
Meridian Life Science |
|
| GTX47560 |
EVL Goat IgG antibody Ab Aff - Purified |
0.1 mg |
336-Eur |
ACR |
|
| GTX105451 |
STK38L antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| LF-PA20090 |
AP-1 _ c-Jun Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| GTX100900 |
CRK Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX100901 |
CRK Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX100916 |
C1q A subunit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105422 |
CDON antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX100912 |
CD9 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX104135 |
ZNF192 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104130 |
ZNF232 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H86901M |
LeptinMouse Purified IgG1 |
1mg |
739-Eur |
Meridian Life Science |
|
| GTX100907 |
Caspase-10 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA20092 |
AP-1 _ c-Jun Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| LF-PA20091 |
AP-1 _ c-Jun Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| H86809M |
TransferrinMouse Purified IgG1 |
1mg |
415-Eur |
Meridian Life Science |
|
| GTX105453 |
PCDHGC5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H86650M |
TNF-a, HumanMouse Purified IgG1,k |
1mg |
441-Eur |
Meridian Life Science |
|
| GTX102741 |
FGL1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP02603PU-S |
Bcl-2-like 8 Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02604PU-N |
Bcl-2-like 8 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP07978PU-N |
ST7 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP07977PU-N |
ST5 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX108501 |
MDFI antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX102745 |
RAB5C antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP02604PU-S |
Bcl-2-like 8 Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| GTX78425 |
CD4 Mouse IgM antibody Ab Purified |
0.1 mg |
264-Eur |
ACR |
|
| AP07971PU-N |
ERG Goat antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| IG41002 |
Mouse IgG, affinity purified |
10 mg |
284-Eur |
Anogen |
|
| IG30001 |
Human IgG, affinity purified |
10 mg |
284-Eur |
Anogen |
|
| GTX104107 |
MCRS1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105464 |
C1s Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX105467 |
MNT Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108506 |
PRKCH antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H86611M |
AlbuminMouse Purified IgG2a |
1mg |
448-Eur |
Meridian Life Science |
|
| AP02600PU-N |
Bcl-2 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02600PU-S |
Bcl-2 Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02601PU-N |
Bcl-2 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP02601PU-S |
Bcl-2 Rabbit antibody Ab Aff - Purified |
50 |
237-Eur |
ACR |
|
| AP02603PU-N |
Bcl-2-like 8 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| GTX108505 |
PRKCH antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP02605PU-N |
Bcl-2-like 8 Rabbit antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| GTX106169 |
CDK1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108168 |
GPR7 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP07214PU-N |
MMP-19 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07213PU-N |
MMP-15 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07212PU-N |
MMP-13 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07211PU-N |
MMP-14 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07210PU-N |
MMP-10 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07209PU-N |
MMP-1 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07207PU-N |
Ki-67 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP22734PU-N |
LYN (1-100) Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX11684 |
MMP-25 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX108167 |
GPR143 _ OA1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108163 |
GALR3 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP22745PU-N |
MMP-9 Rabbit IgG antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP07217PU-N |
MMP-7 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07218PU-N |
MMP-8 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP22719PU-N |
MMP-3 (251-478) Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP22689PU-N |
CD3 (156-168) Rabbit antibody Ab Aff - Purified |
0.25 ml |
372-Eur |
ACR |
|
| AP22690PU-N |
Ki-67 Rabbit antibody Ab Purified |
0.25 ml |
372-Eur |
ACR |
|
| GTX116784 |
ACD Rabbit antibody Ab Aff - Purified |
0.1 ml |
219-Eur |
ACR |
|
| GTX108179 |
GPR66 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX103682 |
MPI Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP07259PU-N |
SYK Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX108175 |
EDG-1 _ S1P1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP22706PU-N |
MMP-14 (160-173) Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| H55136M |
ChymotrypsinMouse Purified IgG3 |
0.2mg |
375-Eur |
Meridian Life Science |
|
| GTX108174 |
GPR132 _ G2A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX116813 |
MMP-28 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX106176 |
Fibulin-4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11683 |
MMP-26 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX108161 |
GPR8 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11685 |
MMP-26 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX11686 |
MMP-26 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| AP22793PU-N |
MMP-3 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX108130 |
GPR75 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108128 |
CYSLTR2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H55131M |
Glucose OxidaseMouse Purified IgM |
1mg |
538-Eur |
Meridian Life Science |
|
| AP15357PU-S |
Bcl-2-like 7 Rabbit antibody Ab Purified |
0.1 ml |
174-Eur |
ACR |
|
| AP15358PU-M |
Bax Rabbit antibody Ab Purified |
0.5 ml |
291-Eur |
ACR |
|
| AP15358PU-N |
Bax Rabbit antibody Ab Purified |
1 ml |
390-Eur |
ACR |
|
| GTX108123 |
GPR52 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108121 |
GPR35 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP15358PU-S |
Bax Rabbit antibody Ab Purified |
0.1 ml |
183-Eur |
ACR |
|
| AP15361PU-M |
Bcl-2 Rabbit antibody Ab Purified |
0.5 ml |
291-Eur |
ACR |
|
| AP15361PU-N |
Bcl-2 Rabbit antibody Ab Purified |
1 ml |
390-Eur |
ACR |
|
| GTX117014 |
PPIL4 antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP15357PU-N |
Bcl-2-like 7 Rabbit antibody Ab Purified |
1 ml |
327-Eur |
ACR |
|
| GTX108132 |
MRGPRC antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H55134M |
TrypsinMouse Purified IgG2b |
0.2mg |
391-Eur |
Meridian Life Science |
|
| AP07190PU-N |
CD5 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP07189PU-N |
CD2 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX11687 |
MMP-27 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| AP15353PU-M |
APC _ DP2.5 Rabbit antibody Ab Purified |
0.5 ml |
273-Eur |
ACR |
|
| AP15353PU-N |
APC _ DP2.5 Rabbit antibody Ab Purified |
1 ml |
327-Eur |
ACR |
|
| GTX108149 |
MC5-R Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP15353PU-S |
APC _ DP2.5 Rabbit antibody Ab Purified |
0.1 ml |
174-Eur |
ACR |
|
| GTX11688 |
MMP-27 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX75504 |
Rat IgM Mouse antibody Ab Purified |
0.25 mg |
300-Eur |
ACR |
|
| GTX108144 |
GPR136 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108142 |
GPR126 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11689 |
MMP-27 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| AP15357PU-M |
Bcl-2-like 7 Rabbit antibody Ab Purified |
0.5 ml |
273-Eur |
ACR |
|
| GTX100031 |
ABR Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP07272PU-N |
ATM Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07474PU-N |
SP3 _ SPR-2 Rabbit IgG antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX108258 |
ARL1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108255 |
COX17 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108253 |
Neuropeptide Y _ NPY antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX103695 |
RNPEPL1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100076 |
GTF2H5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX85455 |
MAP-2 Chicken antibody Ab Aff - Purified |
50 |
291-Eur |
ACR |
|
| GTX100074 |
FLJ39025 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX110606 |
MMP-1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100073 |
FANCM antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108244 |
Latrophilin-2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP20377PU-N |
MAF Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX108243 |
GPR55 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108242 |
MAP3K9 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108260 |
Caveolin-3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP22474PU-N |
C1s Goat IgG antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP20390PU-N |
ELL Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX108281 |
FXYD2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| R1591P |
MIF Chicken antibody Ab Purified |
0.5 mg |
318-Eur |
ACR |
|
| GTX108279 |
BTG2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108275 |
REG3A antibody Ab Aff - Purified |
0.1 ml |
273-Eur |
ACR |
|
| GTX110588 |
MMP-9 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP07449PU-N |
MC4-R Rabbit IgG antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX82925 |
CD74 antibody Ab Purified |
0.2 mg |
282-Eur |
ACR |
|
| GTX108269 |
DUSP5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| R1574P |
kb-Ras Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| H55340M |
TrypsinMouse Purified IgG2b |
1mg |
538-Eur |
Meridian Life Science |
|
| GTX108267 |
Caveolin-2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108266 |
CACNG1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108264 |
SEP15 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX110625 |
YY1 Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108237 |
Latrophilin-3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX85466 |
MPZ Chicken antibody Ab Aff - Purified |
50 |
291-Eur |
ACR |
|
| GTX75541 |
CA 19-9 Mouse antibody Ab Purified |
50 |
201-Eur |
ACR |
|
| GTX108199 |
EDG-3 _ S1P3 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX75540 |
CA 19-9 Mouse antibody Ab Purified |
6 ml |
435-Eur |
ACR |
|
| GTX108196 |
GPR25 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX75539 |
CA 19-9 Mouse antibody Ab Purified |
0.5 ml |
417-Eur |
ACR |
|
| GTX108194 |
FFAR2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX113780 |
MMP-8 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108190 |
MC1-R Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108188 |
FZD6 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP07281PU-N |
Bcl-2-like 11 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07280PU-N |
Bcl-2-like 5 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07277PU-N |
Bax Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX110667 |
NOX-1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108207 |
GALR1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| SP2147P |
GFP Goat antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX108211 |
PTGER1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108232 |
GPR167 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108228 |
GPR137 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| IMS01-120-318 |
GM-CSF Chicken antibody Ab Purified |
0.2 ml |
462-Eur |
ACR |
|
| AP22576PU-N |
NCF-4 Goat antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX108222 |
EDG-2 _ LPAR1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108221 |
MTNR1A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100064 |
Bcl-2 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| H55190M |
HemoglobinMouse Purified IgG1 |
1mg |
660-Eur |
Meridian Life Science |
|
| GTX113797 |
PC1 _ PC3 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX100063 |
Bcl-2-like 7 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP05268PU-N |
EGF Rabbit IgG antibody Ab Purified |
0.5 mg |
408-Eur |
ACR |
|
| GTX108215 |
NR6A1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108213 |
CELSR3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX103131 |
EPHA3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108117 |
NEK9 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| 31R-AR002 |
Rabbit IgG, Purified Immunoglobulins |
25 mg |
427-Eur |
Fitzgerald |
|
| GTX117428 |
CYP4A22 antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| 31R-1034 |
Hamster IgG (H + L) , Purified Immunoglobulins |
10 mg |
267-Eur |
Fitzgerald |
|
| GTX108095 |
PGLYRP3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP15424PU-M |
CD2 (25-209) Rabbit antibody Ab Purified |
0.5 ml |
273-Eur |
ACR |
|
| GTX117488 |
G72 Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP15424PU-N |
CD2 (25-209) Rabbit antibody Ab Purified |
1 ml |
327-Eur |
ACR |
|
| AP15424PU-S |
CD2 (25-209) Rabbit antibody Ab Purified |
0.1 ml |
174-Eur |
ACR |
|
| SP1415P |
CSK Goat antibody Ab Purified |
0.1 mg |
489-Eur |
ACR |
|
| AP22919PU-N |
4E-BP2 (99-120) Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX117543 |
MMP-16 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| RP10305 |
SPA purified human protein |
100 ug |
593-Eur |
Abgent |
human |
| GTX117549 |
NMI Rabbit IgG antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108083 |
CDT1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP20247PU-N |
HGS _ HRS Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| 31R-1036 |
Human IgG (H + L), Purified Immunoglobulins |
10 mg |
231-Eur |
Fitzgerald |
|
| 31R-1037 |
Human IgG Fc, Purified Immunoglobulins |
1 mg |
353-Eur |
Fitzgerald |
|
| GTX75417 |
GM-CSF Mouse antibody Ab Purified |
0.5 mg |
417-Eur |
ACR |
|
| GTX106293 |
RPS27 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX113620 |
ABO Rabbit antibody Ab Aff - Purified |
0.1 ml |
219-Eur |
ACR |
|
| FG-G-026-33A |
Alarin (Rat) _ FAM Labeled Purified IgG _ 100ul |
100 µl |
551-Eur |
Phoenix Peptide |
labeled |
| GTX113618-01 |
GFP Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX113617 |
GFP Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 31R-1048 |
Sheep IgG (H + L), Purified Immunoglobulins |
10 mg |
181-Eur |
Fitzgerald |
|
| P100602_P050 |
DEK Rabbit antibody Ab Aff - Purified |
50 |
327-Eur |
ACR |
|
| H31927M |
MyoglobinMouse Purified IgG1 |
1mg |
326-Eur |
Meridian Life Science |
|
| 31R-1045 |
Rat Ig fraction, Purified Immunoglobulins |
10 mg |
169-Eur |
Fitzgerald |
|
| 31R-1044 |
Rabbit IgG Fab'2, Purified Immunoglobulins |
2 mg |
291-Eur |
Fitzgerald |
|
| 31R-1043 |
Rabbit IgG (H + L), Purified Immunoglobulins |
10 mg |
231-Eur |
Fitzgerald |
|
| 31R-1038 |
Human IgG Fab'2, Purified Immunoglobulins |
2 mg |
317-Eur |
Fitzgerald |
|
| GTX75339 |
CD4 Rat IgG2b antibody Ab Purified |
0.1 mg |
273-Eur |
ACR |
|
| AP15431PU-M |
CD3 (156-168) Rabbit antibody Ab Purified |
0.5 ml |
282-Eur |
ACR |
|
| GTX117563 |
DUT (2-150) Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 0810027SP |
HIV-1 Sucrose Purified, Mn Strain |
MG |
1059-Eur |
Zeptometrix |
|
| GTX108051 |
Bcl-6 corepressor antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP15446PU-M |
CD5 Rabbit antibody Ab Purified |
0.5 ml |
336-Eur |
ACR |
|
| AP15446PU-N |
CD5 Rabbit antibody Ab Purified |
1 ml |
390-Eur |
ACR |
|
| AP15446PU-S |
CD5 Rabbit antibody Ab Purified |
0.1 ml |
183-Eur |
ACR |
|
| P100617_P050 |
MAF Rabbit antibody Ab Aff - Purified |
50 |
327-Eur |
ACR |
|
| 31R-1030 |
Horse IgG (H + L), Purified Immunoglobulins |
10 mg |
181-Eur |
Fitzgerald |
|
| GTX113555 |
SS-B _ La Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 0801033SP |
HTLV-I Sucrose Purified |
MG |
1273-Eur |
Zeptometrix |
|
| AP15454PU-M |
CD8 Rabbit antibody Ab Purified |
0.5 ml |
345-Eur |
ACR |
|
| H31795M |
CK-MBMouse Purified IgG1 |
1mg |
540-Eur |
Meridian Life Science |
|
| H31572M |
MyoglobinMouse Purified IgG1,k |
1mg |
328-Eur |
Meridian Life Science |
|
| AP15454PU-N |
CD8 Rabbit antibody Ab Purified |
1 ml |
444-Eur |
ACR |
|
| 0810028SP |
HIV-1 Sucrose Purified, BaL Strain |
MG |
1059-Eur |
Zeptometrix |
|
| 0810036SP |
Influenza A H1 Sucrose Purified |
ML |
1059-Eur |
Zeptometrix |
|
| 0810036SPN |
Influenza A H1 Sucrose Purified |
ML |
1059-Eur |
Zeptometrix |
|
| RP10295 |
LXN purified human protein |
100 ug |
593-Eur |
Abgent |
human |
| AM20377PU-S |
TRA-1-81 Mouse IgM antibody Ab Aff - Purified |
25 |
210-Eur |
ACR |
|
| AP15431PU-N |
CD3 (156-168) Rabbit antibody Ab Purified |
1 ml |
363-Eur |
ACR |
|
| AP22922PU-N |
AP-1 _ c-Jun Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP15431PU-S |
CD3 (156-168) Rabbit antibody Ab Purified |
0.1 ml |
183-Eur |
ACR |
|
| P100614_P050 |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
50 |
327-Eur |
ACR |
|
| GTX117582 |
TSKS antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108073 |
SAMSN1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX75334 |
CD4 Rat IgG2b antibody Ab Aff - Purified |
0.25 mg |
300-Eur |
ACR |
|
| AP15440PU-N |
CD4 Rabbit antibody Ab Purified |
1 ml |
390-Eur |
ACR |
|
| AP15440PU-S |
CD4 Rabbit antibody Ab Purified |
0.1 ml |
183-Eur |
ACR |
|
| GTX75327 |
NC1.1 Mouse antibody Ab Purified |
0.5 mg |
390-Eur |
ACR |
|
| 0810037SP |
Influenza B Sucrose Purified |
MG |
1059-Eur |
Zeptometrix |
|
| GTX108036 |
PLEKHA5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| FG-G-018-28A |
Nuclear_encoded Hin (Rat) _ FAM Labeled Purified IgG _ 100ul |
100 µl |
763-Eur |
Phoenix Peptide |
labeled |
| AP07132PU-N |
APC _ DP2.5 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX100014 |
GALR3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106190 |
KLHL5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP15367PU-M |
Bcl-2-like 11 BOD Rabbit antibody Ab Purified |
0.5 ml |
273-Eur |
ACR |
|
| GTX117184 |
CYP2F1 antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP15367PU-N |
Bcl-2-like 11 BOD Rabbit antibody Ab Purified |
1 ml |
327-Eur |
ACR |
|
| H54065M |
FolateMouse Purified IgG1 |
1mg |
400-Eur |
Meridian Life Science |
|
| H45950M |
HemoglobinMouse Purified IgG1 |
1mg |
382-Eur |
Meridian Life Science |
|
| AP15367PU-S |
Bcl-2-like 11 BOD Rabbit antibody Ab Purified |
0.1 ml |
174-Eur |
ACR |
|
| GTX117233 |
NFIX antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP05293PU-N |
SMO Rabbit IgG antibody Ab Aff - Purified |
10 Blots |
399-Eur |
ACR |
|
| AP05293SU-N |
SMO Rabbit IgG antibody Ab Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX122234 |
PDXDC1 antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106201 |
KCTD13 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100019 |
MC4-R Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100020 |
MC5-R Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP15365PU-S |
Bcl-2-like 1 Rabbit antibody Ab Purified |
0.1 ml |
174-Eur |
ACR |
|
| AP15361PU-S |
Bcl-2 Rabbit antibody Ab Purified |
0.1 ml |
183-Eur |
ACR |
|
| AP15363PU-M |
Bcl-6 Rabbit antibody Ab Purified |
0.5 ml |
291-Eur |
ACR |
|
| GTX117086 |
ZNF554 antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA20732 |
CRK Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| GTX108109 |
RRH Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP07111PU-N |
MMP-9 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07110PU-N |
MMP-9 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| H55043M |
TrypsinMouse Purified IgG2b |
0.2mg |
375-Eur |
Meridian Life Science |
|
| AP15363PU-S |
Bcl-6 Rabbit antibody Ab Purified |
0.1 ml |
183-Eur |
ACR |
|
| AP15365PU-M |
Bcl-2-like 1 Rabbit antibody Ab Purified |
0.5 ml |
273-Eur |
ACR |
|
| GTX108104 |
Melanophilin antibody Ab Aff - Purified |
0.1 ml |
291-Eur |
ACR |
|
| AP15365PU-N |
Bcl-2-like 1 Rabbit antibody Ab Purified |
1 ml |
327-Eur |
ACR |
|
| GTX117141 |
ZP2 _ ZPA Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP20317PU-N |
SS-B _ La Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX117260 |
SMPD3 antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| GT15229-100 |
BOC Goat IgG antibody Ab Aff - Purified |
0.1 mg |
444-Eur |
ACR |
|
| AM20417PU-N |
BID Rat IgG1 antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP05375PU-N |
Rat IgE Sheep IgG antibody Ab Purified |
0.5 mg |
498-Eur |
ACR |
|
| AP05377PU-N |
Rat IgA Goat IgG antibody Ab Purified |
0.5 mg |
291-Eur |
ACR |
|
| FG-G-009-38A |
Bombinakinin_GAP _ FAM Labeled Purified IgG _ 100ul |
100 µl |
763-Eur |
Phoenix Peptide |
labeled |
| GTX103656 |
Synaptotagmin-5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| SP2060P |
BLM Rabbit antibody Ab Aff - Purified |
50 |
300-Eur |
ACR |
|
| AP05382PU-N |
Rat IgM Goat IgG antibody Ab Purified |
0.5 mg |
291-Eur |
ACR |
|
| GTX106276 |
RAB11FIP1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GT15141-100 |
MOG Goat antibody Ab Aff - Purified |
0.1 mg |
444-Eur |
ACR |
|
| GTX121943 |
MAP2K1 antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX103653 |
IFRD2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP20276PU-N |
BTK Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX117414 |
MMP-26 Rabbit IgG antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106259 |
MAPRE1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| 01056-15 |
Agar Purified, powder |
500G |
220-Eur |
Nacalai |
|
| 01162-15 |
Agar Purified, powder |
500G |
222-Eur |
Nacalai |
|
| LF-MA41505 |
Bax IgG1 antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| LF-MA41504 |
CDK2 IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| GTX113684 |
FBL Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX106221 |
TFDP1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP20298PU-N |
CSK Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX113676 |
ECE-1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
219-Eur |
ACR |
|
| GT15196-100 |
Bcl-2-like 2 Goat IgG antibody Ab Aff - Purified |
0.1 mg |
444-Eur |
ACR |
|
| GTX12208 |
Cyclin D1 Rat IgG antibody Ab Purified |
0.1 mg |
318-Eur |
ACR |
|
| GT15194-100 |
Bcl-2 Goat IgG antibody Ab Aff - Purified |
0.1 mg |
444-Eur |
ACR |
|
| GTX117364 |
NP Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP20292PU-N |
Bcl-2-like 8 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| AP05352PU-N |
NGF Rabbit IgG antibody Ab Purified |
1 mg |
345-Eur |
ACR |
|
| H45502M |
FerritinMouse Purified IgG1 |
1mg |
375-Eur |
Meridian Life Science |
|
| GTX106283 |
MOG Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108282 |
NDUFS6 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105978 |
Ferrochelatase antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| FC5-G-026-33 |
Alarin (Rat) _ Cy5 Labeled Purified IgG _ 100ul |
100 µl |
692-Eur |
Phoenix Peptide |
labeled |
| YNPHIgG |
Human IgG, chromatographically purified |
100 mg. |
779-Eur |
Accurate |
human |
| GTX100198 |
BID Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100197 |
Bcl-7A Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| LF-PA50172 |
c-fos Rabbit IgG antibody Ab Aff - Purified |
0.2 ml |
336-Eur |
ACR |
|
| YNPHFIgG |
Human IgG Fab, chromatographically purified |
10 mg. |
1061-Eur |
Accurate |
human |
| LF-PA20707 |
SYK Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| GTX100186 |
GPR64 _ HE6 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP14270PU-N |
AXL _ UFO Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX103769 |
TPST1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106084 |
MCEE antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| YNPGpIgG |
Guinea pig IgG, chromatographically purified |
10 mg. |
833-Eur |
Accurate |
|
| YNPGIgG |
Goat IgG, chromatographically purified |
100 mg. |
779-Eur |
Accurate |
polyclonal |
| GTX106062 |
PAM Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100203 |
CAPZB antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106059 |
HIPK4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| YSRTPAP001 |
Purified Chicken IgG (IgY), ELISA |
10 mg. |
309-Eur |
Accurate |
elisa |
| AM20825PU-L |
APC _ DP2.5 Rat IgG2a antibody Ab Aff - Purified |
1 mg |
849-Eur |
ACR |
|
| GTX100233 |
AADC _ DDC antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX103015 |
NNT Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX103017 |
RPA4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100226 |
CSK Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| YNPMIgG |
Mouse IgG, chromatographically purified |
10 mg. |
1061-Eur |
Accurate |
mouse |
| LF-PA40231 |
CD5 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| LF-PA40230 |
CD3 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| R8A112 |
HIV-1, nef (a.a. 3-190) Recomb.E. coli Purified |
0.5mg |
574-Eur |
Meridian Life Science |
|
| GTX100222 |
COMT antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP05093PU-N |
Bcl-10 Rabbit IgG antibody Ab Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX103785 |
EIF2AK1 _ HRI antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| FC5-G-045-87 |
Neuromedin S (Rat) _ Cy5 Labeled Purified IgG _ 100ul |
100 µl |
904-Eur |
Phoenix Peptide |
labeled |
| GTX103069 |
HMBS antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100153 |
REV3L antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AM20787PU-N |
GST-Tag Rat IgG2a antibody Ab Aff - Purified |
0.2 mg |
435-Eur |
ACR |
|
| AM20787PU-L |
GST-Tag Rat IgG2a antibody Ab Aff - Purified |
1 mg |
849-Eur |
ACR |
|
| GTX100114 |
XRCC2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106135 |
Cadherin-7 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| FC5-G-076-92 |
NERP_2 (Rat) _ Cy5 Labeled Purified IgG _ 100ul |
100 µl |
692-Eur |
Phoenix Peptide |
labeled |
| H55903M |
HemoglobinMouse Purified IgG1 |
0.2mg |
326-Eur |
Meridian Life Science |
|
| H55902M |
HemoglobinMouse Purified IgG1 |
0.2mg |
391-Eur |
Meridian Life Science |
|
| GTX106139 |
Elastase-2A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| YNPChIgG |
Chicken IgG, chromatographically purified |
10 mg. |
279-Eur |
Accurate |
|
| GTX103081 |
KCNJ5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| YNCBSA |
BSA Fraction V, chromatographically purified |
1 gm. |
69-Eur |
Accurate |
|
| YNPBIgGL |
Bovine IgG, chromatographically purified |
100 mg. |
779-Eur |
Accurate |
bovine |
| GTX30916 |
ZEB1 IgG antibody Ab Aff - Purified |
50 |
390-Eur |
ACR |
|
| GTX106124 |
ARHGEF1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106123 |
POLR1C antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| FC5-G-069-27 |
CCK (46_69) (Human) Cy5 Labeled Purified IgG |
100 µl |
763-Eur |
Phoenix Peptide |
labeled |
| GTX100152 |
RAD51L3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100151 |
RAD51L1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| OBT2270 |
Dog IgG, purified protein, ELISA |
10 mg. |
395-Eur |
Accurate |
elisa |
| AM20787PU-S |
GST-Tag Rat IgG2a antibody Ab Aff - Purified |
0.1 mg |
336-Eur |
ACR |
|
| FC5-G-053-29 |
Catestatin (Rat) _ Cy5 Labeled Purified IgG _ 100ul |
100 µl |
692-Eur |
Phoenix Peptide |
assays |
| CEAI43-645-50 |
Cynomologous Monkey Purified IgG |
50 mg. |
3070-Eur |
Accurate |
|
| GTX100138 |
FANCL antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106115 |
SGK196 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100133 |
ERCC4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| CEAI43-645-2 |
Cynomologous Monkey Purified IgG |
2 mg. |
306-Eur |
Accurate |
|
| AP05148PU-N |
SLA Rabbit IgG antibody Ab Purified |
0.1 mg |
264-Eur |
ACR |
|
| CEAI43-645-10 |
Cynomologous Monkey Purified IgG |
10 mg. |
689-Eur |
Accurate |
|
| FC5-G-069-02 |
CCK_33 (Human) Cy5 Labeled Purified IgG |
100 µl |
728-Eur |
Phoenix Peptide |
labeled |
| GTX106141 |
CLEC1B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AM20825PU-N |
APC _ DP2.5 Rat IgG2a antibody Ab Aff - Purified |
0.2 mg |
435-Eur |
ACR |
|
| GTX105809 |
CAMKV antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| W01235S |
Urokinase (uPA)Sheep Purified |
1mg |
553-Eur |
Meridian Life Science |
|
| GTX102928 |
MMP-12 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP03020PU-N |
Bcl-2-like 11 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
336-Eur |
ACR |
|
| AP03020PU-S |
Bcl-2-like 11 Rabbit IgG antibody Ab Aff - Purified |
25 |
237-Eur |
ACR |
|
| FC3-G-053-29 |
Catestatin (Rat) _ Cy3 Labeled Purified IgG _ 100ul |
100 µl |
692-Eur |
Phoenix Peptide |
assays |
| GTX105864 |
VACVase antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA41833 |
OGT Goat IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| VTI340 |
HIV-1, p24, RecombinantPichia pastoris Purified |
1mg |
814-Eur |
Meridian Life Science |
|
| GTX105872 |
TTC4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| V8Z21-271 |
Streptavidin(blank) Purified |
10mg |
732-Eur |
Meridian Life Science |
|
| FC3-G-069-02 |
CCK_33 (Human) Cy3 Labeled Purified IgG |
100 µl |
763-Eur |
Phoenix Peptide |
labeled |
| FC3-G-069-27 |
CCK (46_69) (Human) Cy3 Labeled Purified IgG |
100 µl |
833-Eur |
Phoenix Peptide |
labeled |
| FC3-G-070-94 |
Exendin_4 _ Cy3 Labeled Purified IgG _ 100ul |
100 µl |
833-Eur |
Phoenix Peptide |
labeled |
| AP03004PU-N |
CSK Rabbit antibody Ab Aff - Purified |
0.1 mg |
246-Eur |
ACR |
|
| GTX103946 |
PPP1R7 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105833 |
Synapsin-3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AS09 554 |
Bromelain (affinity purified) |
1 mg |
457-Eur |
Agrisera |
|
| GTX105813 |
UCK2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX100401 |
APEX2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AS09 547 |
PPI | papain (affinity purified) |
1 mg |
457-Eur |
Agrisera |
|
| GTX105820 |
ZNF189 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AM26128PU-N |
HLA II Mouse IgM antibody Ab Aff - Purified |
0.2 mg |
264-Eur |
ACR |
|
| LF-PA0182 |
BID Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| LF-PA41821 |
MIF Goat IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| FC3-G-035-62 |
Relaxin 2 (Human) Cy3 Labeled Purified IgG |
100 µl |
833-Eur |
Phoenix Peptide |
labeled |
| GTX105831 |
SLA2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA0178 |
Bcl-2 Rabbit IgG antibody Ab Purified |
0.1 ml |
318-Eur |
ACR |
|
| FC3-G-045-87 |
Neuromedin S (Rat) _ Cy3 Labeled Purified IgG _ 100ul |
100 µl |
904-Eur |
Phoenix Peptide |
labeled |
| LF-PA41824 |
MMP-9 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| AP03038PU-N |
Bcl-2-like 11 Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
354-Eur |
ACR |
|
| AP03038PU-S |
Bcl-2-like 11 Rabbit IgG antibody Ab Aff - Purified |
25 |
246-Eur |
ACR |
|
| GTX105873 |
INPP4A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105926 |
MAGE-10 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| YNPShIgG |
Sheep IgG, chromatographically purified |
100 mg. |
779-Eur |
Accurate |
|
| YNPRIgG |
Rabbit IgG, chromatographically purified |
100 mg. |
779-Eur |
Accurate |
polyclonal |
| AM20826PU-S |
APC _ DP2.5 Rat IgG2a antibody Ab Aff - Purified |
0.1 mg |
336-Eur |
ACR |
|
| GTX100257 |
ERG Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| YSRTPHP144 |
Purified Human Prolactin |
100 µg. |
968-Eur |
Accurate |
human |
| T24210R |
Laminin 5, HumanRabbit Purified |
10ug |
249-Eur |
Meridian Life Science |
|
| AM20826PU-N |
APC _ DP2.5 Rat IgG2a antibody Ab Aff - Purified |
0.2 mg |
435-Eur |
ACR |
|
| YSRTPHP156 |
Purified Human Myoglobin |
1 mg. |
348-Eur |
Accurate |
human |
| H6G69-163 |
IgE, kappaHuman Myeloma Purified |
100ug |
268-Eur |
Meridian Life Science |
|
| AM20826PU-L |
APC _ DP2.5 Rat IgG2a antibody Ab Aff - Purified |
1 mg |
849-Eur |
ACR |
|
| GTX105968 |
MGAT4B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105971 |
Wnt-11 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX100287 |
GEM _ KIR Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX103846 |
Carboxypeptidase A4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX105918 |
Cathepsin W antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX103893 |
OAT Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AM26024PU-N |
CD45 _ LCA Rat IgG antibody Ab Purified |
0.1 mg |
165-Eur |
ACR |
|
| AM26023PU-N |
CD9 Rat IgG1 antibody Ab Purified |
0.1 mg |
174-Eur |
ACR |
|
| GTX103888 |
NOX-1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| YNPSwIgG |
Swine IgG, chromatographically purified |
100 mg. |
779-Eur |
Accurate |
porcine |
| GTX100322 |
TRHR antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| DAG109 |
Purified, Human HEMOGLOBIN |
20mg |
824-Eur |
CDiagnostic |
|
| LF-PA0074 |
LYN Rabbit IgG antibody Ab Aff - Purified |
0.1 ml |
318-Eur |
ACR |
|
| FC3-G-076-92 |
NERP_2 (Rat) _ Cy3 Labeled Purified IgG _ 100ul |
100 µl |
692-Eur |
Phoenix Peptide |
labeled |
| AP05004PU-N |
Bcl-2 Sheep IgG antibody Ab Purified |
0.25 mg |
318-Eur |
ACR |
|
| AP05005PU-N |
Bcl-2-like 1 (Bcl-xL) Sheep IgG antibody Ab Purified |
0.1 mg |
300-Eur |
ACR |
|
| GTX103874 |
RAD51L3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP14063PU-N |
Jun-D Rabbit Ig antibody Ab Aff - Purified |
0.1 mg |
327-Eur |
ACR |
|
| AM20825PU-S |
APC _ DP2.5 Rat IgG2a antibody Ab Aff - Purified |
0.1 mg |
336-Eur |
ACR |
|
| GTX108434 |
Myoglobin antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP07668PU-N |
BIK Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX11642 |
MMP-23 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| MO15029-500 |
RAGE Rat IgG antibody Ab Purified |
0.5 mg |
408-Eur |
ACR |
|
| GTX113911 |
Bcl-2-like 10 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX11643 |
MMP-23 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108321 |
PKIB antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP22388PU-N |
Bcl-2-like 5 Goat antibody Ab Aff - Purified |
0.1 mg |
273-Eur |
ACR |
|
| GTX106153 |
RAB40B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108319 |
STK32A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX110549 |
PTS Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX11644 |
MMP-23 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108316 |
PHKA2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108315 |
PRKAA1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11645 |
MMP-23 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108327 |
PRKY antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| H55431M |
TrypsinMouse Purified IgG2b |
0.2mg |
375-Eur |
Meridian Life Science |
|
| AP05225PU-N |
MD-2 Rabbit IgG antibody Ab Purified |
0.1 mg |
318-Eur |
ACR |
|
| AP07667PU-N |
Bcl-2-like 13 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| AP07666PU-N |
Bcl-2-like 10 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP07665PU-N |
Bcl-2-like 1 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP07664PU-N |
Bcl-2-like 5 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| AP22323PU-N |
TFG (350-400) Rabbit antibody Ab Aff - Purified |
0.1 mg |
309-Eur |
ACR |
|
| GTX108340 |
STK31 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX116388 |
PECR antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11639 |
MMP-21 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX75675 |
MMP-9 Mouse antibody Ab Purified |
20 |
237-Eur |
ACR |
|
| GTX108330 |
PDIK1L antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| RA15045-100 |
MMP-24 Rabbit antibody Ab Purified |
0.1 mg |
417-Eur |
ACR |
|
| SP3005P |
GFP Rabbit antibody Ab Purified |
0.1 mg |
228-Eur |
ACR |
|
| GTX108329 |
PKDCC antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108314 |
PKIB antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| RA107P |
Rat IgG Fc Fragment antigen Purified |
1 mg |
237-Eur |
ACR |
|
| GTX11646 |
MMP-23 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108302 |
CKS1B antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108301 |
PFKFB3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP20417PU-N |
CSK Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX11652 |
MMP-25 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX122542 |
ZFY Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX103714 |
MR1 Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108297 |
Histone H2A.x antibody Ab Aff - Purified |
0.1 ml |
291-Eur |
ACR |
|
| GTX108293 |
Bcl-3 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX11653 |
MMP-25 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| AP07486PU-N |
LYN Rabbit IgG antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX108292 |
FXYD2 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108287 |
Aquaporin-5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX103703 |
PDE7A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX110568 |
BID Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX11651 |
MMP-25 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX11650 |
MMP-24 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108312 |
NME6 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| RA101 |
Protein G antigen Aff - Purified |
1 mg |
210-Eur |
ACR |
|
| GTX100080 |
MMS19 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX106159 |
TMED1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| RA100 |
Protein A antigen Purified |
5 mg |
192-Eur |
ACR |
|
| GTX11647 |
MMP-24 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX116474 |
MMP-23 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| RA021P |
Streptavidin antigen Purified |
5 mg |
255-Eur |
ACR |
|
| GTX108311 |
TBK1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108310 |
STK31 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11648 |
MMP-24 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108307 |
CDK5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11649 |
MMP-24 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108285 |
PDGFA antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP07672PU-N |
BMF Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX110442 |
YY1 Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP07848PU-N |
Bcl-10 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX82080 |
RIP Chicken antibody Ab Aff - Purified |
50 |
444-Eur |
ACR |
|
| GTX116200 |
Bcl-11A Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX106146 |
ATP6V1C1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP22214PU-N |
SLA (175-225) Rabbit antibody Ab Purified |
0.1 mg |
300-Eur |
ACR |
|
| GTX106147 |
HTRA4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11621 |
MMP-14 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX70390 |
MMP-9 Rabbit IgG antibody Ab Aff - Purified |
0.1 mg |
300-Eur |
ACR |
|
| GTX106149 |
UCK1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108398 |
RED _ RER Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX11622 |
MMP-16 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| H55601M |
ChymotrypsinMouse Purified IgG3 |
0.2mg |
375-Eur |
Meridian Life Science |
|
| AP22226PU-N |
SMO (190-240) Rabbit antibody Ab Aff - Purified |
0.1 mg |
300-Eur |
ACR |
|
| AP07849PU-N |
Bcl-2-like 11 Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX82076 |
MMP-14 Chicken antibody Ab Aff - Purified |
50 |
444-Eur |
ACR |
|
| GTX106142 |
KEAP1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX108426 |
CXCL10 _ IP-10 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP20518PU-N |
c-Fes Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| AP14457PU-N |
BMX Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX11616 |
MMP-13 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| AP20516PU-N |
c-Myc Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX114058 |
CD6 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX116168 |
EVL Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108416 |
CMTM7 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108411 |
Interleukin-4 _ IL4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP07873PU-N |
Bcl-10 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX108410 |
GDF9 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP20509PU-N |
HGS _ HRS Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX110473 |
TDG Rabbit antibody Ab Aff - Purified |
0.1 ml |
327-Eur |
ACR |
|
| GTX108395 |
CMTM1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108394 |
CMTM7 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP14560PU-N |
NGF Rabbit Ig antibody Ab Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX103738 |
Fucosyltransferase 9 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11633 |
MMP-25 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108355 |
REXO4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11634 |
MMP-25 Rabbit IgG antibody Ab Aff - Purified |
50 |
318-Eur |
ACR |
|
| RA18019-100 |
AP-1 _ c-Jun Rabbit antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP14659PU-N |
CRK Rabbit Ig antibody Ab Aff - Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX11635 |
MMP-25 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108351 |
KLHDC8A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108348 |
UBTD1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX103102 |
DAK Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX11636 |
MMP-21 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX11637 |
MMP-21 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| AP07676PU-N |
Bcl-2-like 8 Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX11631 |
MMP-19 Rabbit IgG antibody Ab Aff - Purified |
50 |
318-Eur |
ACR |
|
| GTX108368 |
LUZP1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX10837 |
NGF Goat IgG antibody Ab Aff - Purified |
25 |
300-Eur |
ACR |
|
| AP22235PU-N |
SOX (pan) Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX108389 |
CD70 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108388 |
Cytoglobin antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108387 |
CMTM6 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX108384 |
PF4V1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX82133 |
DUT Chicken antibody Ab Aff - Purified |
50 |
444-Eur |
ACR |
|
| GTX108381 |
Cardiotrophin-1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11628 |
MMP-19 Rabbit IgG antibody Ab Aff - Purified |
25 |
255-Eur |
ACR |
|
| AP07736PU-N |
SKI Rabbit antibody Ab Purified |
50 |
372-Eur |
ACR |
|
| GTX103742 |
DDX18 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11629 |
MMP-19 Rabbit IgG antibody Ab Aff - Purified |
25 |
282-Eur |
ACR |
|
| GTX108371 |
ABCA4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX11630 |
MMP-19 Rabbit IgG antibody Ab Aff - Purified |
50 |
318-Eur |
ACR |
|
| GTX11638 |
MMP-21 Rabbit IgG antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| AP10125PU-N |
MC3-R Rabbit antibody Ab Aff - Purified |
0.1 mg |
345-Eur |
ACR |
|
| AP00543PU-N |
MMP-7 Rabbit antibody Ab Purified |
0.5 mg |
399-Eur |
ACR |
|
| N77810M |
VitronectinMouse Purified IgG2a |
0.5mg |
694-Eur |
Meridian Life Science |
|
| SP5437P |
GFP Rabbit antibody Ab Aff - Purified |
0.1 ml |
264-Eur |
ACR |
|
| AP00545PU-N |
MMP-1 Rabbit antibody Ab Purified |
0.5 mg |
435-Eur |
ACR |
|
| N77199M |
AntithrombinMouse Purified IgG1 |
0.5mg |
694-Eur |
Meridian Life Science |
|
| N77190M |
FibrinogenMouse Purified IgG1 |
0.5mg |
593-Eur |
Meridian Life Science |
|
| N77095M |
ProthrombinMouse Purified IgG2a |
0.5mg |
538-Eur |
Meridian Life Science |
|
| AP00546PU-N |
MMP-2 Rabbit antibody Ab Purified |
0.5 mg |
435-Eur |
ACR |
|
| AP00550PU-N |
MMP-14 Rabbit antibody Ab Purified |
0.5 mg |
399-Eur |
ACR |
|
| AP00551PU-N |
MMP-15 Rabbit antibody Ab Purified |
0.5 mg |
399-Eur |
ACR |
|
| AP00552PU-N |
MMP-16 Rabbit antibody Ab Purified |
0.5 mg |
399-Eur |
ACR |
|
| GTX28482 |
MMP-3 Sheep IgG antibody Ab Purified |
1 ml |
471-Eur |
ACR |
|
| N86226M |
PlasminogenMouse Purified IgG1 |
1mg |
402-Eur |
Meridian Life Science |
|
| GTX28484 |
MMP-9 Sheep IgG antibody Ab Purified |
1 ml |
471-Eur |
ACR |
|
| GTX101858 |
CD2 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| P01153M |
CD14Mouse Purified IgG2a |
0.2mg |
336-Eur |
Meridian Life Science |
|
| P01113M |
CD5Mouse Purified IgG1 |
0.2mg |
336-Eur |
Meridian Life Science |
|
| N95905M |
ThrombinMouse Purified IgG1 |
100ug |
229-Eur |
Meridian Life Science |
|
| N95060M |
Factor XIMouse Purified IgG |
100ug |
229-Eur |
Meridian Life Science |
|
| GTX104749 |
LMO7 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| N86952M |
PlasminogenMouse Purified IgG2a |
1mg |
402-Eur |
Meridian Life Science |
|
| GTX114502 |
IVD Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| N86413M |
FibrinogenMouse Purified IgG2b |
1mg |
482-Eur |
Meridian Life Science |
|
| N86411M |
FibrinogenMouse Purified IgG1 |
1mg |
482-Eur |
Meridian Life Science |
|
| AP00535PU-N |
Bcl-2-like 1 Rabbit antibody Ab Purified |
0.5 mg |
399-Eur |
ACR |
|
| AP00538PU-N |
Ki-67 Rabbit antibody Ab Purified |
0.5 mg |
381-Eur |
ACR |
|
| AP00539PU-N |
Bcl-2-like 7 Rabbit antibody Ab Purified |
0.5 mg |
435-Eur |
ACR |
|
| GTX28481 |
MMP-2 Sheep IgG antibody Ab Purified |
1 ml |
471-Eur |
ACR |
|
| AP00561PU-N |
MMP-9 Rabbit antibody Ab Purified |
0.5 mg |
435-Eur |
ACR |
|
| SP5447P |
MAL Rabbit antibody Ab Aff - Purified |
0.1 mg |
363-Eur |
ACR |
|
| MHP18-601 |
C-peptideMouse Purified IgG1 |
100ug |
268-Eur |
Meridian Life Science |
|
| GTX109939 |
OGT Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| MEL68-930T |
CD36Mouse Purified IgM |
0.2mg |
340-Eur |
Meridian Life Science |
|
| MDM04-710 |
FerritinMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MCV41-121 |
RotavirusMouse Purified IgG2b,k |
0.2mg |
388-Eur |
Meridian Life Science |
|
| AP00617PU-N |
CD2 Rabbit antibody Ab Aff - Purified |
0.1 mg |
354-Eur |
ACR |
|
| AP00618PU-N |
CD7 Rabbit antibody Ab Aff - Purified |
0.1 mg |
309-Eur |
ACR |
|
| AP00638PU-N |
CD4 Rabbit antibody Ab Aff - Purified |
0.1 mg |
354-Eur |
ACR |
|
| 600-770 |
Plectin Rabbit antibody Ab Aff - Purified |
0.1 mg |
282-Eur |
ACR |
|
| LF-PA41079 |
SP3 _ SPR-2 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| MCF10-145 |
ProlactinMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| GTX114444 |
GNS _ G6S Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX102505 |
Cadherin-18 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX101840 |
RPS16 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AM05407PU-S |
GM-CSF Rat IgG2a antibody Ab Purified |
0.1 mg |
255-Eur |
ACR |
|
| GTX28480 |
MMP-1 Sheep IgG antibody Ab Purified |
1 ml |
471-Eur |
ACR |
|
| GTX101855 |
DOK5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX101850 |
ZBED1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP00574PU-N |
LCK Rabbit antibody Ab Purified |
0.5 mg |
399-Eur |
ACR |
|
| GTX28425 |
RAIDD IgG antibody Ab Purified |
0.1 mg |
381-Eur |
ACR |
|
| GTX104771 |
LAT Rabbit antibody Ab Aff - Purified |
0.1 ml |
219-Eur |
ACR |
|
| GTX101845 |
snRNP-D1 _ Sm-D antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| N01251M |
Factor XRat Purified |
100ug |
356-Eur |
Meridian Life Science |
|
| N01247M |
Protein CRat Purified |
100ug |
356-Eur |
Meridian Life Science |
|
| N01246M |
Protein CRat Purified |
100ug |
356-Eur |
Meridian Life Science |
|
| AM05408PU-S |
GM-CSF Rat IgG1 antibody Ab Purified |
0.1 mg |
255-Eur |
ACR |
|
| MNL14-018 |
CD14Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| AM05334PU-N |
GFP Mouse IgG antibody Ab Purified |
0.1 mg |
300-Eur |
ACR |
|
| P01207M |
CD3 EpsilonHamster Purified IgG (Hamster) |
0.5mg |
323-Eur |
Meridian Life Science |
|
| P54304M |
VLA-4Rat Purified IgG2b,k (Rat) |
0.5mg |
446-Eur |
Meridian Life Science |
|
| GTX101912 |
MPG _ ANPG antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| P42280M |
CD3 T-CellsMouse Purified IgG1 |
100TS |
367-Eur |
Meridian Life Science |
|
| P42235M |
CD28Mouse Purified IgG1 |
100TS |
361-Eur |
Meridian Life Science |
|
| P42195M |
CD35Mouse Purified IgG1,k |
0.2mg |
521-Eur |
Meridian Life Science |
|
| P42190M |
CD11bMouse Purified IgG1,k |
0.2mg |
423-Eur |
Meridian Life Science |
|
| P42180M |
CD2Mouse Purified IgG1 |
0.2mg |
521-Eur |
Meridian Life Science |
|
| P42178M |
CD3Mouse Purified IgG2a |
0.2mg |
510-Eur |
Meridian Life Science |
|
| AP00317PU-N |
Bcl-2-like 13 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX104383 |
NR2F2 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| P42165M |
CD15 GranulocytesMouse Purified IgM,k |
0.2mg |
488-Eur |
Meridian Life Science |
|
| P42130M |
CD1aMouse Purified IgG1,k |
0.2mg |
636-Eur |
Meridian Life Science |
|
| GTX13789 |
GM-CSF Rat IgG1 antibody Ab Purified |
0.1 mg |
354-Eur |
ACR |
|
| GTX101915 |
Metaxin-1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104388 |
PIK3R5 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| P42395M |
CD2Rat Purified IgG2a (Rat) |
0.2mg |
521-Eur |
Meridian Life Science |
|
| GTX29653 |
BMF Rabbit IgG antibody Ab Aff - Purified |
0.1 mg |
381-Eur |
ACR |
|
| P54211M |
CD11bMouse Purified IgG2a |
0.5mg |
446-Eur |
Meridian Life Science |
|
| P54162M |
CD9Mouse Purified IgG2b,k |
100ug |
284-Eur |
Meridian Life Science |
|
| GTX29655 |
BMF Rabbit IgG antibody Ab Aff - Purified |
0.1 mg |
381-Eur |
ACR |
|
| GTX104704 |
MC3-R Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104393 |
LHPP antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX29667 |
GM-CSF Rabbit antibody Ab Aff - Purified |
0.1 mg |
408-Eur |
ACR |
|
| GTX104392 |
IRAK1BP1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| P42705M |
CD30Mouse Purified IgG1 |
0.2mg |
483-Eur |
Meridian Life Science |
|
| GTX104709 |
MAX Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| P42449M |
CD80Mouse Purified IgG1 |
0.2mg |
606-Eur |
Meridian Life Science |
|
| P42398M |
CD4Mouse Purified IgG1,k |
0.2mg |
418-Eur |
Meridian Life Science |
|
| P42118M |
CD24Mouse Purified IgG1 |
0.2mg |
521-Eur |
Meridian Life Science |
|
| P42117M |
CD9Mouse Purified IgG1,k |
0.2mg |
521-Eur |
Meridian Life Science |
|
| P42115M |
CD4Mouse Purified IgG2a,k |
0.2mg |
488-Eur |
Meridian Life Science |
|
| P01255M |
CD45 (LCA)Rat Purified IgG2b (Rat) |
0.5mg |
363-Eur |
Meridian Life Science |
|
| P01248M |
DefensinMouse Purified IgG1 |
1mg |
865-Eur |
Meridian Life Science |
|
| GTX14437 |
BID Rabbit IgG antibody Ab Aff - Purified |
0.1 mg |
381-Eur |
ACR |
|
| P01243M |
CD28Hamster Purified IgG (Hamster) |
0.5mg |
402-Eur |
Meridian Life Science |
|
| P01242M |
CD1dMouse Purified IgG1 |
0.2mg |
779-Eur |
Meridian Life Science |
|
| GTX114521 |
LBP Rabbit antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| P01239R |
SIGN-R1Rat Purified IgM |
0.25mg |
1155-Eur |
Meridian Life Science |
|
| P01238R |
ER-HR3Rat Purified IgG2c |
0.25mg |
700-Eur |
Meridian Life Science |
|
| GTX101874 |
CD2 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| P01236R |
ER-MP54Rat Purified IgG1 |
0.25mg |
614-Eur |
Meridian Life Science |
|
| GTX28753 |
c-fos Mouse IgM antibody Ab Aff - Purified |
0.5 ml |
354-Eur |
ACR |
|
| SP5386P |
GST-Tag Rabbit antibody Ab Aff - Purified |
0.1 mg |
264-Eur |
ACR |
|
| GTX14436 |
BID Rabbit IgG antibody Ab Aff - Purified |
0.1 mg |
381-Eur |
ACR |
|
| GTX14435 |
BID Rabbit antibody Ab Aff - Purified |
0.1 mg |
408-Eur |
ACR |
|
| P01271M |
CD90 (Thy-1, nonpolymorphic)Rat Purified IgG (Rat) |
0.5mg |
294-Eur |
Meridian Life Science |
|
| GTX13788 |
GM-CSF Rat IgG2a antibody Ab Purified |
0.1 mg |
354-Eur |
ACR |
|
| GTX101903 |
ZFP42 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP00340PU-N |
AP-1 _ c-Jun Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| P18432M |
Interleukin 4 (IL-4)Rat Purified IgG1 |
0.2mg |
268-Eur |
Meridian Life Science |
|
| AP00346PU-N |
MMP-12 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| LF-PA41048 |
SKI Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| GTX47276 |
MMP-14 Rabbit IgG antibody Ab Aff - Purified |
7 ml |
318-Eur |
ACR |
|
| GTX101891 |
TUBB2A antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| SM1474P |
FITC Rat IgM antibody Ab Purified |
0.5 mg |
363-Eur |
ACR |
|
| GTX29695 |
EGF Rabbit antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| P01295M |
CD61Mouse Purified IgG1 |
0.2mg |
622-Eur |
Meridian Life Science |
|
| P01283M |
CD90 (Thy-1.2)Rat Purified IgG2b |
0.5mg |
336-Eur |
Meridian Life Science |
|
| P01235M |
CD24 (Nectadrin)Rat Purified IgG (Rat) |
0.5mg |
371-Eur |
Meridian Life Science |
|
| MAL177-166 |
CD177Mouse Purified IgG1 |
100ug |
283-Eur |
Meridian Life Science |
|
| MAG40-015 |
IgEMouse Purified IgG2b,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAG40-002 |
IgEMouse Purified IgG2b,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAF10-710 |
ProlactinMouse Purified IgG2a,k |
1mg |
273-Eur |
Meridian Life Science |
|
| AP08533PU-N |
XDH Rabbit IgG antibody Ab Purified |
0.5 mg |
381-Eur |
ACR |
|
| AP20697PU-N |
LCK Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| MAF10-245 |
ProlactinMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| SM011PT |
CD8 Rat IgG2a antibody Ab Purified |
25 |
156-Eur |
ACR |
|
| SM011PS |
CD8 Rat IgG2a antibody Ab Purified |
0.1 mg |
219-Eur |
ACR |
|
| SM011P |
CD8 Rat IgG2a antibody Ab Purified |
0.25 mg |
318-Eur |
ACR |
|
| GTX115567 |
STYXL1 antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| SM005PT |
CD4 Rat IgG2b antibody Ab Purified |
25 |
156-Eur |
ACR |
|
| SM005PS |
CD4 Rat IgG2b antibody Ab Purified |
0.1 mg |
219-Eur |
ACR |
|
| MAG40-231 |
IgEMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAG40-348 |
IgEMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| SM024P |
CD8 Rat IgG2a antibody Ab Purified |
0.25 mg |
318-Eur |
ACR |
|
| MAL16-154 |
CD16Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL147-612 |
CD147Mouse Purified IgG2b |
100ug |
266-Eur |
Meridian Life Science |
|
| MAL105-226 |
CD105Mouse Purified IgG2a |
100ug |
266-Eur |
Meridian Life Science |
|
| MAL10-078 |
CD10Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL09-061 |
CD9Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL08-804 |
CD8Mouse Purified IgG2a,k |
0.2mg |
265-Eur |
Meridian Life Science |
|
| MAL06-098 |
CD6Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL04-241 |
CD4Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| GTX76184 |
CD9 Mouse antibody Ab Purified |
0.2 mg |
408-Eur |
ACR |
|
| HPEX17-N-25 |
Hemopexin Rat, purified protein |
25 ug |
262-Eur |
Alpha Diagnostics |
rat |
| MAGG16-264 |
IgG (Fc), GoatMouse Purified IgG2b,k |
1mg |
159-Eur |
Meridian Life Science |
|
| MAG40-368 |
IgEMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAF10-216 |
ProlactinMouse Purified IgG2a,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAF10-145 |
ProlactinMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| SM005P |
CD4 Rat IgG2b antibody Ab Purified |
0.25 mg |
318-Eur |
ACR |
|
| GTX104829 |
MAD3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| SA6051X |
Adiponectin (111-247) antigen Purified |
0.5 mg |
516-Eur |
ACR |
|
| SA6051 |
Adiponectin (111-247) antigen Purified |
0.1 mg |
237-Eur |
ACR |
|
| SA6050X |
Adiponectin antigen Purified |
0.5 mg |
930-Eur |
ACR |
|
| SA6050 |
Adiponectin antigen Purified |
0.1 mg |
363-Eur |
ACR |
|
| SA6048X |
Ubiquitin antigen Purified |
0.5 mg |
516-Eur |
ACR |
|
| SA6048 |
Ubiquitin antigen Purified |
0.1 mg |
237-Eur |
ACR |
|
| SA6047X |
UBE2G1 antigen Purified |
0.5 mg |
516-Eur |
ACR |
|
| SA6047 |
UBE2G1 antigen Purified |
0.1 mg |
237-Eur |
ACR |
|
| AP20662PU-N |
EGF Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX29721 |
CXCL9 antigen Purified |
20 |
354-Eur |
ACR |
|
| GTX29727 |
Interleukin-3 _ IL3 antigen Purified |
10 |
354-Eur |
ACR |
|
| MAF07-036 |
LHMouse Purified IgG2a,k |
1mg |
273-Eur |
Meridian Life Science |
|
| SA6054 |
Interleukin-8 _ IL8 (78 aa) antigen Purified |
0.1 mg |
237-Eur |
ACR |
|
| SA6054X |
Interleukin-8 _ IL8 (78 aa) antigen Purified |
0.5 mg |
516-Eur |
ACR |
|
| SM003PT |
CD3 Rat IgG2a antibody Ab Purified |
25 |
156-Eur |
ACR |
|
| SM003PS |
CD3 Rat IgG2a antibody Ab Purified |
0.1 mg |
219-Eur |
ACR |
|
| SM003P |
CD3 Rat IgG2a antibody Ab Purified |
0.25 mg |
318-Eur |
ACR |
|
| AP20675PU-N |
NGF Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| MAF10-111 |
ProlactinMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| SA6058X |
Recoverin antigen Purified |
0.5 mg |
705-Eur |
ACR |
|
| SA6058 |
Recoverin antigen Purified |
0.1 mg |
300-Eur |
ACR |
|
| MAF07-412 |
LHMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAF07-226 |
LHMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAF07-037 |
LHMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| SA6056X |
KITLG _ SCF antigen Purified |
0.5 mg |
705-Eur |
ACR |
|
| SA6056 |
KITLG _ SCF antigen Purified |
0.1 mg |
300-Eur |
ACR |
|
| GTX29729 |
Interleukin-4 _ IL4 antigen Purified |
10 |
354-Eur |
ACR |
|
| MAL222-238 |
CD222Mouse Purified IgG1 |
100ug |
283-Eur |
Meridian Life Science |
|
| GTX114430 |
GEM _ KIR Rabbit IgG antibody Ab Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104806 |
MSH4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104808 |
MARK4 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| LF-PA41108 |
SYK Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| AM05166PU-N |
Prothrombin (F2) Rat antibody Ab Purified |
0.1 mg |
345-Eur |
ACR |
|
| GTX101789 |
MAZ Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX101788 |
CYB5R3 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AM05163PU-N |
Plasminogen _ PLG Rat antibody Ab Purified |
0.1 mg |
345-Eur |
ACR |
|
| GTX102506 |
Cadherin-18 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| MAS04-267 |
EstradiolMouse Purified IgG2a,k |
1mg |
374-Eur |
Meridian Life Science |
|
| MAS01-501 |
CortisolMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MARG16-125 |
IgG (Fc), RabbitMouse Purified IgG2b,k |
1mg |
159-Eur |
Meridian Life Science |
|
| GTX101785 |
M6PR antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP20723PU-N |
RET Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| GTX101806 |
ERH Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX101807 |
FBL Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| LF-PA41089 |
ST5 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| LF-PA41090 |
ST7 Rabbit IgG antibody Ab Purified |
50 |
399-Eur |
ACR |
|
| GTX104795 |
SNAP25 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX104802 |
SENP6 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| MAV133-236 |
RicinMouse Purified IgG1 |
1mg |
571-Eur |
Meridian Life Science |
|
| SP7024P |
Bcl-3 Rabbit antibody Ab Purified |
0.1 mg |
309-Eur |
ACR |
|
| SP7025P |
Bcl-6 Rabbit antibody Ab Purified |
0.1 mg |
300-Eur |
ACR |
|
| SP7027P |
Bcl-2-like 11 Rabbit antibody Ab Purified |
0.1 mg |
462-Eur |
ACR |
|
| GTX101810 |
FUS _ TLS Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP00758PU-N |
HCV NS3 Goat antibody Ab Purified |
1 ml |
372-Eur |
ACR |
|
| AP00759PU-N |
HCV NS4 Goat antibody Ab Purified |
1 ml |
390-Eur |
ACR |
|
| AP00760PU-N |
HCV NS5 Goat antibody Ab Purified |
1 ml |
354-Eur |
ACR |
|
| MAM45-802 |
p53 (a.a. 306-393)Mouse Purified IgG1,k |
0.2mg |
273-Eur |
Meridian Life Science |
|
| MAM42-801 |
p53 (a.a. 32-79)Mouse Purified IgG1,k |
0.2mg |
273-Eur |
Meridian Life Science |
|
| MAM40-511 |
c-myc PeptideMouse Purified IgG2a,k |
0.2mg |
266-Eur |
Meridian Life Science |
|
| MAL79-180 |
CD97Mouse Purified IgG1 |
100ug |
266-Eur |
Meridian Life Science |
|
| GTX76185 |
CD9 Mouse antibody Ab Purified |
0.1 mg |
282-Eur |
ACR |
|
| MAL75-211 |
CD44Mouse Purified IgG2a,k |
0.2mg |
50-Eur |
Meridian Life Science |
|
| MAL70-152 |
CD54Mouse Purified IgG1,k |
0.2mg |
283-Eur |
Meridian Life Science |
|
| MAL66-801 |
CD3Mouse Purified IgG1,k |
0.2mg |
273-Eur |
Meridian Life Science |
|
| MAL59-043 |
CD59Mouse Purified IgG2a |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL56-188 |
CD56Mouse Purified IgG2a |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL45-241 |
CD45Mouse Purified IgG1 |
0.2mg |
283-Eur |
Meridian Life Science |
|
| MAL43-059 |
CD43Mouse Purified IgG1 |
100ug |
266-Eur |
Meridian Life Science |
|
| MAL41-006 |
CD41Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL31-005 |
CD31Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL300-260 |
CD300aMouse Purified IgG1 |
100ug |
283-Eur |
Meridian Life Science |
|
| MAL80-233 |
CD80Mouse Purified IgG1 |
100ug |
266-Eur |
Meridian Life Science |
|
| MAL90-171 |
CD50Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL91-259 |
CD63Mouse Purified IgG1 |
100ug |
266-Eur |
Meridian Life Science |
|
| MAM26-014 |
DesminMouse Purified IgG1,k |
100ug |
265-Eur |
Meridian Life Science |
|
| GTX104813 |
NEK11 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AM03218PU-N |
CA 19-9 Mouse IgM antibody Ab Purified |
1 mg |
372-Eur |
ACR |
|
| GTX104814 |
STK35 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| MAM04-710 |
FerritinMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAM04-187 |
FerritinMouse Purified IgG2a,k |
1mg |
260-Eur |
Meridian Life Science |
|
| MAM04-175 |
FerritinMouse Purified IgG2a,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAM04-030 |
FerritinMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| MAM04-010 |
FerritinMouse Purified IgG1,k |
1mg |
273-Eur |
Meridian Life Science |
|
| AM03098PU-N |
CD4 Mouse IgM antibody Ab Purified |
0.1 mg |
210-Eur |
ACR |
|
| GTX104821 |
Musculin antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| MAL93-053 |
CD53Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| MAL29-101 |
CD29Mouse Purified IgG1 |
100ug |
252-Eur |
Meridian Life Science |
|
| P54313M |
CD11b (MAC-1)Rat Purified IgG2b (Rat) |
0.5mg |
446-Eur |
Meridian Life Science |
|
| GTX102218 |
RPL10 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX109658 |
CPEB1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX14285 |
c-fos Chicken antibody Ab Aff - Purified |
50 |
444-Eur |
ACR |
|
| GTX14286 |
c-Myc Chicken antibody Ab Aff - Purified |
50 |
354-Eur |
ACR |
|
| GTX109159 |
Bcl-10 Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX115214 |
Bcl-7C Rabbit IgG antibody Ab Purified |
0.1 ml |
300-Eur |
ACR |
|
| AP09001PU-N |
MMP-9 (659-674) Rabbit antibody Ab Aff - Purified |
50 |
372-Eur |
ACR |
|
| GTX114724 |
RPE Rabbit antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| GTX77732 |
MMP-10 Rabbit IgG antibody Ab Aff - Purified |
0.1 mg |
327-Eur |
ACR |
|
| GTX109668 |
INCENP antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| GTX102191 |
SLC25A1 antibody Ab Aff - Purified |
0.1 ml |
300-Eur |
ACR |
|
| ABS3014 |
PURIFIED HUMAN PROLACTIN |
0.1 mg |
566-Eur |
AbD Serotec |
human |
| AP21379PU-N |
MPI Rabbit IgG antibody Ab Aff - Purified |
1 mg |
354-Eur |
ACR |
|
| GTX109655 |
SFRP1 antibody Ab Aff - Purified |
0.1 ml |
210-Eur |
ACR |
|
| AP21354PU-N |
NP Rabbit IgG antibody Ab Aff - Purified |
1 mg |
354-Eur |
ACR |
|
| AP21077PU-N |
ME3 Rabbit antibody Ab Aff - Purified |
0.1 mg |
318-Eur |
ACR |
|
| AP21306PU-N |
Bcl-10 Rabbit IgG antibody Ab Purified |
1 ml |
390-Eur |
ACR |
|
| AP21306PU-S |
Bcl-10 Rabbit IgG antibody Ab Purified |
0.1 ml |
183-Eur |
ACR |
|